From 9e342041f05e88f8d1987a48fdcdc10c14ef095f Mon Sep 17 00:00:00 2001 From: eugue Date: Sat, 12 Feb 2011 20:07:15 -0500 Subject: Added SwitchBehavior and its unit test file. Could be used to control games. --- behaviors/SwitchBehavior.py | 24 ++++++++++++++++++++++++ tests/TestSwitchBehavior.py | 35 +++++++++++++++++++++++++++++++++++ 2 files changed, 59 insertions(+) create mode 100644 behaviors/SwitchBehavior.py create mode 100644 tests/TestSwitchBehavior.py diff --git a/behaviors/SwitchBehavior.py b/behaviors/SwitchBehavior.py new file mode 100644 index 0000000..1fb755d --- /dev/null +++ b/behaviors/SwitchBehavior.py @@ -0,0 +1,24 @@ +from operationscore.Behavior import * +import util.ComponentRegistry as compReg + +class SwitchBehavior(Behavior): + """ + SwitchBehavior is a behavior that transform into different behaviors base on the input data. + The behavior expects Args in the form of s mapping to s. The behavior detects the prefix on the data and use the corresponding Behavior to process the data and return the outputs. + In Config file, include: + Behavior's ID + Default behavior's ID + """ + def behaviorInit(self): + self.defaultBehavior = compReg.getComponent(self['DefaultBehavior']) + self.currBehavior = None + + def processResponse(self, sInputs, rInputs): + dataStr = sInputs[-1]['Data'] + if dataStr[0] in self.argDict: + self.currBehavior = compReg.getComponent(self[dataStr[0]]) + sInputs[-1]['Data'] = sInputs[-1]['Data'][1:] # remove prefix + return self.currBehavior.processResponse(sInputs, rInputs) + else: + return self.defaultBehavior.processsResponse(sInputs, rInputs) + diff --git a/tests/TestSwitchBehavior.py b/tests/TestSwitchBehavior.py new file mode 100644 index 0000000..f130431 --- /dev/null +++ b/tests/TestSwitchBehavior.py @@ -0,0 +1,35 @@ +import unittest +import util.ComponentRegistry as compReg + +from behaviors.SwitchBehavior import SwitchBehavior +from behaviors.EchoBehavior import EchoBehavior +from behaviors.DebugBehavior import DebugBehavior + +class TestSwitchBehavior(unittest.TestCase): + def setUp(self): + compReg.initRegistry() + + # add a test registry + self.behavior1 = EchoBehavior({'Id': 'behavior1'}) + self.behavior2 = DebugBehavior({'Id': 'behavior2'}) + compReg.registerComponent(self.behavior1) + compReg.registerComponent(self.behavior2) + + self.switchBehavior = SwitchBehavior({'Id': 'switch', '1': 'behavior1', '2': 'behavior2', 'DefaultBehavior': 'behavior1'}) + compReg.registerComponent(self.switchBehavior) + + def tearDown(self): + pass + + def test_switch_to_behavior1(self): + inputs = [{'Data': '1something', 'Location': 'someloc'}] + returned = self.switchBehavior.processResponse(inputs, []) + assert returned[0][0]['Location'] == 'someloc' + + def test_switch_to_behavior2(self): + inputs = [{'Data': '2something'}] + returned = self.switchBehavior.processResponse(inputs, []) + assert returned[0] == [] + +if __name__ == '__main__': + unittest.main() -- cgit v1.2.3 From d8ba03006e2ea1400e80caded738e79c186e8de3 Mon Sep 17 00:00:00 2001 From: eugue Date: Mon, 14 Feb 2011 17:13:33 -0500 Subject: change SwitchBehavior to take in a JSON dict to avoid weird XML parsing. Also added a public function to manually set current behavior. --- behaviors/SwitchBehavior.py | 28 ++++++++++++++++++++-------- tests/TestSwitchBehavior.py | 12 +++++++++--- 2 files changed, 29 insertions(+), 11 deletions(-) diff --git a/behaviors/SwitchBehavior.py b/behaviors/SwitchBehavior.py index 1fb755d..1377b42 100644 --- a/behaviors/SwitchBehavior.py +++ b/behaviors/SwitchBehavior.py @@ -1,24 +1,36 @@ from operationscore.Behavior import * import util.ComponentRegistry as compReg +import json class SwitchBehavior(Behavior): """ SwitchBehavior is a behavior that transform into different behaviors base on the input data. - The behavior expects Args in the form of s mapping to s. The behavior detects the prefix on the data and use the corresponding Behavior to process the data and return the outputs. + The behavior expects a JSON formatted argument 'PrefixToBehavior' that maps prefixes to behaviors. The behavior detects the prefix on the data and use the corresponding Behavior to process the data and return the outputs. In Config file, include: - Behavior's ID - Default behavior's ID + JSON format dict with prefix keys and behavior ID values + Default behavior's ID + An example config excerpt: + + behaviors.SwitchBehavior + + switch + {'@':'game1', '#':'game2', '$':'game3'} + game1 + + """ def behaviorInit(self): self.defaultBehavior = compReg.getComponent(self['DefaultBehavior']) + self.prefixDict = json.loads(self['PrefixToBehavior']) self.currBehavior = None + self.setBehavior(self.defaultBehavior) def processResponse(self, sInputs, rInputs): dataStr = sInputs[-1]['Data'] - if dataStr[0] in self.argDict: - self.currBehavior = compReg.getComponent(self[dataStr[0]]) + if dataStr[0] in self.prefixDict: + self.setBehavior(compReg.getComponent(self.prefixDict[dataStr[0]])) sInputs[-1]['Data'] = sInputs[-1]['Data'][1:] # remove prefix - return self.currBehavior.processResponse(sInputs, rInputs) - else: - return self.defaultBehavior.processsResponse(sInputs, rInputs) + return self.currBehavior.processResponse(sInputs, rInputs) + def setBehavior(self, behavior): + self.currBehavior = behavior diff --git a/tests/TestSwitchBehavior.py b/tests/TestSwitchBehavior.py index f130431..774dbbc 100644 --- a/tests/TestSwitchBehavior.py +++ b/tests/TestSwitchBehavior.py @@ -15,21 +15,27 @@ class TestSwitchBehavior(unittest.TestCase): compReg.registerComponent(self.behavior1) compReg.registerComponent(self.behavior2) - self.switchBehavior = SwitchBehavior({'Id': 'switch', '1': 'behavior1', '2': 'behavior2', 'DefaultBehavior': 'behavior1'}) + self.switchBehavior = SwitchBehavior({'Id': 'switch', 'PrefixToBehavior': '{"@": "behavior1", "#": "behavior2"}', 'DefaultBehavior': 'behavior1'}) compReg.registerComponent(self.switchBehavior) def tearDown(self): pass def test_switch_to_behavior1(self): - inputs = [{'Data': '1something', 'Location': 'someloc'}] + inputs = [{'Data': '@something', 'Location': 'someloc'}] returned = self.switchBehavior.processResponse(inputs, []) assert returned[0][0]['Location'] == 'someloc' def test_switch_to_behavior2(self): - inputs = [{'Data': '2something'}] + inputs = [{'Data': '#something'}] returned = self.switchBehavior.processResponse(inputs, []) assert returned[0] == [] + def test_default_behavior(self): + inputs = [{'Data': 'something', 'Location': 'someloc'}] + returned = self.switchBehavior.processResponse(inputs, []) + assert returned[0][0]['Location'] == 'someloc' + + if __name__ == '__main__': unittest.main() -- cgit v1.2.3 From 84d914b0a015ef6c588253ac7f70382bfa9030e5 Mon Sep 17 00:00:00 2001 From: rcoh Date: Tue, 15 Feb 2011 15:15:43 -0500 Subject: Added documentation to repo in docs folder. --- config/C5Sign.xml | 234 +++++++++++++++++++++++++++++++++++++++++++ docs/Behaviors/Behaviors.pdf | Bin 0 -> 98731 bytes docs/Behaviors/Behaviors.tex | 143 ++++++++++++++++++++++++++ docs/ClassOverview.pdf | Bin 0 -> 132526 bytes docs/designDocs.pdf | Bin 129631 -> 0 bytes docs/designDocs.tex | 192 ----------------------------------- docs/tex/Behaviors.tex | 143 ++++++++++++++++++++++++++ docs/tex/ClassOverview.tex | 186 ++++++++++++++++++++++++++++++++++ ga | 1 + layouts/SpecifiedLayout.py | 21 ++++ renderers/C5Renderer.xml | 10 ++ 11 files changed, 738 insertions(+), 192 deletions(-) create mode 100644 config/C5Sign.xml create mode 100644 docs/Behaviors/Behaviors.pdf create mode 100644 docs/Behaviors/Behaviors.tex create mode 100644 docs/ClassOverview.pdf delete mode 100644 docs/designDocs.pdf delete mode 100644 docs/designDocs.tex create mode 100644 docs/tex/Behaviors.tex create mode 100644 docs/tex/ClassOverview.tex create mode 100644 layouts/SpecifiedLayout.py create mode 100644 renderers/C5Renderer.xml diff --git a/config/C5Sign.xml b/config/C5Sign.xml new file mode 100644 index 0000000..6550067 --- /dev/null +++ b/config/C5Sign.xml @@ -0,0 +1,234 @@ + + + + + simplemap + + + + layouts/C5SignLayout.xml + + + + pixelmappers.SimpleMapper + + simplemap + 20 + + + + pixelmappers.GaussianMapper + + gaussmap + 30 + 0.1 + 10 + 1 + + + + + + renderers/C5Renderer.xml + + + renderers/Pygame.xml + + + + + inputs.PygameInput + + pygameclick + 10 + True + + + + inputs.PygameInput + + pygamekey + 10 + True + + + + inputs.UDPInput + + udp + 3344 + 50 + + + + + inputs/MouseFollower.xml + + + + + behaviors/RandomColor.xml + + + (255,0,0) + (0,0,255) + + + + + behaviors/PixelDecay.xml + + + behaviors/SingleFrame.xml + + + behaviors/PixelDecay.xml + + .01 + + + + behaviors.XYMove + + xymove + 5 + 2 + + + + behaviors.RestrictLocation + + xbounce + {val}*-1 + XStep + {x}<0 or {x}>200 + + + + behaviors.RestrictLocation + + ybounce + {val}*-1 + YStep + {y}<0 or {y}>100 + + + + behaviors.BehaviorChain + + movebounce + + xymove + colorshift + ybounce + xbounce + + + + + behaviors.ModifyParam + + ysin + YStep + Sensor + 4*math.sin({x}/float(40)) + + + + behaviors.DebugBehavior + + debug + 0 + + pygamekey + udp + + + + + behaviors.AllPixels + + square + 20 + + + + behaviors/LoopAndDie.xml + + 80 + + + + behaviors.BehaviorChain + + runcolordecay + + pygameclick + + + colorchange + mover + decay + + {'mover':'movebounce'} + True + gaussmap + + + + behaviors.ResponseMover + + mover + + + + behaviors.RandomWalk + + randmovement + 2 + + + + behaviors/Accelerate.xml + + + behaviors.EchoBehavior + + echo + 0 + False + + + + behaviors.ColorShift + + colorshift + + + + behaviors.BehaviorChain + + mousechaser + + followmouse + + + echo + square + singleframe + + False + + + + behaviors/RunningBehavior.xml + + + diff --git a/docs/Behaviors/Behaviors.pdf b/docs/Behaviors/Behaviors.pdf new file mode 100644 index 0000000..14eafa6 Binary files /dev/null and b/docs/Behaviors/Behaviors.pdf differ diff --git a/docs/Behaviors/Behaviors.tex b/docs/Behaviors/Behaviors.tex new file mode 100644 index 0000000..9021581 --- /dev/null +++ b/docs/Behaviors/Behaviors.tex @@ -0,0 +1,143 @@ +\documentclass{article} +\usepackage{fullpage} +\begin{document} + \title{Behaviors: An Introduction and Exercises} + \author{Russell Cohen} + \date{\today} + \maketitle + \section{What is a behavior?} + At its most basic, a behavior is machine with two input terminals and two + output terminals. One of these input terminals is external input. The + other is feedback from the behavior. Similarly, the behavior has two output + terminals. One gets released externally as output, and the other gets fed + back to the behavior. At their core, behaviors have nothing to do with + pixels are light effects -- this is merely how we commonly use them. + \section{How do I write a behavior?} + At the core of a behavior is its \texttt{ProcessResponse} method which + tells a behavior what to get on input. As you might expect, it has 2 + input ports, and two output ports. The `type' of inputs and outputs can be + anything -- numbers, strings, lists, however, in our system, the inputs + and outputs are all python dictionaries. This allows us to have an + arbitrary number of named parameters. As sample input might look + something like \texttt{{'Location':(20,20), 'Height':10}}. When we + return a value, we return a tuple of (list,list). Note that on a + process response method you will actually be given a \textbf{List of + dictionaries} and you should iterate over them. + \textbf{Important:} You should not directly modify the inputs! Use + \texttt{dict(input)} to create a copy of them! + \section{Exercise 1: addFive} + Our goal: Create a behavior that will add 5 to the 'Value' field of the + input. If no 'Value' field exists, we will set it to five. Below is a + sample \verb processResponse method to do this. Note that process + response is the only part of a behavior that must be written (everything + else happens behind the scenes when you \textbf{inherit} from the + \texttt{Behavior} class. + \begin{verbatim} + def processResponse(self, inputs, recurrences): + output = [] #empty list + for inp in inputs: + inpCopy = dict(inp) + if not ('Value' in inpCopy): + inpCopy['Value'] = 0 + inpCopy['Value'] += 5 + output.append(inpCopy) + return (output, []) #empty list, no recurrences + \end{verbatim} + \section{Exercise 2: A Sum-er} + Create a behavior that outputs the sum of all previous input. Hint: + You will need to use recurrences! + \section{Declaring and Configuring Behaviors} + Once you've written your behavior (or are using an already written + behavior, you will need to tell the light installation to use the + behavior. This is done via XML in the configuration file. When you + run the system, you specify a configuration file eg: + \texttt{python LightInstallation.py config/ConfigFile.xml} + + Behaviors are specified in the \verb BehaviorConfiguration section. + A sample behavior follows: + \begin{verbatim} + + behaviors.EchoBehavior + + echo + False + + + \end{verbatim} + + The ``Class'' attribute specifies the \textbf{Python} class for this + behavior. (The \verb behaviors. prefix tells Python to look in the + behaviors folder). You may recall that all classes SmootLight take a + single python dictionary as an argument -- this is embodied by the + \texttt{Args} tag. A dictionary is created from the XML at runtime + -- this dictionary would be: \texttt{{'Id':'echo', + 'RenderToScreen':False}} + The id we specify is the id that we can reference this behavior by + later. The \verb RenderToScreen attribute specifies whether or not + outputs from this behavior should be directed to the screen (some + behaviors act only as the building blocks for other + behaviors, and are never rendered directly to the screen) + + \section{Behavior Chains} + I have mentioned several times that the system allows for behaviors to + be chained together to create many different effects -- often the + ``motion'' effect and the ``coloring'' effects are two separate + behaviors. The result you see on the screen are these two pieces + connected together. This allows us to build up many different behaviors + from a library of simple pieces. Let's look at how we actually + accomplish this. + + Behavior Chaining is accomplished through the behavior chain class. + Here is an example of a behavior we declare (in XML) via a behavior + chain: + \begin{verbatim} + + behaviors.BehaviorChain + + runcolordecay + + pygame + randomLoc + + + colorchange + running + decay + + {'running':'acceleratedie'} + True + gaussmap + + + \end{verbatim} + + Note the importance of the `Id' field -- that is how we reference all + other components of the system. Let's walk through what is going on + here. We declare this behavior just like any other -- however, for + class, we specify \verb BehaviorChain . The \verb Inputs tag specifies + which inputs will be routed to this behavior. In this case, it is + \verb pygame and \verb randomLoc , two previously declared behaviors. + Inputs from these behaviors will be passed to the behavior chain via + sensorInputs. Next, we have the meet of this chain, the behaviors it is + composed of. This states that first, an input is routed through + \texttt{colorchange}. \verb colorchange adds a color field to the + sensor data. Next, the input is routed to \verb running a behavior + that makes pixels run back and forth. Finally, the input is routed to + \verb decay , a behavior that adds a decay ``PixelEvent'' that makes + individual pixels turn on and then decay. + + The next item we see is \verb RecursiveHooks . This is a special + feature of the \verb BehaviorChain that allows us to augment the + reccurences recursive events have. We specify that we will augment the + recursive behavior of \verb running with another behavior, + \verb acceleratedie which modifies increases the speed of the running + behavior, and stops the behavior after a certain number of iterations. + Note that recursive hooks take data in via their \textbf{external input} + port, and \textbf{not} their recursive port. + + Finally, we state that this behavior will indeed be rendered directly to + the screen. We also specify which PixelMapper we want to use. + + Phew. This isn't as complicated as it sounds. I promise. + + \end{document} diff --git a/docs/ClassOverview.pdf b/docs/ClassOverview.pdf new file mode 100644 index 0000000..530dfa6 Binary files /dev/null and b/docs/ClassOverview.pdf differ diff --git a/docs/designDocs.pdf b/docs/designDocs.pdf deleted file mode 100644 index 78eb646..0000000 Binary files a/docs/designDocs.pdf and /dev/null differ diff --git a/docs/designDocs.tex b/docs/designDocs.tex deleted file mode 100644 index 8e62edc..0000000 --- a/docs/designDocs.tex +++ /dev/null @@ -1,192 +0,0 @@ -\documentclass{article} -\usepackage{fullpage} -\begin{document} - \title{150 Smoots Lighting Installation Design Document} - \author{Russell Cohen} - \date{\today} - \maketitle - \newcommand{\classDoc}[5]{ - \subsection{#1} - \begin{itemize} - \item \textbf{Inherits from: } #2 - \item \textbf{Inherited by: } #3 - \item \textbf{Brief Description: } #4 - \item \textbf{Argument Requirements: } #5 - \end{itemize} - } - \section{Intro} - \textbf{NB: These docs give an overview of the classes and methods but - may lag behind the code for certain in-flux functionality. For - up-to-the minute docs, please use pydoc.} \\ - The system, which we will describe henceforth as SmootLight is a - modular system designed with the following goals in mind: - \begin{itemize} - \item The system must abstract away from all components while - remaining useful (\verb=Renderer=, \verb=Input=, \verb=Behavior=) - \item The system must be modular and be easy to write new code for. - \item More goals as I think of them - \end{itemize} - We accomplish this in the following manner: - \begin{itemize} - \item The system is configured by an XML file which specifies its - components. - \item All classes are initialized with a dictionary as an argument - containing anything a class may need. All objects are passed - between members as python dictionaries because their easy - serialization. - \end{itemize} - \section{Overview} - \begin{itemize} - \item - \section{Operations Class Patterns} - \classDoc{SmootCoreObject}{None}{All 2nd level classes (PixelAssembler, Renderer, - Input, Behavior)} - {SmootCoreObject is essentially a super-object - that makes things easy for us. It does the following actions: - \begin{itemize} - \item Defines a constructor that sets argDict - \item Defines a \texttt{\_\_getitem\_\_} , which lets us acces items in - argDict as if the class was a dictionary. - (\texttt{self['itemName']}). It also automatically maps the - initial contents of the argDict to class attributes. - \item Defines validateArgs and validateArgDict which - validate the incoming arguments against a dictionary - containing argument names as keys and an error message to - display if they are missing as a values. This file should - be named classname.params and look like a python dict - (\texttt{\{'key':value, 'key2':value2\}} ) - \end{itemize} - Note that at this point, the only class using this functionality - is the PixelEvent class.} - {No required parameters in argDict} - \classDoc{PixelAssembler}{SmootCoreObject}{LineLayout, ZigzagLayout}{ - PixelAssembler is a class that defines the positions of lights. It - provides a method \texttt{getLightLocations} which give a list of - all light locations for a given strip. Inheriting classes must - define \texttt{layoutFunc} which returns the next location given the - previous location. (They may simply override - \texttt{getLightLocations} - instead, if they wish, but be careful when doing so). In - heriting classes may defint \texttt{initLayout} which is called at - initialization.}{\begin{itemize} - \item \texttt{lightToLightSpacing}: this is the length of wire - between 2 adjacent LEDs. Common values are 4 or 12. - \item \texttt{numLights}: Number of lights in a strip. - \item \texttt{originLocation}: Location of the first light. - \end{itemize}} - \classDoc{Renderer}{SmootCoreObject}{PygameRenderer, IndoorRenderer}{ - Renderer is a class that serves as an abstract class for renderers - interacting with the system. Inheriting classes must define - render, which is passed a \texttt{lightSystem} object. Inheriting - classes may define initRenderer which is called on initiation. - }{No required arguments} - \classDoc{Input}{SmootCoreObject, threading.Thread}{PygameInput, - TCPInput,UDPInput}{Input is a abstract class which facilitates Inputs. - It does this by providing a method that is polled at a periodic - interval within which the inheriting class can raise an event. - Inheriting classes must define \texttt{sensingLoop} which is - called at the interval specified in the config. Inheriting - classes should call respond with an dictionary as an argument - to raise an event. Classes using (not - inheriting) input must pass a scope into - the argDict which offers a \texttt{processInput} - method. Inputs are marked as Daemon threads, and - are therefore killed when their parent is - killed.}{\begin{itemize} - \item \texttt{InputId}: The string id of a given input. Must be - unique. - \item Optional:\texttt{RefreshInterval}: The interval in - seconds (will soon be changed to milliseconds) between - sucessive calls to the sensingLoop method. TODO: make - timeout. - \end{itemize}} - \classDoc{Behavior}{SmootCoreObject}{EchoBehavior, DebugBehavior}{ -Abstract class for a behavior. On every time step, the behavior is passed the -inputs from all sensors it is bound to as well as any recursive inputs that it -spawned during the last time step. Inheriting classes MUST define -\texttt{processBehavior}. \texttt{processBehavior} should return a list of dictionaries which -define the properties of the light response. The must return a location -\texttt{PixelEvent} class. Soon be be deprecated:\textit{They must give a location and -color. They may define a function pointer which defines a custom mapping. -[More on this later. Bug Russell if you want to do it].} -Call \texttt{recursiveResponse} to queue a input on the next iteration with a dictionary -argument. This will be passed in via recursive inputs.} -{\begin{itemize} - \item \texttt{Inputs}: A list of input Ids specifying input to the - behavior. In the future, this may also contain behavior ids. -\end{itemize}} -\classDoc{PixelEvent}{SmootCoreObject}{StepResponse}{ - Abstract class defining the behavior of a light after it has been turned on. - Inheriting classes should defint \texttt{lightState} which is passed a - timeDelay in ms as an argument. \texttt{lightState} should return a - color or None if the response is complete.}{\begin{itemize} - \item \texttt{Color}: The color of response. \textit{This is may be - removed in the future} - \end{itemize} - } -\section{The Screen Class and Its Relatives} -\classDoc{Screen}{None}{None} -{The \texttt{Screen} class is a representation of an entire system of pixels, - distributed over space. The Screen class and its relatives process - responses (mapped to pixels via a LayoutEngine), and add PixelEvents - to the individual pixels. The Screen provides an instance that - renderers can call to determine the color of all the individual pixels. It contains a list of PixelStrips, which each - address the individual pixels. \texttt{Screen} offers a - \texttt{respond} method which takes a dictionary containing information - about a response. TODO: detail the contents of this dictionary (maybe - somewhere else). Note: \texttt{Screen} will not process its - responses until \texttt{timeStep} is called which processes all responses that - have been queued since the last time that \texttt{timeStep} was - called. Screen also offers an iterator over \textit{all} lights, - accesible by using an expression like: \texttt{for light in screen:}. For - addressing of specific \texttt{PixelStrips} , \texttt{self.pixelStrips} - is exposed.}{No required parameters} -\classDoc{PixelStrip}{None}{None} -{The \texttt{PixelStrip} class is a representation of a string of Pixels that are - connected in physical space (eg. a strip of lights). A \texttt{PixelStrip} takes a - \texttt{LayoutBuilder} (\textit{Name up for debate, currently known as layout - engine}) as an argument. The \texttt{argDict} of the - \texttt{LayoutBuilder} is - passed becomes the \texttt{argDict} of the \texttt{PixelStrip}. - \texttt{PixelStrip} generally shouldn't be - adressed directly unless you need Strip-Identification for rendering - purposes. You should never, for example, call \texttt{respond} on a - \texttt{PixelStrip} - directly, unless you really know what you're doing. Well, actually you - should never need to do that. - never. Don't do it.}{Takes a \texttt{LayoutBuilder} as an argument.} - \section{Best Practices} - \subsection{Variable and function naming} - I'm pretty bad about being consistent. However, in all future - code, please adhere to the following: - \begin{itemize} - \item Classes: \texttt{FirstLetterCaps} - \item Functions: \texttt{camelCase} - \item Property Names: \texttt{FirstLetterCaps} - \item Constants: \texttt{ALL\_CAPS\_WITH\_UNDERSCORES} - \end{itemize} - \subsection{Time} - For time, use the \texttt{util.TimeOps.time()} method to return the current - time in ms. - \subsection{Acessing a Component Given an Id} - Use \texttt{util.ComponentRegistry.getComponent(id)}. This provides any - component access to any other components. We may consider a way to - make this read-only. - \subsection{Acessing Pixels} - The ideal method for acessing Pixels in a screen is to use its - iterator. Iterating over the individual PixelStrips is also an - acceptable method. - \subsection{Determining the state of a \texttt{Pixel}} - The best practice for determining the color of a \texttt{Pixel} is to call - \texttt{state}. This ensures - all current active responses running on the Pixel contribute correctly. - \subsection{Color} - For color, use a tuple of (R,G,B) 0-255 for each. Colors can be - easily manipulated with members of the Util class. - \subsection{Locations} - Locations are stored (x,y), in whatever unit you light system is - in. (Whatever unit you use when you define spacing). - \subsection{Constant Strings (key strings, 'Location', 'Color', etc.)} - Use the util.Strings module. It contains many currently in use - Strings, and ensures consistency. - \end{document} diff --git a/docs/tex/Behaviors.tex b/docs/tex/Behaviors.tex new file mode 100644 index 0000000..9021581 --- /dev/null +++ b/docs/tex/Behaviors.tex @@ -0,0 +1,143 @@ +\documentclass{article} +\usepackage{fullpage} +\begin{document} + \title{Behaviors: An Introduction and Exercises} + \author{Russell Cohen} + \date{\today} + \maketitle + \section{What is a behavior?} + At its most basic, a behavior is machine with two input terminals and two + output terminals. One of these input terminals is external input. The + other is feedback from the behavior. Similarly, the behavior has two output + terminals. One gets released externally as output, and the other gets fed + back to the behavior. At their core, behaviors have nothing to do with + pixels are light effects -- this is merely how we commonly use them. + \section{How do I write a behavior?} + At the core of a behavior is its \texttt{ProcessResponse} method which + tells a behavior what to get on input. As you might expect, it has 2 + input ports, and two output ports. The `type' of inputs and outputs can be + anything -- numbers, strings, lists, however, in our system, the inputs + and outputs are all python dictionaries. This allows us to have an + arbitrary number of named parameters. As sample input might look + something like \texttt{{'Location':(20,20), 'Height':10}}. When we + return a value, we return a tuple of (list,list). Note that on a + process response method you will actually be given a \textbf{List of + dictionaries} and you should iterate over them. + \textbf{Important:} You should not directly modify the inputs! Use + \texttt{dict(input)} to create a copy of them! + \section{Exercise 1: addFive} + Our goal: Create a behavior that will add 5 to the 'Value' field of the + input. If no 'Value' field exists, we will set it to five. Below is a + sample \verb processResponse method to do this. Note that process + response is the only part of a behavior that must be written (everything + else happens behind the scenes when you \textbf{inherit} from the + \texttt{Behavior} class. + \begin{verbatim} + def processResponse(self, inputs, recurrences): + output = [] #empty list + for inp in inputs: + inpCopy = dict(inp) + if not ('Value' in inpCopy): + inpCopy['Value'] = 0 + inpCopy['Value'] += 5 + output.append(inpCopy) + return (output, []) #empty list, no recurrences + \end{verbatim} + \section{Exercise 2: A Sum-er} + Create a behavior that outputs the sum of all previous input. Hint: + You will need to use recurrences! + \section{Declaring and Configuring Behaviors} + Once you've written your behavior (or are using an already written + behavior, you will need to tell the light installation to use the + behavior. This is done via XML in the configuration file. When you + run the system, you specify a configuration file eg: + \texttt{python LightInstallation.py config/ConfigFile.xml} + + Behaviors are specified in the \verb BehaviorConfiguration section. + A sample behavior follows: + \begin{verbatim} + + behaviors.EchoBehavior + + echo + False + + + \end{verbatim} + + The ``Class'' attribute specifies the \textbf{Python} class for this + behavior. (The \verb behaviors. prefix tells Python to look in the + behaviors folder). You may recall that all classes SmootLight take a + single python dictionary as an argument -- this is embodied by the + \texttt{Args} tag. A dictionary is created from the XML at runtime + -- this dictionary would be: \texttt{{'Id':'echo', + 'RenderToScreen':False}} + The id we specify is the id that we can reference this behavior by + later. The \verb RenderToScreen attribute specifies whether or not + outputs from this behavior should be directed to the screen (some + behaviors act only as the building blocks for other + behaviors, and are never rendered directly to the screen) + + \section{Behavior Chains} + I have mentioned several times that the system allows for behaviors to + be chained together to create many different effects -- often the + ``motion'' effect and the ``coloring'' effects are two separate + behaviors. The result you see on the screen are these two pieces + connected together. This allows us to build up many different behaviors + from a library of simple pieces. Let's look at how we actually + accomplish this. + + Behavior Chaining is accomplished through the behavior chain class. + Here is an example of a behavior we declare (in XML) via a behavior + chain: + \begin{verbatim} + + behaviors.BehaviorChain + + runcolordecay + + pygame + randomLoc + + + colorchange + running + decay + + {'running':'acceleratedie'} + True + gaussmap + + + \end{verbatim} + + Note the importance of the `Id' field -- that is how we reference all + other components of the system. Let's walk through what is going on + here. We declare this behavior just like any other -- however, for + class, we specify \verb BehaviorChain . The \verb Inputs tag specifies + which inputs will be routed to this behavior. In this case, it is + \verb pygame and \verb randomLoc , two previously declared behaviors. + Inputs from these behaviors will be passed to the behavior chain via + sensorInputs. Next, we have the meet of this chain, the behaviors it is + composed of. This states that first, an input is routed through + \texttt{colorchange}. \verb colorchange adds a color field to the + sensor data. Next, the input is routed to \verb running a behavior + that makes pixels run back and forth. Finally, the input is routed to + \verb decay , a behavior that adds a decay ``PixelEvent'' that makes + individual pixels turn on and then decay. + + The next item we see is \verb RecursiveHooks . This is a special + feature of the \verb BehaviorChain that allows us to augment the + reccurences recursive events have. We specify that we will augment the + recursive behavior of \verb running with another behavior, + \verb acceleratedie which modifies increases the speed of the running + behavior, and stops the behavior after a certain number of iterations. + Note that recursive hooks take data in via their \textbf{external input} + port, and \textbf{not} their recursive port. + + Finally, we state that this behavior will indeed be rendered directly to + the screen. We also specify which PixelMapper we want to use. + + Phew. This isn't as complicated as it sounds. I promise. + + \end{document} diff --git a/docs/tex/ClassOverview.tex b/docs/tex/ClassOverview.tex new file mode 100644 index 0000000..00d55ec --- /dev/null +++ b/docs/tex/ClassOverview.tex @@ -0,0 +1,186 @@ +\documentclass{article} +\usepackage{fullpage} +\begin{document} + \title{150 Smoots Lighting Installation Design Document} + \author{Russell Cohen} + \date{\today} + \maketitle + \newcommand{\classDoc}[5]{ + \subsection{#1} + \begin{itemize} + \item \textbf{Inherits from: } #2 + \item \textbf{Inherited by: } #3 + \item \textbf{Brief Description: } #4 + \item \textbf{Argument Requirements: } #5 + \end{itemize} + } + \section{Intro} + \textbf{NB: These docs give an overview of the classes and methods but + may lag behind the code for certain in-flux functionality. For + up-to-the minute docs, please use pydoc.} \\ + The system, which we will describe henceforth as SmootLight is a + modular system designed with the following goals in mind: + \begin{itemize} + \item The system must abstract away from all components while + remaining useful (\verb=Renderer=, \verb=Input=, \verb=Behavior=) + \item The system must be modular and be easy to write new code for. + \item More goals as I think of them + \end{itemize} + We accomplish this in the following manner: + \begin{itemize} + \item The system is configured by an XML file which specifies its + components. + \item All classes are initialized with a dictionary as an argument + containing anything a class may need. All objects are passed + between members as python dictionaries because their easy + serialization. + \end{itemize} + \section{Overview} + \begin{itemize} + \item + \section{Operations Class Patterns} + \classDoc{SmootCoreObject}{None}{All 2nd level classes (PixelAssembler, Renderer, + Input, Behavior)} + {SmootCoreObject is essentially a super-object + that makes things easy for us. It does the following actions: + \begin{itemize} + \item Defines a constructor that sets argDict + \item Defines a \texttt{\_\_getitem\_\_} , which lets us acces items in + argDict as if the class was a dictionary. + (\texttt{self['itemName']}). It also automatically maps the + initial contents of the argDict to class attributes. + \item Defines validateArgs and validateArgDict which + validate the incoming arguments against a dictionary + containing argument names as keys and an error message to + display if they are missing as a values. This file should + be named classname.params and look like a python dict + (\texttt{\{'key':value, 'key2':value2\}} ) + \end{itemize} + } + {No required parameters in argDict} + \classDoc{PixelAssembler}{SmootCoreObject}{LineLayout, ZigzagLayout}{ + PixelAssembler is a class that defines the positions of lights. It + provides a method \texttt{getLightLocations} which give a list of + all light locations for a given strip. Inheriting classes must + define \texttt{layoutFunc} which returns the next location given the + previous location. (They may simply override + \texttt{getLightLocations} + instead, if they wish, but be careful when doing so). In + heriting classes may defint \texttt{initLayout} which is called at + initialization.}{\begin{itemize} + \item \texttt{lightToLightSpacing}: this is the length of wire + between 2 adjacent LEDs. Common values are 4 or 12. + \item \texttt{numLights}: Number of lights in a strip. + \item \texttt{originLocation}: Location of the first light. + \end{itemize}} + \classDoc{Renderer}{SmootCoreObject}{PygameRenderer, IndoorRenderer}{ + Renderer is a class that serves as an abstract class for renderers + interacting with the system. Inheriting classes must define + render, which is passed a \texttt{lightSystem} object. Inheriting + classes may define initRenderer which is called on initiation. + }{No required arguments} + \classDoc{Input}{SmootCoreObject, threading.Thread}{PygameInput, + TCPInput,UDPInput}{Input is a abstract class which facilitates Inputs. + It does this by providing a method that is polled at a periodic + interval within which the inheriting class can raise an event. + Inheriting classes must define \texttt{sensingLoop} which is + called at the interval specified in the config. Inheriting + classes should call respond with an dictionary as an argument + to raise an event. Classes using (not + inheriting) input must pass a scope into + the argDict which offers a \texttt{processInput} + method. Inputs are marked as Daemon threads, and + are therefore killed when their parent is + killed.}{\begin{itemize} + \item \texttt{InputId}: The string id of a given input. Must be + unique. + \item Optional:\texttt{RefreshInterval}: The interval in + seconds (will soon be changed to milliseconds) between + sucessive calls to the sensingLoop method. TODO: make + timeout. + \end{itemize}} + \classDoc{Behavior}{SmootCoreObject}{EchoBehavior, DebugBehavior}{ +Abstract class for a behavior. On every time step, the behavior is passed the +inputs from all sensors it is bound to as well as any recursive inputs that it +spawned during the last time step. Inheriting classes MUST define \texttt{processResponse}. Look +at the Behaviors documentation for more details.} +{\begin{itemize} + \item \texttt{Inputs}: A list of input Ids specifying input to the + behavior. +\end{itemize}} +\classDoc{PixelEvent}{SmootCoreObject}{StepResponse}{ + Abstract class defining the behavior of a light after it has been turned on. + Inheriting classes should defint \texttt{lightState} which is passed a + timeDelay in ms as an argument. \texttt{lightState} should return a + color or None if the response is complete.}{\begin{itemize} + \item \texttt{Color}: The color of response. \textit{This is may be + removed in the future} + \end{itemize} + } +\section{The Screen Class and Its Relatives} +\classDoc{Screen}{None}{None} +{The \texttt{Screen} class is a representation of an entire system of pixels, + distributed over space. The Screen class and its relatives process + responses (mapped to pixels via a LayoutEngine), and add PixelEvents + to the individual pixels. The Screen provides an instance that + renderers can call to determine the color of all the individual pixels. It contains a list of PixelStrips, which each + address the individual pixels. \texttt{Screen} offers a + \texttt{respond} method which takes a dictionary containing information + about a response. TODO: detail the contents of this dictionary (maybe + somewhere else). Note: \texttt{Screen} will not process its + responses until \texttt{timeStep} is called which processes all responses that + have been queued since the last time that \texttt{timeStep} was + called. Screen also offers an iterator over \textit{all} lights, + accesible by using an expression like: \texttt{for light in screen:}. For + addressing of specific \texttt{PixelStrips} , \texttt{self.pixelStrips} + is exposed.}{No required parameters} +\classDoc{PixelStrip}{None}{None} +{The \texttt{PixelStrip} class is a representation of a string of Pixels that are + connected in physical space (eg. a strip of lights). A \texttt{PixelStrip} takes a + \texttt{LayoutBuilder} (\textit{Name up for debate, currently known as layout + engine}) as an argument. The \texttt{argDict} of the + \texttt{LayoutBuilder} is + passed becomes the \texttt{argDict} of the \texttt{PixelStrip}. + \texttt{PixelStrip} generally shouldn't be + adressed directly unless you need Strip-Identification for rendering + purposes. You should never, for example, call \texttt{respond} on a + \texttt{PixelStrip} + directly, unless you really know what you're doing. Well, actually you + should never need to do that. + never. Don't do it.}{Takes a \texttt{LayoutBuilder} as an argument.} + \end{itemize} + \section{Best Practices} + \subsection{Variable and function naming} + I'm pretty bad about being consistent. However, in all future + code, please adhere to the following: + \begin{itemize} + \item Classes: \texttt{FirstLetterCaps} + \item Functions: \texttt{camelCase} + \item Property Names: \texttt{FirstLetterCaps} + \item Constants: \texttt{ALL\_CAPS\_WITH\_UNDERSCORES} + \end{itemize} + \subsection{Time} + For time, use the \texttt{util.TimeOps.time()} method to return the current + time in ms. + \subsection{Acessing a Component Given an Id} + Use \texttt{util.ComponentRegistry.getComponent(id)}. This provides any + component access to any other components. We may consider a way to + make this read-only. + \subsection{Acessing Pixels} + The ideal method for acessing Pixels in a screen is to use its + iterator. Iterating over the individual PixelStrips is also an + acceptable method. + \subsection{Determining the state of a \texttt{Pixel}} + The best practice for determining the color of a \texttt{Pixel} is to call + \texttt{state}. This ensures + all current active responses running on the Pixel contribute correctly. + \subsection{Color} + For color, use a tuple of (R,G,B) 0-255 for each. Colors can be + easily manipulated with members of the Util class. + \subsection{Locations} + Locations are stored (x,y), in whatever unit you light system is + in. (Whatever unit you use when you define spacing). + \subsection{Constant Strings (key strings, 'Location', 'Color', etc.)} + Use the util.Strings module. It contains many currently in use + Strings, and ensures consistency. + \end{document} diff --git a/ga b/ga index 7bed4ad..4ec4cc4 100755 --- a/ga +++ b/ga @@ -1 +1,2 @@ git add *.py */*.py *.xml */*.xml tests/*.py tests/testdata/* +git add docs/*.tex docs/*.pdf docs/*/*.tex docs/*/*.pdf diff --git a/layouts/SpecifiedLayout.py b/layouts/SpecifiedLayout.py new file mode 100644 index 0000000..5a6e963 --- /dev/null +++ b/layouts/SpecifiedLayout.py @@ -0,0 +1,21 @@ +from operationscore.PixelAssembler import * +class SpecifiedLayout(PixelAssembler): + """SpecifiedLayout is a class that allows precise specification of each individual LED. + Configure with a tag in the args dict as follows': + + + (1,1) + (50,50) + + etc. + + You may put attributes on the Locs so that you don't get confused. + """ + + def layoutInit(self): + self.lightNum = -1 + + def layoutFunc(self, lastLocation): + self.lightNum += 1 + return self['Locations'][self.lightNum] + diff --git a/renderers/C5Renderer.xml b/renderers/C5Renderer.xml new file mode 100644 index 0000000..d9fc9b0 --- /dev/null +++ b/renderers/C5Renderer.xml @@ -0,0 +1,10 @@ + + renderers.IndoorRenderer + + indoorRenderer + + 10.32.97.17 + {'strip1':1} + + + -- cgit v1.2.3 From f34e1c732036553e4a68534dfc1b24a13ccd33ce Mon Sep 17 00:00:00 2001 From: rcoh Date: Tue, 15 Feb 2011 16:25:37 -0500 Subject: Adding images to the Behaviors Docs --- docs/Behaviors/Behavior.jpg | Bin 0 -> 21577 bytes docs/Behaviors/Behaviors.pdf | Bin 98731 -> 148809 bytes docs/Behaviors/Behaviors.tex | 24 ++++++++++++++++++------ docs/Behaviors/BehaviorwithRecursiveHook.jpg | Bin 0 -> 27186 bytes 4 files changed, 18 insertions(+), 6 deletions(-) create mode 100644 docs/Behaviors/Behavior.jpg create mode 100644 docs/Behaviors/BehaviorwithRecursiveHook.jpg diff --git a/docs/Behaviors/Behavior.jpg b/docs/Behaviors/Behavior.jpg new file mode 100644 index 0000000..c96ee84 Binary files /dev/null and b/docs/Behaviors/Behavior.jpg differ diff --git a/docs/Behaviors/Behaviors.pdf b/docs/Behaviors/Behaviors.pdf index 14eafa6..32c5b75 100644 Binary files a/docs/Behaviors/Behaviors.pdf and b/docs/Behaviors/Behaviors.pdf differ diff --git a/docs/Behaviors/Behaviors.tex b/docs/Behaviors/Behaviors.tex index 9021581..5105588 100644 --- a/docs/Behaviors/Behaviors.tex +++ b/docs/Behaviors/Behaviors.tex @@ -1,5 +1,6 @@ \documentclass{article} \usepackage{fullpage} +\usepackage{graphicx} \begin{document} \title{Behaviors: An Introduction and Exercises} \author{Russell Cohen} @@ -12,6 +13,9 @@ terminals. One gets released externally as output, and the other gets fed back to the behavior. At their core, behaviors have nothing to do with pixels are light effects -- this is merely how we commonly use them. + \begin{center} + \includegraphics[width=4 in]{Behavior.jpg} + \end{center} \section{How do I write a behavior?} At the core of a behavior is its \texttt{ProcessResponse} method which tells a behavior what to get on input. As you might expect, it has 2 @@ -20,7 +24,7 @@ and outputs are all python dictionaries. This allows us to have an arbitrary number of named parameters. As sample input might look something like \texttt{{'Location':(20,20), 'Height':10}}. When we - return a value, we return a tuple of (list,list). Note that on a + return a value, we return a tuple of \texttt{(list,list)}. Note that on a process response method you will actually be given a \textbf{List of dictionaries} and you should iterate over them. \textbf{Important:} You should not directly modify the inputs! Use @@ -86,7 +90,7 @@ connected together. This allows us to build up many different behaviors from a library of simple pieces. Let's look at how we actually accomplish this. - + Behavior Chaining is accomplished through the behavior chain class. Here is an example of a behavior we declare (in XML) via a behavior chain: @@ -134,10 +138,18 @@ behavior, and stops the behavior after a certain number of iterations. Note that recursive hooks take data in via their \textbf{external input} port, and \textbf{not} their recursive port. - + \begin{center} + \includegraphics[width=4 in]{BehaviorwithRecursiveHook.jpg} + \end{center} Finally, we state that this behavior will indeed be rendered directly to - the screen. We also specify which PixelMapper we want to use. - + the screen, by specifying: + \begin{center}\texttt{True} \end{center} + We also specify which PixelMapper we want to use (gaussmap): + \texttt{gaussmap}. \verb gaussmap is the id we assigned to the mapper when + we declared in the \verb PixelMappers section of the xml. + \begin{center} Phew. This isn't as complicated as it sounds. I promise. - + \end{center} + Browse around the behaviors to get an idea of what is possible and what has been done. They + all live in the behaviors folder. Enjoy! \end{document} diff --git a/docs/Behaviors/BehaviorwithRecursiveHook.jpg b/docs/Behaviors/BehaviorwithRecursiveHook.jpg new file mode 100644 index 0000000..84e99d6 Binary files /dev/null and b/docs/Behaviors/BehaviorwithRecursiveHook.jpg differ -- cgit v1.2.3 From bb5a90235f2cf2efb28fa85a237774acd33f09c0 Mon Sep 17 00:00:00 2001 From: dlaw Date: Sun, 13 Feb 2011 00:09:39 +0800 Subject: Fixed python 2.7 issue where {val} is interpreted as set([val]). --- config/FireflyDemo.xml | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/config/FireflyDemo.xml b/config/FireflyDemo.xml index 856569e..de639d9 100644 --- a/config/FireflyDemo.xml +++ b/config/FireflyDemo.xml @@ -81,7 +81,7 @@ behaviors.RestrictLocation xbounce - {val}*-1 + '{val}*-1' XStep {x}<0 or {x}>800 @@ -90,7 +90,7 @@ behaviors.RestrictLocation ybounce - {val}*-1 + '{val}*-1' YStep {y}<0 or {y}>200 -- cgit v1.2.3 From 14a83772c12570e51387a316a7e5f2e4d9d46dd0 Mon Sep 17 00:00:00 2001 From: rcoh Date: Wed, 16 Feb 2011 19:59:45 -0500 Subject: Adding XML Docs --- docs/XmlConfiguration.pdf | Bin 0 -> 134992 bytes docs/XmlConfiguration.tex | 99 ++++++++++++++++++++++++++++++++++++++++++++++ 2 files changed, 99 insertions(+) create mode 100644 docs/XmlConfiguration.pdf create mode 100644 docs/XmlConfiguration.tex diff --git a/docs/XmlConfiguration.pdf b/docs/XmlConfiguration.pdf new file mode 100644 index 0000000..343347a Binary files /dev/null and b/docs/XmlConfiguration.pdf differ diff --git a/docs/XmlConfiguration.tex b/docs/XmlConfiguration.tex new file mode 100644 index 0000000..a1cce8f --- /dev/null +++ b/docs/XmlConfiguration.tex @@ -0,0 +1,99 @@ +\documentclass{article} +\usepackage{fullpage} +\begin{document} + \title{XML in SmootLight: Configuration++} + \author{Russell Cohen} + \date{\today} + \maketitle + \section{Motivation} + Why use XML (or any non-code language for that matter) to configure code? 2 Reasons: + \begin{itemize} + \item We would like small changes (like changing the color, speed, or type of behavior) + to be as quick as possible, and require modifying only 1 piece of code. + \item We would like these changes to be able to be made \emph{programmatically} + \item (Not applicable to python, but important in languages like Java or C): We want to + be able to make changes \textbf{without} having to recompile the source. + \end{itemize} + As you will see, however, XML in SmootLight goes beyond simple configuration. XML in + SmootLight allows us to declare a LightSystem (an inherently non-declarative thing) in the + same way you might write a webpage in HTML. We will refer to the XML system here-on-in as + `SmootConf'. Without any further ado, lets start looking at + how this all works. + \section{Declaring a class in SmootConf} + The most common thing done is SmootConf is declaring a class -- Class declaration code will + get parsed by SmootLight at runtime and \emph{actually} \textbf{declare} your classes for + you, exactly how you describe them. Classes are declared under a broader + \texttt{Configuration} tag which we will describe later. Lets look at the declaration of + \texttt{PygameInput}, an input that takes data from a Pygame window. + \begin{verbatim} + + inputs.PygameInput + + pygameclick + 10 + True + + + \end{verbatim} + The first attribute we see is the \texttt{Class} attribute. This specifies what + fully-qualified Python class to this object should be an instance of. In this case, it is + an instance of PygameInput, which lives in the inputs module/folder. Next, we see the + \texttt{Args}. The Args are where \emph{every} piece of configuration (except the actual + Class) goes. Let me repeat that, becuase it is a common sticking point. If you place + something in the configuration outside of the \texttt{Args} tag, it will not be read. + Period. + + If you are familiar with the SmootLight system, you will know that many objects in + SmootLight behave like dictionaries -- you can use statements like + \texttt{Self['ParamName']} to access parameters. If you have ever wondered where this + mystery dictionary is filled from, look no further -- it is here in the Args tag. + + Lets dig into the contents of the Arg tag. First we see \texttt{Id}. All components in the + SmootLight system are \emph{not} explicitly required to have an Id + specified.\footnote{Components declared without Id's will get a randomly assigned Id at + declaration time} + However, if you want to be able to reference this class in other places in the XML (which + we will look into later), you will need to specify and Id. The other two parameters are + simply bits of configuration which will get passed to PygameInput when it gets instantiated. + + \section{The Structure of a SmootLight Configuration Document} + The individual class declarations are the `leaves' of a full configuration document that + gets interpreted by the parser. In order for the parser to know what to do with them, it + also needs the branches. The structure of these `branches' (tags) follow: + \begin{verbatim} + + + + + + + + + + + \end{verbatim} + Under each of the tags indicated, place the classes that you want to instantiate in that + category. Each category has a different child tag: + \begin{itemize} + \item PixelConfiguration: PixelStrip + \item PixelMapperConfiguration: PixelMapper + \item RendererConfiguration: Renderer + \item InputConfiguration: InputElement + \item BehaviorConfiguration: Behavior + \end{itemize} + Some further clarification on this: Recall in the previous section we inspected the + declaration of the Input element. The input configuration for that system might have looked + like: + \begin{verbatim} + + + inputs.PygameInput + + pygameclick + 10 + True + + + + \end{verbatim} +\end{document} -- cgit v1.2.3 From 2c9cb0784184346917f9ad509f9b2c4056b60167 Mon Sep 17 00:00:00 2001 From: rcoh Date: Wed, 16 Feb 2011 20:07:15 -0500 Subject: remove email address. --- behaviors/Flasher.py | 2 +- config/FireflyDemo.xml | 2 +- docs/XmlConfiguration.tex | 4 +++- 3 files changed, 5 insertions(+), 3 deletions(-) diff --git a/behaviors/Flasher.py b/behaviors/Flasher.py index 1d79d41..395d898 100644 --- a/behaviors/Flasher.py +++ b/behaviors/Flasher.py @@ -4,7 +4,7 @@ import util.ColorOps as colorops import pdb class Flasher(Behavior): """Implements a pulsing/flashing behavior. - Jim Salem: jsalem@gmail.com + Jim Salem Args: Factor - The speed of flashing. Must be b/w 0 and 1. Default is .95 diff --git a/config/FireflyDemo.xml b/config/FireflyDemo.xml index de639d9..06ae7ba 100644 --- a/config/FireflyDemo.xml +++ b/config/FireflyDemo.xml @@ -1,6 +1,6 @@ - + diff --git a/docs/XmlConfiguration.tex b/docs/XmlConfiguration.tex index a1cce8f..0ccd08d 100644 --- a/docs/XmlConfiguration.tex +++ b/docs/XmlConfiguration.tex @@ -17,7 +17,9 @@ As you will see, however, XML in SmootLight goes beyond simple configuration. XML in SmootLight allows us to declare a LightSystem (an inherently non-declarative thing) in the same way you might write a webpage in HTML. We will refer to the XML system here-on-in as - `SmootConf'. Without any further ado, lets start looking at + `SmootConf'. \textbf{The fastest way to get familiar with SmootConf is simply to look at + the XML files in the configuration file. However, if you want a more structured approach to + its feature and sublties this document should do the job.} Without any further ado, lets start looking at how this all works. \section{Declaring a class in SmootConf} The most common thing done is SmootConf is declaring a class -- Class declaration code will -- cgit v1.2.3 From 90a03b1b91c579a911fbbbbea398124c83726a3f Mon Sep 17 00:00:00 2001 From: Russell Cohen Date: Thu, 17 Feb 2011 10:59:57 -0500 Subject: Added a readme! --- README | 14 ++++++++++++++ 1 file changed, 14 insertions(+) diff --git a/README b/README index e69de29..833dcfc 100644 --- a/README +++ b/README @@ -0,0 +1,14 @@ +#SmootLight +SmootLight is a modular, scalable system for control interactive light +installations. + +##Dependencies +- Python 2.6 (2.7 should work, 3.x won't) +[Optional]: + - PIL (For JPGInput) + - Pygame (for simulations) + - Liblo (for mobile phone input) + +##Usage +Command line: `python LightInstallation.py config/Demo.xml` +(or whichever config file you want) -- cgit v1.2.3 From e3d0104e43efbb3724d4156f06310bd915307581 Mon Sep 17 00:00:00 2001 From: Andrew Chen Date: Thu, 17 Feb 2011 15:19:33 -0800 Subject: Added Getting Started documentation. --- docs/gettingStarted.pdf | Bin 0 -> 96917 bytes docs/gettingStarted.tex | 37 +++++++++++++++++++++++++++++++++++++ 2 files changed, 37 insertions(+) create mode 100644 docs/gettingStarted.pdf create mode 100644 docs/gettingStarted.tex diff --git a/docs/gettingStarted.pdf b/docs/gettingStarted.pdf new file mode 100644 index 0000000..f7f2b8e Binary files /dev/null and b/docs/gettingStarted.pdf differ diff --git a/docs/gettingStarted.tex b/docs/gettingStarted.tex new file mode 100644 index 0000000..67357fe --- /dev/null +++ b/docs/gettingStarted.tex @@ -0,0 +1,37 @@ +\documentclass{article} +\usepackage{fullpage} +\usepackage{hyperref} +\begin{document} + \title{150 Smoots Getting Started on Linux} + \author{Andrew Chen} + \date{\today} + \maketitle + \section{Repository Access} + \begin{itemize} + \item \textbf{Install} Git packages with \emph{sudo apt-get install git-core git-gui git-doc}. Set up your basic git settings \href{http://help.github.com/git-email-settings/}{like so}. + \item \textbf{Sign up} for a GitHub account (\href{https://github.com/signup/free}{here}) then ask Russell to add your account as a collaborator to the rcoh/SmootLight code repository. + \item \textbf{Connect} to the SmootLight GitHub code repository. Generate SSH keys and upload the public one to GitHub by following the instructions \href{http://help.github.com/linux-key-setup/}{here}. + \item \textbf{Clone and branch} the code repository; use \href{http://help.github.com/git-cheat-sheets/}{this cheatsheet} for help as necessary. + \end{itemize} + \section{Testing on Pygame} + \begin{itemize} + \item \textbf{Install} Pygame with \emph{sudo apt-get install python-pygame}. + \item \textbf{Setup} logging by running \emph{./setup.sh}. + \item \textbf{Run} your LightInstallation code with \emph{python LightInstallation.py}. + \end{itemize} + \section{Repository Check In} + \begin{itemize} + \item \textbf{Stage} files to be committed with \emph{./ga}. + \item \textbf{Commit} your changes locally with \emph{git commit}. + \item \textbf{Push} your changes to your branch with \emph{git push origin yourbranchname}. + \item \textbf{Request a pull} to the source repository by following instructions \href{http://help.github.com/pull-requests/}{here}. + \item \textbf{Learn more} about working with remote repositories \href{http://help.github.com/remotes/}{here}. + \end{itemize} + \section{Latex Documentation} + \begin{itemize} + \item \textbf{Install} Latex packages to be consistent with current documentation style. I had to run \emph{sudo apt-get install texlive-fonts-recommended texlive-latex-extra} to successfully convert Russell's .tex to pdf. + \item \textbf{Edit} the .tex files with any text editor. I use vim for quick edits and gedit with the Latex plugin for autocompletion and quick previews. Get the Latex plugin with \emph{sudo apt-get install gedit-latex-plugin}. + \item \textbf{Publish to PDF} with \emph{pdflatex yourfile.tex}. + \item \textbf{View PDF} with \emph{evince yourfile.pdf}. + \end{itemize} +\end{document} -- cgit v1.2.3 From 53c18ac308d90329cb0b9fbedd45194971785b85 Mon Sep 17 00:00:00 2001 From: rcoh Date: Thu, 17 Feb 2011 18:51:46 -0500 Subject: Adding gettingStarted docs and improving XmlConfiguration docs. --- docs/XmlConfiguration.pdf | Bin 134992 -> 152157 bytes docs/XmlConfiguration.tex | 124 +++++++++++++++++++++++++++++++++++++++++++++- docs/gettingStarted.pdf | Bin 96917 -> 95402 bytes docs/gettingStarted.tex | 22 ++++---- 4 files changed, 134 insertions(+), 12 deletions(-) diff --git a/docs/XmlConfiguration.pdf b/docs/XmlConfiguration.pdf index 343347a..9136232 100644 Binary files a/docs/XmlConfiguration.pdf and b/docs/XmlConfiguration.pdf differ diff --git a/docs/XmlConfiguration.tex b/docs/XmlConfiguration.tex index 0ccd08d..6f45de2 100644 --- a/docs/XmlConfiguration.tex +++ b/docs/XmlConfiguration.tex @@ -19,7 +19,7 @@ same way you might write a webpage in HTML. We will refer to the XML system here-on-in as `SmootConf'. \textbf{The fastest way to get familiar with SmootConf is simply to look at the XML files in the configuration file. However, if you want a more structured approach to - its feature and sublties this document should do the job.} Without any further ado, lets start looking at + its feature and subtleties this document should do the job.} Without any further ado, lets start looking at how this all works. \section{Declaring a class in SmootConf} The most common thing done is SmootConf is declaring a class -- Class declaration code will @@ -98,4 +98,126 @@ \end{verbatim} + \texttt{InputElement}s live under the broader \texttt{InputConfiguration} tag. Thats all in + terms of basic configuration -- all other features are going to be specific to the + particular class you are declaring (and the class should specify those). However, the + system also offers a lot of features to give you more power and flexibility, as well as + minimizing repeated XML. + \section{XML Inheritance} + SmootConf allows you have XML objects inherit from this other. Think of this as an + X:Include crossed with OO style inheritance, if those are familiar concepts. The most basic + tag of inheritance in SmootConf is the \texttt{InheritsFrom} tag. Here is a quick example + of it in action: + \begin{verbatim} + + renderers/Pygame.xml + + \end{verbatim} + + And the contents of \texttt{renderers/Pygame.xml}: + \begin{verbatim} + + renderers.PygameRenderer + + pygamerender + (1300,50) + + + \end{verbatim} + + The \texttt{InheritsFrom} tag indicates to look in the XML File indicated, parse it, and + recursively merge its tags with the siblings of the \texttt{InheritsFrom} tag. From a high + level, the algorithm works as follows: + + \begin{itemize} + \item For every tag: + \item If the tag is in the inheriter, use that. Otherwise, use the inherited tag. + \item Recurse to children. + \end{itemize} + + SmootConf adds a bit of syntactic sugar that allows you override args in the args dict when + doing inheritance by simply specifying them as attributes of the parent. The example below + comes from a pixel layout config: + \begin{verbatim} + + + layouts/50PixelStrip.xml + + + layouts/50PixelStrip.xml + + \end{verbatim} + + The contents of \texttt{layouts/50PixelStrip.xml} are: + \begin{verbatim} + + layouts.LineLayout + + 4 + 4 + 50 + + + \end{verbatim} + + A careful reading of the algorithm will reveal some behaviors which are not specified. What if there are + multiple instances of identical sibling tags? The answer is that this is not currently + supported. It may be supported in the future. + + If you want your tags to be added to an inherited config without trying to merge, put them + in an \texttt{APPEND} tag like so: + + \begin{verbatim} + + behaviors/StockBehaviors.xml + + + behaviors/SomethingElse.xml + + + blah.blah + + + + + + \end{verbatim} + \section{Variable Bindings} + SmootConf allows developers to reference other variables within the \texttt{} tag. These + references are dynamic, and are bound for the lifetime of the object and will updated as + their bound values update. Here is an example: + \begin{verbatim} + + behaviors.SomeClass + + dimming + ${DecayTime}$*5 + 10 + + + \end{verbatim} + In this (fake) example, we bind the DecayCoefficient to the value of DecayTime, which allows us to + set decay in a reasonable unit, decoupled from the coefficient required by the behavior + itself. + + Under the hood, this feature is done with lambda functions. When you query arguments on the + object, the lambda gets resolved (look at \texttt{operationscore/SmootCoreObject.py} for the + implementation of this). Because of this, we also have to ability to go 1 layer deeper. + + Let's say you wanted to operate on another dictionary -- say, the current behavior packet or + and args of another behavior. By surrounding your variable in quotes, querying its value + with product a lambda function, which, when given another dictionary, will resolve the + value. + \begin{verbatim} + + behaviors.SomeClass + + stayinbounds + 100 + '${x}$' < ${MaxX}$ + + + \end{verbatim} + If you call \texttt{self['OutOfBounds']}, and pass it a dictionary with a value at key + \texttt{x}, it will return a boolean stating whether or not \texttt{x > MaxX}. \end{document} diff --git a/docs/gettingStarted.pdf b/docs/gettingStarted.pdf index f7f2b8e..4d295f7 100644 Binary files a/docs/gettingStarted.pdf and b/docs/gettingStarted.pdf differ diff --git a/docs/gettingStarted.tex b/docs/gettingStarted.tex index 67357fe..4d88ace 100644 --- a/docs/gettingStarted.tex +++ b/docs/gettingStarted.tex @@ -8,30 +8,30 @@ \maketitle \section{Repository Access} \begin{itemize} - \item \textbf{Install} Git packages with \emph{sudo apt-get install git-core git-gui git-doc}. Set up your basic git settings \href{http://help.github.com/git-email-settings/}{like so}. + \item \textbf{Install} Git packages with \texttt{sudo apt-get install git-core git-gui git-doc}. Set up your basic git settings \href{http://help.github.com/git-email-settings/}{like so}. \item \textbf{Sign up} for a GitHub account (\href{https://github.com/signup/free}{here}) then ask Russell to add your account as a collaborator to the rcoh/SmootLight code repository. \item \textbf{Connect} to the SmootLight GitHub code repository. Generate SSH keys and upload the public one to GitHub by following the instructions \href{http://help.github.com/linux-key-setup/}{here}. \item \textbf{Clone and branch} the code repository; use \href{http://help.github.com/git-cheat-sheets/}{this cheatsheet} for help as necessary. \end{itemize} \section{Testing on Pygame} \begin{itemize} - \item \textbf{Install} Pygame with \emph{sudo apt-get install python-pygame}. - \item \textbf{Setup} logging by running \emph{./setup.sh}. - \item \textbf{Run} your LightInstallation code with \emph{python LightInstallation.py}. + \item \textbf{Install} Pygame with \texttt{sudo apt-get install python-pygame}. + \item \textbf{Setup} logging by running \texttt{./setup.sh}. + \item \textbf{Run} your LightInstallation code with \texttt{python LightInstallation.py}. \end{itemize} \section{Repository Check In} \begin{itemize} - \item \textbf{Stage} files to be committed with \emph{./ga}. - \item \textbf{Commit} your changes locally with \emph{git commit}. - \item \textbf{Push} your changes to your branch with \emph{git push origin yourbranchname}. + \item \textbf{Stage} files to be committed with \texttt{./ga}. + \item \textbf{Commit} your changes locally with \texttt{git commit}. + \item \textbf{Push} your changes to your branch with \texttt{git push origin yourbranchname}. \item \textbf{Request a pull} to the source repository by following instructions \href{http://help.github.com/pull-requests/}{here}. \item \textbf{Learn more} about working with remote repositories \href{http://help.github.com/remotes/}{here}. \end{itemize} \section{Latex Documentation} \begin{itemize} - \item \textbf{Install} Latex packages to be consistent with current documentation style. I had to run \emph{sudo apt-get install texlive-fonts-recommended texlive-latex-extra} to successfully convert Russell's .tex to pdf. - \item \textbf{Edit} the .tex files with any text editor. I use vim for quick edits and gedit with the Latex plugin for autocompletion and quick previews. Get the Latex plugin with \emph{sudo apt-get install gedit-latex-plugin}. - \item \textbf{Publish to PDF} with \emph{pdflatex yourfile.tex}. - \item \textbf{View PDF} with \emph{evince yourfile.pdf}. + \item \textbf{Install} Latex packages to be consistent with current documentation style. I had to run \texttt{sudo apt-get install texlive-fonts-recommended texlive-latex-extra} to successfully convert Russell's .tex to pdf. + \item \textbf{Edit} the .tex files with any text editor. I use vim for quick edits and gedit with the Latex plugin for autocompletion and quick previews. Get the Latex plugin with \texttt{sudo apt-get install gedit-latex-plugin}. + \item \textbf{Publish to PDF} with \texttt{pdflatex yourfile.tex}. + \item \textbf{View PDF} with \texttt{evince yourfile.pdf}. \end{itemize} \end{document} -- cgit v1.2.3 From cb69d2e1c7ced951cbf7a31ee286b0ed92cab8a8 Mon Sep 17 00:00:00 2001 From: rcoh Date: Fri, 18 Feb 2011 16:56:43 -0500 Subject: Adding Epydoc generated docs. --- html/SmootLight-module.html | 291 ++ html/SmootLight-pysrc.html | 111 + html/SmootLight.LightInstallation-module.html | 188 ++ html/SmootLight.LightInstallation-pysrc.html | 930 ++++++ ....LightInstallation.LightInstallation-class.html | 509 +++ html/SmootLight.Profile-module.html | 129 + html/SmootLight.Profile-pysrc.html | 118 + html/SmootLight.TestAll-module.html | 189 ++ html/SmootLight.TestAll-pysrc.html | 117 + html/SmootLight.TestProfile-module.html | 376 +++ html/SmootLight.TestProfile-pysrc.html | 206 ++ html/SmootLight.behaviors-module.html | 191 ++ html/SmootLight.behaviors-pysrc.html | 112 + .../SmootLight.behaviors.AddPixelEvent-module.html | 157 + html/SmootLight.behaviors.AddPixelEvent-pysrc.html | 271 ++ ...ehaviors.AddPixelEvent.AddPixelEvent-class.html | 333 ++ html/SmootLight.behaviors.AllPixels-module.html | 163 + html/SmootLight.behaviors.AllPixels-pysrc.html | 122 + ...tLight.behaviors.AllPixels.AllPixels-class.html | 294 ++ .../SmootLight.behaviors.AllPixelsLeft-module.html | 163 + html/SmootLight.behaviors.AllPixelsLeft-pysrc.html | 123 + ...ehaviors.AllPixelsLeft.AllPixelsLeft-class.html | 293 ++ .../SmootLight.behaviors.BehaviorChain-module.html | 156 + html/SmootLight.behaviors.BehaviorChain-pysrc.html | 254 ++ ...ehaviors.BehaviorChain.BehaviorChain-class.html | 365 +++ html/SmootLight.behaviors.Circle-module.html | 162 + html/SmootLight.behaviors.Circle-pysrc.html | 143 + html/SmootLight.behaviors.Circle.Circle-class.html | 338 ++ ...ight.behaviors.ColorChangerBehavior-module.html | 163 + ...Light.behaviors.ColorChangerBehavior-pysrc.html | 141 + ...ChangerBehavior.ColorChangerBehavior-class.html | 305 ++ html/SmootLight.behaviors.ColorShift-module.html | 162 + html/SmootLight.behaviors.ColorShift-pysrc.html | 129 + ...ight.behaviors.ColorShift.ColorShift-class.html | 291 ++ .../SmootLight.behaviors.ControllerOSC-module.html | 204 ++ html/SmootLight.behaviors.ControllerOSC-pysrc.html | 261 ++ ...ehaviors.ControllerOSC.ControllerOSC-class.html | 328 ++ .../SmootLight.behaviors.DebugBehavior-module.html | 157 + html/SmootLight.behaviors.DebugBehavior-pysrc.html | 210 ++ ...ehaviors.DebugBehavior.DebugBehavior-class.html | 295 ++ .../SmootLight.behaviors.DecayBehavior-module.html | 163 + html/SmootLight.behaviors.DecayBehavior-pysrc.html | 131 + ...ehaviors.DecayBehavior.DecayBehavior-class.html | 293 ++ html/SmootLight.behaviors.EchoBehavior-module.html | 164 + html/SmootLight.behaviors.EchoBehavior-pysrc.html | 130 + ....behaviors.EchoBehavior.EchoBehavior-class.html | 294 ++ html/SmootLight.behaviors.Expand-module.html | 164 + html/SmootLight.behaviors.Expand-pysrc.html | 134 + html/SmootLight.behaviors.Expand.Expand-class.html | 296 ++ ...Light.behaviors.ExpandingColorZones-module.html | 155 + ...tLight.behaviors.ExpandingColorZones-pysrc.html | 220 ++ ...andingColorZones.ExpandingColorZones-class.html | 328 ++ html/SmootLight.behaviors.Flasher-module.html | 163 + html/SmootLight.behaviors.Flasher-pysrc.html | 154 + ...SmootLight.behaviors.Flasher.Flasher-class.html | 300 ++ html/SmootLight.behaviors.MITDoors-module.html | 164 + html/SmootLight.behaviors.MITDoors-pysrc.html | 141 + ...ootLight.behaviors.MITDoors.MITDoors-class.html | 331 ++ ...Light.behaviors.MobileShakeBehavior-module.html | 162 + ...tLight.behaviors.MobileShakeBehavior-pysrc.html | 139 + ...ileShakeBehavior.MobileShakeBehavior-class.html | 328 ++ html/SmootLight.behaviors.ModifyParam-module.html | 164 + html/SmootLight.behaviors.ModifyParam-pysrc.html | 149 + ...ht.behaviors.ModifyParam.ModifyParam-class.html | 298 ++ .../SmootLight.behaviors.ModulateColor-module.html | 162 + html/SmootLight.behaviors.ModulateColor-pysrc.html | 129 + ...t.behaviors.ModulateColor.ColorShift-class.html | 291 ++ html/SmootLight.behaviors.MoveBehavior-module.html | 163 + html/SmootLight.behaviors.MoveBehavior-pysrc.html | 148 + ....behaviors.MoveBehavior.MoveBehavior-class.html | 294 ++ html/SmootLight.behaviors.MrmrSetColor-module.html | 155 + html/SmootLight.behaviors.MrmrSetColor-pysrc.html | 220 ++ ....behaviors.MrmrSetColor.MrmrSetColor-class.html | 328 ++ html/SmootLight.behaviors.Oval-module.html | 162 + html/SmootLight.behaviors.Oval-pysrc.html | 150 + html/SmootLight.behaviors.Oval.Oval-class.html | 338 ++ ...aviors.RandomSetBrightColorBehavior-module.html | 163 + ...haviors.RandomSetBrightColorBehavior-pysrc.html | 127 + ...ehavior.RandomSetBrightColorBehavior-class.html | 293 ++ html/SmootLight.behaviors.RandomWalk-module.html | 164 + html/SmootLight.behaviors.RandomWalk-pysrc.html | 132 + ...ight.behaviors.RandomWalk.RandomWalk-class.html | 294 ++ ...SmootLight.behaviors.RecursiveDecay-module.html | 165 + .../SmootLight.behaviors.RecursiveDecay-pysrc.html | 131 + ...aviors.RecursiveDecay.RecursiveDecay-class.html | 296 ++ .../SmootLight.behaviors.ResponseMover-module.html | 164 + html/SmootLight.behaviors.ResponseMover-pysrc.html | 123 + ...ehaviors.ResponseMover.ResponseMover-class.html | 296 ++ ...ootLight.behaviors.RestrictLocation-module.html | 165 + ...mootLight.behaviors.RestrictLocation-pysrc.html | 159 + ...rs.RestrictLocation.RestrictLocation-class.html | 339 ++ html/SmootLight.behaviors.RiseFall-module.html | 164 + html/SmootLight.behaviors.RiseFall-pysrc.html | 157 + ...ootLight.behaviors.RiseFall.RiseFall-class.html | 297 ++ ...mootLight.behaviors.RunningBehavior-module.html | 164 + ...SmootLight.behaviors.RunningBehavior-pysrc.html | 142 + ...iors.RunningBehavior.RunningBehavior-class.html | 295 ++ html/SmootLight.behaviors.Sink-module.html | 164 + html/SmootLight.behaviors.Sink-pysrc.html | 153 + html/SmootLight.behaviors.Sink.Sink-class.html | 297 ++ html/SmootLight.behaviors.SmootWind-module.html | 162 + html/SmootLight.behaviors.SmootWind-pysrc.html | 156 + ...tLight.behaviors.SmootWind.SmootWind-class.html | 328 ++ html/SmootLight.behaviors.Square-module.html | 164 + html/SmootLight.behaviors.Square-pysrc.html | 138 + html/SmootLight.behaviors.Square.Square-class.html | 342 ++ ...SmootLight.behaviors.SwitchBehavior-module.html | 163 + .../SmootLight.behaviors.SwitchBehavior-pysrc.html | 190 ++ ...aviors.SwitchBehavior.SwitchBehavior-class.html | 364 +++ html/SmootLight.behaviors.SynchTest-module.html | 162 + html/SmootLight.behaviors.SynchTest-pysrc.html | 127 + ...tLight.behaviors.SynchTest.SynchTest-class.html | 328 ++ html/SmootLight.behaviors.TimeSwitch-module.html | 157 + html/SmootLight.behaviors.TimeSwitch-pysrc.html | 223 ++ ...ight.behaviors.TimeSwitch.TimeSwitch-class.html | 336 ++ html/SmootLight.behaviors.TimedDie-module.html | 164 + html/SmootLight.behaviors.TimedDie-pysrc.html | 128 + ...mootLight.behaviors.TimedDie.Timeout-class.html | 296 ++ html/SmootLight.behaviors.Timeout-module.html | 164 + html/SmootLight.behaviors.Timeout-pysrc.html | 129 + ...SmootLight.behaviors.Timeout.Timeout-class.html | 296 ++ html/SmootLight.behaviors.TouchOSC-module.html | 155 + html/SmootLight.behaviors.TouchOSC-pysrc.html | 233 ++ ...ootLight.behaviors.TouchOSC.TouchOSC-class.html | 328 ++ html/SmootLight.behaviors.VerticalBar-module.html | 162 + html/SmootLight.behaviors.VerticalBar-pysrc.html | 134 + ...ht.behaviors.VerticalBar.VerticalBar-class.html | 291 ++ html/SmootLight.behaviors.XYMove-module.html | 164 + html/SmootLight.behaviors.XYMove-pysrc.html | 136 + html/SmootLight.behaviors.XYMove.XYMove-class.html | 314 ++ html/SmootLight.inputs-module.html | 161 + html/SmootLight.inputs-pysrc.html | 112 + ...tLight.inputs.ContinuousCenterInput-module.html | 169 + ...otLight.inputs.ContinuousCenterInput-pysrc.html | 126 + ...ousCenterInput.ContinuousCenterInput-class.html | 326 ++ ...ight.inputs.ContinuousLocationInput-module.html | 172 + ...Light.inputs.ContinuousLocationInput-pysrc.html | 133 + ...ocationInput.ContinuousLocationInput-class.html | 330 ++ html/SmootLight.inputs.HTMLInput-module.html | 169 + html/SmootLight.inputs.HTMLInput-pysrc.html | 142 + ...mootLight.inputs.HTMLInput.HTMLInput-class.html | 342 ++ html/SmootLight.inputs.OSCInput-module.html | 162 + html/SmootLight.inputs.OSCInput-pysrc.html | 179 + .../SmootLight.inputs.OSCInput.OSCInput-class.html | 346 ++ html/SmootLight.inputs.PygameInput-module.html | 1948 +++++++++++ html/SmootLight.inputs.PygameInput-pysrc.html | 160 + ...Light.inputs.PygameInput.PygameInput-class.html | 298 ++ html/SmootLight.inputs.RandomLocs-module.html | 171 + html/SmootLight.inputs.RandomLocs-pysrc.html | 130 + ...otLight.inputs.RandomLocs.RandomLocs-class.html | 330 ++ html/SmootLight.inputs.TCPInput-module.html | 163 + html/SmootLight.inputs.TCPInput-pysrc.html | 310 ++ .../SmootLight.inputs.TCPInput.TCPInput-class.html | 331 ++ html/SmootLight.inputs.TCPInput_backup-module.html | 130 + html/SmootLight.inputs.TCPInput_backup-pysrc.html | 163 + ...ight.inputs.TCPInput_backup.TCPInput-class.html | 204 ++ ...nput_backup.TCPInput.InputTCPHandler-class.html | 198 ++ html/SmootLight.inputs.UDPInput-module.html | 170 + html/SmootLight.inputs.UDPInput-pysrc.html | 130 + .../SmootLight.inputs.UDPInput.UDPInput-class.html | 330 ++ html/SmootLight.layouts-module.html | 155 + html/SmootLight.layouts-pysrc.html | 112 + html/SmootLight.layouts.LineLayout-module.html | 156 + html/SmootLight.layouts.LineLayout-pysrc.html | 118 + ...tLight.layouts.LineLayout.LineLayout-class.html | 260 ++ .../SmootLight.layouts.SpecifiedLayout-module.html | 156 + html/SmootLight.layouts.SpecifiedLayout-pysrc.html | 133 + ...outs.SpecifiedLayout.SpecifiedLayout-class.html | 309 ++ html/SmootLight.layouts.ZigzagLayout-module.html | 158 + html/SmootLight.layouts.ZigzagLayout-pysrc.html | 156 + ...ht.layouts.ZigzagLayout.ZigzagLayout-class.html | 308 ++ html/SmootLight.logger-module.html | 154 + html/SmootLight.logger-pysrc.html | 163 + html/SmootLight.logger.Logger-module.html | 151 + html/SmootLight.logger.Logger-pysrc.html | 181 ++ .../SmootLight.logger.UTF8LogFormatter-module.html | 155 + html/SmootLight.logger.UTF8LogFormatter-pysrc.html | 120 + ...er.UTF8LogFormatter.UTF8LogFormatter-class.html | 209 ++ html/SmootLight.operationscore-module.html | 160 + html/SmootLight.operationscore-pysrc.html | 112 + .../SmootLight.operationscore.Behavior-module.html | 156 + html/SmootLight.operationscore.Behavior-pysrc.html | 390 +++ ...ght.operationscore.Behavior.Behavior-class.html | 492 +++ html/SmootLight.operationscore.Input-module.html | 156 + html/SmootLight.operationscore.Input-pysrc.html | 271 ++ ...mootLight.operationscore.Input.Input-class.html | 390 +++ ...Light.operationscore.PixelAssembler-module.html | 155 + ...tLight.operationscore.PixelAssembler-pysrc.html | 151 + ...nscore.PixelAssembler.PixelAssembler-class.html | 313 ++ ...mootLight.operationscore.PixelEvent-module.html | 159 + ...SmootLight.operationscore.PixelEvent-pysrc.html | 149 + ...operationscore.PixelEvent.PixelEvent-class.html | 332 ++ ...ootLight.operationscore.PixelMapper-module.html | 156 + ...mootLight.operationscore.PixelMapper-pysrc.html | 231 ++ ...erationscore.PixelMapper.PixelMapper-class.html | 291 ++ .../SmootLight.operationscore.Renderer-module.html | 156 + html/SmootLight.operationscore.Renderer-pysrc.html | 128 + ...ght.operationscore.Renderer.Renderer-class.html | 285 ++ ...ight.operationscore.SmootCoreObject-module.html | 157 + ...Light.operationscore.SmootCoreObject-pysrc.html | 191 ++ ...core.SmootCoreObject.SmootCoreObject-class.html | 461 +++ ...rationscore.ThreadedSmootCoreObject-module.html | 157 + ...erationscore.ThreadedSmootCoreObject-pysrc.html | 143 + ...otCoreObject.ThreadedSmootCoreObject-class.html | 288 ++ html/SmootLight.pixelcore-module.html | 155 + html/SmootLight.pixelcore-pysrc.html | 112 + html/SmootLight.pixelcore.Pixel-module.html | 157 + html/SmootLight.pixelcore.Pixel-pysrc.html | 282 ++ html/SmootLight.pixelcore.Pixel.Pixel-class.html | 284 ++ html/SmootLight.pixelcore.PixelStrip-module.html | 163 + html/SmootLight.pixelcore.PixelStrip-pysrc.html | 135 + ...ight.pixelcore.PixelStrip.PixelStrip-class.html | 176 + html/SmootLight.pixelcore.Screen-module.html | 156 + html/SmootLight.pixelcore.Screen-pysrc.html | 345 ++ html/SmootLight.pixelcore.Screen.Screen-class.html | 324 ++ html/SmootLight.pixelevents-module.html | 156 + html/SmootLight.pixelevents-pysrc.html | 112 + html/SmootLight.pixelevents.DecayEvent-module.html | 157 + html/SmootLight.pixelevents.DecayEvent-pysrc.html | 144 + ...ht.pixelevents.DecayEvent.DecayEvent-class.html | 341 ++ ...tLight.pixelevents.SingleFrameEvent-module.html | 157 + ...otLight.pixelevents.SingleFrameEvent-pysrc.html | 126 + ...ts.SingleFrameEvent.SingleFrameEvent-class.html | 322 ++ html/SmootLight.pixelevents.StepEvent-module.html | 155 + html/SmootLight.pixelevents.StepEvent-pysrc.html | 127 + ...ight.pixelevents.StepEvent.StepEvent-class.html | 336 ++ ...ootLight.pixelevents.SynchTestEvent-module.html | 157 + ...mootLight.pixelevents.SynchTestEvent-pysrc.html | 128 + ...events.SynchTestEvent.SynchTestEvent-class.html | 322 ++ html/SmootLight.pixelmappers-module.html | 156 + html/SmootLight.pixelmappers-pysrc.html | 112 + ...mootLight.pixelmappers.C5SignMapper-module.html | 164 + ...SmootLight.pixelmappers.C5SignMapper-pysrc.html | 242 ++ ...xelmappers.C5SignMapper.C5SignMapper-class.html | 347 ++ ...otLight.pixelmappers.GaussianMapper-module.html | 164 + ...ootLight.pixelmappers.GaussianMapper-pysrc.html | 137 + ...appers.GaussianMapper.GaussianMapper-class.html | 268 ++ ...mootLight.pixelmappers.SimpleMapper-module.html | 164 + ...SmootLight.pixelmappers.SimpleMapper-pysrc.html | 162 + ...xelmappers.SimpleMapper.SimpleMapper-class.html | 268 ++ ...ght.pixelmappers.WindGaussianMapper-module.html | 162 + ...ight.pixelmappers.WindGaussianMapper-pysrc.html | 131 + ...indGaussianMapper.WindGaussianMapper-class.html | 262 ++ html/SmootLight.renderers-module.html | 154 + html/SmootLight.renderers-pysrc.html | 112 + ...SmootLight.renderers.IndoorRenderer-module.html | 163 + .../SmootLight.renderers.IndoorRenderer-pysrc.html | 151 + ...derers.IndoorRenderer.IndoorRenderer-class.html | 297 ++ ...SmootLight.renderers.PygameRenderer-module.html | 1935 +++++++++++ .../SmootLight.renderers.PygameRenderer-pysrc.html | 158 + ...derers.PygameRenderer.PygameRenderer-class.html | 298 ++ html/SmootLight.tests-module.html | 160 + html/SmootLight.tests-pysrc.html | 114 + html/SmootLight.tests.TestBQS'-module.html | 162 + html/SmootLight.tests.TestBQS'-pysrc.html | 160 + html/SmootLight.tests.TestBQS'.TestBQS-class.html | 383 +++ ...tLight.tests.TestComponentRegistry'-module.html | 155 + ...otLight.tests.TestComponentRegistry'-pysrc.html | 137 + ...onentRegistry'.TestComponentRegistry-class.html | 367 +++ ...SmootLight.tests.TestConfigLoaders'-module.html | 162 + .../SmootLight.tests.TestConfigLoaders'-pysrc.html | 160 + ...TestConfigLoaders'.TestConfigLoaders-class.html | 383 +++ ...SmootLight.tests.TestSwitchBehavior-module.html | 155 + .../SmootLight.tests.TestSwitchBehavior-pysrc.html | 285 ++ ...estSwitchBehavior.TestSwitchBehavior-class.html | 383 +++ html/SmootLight.tests.testosc-module.html | 204 ++ html/SmootLight.tests.testosc-pysrc.html | 149 + html/SmootLight.util-module.html | 162 + html/SmootLight.util-pysrc.html | 112 + ...SmootLight.util.BehaviorQuerySystem-module.html | 345 ++ .../SmootLight.util.BehaviorQuerySystem-pysrc.html | 159 + html/SmootLight.util.ColorOps-module.html | 288 ++ html/SmootLight.util.ColorOps-pysrc.html | 158 + html/SmootLight.util.ColorOps.Color-class.html | 241 ++ html/SmootLight.util.ComponentRegistry-module.html | 360 ++ html/SmootLight.util.ComponentRegistry-pysrc.html | 303 ++ html/SmootLight.util.Config-module.html | 496 +++ html/SmootLight.util.Config-pysrc.html | 718 ++++ html/SmootLight.util.Geo-module.html | 298 ++ html/SmootLight.util.Geo-pysrc.html | 154 + html/SmootLight.util.Geo.Location-class.html | 256 ++ html/SmootLight.util.NetworkOps-module.html | 181 ++ html/SmootLight.util.NetworkOps-pysrc.html | 222 ++ html/SmootLight.util.PacketComposition-module.html | 379 +++ html/SmootLight.util.PacketComposition-pysrc.html | 202 ++ html/SmootLight.util.Search-module.html | 203 ++ html/SmootLight.util.Search-pysrc.html | 134 + html/SmootLight.util.Strings-module.html | 151 + html/SmootLight.util.Strings-pysrc.html | 119 + html/SmootLight.util.TimeOps-module.html | 189 ++ html/SmootLight.util.TimeOps-pysrc.html | 132 + html/SmootLight.util.TimeOps.Stopwatch-class.html | 188 ++ html/api-objects.txt | 1178 +++++++ html/class-tree.html | 480 +++ html/crarr.png | Bin 0 -> 340 bytes html/epydoc.css | 322 ++ html/epydoc.js | 293 ++ html/exceptions.AssertionError-class.html | 293 ++ html/frames.html | 17 + html/help.html | 268 ++ html/identifier-index.html | 3421 ++++++++++++++++++++ html/index.html | 17 + html/module-tree.html | 248 ++ html/redirect.html | 38 + html/toc-SmootLight-module.html | 31 + html/toc-SmootLight.LightInstallation-module.html | 35 + html/toc-SmootLight.Profile-module.html | 31 + html/toc-SmootLight.TestAll-module.html | 32 + html/toc-SmootLight.TestProfile-module.html | 48 + html/toc-SmootLight.behaviors-module.html | 31 + ...-SmootLight.behaviors.AddPixelEvent-module.html | 33 + .../toc-SmootLight.behaviors.AllPixels-module.html | 34 + ...-SmootLight.behaviors.AllPixelsLeft-module.html | 34 + ...-SmootLight.behaviors.BehaviorChain-module.html | 33 + html/toc-SmootLight.behaviors.Circle-module.html | 34 + ...ight.behaviors.ColorChangerBehavior-module.html | 34 + ...toc-SmootLight.behaviors.ColorShift-module.html | 34 + ...-SmootLight.behaviors.ControllerOSC-module.html | 37 + ...-SmootLight.behaviors.DebugBehavior-module.html | 33 + ...-SmootLight.behaviors.DecayBehavior-module.html | 34 + ...c-SmootLight.behaviors.EchoBehavior-module.html | 34 + html/toc-SmootLight.behaviors.Expand-module.html | 34 + ...Light.behaviors.ExpandingColorZones-module.html | 33 + html/toc-SmootLight.behaviors.Flasher-module.html | 34 + html/toc-SmootLight.behaviors.MITDoors-module.html | 34 + ...Light.behaviors.MobileShakeBehavior-module.html | 34 + ...oc-SmootLight.behaviors.ModifyParam-module.html | 34 + ...-SmootLight.behaviors.ModulateColor-module.html | 34 + ...c-SmootLight.behaviors.MoveBehavior-module.html | 34 + ...c-SmootLight.behaviors.MrmrSetColor-module.html | 33 + html/toc-SmootLight.behaviors.Oval-module.html | 34 + ...aviors.RandomSetBrightColorBehavior-module.html | 34 + ...toc-SmootLight.behaviors.RandomWalk-module.html | 34 + ...SmootLight.behaviors.RecursiveDecay-module.html | 34 + ...-SmootLight.behaviors.ResponseMover-module.html | 34 + ...ootLight.behaviors.RestrictLocation-module.html | 34 + html/toc-SmootLight.behaviors.RiseFall-module.html | 34 + ...mootLight.behaviors.RunningBehavior-module.html | 34 + html/toc-SmootLight.behaviors.Sink-module.html | 34 + .../toc-SmootLight.behaviors.SmootWind-module.html | 34 + html/toc-SmootLight.behaviors.Square-module.html | 34 + ...SmootLight.behaviors.SwitchBehavior-module.html | 34 + .../toc-SmootLight.behaviors.SynchTest-module.html | 34 + ...toc-SmootLight.behaviors.TimeSwitch-module.html | 33 + html/toc-SmootLight.behaviors.TimedDie-module.html | 34 + html/toc-SmootLight.behaviors.Timeout-module.html | 34 + html/toc-SmootLight.behaviors.TouchOSC-module.html | 33 + ...oc-SmootLight.behaviors.VerticalBar-module.html | 34 + html/toc-SmootLight.behaviors.XYMove-module.html | 34 + html/toc-SmootLight.inputs-module.html | 31 + ...tLight.inputs.ContinuousCenterInput-module.html | 35 + ...ight.inputs.ContinuousLocationInput-module.html | 35 + html/toc-SmootLight.inputs.HTMLInput-module.html | 35 + html/toc-SmootLight.inputs.OSCInput-module.html | 34 + html/toc-SmootLight.inputs.PygameInput-module.html | 289 ++ html/toc-SmootLight.inputs.RandomLocs-module.html | 35 + html/toc-SmootLight.inputs.TCPInput-module.html | 34 + ...c-SmootLight.inputs.TCPInput_backup-module.html | 31 + html/toc-SmootLight.inputs.UDPInput-module.html | 35 + html/toc-SmootLight.layouts-module.html | 31 + html/toc-SmootLight.layouts.LineLayout-module.html | 33 + ...-SmootLight.layouts.SpecifiedLayout-module.html | 33 + ...toc-SmootLight.layouts.ZigzagLayout-module.html | 33 + html/toc-SmootLight.logger-module.html | 31 + html/toc-SmootLight.logger.Logger-module.html | 34 + ...-SmootLight.logger.UTF8LogFormatter-module.html | 33 + html/toc-SmootLight.operationscore-module.html | 31 + ...-SmootLight.operationscore.Behavior-module.html | 33 + ...toc-SmootLight.operationscore.Input-module.html | 33 + ...Light.operationscore.PixelAssembler-module.html | 33 + ...mootLight.operationscore.PixelEvent-module.html | 33 + ...ootLight.operationscore.PixelMapper-module.html | 33 + ...-SmootLight.operationscore.Renderer-module.html | 33 + ...ight.operationscore.SmootCoreObject-module.html | 33 + ...rationscore.ThreadedSmootCoreObject-module.html | 33 + html/toc-SmootLight.pixelcore-module.html | 31 + html/toc-SmootLight.pixelcore.Pixel-module.html | 33 + ...toc-SmootLight.pixelcore.PixelStrip-module.html | 34 + html/toc-SmootLight.pixelcore.Screen-module.html | 33 + html/toc-SmootLight.pixelevents-module.html | 31 + ...c-SmootLight.pixelevents.DecayEvent-module.html | 33 + ...tLight.pixelevents.SingleFrameEvent-module.html | 33 + ...oc-SmootLight.pixelevents.StepEvent-module.html | 33 + ...ootLight.pixelevents.SynchTestEvent-module.html | 33 + html/toc-SmootLight.pixelmappers-module.html | 31 + ...mootLight.pixelmappers.C5SignMapper-module.html | 34 + ...otLight.pixelmappers.GaussianMapper-module.html | 34 + ...mootLight.pixelmappers.SimpleMapper-module.html | 34 + ...ght.pixelmappers.WindGaussianMapper-module.html | 34 + html/toc-SmootLight.renderers-module.html | 31 + ...SmootLight.renderers.IndoorRenderer-module.html | 34 + ...SmootLight.renderers.PygameRenderer-module.html | 287 ++ html/toc-SmootLight.tests-module.html | 31 + html/toc-SmootLight.tests.TestBQS'-module.html | 34 + ...tLight.tests.TestComponentRegistry'-module.html | 33 + ...SmootLight.tests.TestConfigLoaders'-module.html | 34 + ...SmootLight.tests.TestSwitchBehavior-module.html | 33 + html/toc-SmootLight.tests.testosc-module.html | 35 + html/toc-SmootLight.util-module.html | 31 + ...SmootLight.util.BehaviorQuerySystem-module.html | 39 + html/toc-SmootLight.util.ColorOps-module.html | 41 + ...c-SmootLight.util.ComponentRegistry-module.html | 43 + html/toc-SmootLight.util.Config-module.html | 46 + html/toc-SmootLight.util.Geo-module.html | 41 + html/toc-SmootLight.util.NetworkOps-module.html | 34 + ...c-SmootLight.util.PacketComposition-module.html | 47 + html/toc-SmootLight.util.Search-module.html | 35 + html/toc-SmootLight.util.Strings-module.html | 34 + html/toc-SmootLight.util.TimeOps-module.html | 35 + html/toc-everything.html | 877 +++++ html/toc.html | 137 + 411 files changed, 77832 insertions(+) create mode 100644 html/SmootLight-module.html create mode 100644 html/SmootLight-pysrc.html create mode 100644 html/SmootLight.LightInstallation-module.html create mode 100644 html/SmootLight.LightInstallation-pysrc.html create mode 100644 html/SmootLight.LightInstallation.LightInstallation-class.html create mode 100644 html/SmootLight.Profile-module.html create mode 100644 html/SmootLight.Profile-pysrc.html create mode 100644 html/SmootLight.TestAll-module.html create mode 100644 html/SmootLight.TestAll-pysrc.html create mode 100644 html/SmootLight.TestProfile-module.html create mode 100644 html/SmootLight.TestProfile-pysrc.html create mode 100644 html/SmootLight.behaviors-module.html create mode 100644 html/SmootLight.behaviors-pysrc.html create mode 100644 html/SmootLight.behaviors.AddPixelEvent-module.html create mode 100644 html/SmootLight.behaviors.AddPixelEvent-pysrc.html create mode 100644 html/SmootLight.behaviors.AddPixelEvent.AddPixelEvent-class.html create mode 100644 html/SmootLight.behaviors.AllPixels-module.html create mode 100644 html/SmootLight.behaviors.AllPixels-pysrc.html create mode 100644 html/SmootLight.behaviors.AllPixels.AllPixels-class.html create mode 100644 html/SmootLight.behaviors.AllPixelsLeft-module.html create mode 100644 html/SmootLight.behaviors.AllPixelsLeft-pysrc.html create mode 100644 html/SmootLight.behaviors.AllPixelsLeft.AllPixelsLeft-class.html create mode 100644 html/SmootLight.behaviors.BehaviorChain-module.html create mode 100644 html/SmootLight.behaviors.BehaviorChain-pysrc.html create mode 100644 html/SmootLight.behaviors.BehaviorChain.BehaviorChain-class.html create mode 100644 html/SmootLight.behaviors.Circle-module.html create mode 100644 html/SmootLight.behaviors.Circle-pysrc.html create mode 100644 html/SmootLight.behaviors.Circle.Circle-class.html create mode 100644 html/SmootLight.behaviors.ColorChangerBehavior-module.html create mode 100644 html/SmootLight.behaviors.ColorChangerBehavior-pysrc.html create mode 100644 html/SmootLight.behaviors.ColorChangerBehavior.ColorChangerBehavior-class.html create mode 100644 html/SmootLight.behaviors.ColorShift-module.html create mode 100644 html/SmootLight.behaviors.ColorShift-pysrc.html create mode 100644 html/SmootLight.behaviors.ColorShift.ColorShift-class.html create mode 100644 html/SmootLight.behaviors.ControllerOSC-module.html create mode 100644 html/SmootLight.behaviors.ControllerOSC-pysrc.html create mode 100644 html/SmootLight.behaviors.ControllerOSC.ControllerOSC-class.html create mode 100644 html/SmootLight.behaviors.DebugBehavior-module.html create mode 100644 html/SmootLight.behaviors.DebugBehavior-pysrc.html create mode 100644 html/SmootLight.behaviors.DebugBehavior.DebugBehavior-class.html create mode 100644 html/SmootLight.behaviors.DecayBehavior-module.html create mode 100644 html/SmootLight.behaviors.DecayBehavior-pysrc.html create mode 100644 html/SmootLight.behaviors.DecayBehavior.DecayBehavior-class.html create mode 100644 html/SmootLight.behaviors.EchoBehavior-module.html create mode 100644 html/SmootLight.behaviors.EchoBehavior-pysrc.html create mode 100644 html/SmootLight.behaviors.EchoBehavior.EchoBehavior-class.html create mode 100644 html/SmootLight.behaviors.Expand-module.html create mode 100644 html/SmootLight.behaviors.Expand-pysrc.html create mode 100644 html/SmootLight.behaviors.Expand.Expand-class.html create mode 100644 html/SmootLight.behaviors.ExpandingColorZones-module.html create mode 100644 html/SmootLight.behaviors.ExpandingColorZones-pysrc.html create mode 100644 html/SmootLight.behaviors.ExpandingColorZones.ExpandingColorZones-class.html create mode 100644 html/SmootLight.behaviors.Flasher-module.html create mode 100644 html/SmootLight.behaviors.Flasher-pysrc.html create mode 100644 html/SmootLight.behaviors.Flasher.Flasher-class.html create mode 100644 html/SmootLight.behaviors.MITDoors-module.html create mode 100644 html/SmootLight.behaviors.MITDoors-pysrc.html create mode 100644 html/SmootLight.behaviors.MITDoors.MITDoors-class.html create mode 100644 html/SmootLight.behaviors.MobileShakeBehavior-module.html create mode 100644 html/SmootLight.behaviors.MobileShakeBehavior-pysrc.html create mode 100644 html/SmootLight.behaviors.MobileShakeBehavior.MobileShakeBehavior-class.html create mode 100644 html/SmootLight.behaviors.ModifyParam-module.html create mode 100644 html/SmootLight.behaviors.ModifyParam-pysrc.html create mode 100644 html/SmootLight.behaviors.ModifyParam.ModifyParam-class.html create mode 100644 html/SmootLight.behaviors.ModulateColor-module.html create mode 100644 html/SmootLight.behaviors.ModulateColor-pysrc.html create mode 100644 html/SmootLight.behaviors.ModulateColor.ColorShift-class.html create mode 100644 html/SmootLight.behaviors.MoveBehavior-module.html create mode 100644 html/SmootLight.behaviors.MoveBehavior-pysrc.html create mode 100644 html/SmootLight.behaviors.MoveBehavior.MoveBehavior-class.html create mode 100644 html/SmootLight.behaviors.MrmrSetColor-module.html create mode 100644 html/SmootLight.behaviors.MrmrSetColor-pysrc.html create mode 100644 html/SmootLight.behaviors.MrmrSetColor.MrmrSetColor-class.html create mode 100644 html/SmootLight.behaviors.Oval-module.html create mode 100644 html/SmootLight.behaviors.Oval-pysrc.html create mode 100644 html/SmootLight.behaviors.Oval.Oval-class.html create mode 100644 html/SmootLight.behaviors.RandomSetBrightColorBehavior-module.html create mode 100644 html/SmootLight.behaviors.RandomSetBrightColorBehavior-pysrc.html create mode 100644 html/SmootLight.behaviors.RandomSetBrightColorBehavior.RandomSetBrightColorBehavior-class.html create mode 100644 html/SmootLight.behaviors.RandomWalk-module.html create mode 100644 html/SmootLight.behaviors.RandomWalk-pysrc.html create mode 100644 html/SmootLight.behaviors.RandomWalk.RandomWalk-class.html create mode 100644 html/SmootLight.behaviors.RecursiveDecay-module.html create mode 100644 html/SmootLight.behaviors.RecursiveDecay-pysrc.html create mode 100644 html/SmootLight.behaviors.RecursiveDecay.RecursiveDecay-class.html create mode 100644 html/SmootLight.behaviors.ResponseMover-module.html create mode 100644 html/SmootLight.behaviors.ResponseMover-pysrc.html create mode 100644 html/SmootLight.behaviors.ResponseMover.ResponseMover-class.html create mode 100644 html/SmootLight.behaviors.RestrictLocation-module.html create mode 100644 html/SmootLight.behaviors.RestrictLocation-pysrc.html create mode 100644 html/SmootLight.behaviors.RestrictLocation.RestrictLocation-class.html create mode 100644 html/SmootLight.behaviors.RiseFall-module.html create mode 100644 html/SmootLight.behaviors.RiseFall-pysrc.html create mode 100644 html/SmootLight.behaviors.RiseFall.RiseFall-class.html create mode 100644 html/SmootLight.behaviors.RunningBehavior-module.html create mode 100644 html/SmootLight.behaviors.RunningBehavior-pysrc.html create mode 100644 html/SmootLight.behaviors.RunningBehavior.RunningBehavior-class.html create mode 100644 html/SmootLight.behaviors.Sink-module.html create mode 100644 html/SmootLight.behaviors.Sink-pysrc.html create mode 100644 html/SmootLight.behaviors.Sink.Sink-class.html create mode 100644 html/SmootLight.behaviors.SmootWind-module.html create mode 100644 html/SmootLight.behaviors.SmootWind-pysrc.html create mode 100644 html/SmootLight.behaviors.SmootWind.SmootWind-class.html create mode 100644 html/SmootLight.behaviors.Square-module.html create mode 100644 html/SmootLight.behaviors.Square-pysrc.html create mode 100644 html/SmootLight.behaviors.Square.Square-class.html create mode 100644 html/SmootLight.behaviors.SwitchBehavior-module.html create mode 100644 html/SmootLight.behaviors.SwitchBehavior-pysrc.html create mode 100644 html/SmootLight.behaviors.SwitchBehavior.SwitchBehavior-class.html create mode 100644 html/SmootLight.behaviors.SynchTest-module.html create mode 100644 html/SmootLight.behaviors.SynchTest-pysrc.html create mode 100644 html/SmootLight.behaviors.SynchTest.SynchTest-class.html create mode 100644 html/SmootLight.behaviors.TimeSwitch-module.html create mode 100644 html/SmootLight.behaviors.TimeSwitch-pysrc.html create mode 100644 html/SmootLight.behaviors.TimeSwitch.TimeSwitch-class.html create mode 100644 html/SmootLight.behaviors.TimedDie-module.html create mode 100644 html/SmootLight.behaviors.TimedDie-pysrc.html create mode 100644 html/SmootLight.behaviors.TimedDie.Timeout-class.html create mode 100644 html/SmootLight.behaviors.Timeout-module.html create mode 100644 html/SmootLight.behaviors.Timeout-pysrc.html create mode 100644 html/SmootLight.behaviors.Timeout.Timeout-class.html create mode 100644 html/SmootLight.behaviors.TouchOSC-module.html create mode 100644 html/SmootLight.behaviors.TouchOSC-pysrc.html create mode 100644 html/SmootLight.behaviors.TouchOSC.TouchOSC-class.html create mode 100644 html/SmootLight.behaviors.VerticalBar-module.html create mode 100644 html/SmootLight.behaviors.VerticalBar-pysrc.html create mode 100644 html/SmootLight.behaviors.VerticalBar.VerticalBar-class.html create mode 100644 html/SmootLight.behaviors.XYMove-module.html create mode 100644 html/SmootLight.behaviors.XYMove-pysrc.html create mode 100644 html/SmootLight.behaviors.XYMove.XYMove-class.html create mode 100644 html/SmootLight.inputs-module.html create mode 100644 html/SmootLight.inputs-pysrc.html create mode 100644 html/SmootLight.inputs.ContinuousCenterInput-module.html create mode 100644 html/SmootLight.inputs.ContinuousCenterInput-pysrc.html create mode 100644 html/SmootLight.inputs.ContinuousCenterInput.ContinuousCenterInput-class.html create mode 100644 html/SmootLight.inputs.ContinuousLocationInput-module.html create mode 100644 html/SmootLight.inputs.ContinuousLocationInput-pysrc.html create mode 100644 html/SmootLight.inputs.ContinuousLocationInput.ContinuousLocationInput-class.html create mode 100644 html/SmootLight.inputs.HTMLInput-module.html create mode 100644 html/SmootLight.inputs.HTMLInput-pysrc.html create mode 100644 html/SmootLight.inputs.HTMLInput.HTMLInput-class.html create mode 100644 html/SmootLight.inputs.OSCInput-module.html create mode 100644 html/SmootLight.inputs.OSCInput-pysrc.html create mode 100644 html/SmootLight.inputs.OSCInput.OSCInput-class.html create mode 100644 html/SmootLight.inputs.PygameInput-module.html create mode 100644 html/SmootLight.inputs.PygameInput-pysrc.html create mode 100644 html/SmootLight.inputs.PygameInput.PygameInput-class.html create mode 100644 html/SmootLight.inputs.RandomLocs-module.html create mode 100644 html/SmootLight.inputs.RandomLocs-pysrc.html create mode 100644 html/SmootLight.inputs.RandomLocs.RandomLocs-class.html create mode 100644 html/SmootLight.inputs.TCPInput-module.html create mode 100644 html/SmootLight.inputs.TCPInput-pysrc.html create mode 100644 html/SmootLight.inputs.TCPInput.TCPInput-class.html create mode 100644 html/SmootLight.inputs.TCPInput_backup-module.html create mode 100644 html/SmootLight.inputs.TCPInput_backup-pysrc.html create mode 100644 html/SmootLight.inputs.TCPInput_backup.TCPInput-class.html create mode 100644 html/SmootLight.inputs.TCPInput_backup.TCPInput.InputTCPHandler-class.html create mode 100644 html/SmootLight.inputs.UDPInput-module.html create mode 100644 html/SmootLight.inputs.UDPInput-pysrc.html create mode 100644 html/SmootLight.inputs.UDPInput.UDPInput-class.html create mode 100644 html/SmootLight.layouts-module.html create mode 100644 html/SmootLight.layouts-pysrc.html create mode 100644 html/SmootLight.layouts.LineLayout-module.html create mode 100644 html/SmootLight.layouts.LineLayout-pysrc.html create mode 100644 html/SmootLight.layouts.LineLayout.LineLayout-class.html create mode 100644 html/SmootLight.layouts.SpecifiedLayout-module.html create mode 100644 html/SmootLight.layouts.SpecifiedLayout-pysrc.html create mode 100644 html/SmootLight.layouts.SpecifiedLayout.SpecifiedLayout-class.html create mode 100644 html/SmootLight.layouts.ZigzagLayout-module.html create mode 100644 html/SmootLight.layouts.ZigzagLayout-pysrc.html create mode 100644 html/SmootLight.layouts.ZigzagLayout.ZigzagLayout-class.html create mode 100644 html/SmootLight.logger-module.html create mode 100644 html/SmootLight.logger-pysrc.html create mode 100644 html/SmootLight.logger.Logger-module.html create mode 100644 html/SmootLight.logger.Logger-pysrc.html create mode 100644 html/SmootLight.logger.UTF8LogFormatter-module.html create mode 100644 html/SmootLight.logger.UTF8LogFormatter-pysrc.html create mode 100644 html/SmootLight.logger.UTF8LogFormatter.UTF8LogFormatter-class.html create mode 100644 html/SmootLight.operationscore-module.html create mode 100644 html/SmootLight.operationscore-pysrc.html create mode 100644 html/SmootLight.operationscore.Behavior-module.html create mode 100644 html/SmootLight.operationscore.Behavior-pysrc.html create mode 100644 html/SmootLight.operationscore.Behavior.Behavior-class.html create mode 100644 html/SmootLight.operationscore.Input-module.html create mode 100644 html/SmootLight.operationscore.Input-pysrc.html create mode 100644 html/SmootLight.operationscore.Input.Input-class.html create mode 100644 html/SmootLight.operationscore.PixelAssembler-module.html create mode 100644 html/SmootLight.operationscore.PixelAssembler-pysrc.html create mode 100644 html/SmootLight.operationscore.PixelAssembler.PixelAssembler-class.html create mode 100644 html/SmootLight.operationscore.PixelEvent-module.html create mode 100644 html/SmootLight.operationscore.PixelEvent-pysrc.html create mode 100644 html/SmootLight.operationscore.PixelEvent.PixelEvent-class.html create mode 100644 html/SmootLight.operationscore.PixelMapper-module.html create mode 100644 html/SmootLight.operationscore.PixelMapper-pysrc.html create mode 100644 html/SmootLight.operationscore.PixelMapper.PixelMapper-class.html create mode 100644 html/SmootLight.operationscore.Renderer-module.html create mode 100644 html/SmootLight.operationscore.Renderer-pysrc.html create mode 100644 html/SmootLight.operationscore.Renderer.Renderer-class.html create mode 100644 html/SmootLight.operationscore.SmootCoreObject-module.html create mode 100644 html/SmootLight.operationscore.SmootCoreObject-pysrc.html create mode 100644 html/SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html create mode 100644 html/SmootLight.operationscore.ThreadedSmootCoreObject-module.html create mode 100644 html/SmootLight.operationscore.ThreadedSmootCoreObject-pysrc.html create mode 100644 html/SmootLight.operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject-class.html create mode 100644 html/SmootLight.pixelcore-module.html create mode 100644 html/SmootLight.pixelcore-pysrc.html create mode 100644 html/SmootLight.pixelcore.Pixel-module.html create mode 100644 html/SmootLight.pixelcore.Pixel-pysrc.html create mode 100644 html/SmootLight.pixelcore.Pixel.Pixel-class.html create mode 100644 html/SmootLight.pixelcore.PixelStrip-module.html create mode 100644 html/SmootLight.pixelcore.PixelStrip-pysrc.html create mode 100644 html/SmootLight.pixelcore.PixelStrip.PixelStrip-class.html create mode 100644 html/SmootLight.pixelcore.Screen-module.html create mode 100644 html/SmootLight.pixelcore.Screen-pysrc.html create mode 100644 html/SmootLight.pixelcore.Screen.Screen-class.html create mode 100644 html/SmootLight.pixelevents-module.html create mode 100644 html/SmootLight.pixelevents-pysrc.html create mode 100644 html/SmootLight.pixelevents.DecayEvent-module.html create mode 100644 html/SmootLight.pixelevents.DecayEvent-pysrc.html create mode 100644 html/SmootLight.pixelevents.DecayEvent.DecayEvent-class.html create mode 100644 html/SmootLight.pixelevents.SingleFrameEvent-module.html create mode 100644 html/SmootLight.pixelevents.SingleFrameEvent-pysrc.html create mode 100644 html/SmootLight.pixelevents.SingleFrameEvent.SingleFrameEvent-class.html create mode 100644 html/SmootLight.pixelevents.StepEvent-module.html create mode 100644 html/SmootLight.pixelevents.StepEvent-pysrc.html create mode 100644 html/SmootLight.pixelevents.StepEvent.StepEvent-class.html create mode 100644 html/SmootLight.pixelevents.SynchTestEvent-module.html create mode 100644 html/SmootLight.pixelevents.SynchTestEvent-pysrc.html create mode 100644 html/SmootLight.pixelevents.SynchTestEvent.SynchTestEvent-class.html create mode 100644 html/SmootLight.pixelmappers-module.html create mode 100644 html/SmootLight.pixelmappers-pysrc.html create mode 100644 html/SmootLight.pixelmappers.C5SignMapper-module.html create mode 100644 html/SmootLight.pixelmappers.C5SignMapper-pysrc.html create mode 100644 html/SmootLight.pixelmappers.C5SignMapper.C5SignMapper-class.html create mode 100644 html/SmootLight.pixelmappers.GaussianMapper-module.html create mode 100644 html/SmootLight.pixelmappers.GaussianMapper-pysrc.html create mode 100644 html/SmootLight.pixelmappers.GaussianMapper.GaussianMapper-class.html create mode 100644 html/SmootLight.pixelmappers.SimpleMapper-module.html create mode 100644 html/SmootLight.pixelmappers.SimpleMapper-pysrc.html create mode 100644 html/SmootLight.pixelmappers.SimpleMapper.SimpleMapper-class.html create mode 100644 html/SmootLight.pixelmappers.WindGaussianMapper-module.html create mode 100644 html/SmootLight.pixelmappers.WindGaussianMapper-pysrc.html create mode 100644 html/SmootLight.pixelmappers.WindGaussianMapper.WindGaussianMapper-class.html create mode 100644 html/SmootLight.renderers-module.html create mode 100644 html/SmootLight.renderers-pysrc.html create mode 100644 html/SmootLight.renderers.IndoorRenderer-module.html create mode 100644 html/SmootLight.renderers.IndoorRenderer-pysrc.html create mode 100644 html/SmootLight.renderers.IndoorRenderer.IndoorRenderer-class.html create mode 100644 html/SmootLight.renderers.PygameRenderer-module.html create mode 100644 html/SmootLight.renderers.PygameRenderer-pysrc.html create mode 100644 html/SmootLight.renderers.PygameRenderer.PygameRenderer-class.html create mode 100644 html/SmootLight.tests-module.html create mode 100644 html/SmootLight.tests-pysrc.html create mode 100644 html/SmootLight.tests.TestBQS'-module.html create mode 100644 html/SmootLight.tests.TestBQS'-pysrc.html create mode 100644 html/SmootLight.tests.TestBQS'.TestBQS-class.html create mode 100644 html/SmootLight.tests.TestComponentRegistry'-module.html create mode 100644 html/SmootLight.tests.TestComponentRegistry'-pysrc.html create mode 100644 html/SmootLight.tests.TestComponentRegistry'.TestComponentRegistry-class.html create mode 100644 html/SmootLight.tests.TestConfigLoaders'-module.html create mode 100644 html/SmootLight.tests.TestConfigLoaders'-pysrc.html create mode 100644 html/SmootLight.tests.TestConfigLoaders'.TestConfigLoaders-class.html create mode 100644 html/SmootLight.tests.TestSwitchBehavior-module.html create mode 100644 html/SmootLight.tests.TestSwitchBehavior-pysrc.html create mode 100644 html/SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior-class.html create mode 100644 html/SmootLight.tests.testosc-module.html create mode 100644 html/SmootLight.tests.testosc-pysrc.html create mode 100644 html/SmootLight.util-module.html create mode 100644 html/SmootLight.util-pysrc.html create mode 100644 html/SmootLight.util.BehaviorQuerySystem-module.html create mode 100644 html/SmootLight.util.BehaviorQuerySystem-pysrc.html create mode 100644 html/SmootLight.util.ColorOps-module.html create mode 100644 html/SmootLight.util.ColorOps-pysrc.html create mode 100644 html/SmootLight.util.ColorOps.Color-class.html create mode 100644 html/SmootLight.util.ComponentRegistry-module.html create mode 100644 html/SmootLight.util.ComponentRegistry-pysrc.html create mode 100644 html/SmootLight.util.Config-module.html create mode 100644 html/SmootLight.util.Config-pysrc.html create mode 100644 html/SmootLight.util.Geo-module.html create mode 100644 html/SmootLight.util.Geo-pysrc.html create mode 100644 html/SmootLight.util.Geo.Location-class.html create mode 100644 html/SmootLight.util.NetworkOps-module.html create mode 100644 html/SmootLight.util.NetworkOps-pysrc.html create mode 100644 html/SmootLight.util.PacketComposition-module.html create mode 100644 html/SmootLight.util.PacketComposition-pysrc.html create mode 100644 html/SmootLight.util.Search-module.html create mode 100644 html/SmootLight.util.Search-pysrc.html create mode 100644 html/SmootLight.util.Strings-module.html create mode 100644 html/SmootLight.util.Strings-pysrc.html create mode 100644 html/SmootLight.util.TimeOps-module.html create mode 100644 html/SmootLight.util.TimeOps-pysrc.html create mode 100644 html/SmootLight.util.TimeOps.Stopwatch-class.html create mode 100644 html/api-objects.txt create mode 100644 html/class-tree.html create mode 100644 html/crarr.png create mode 100644 html/epydoc.css create mode 100644 html/epydoc.js create mode 100644 html/exceptions.AssertionError-class.html create mode 100644 html/frames.html create mode 100644 html/help.html create mode 100644 html/identifier-index.html create mode 100644 html/index.html create mode 100644 html/module-tree.html create mode 100644 html/redirect.html create mode 100644 html/toc-SmootLight-module.html create mode 100644 html/toc-SmootLight.LightInstallation-module.html create mode 100644 html/toc-SmootLight.Profile-module.html create mode 100644 html/toc-SmootLight.TestAll-module.html create mode 100644 html/toc-SmootLight.TestProfile-module.html create mode 100644 html/toc-SmootLight.behaviors-module.html create mode 100644 html/toc-SmootLight.behaviors.AddPixelEvent-module.html create mode 100644 html/toc-SmootLight.behaviors.AllPixels-module.html create mode 100644 html/toc-SmootLight.behaviors.AllPixelsLeft-module.html create mode 100644 html/toc-SmootLight.behaviors.BehaviorChain-module.html create mode 100644 html/toc-SmootLight.behaviors.Circle-module.html create mode 100644 html/toc-SmootLight.behaviors.ColorChangerBehavior-module.html create mode 100644 html/toc-SmootLight.behaviors.ColorShift-module.html create mode 100644 html/toc-SmootLight.behaviors.ControllerOSC-module.html create mode 100644 html/toc-SmootLight.behaviors.DebugBehavior-module.html create mode 100644 html/toc-SmootLight.behaviors.DecayBehavior-module.html create mode 100644 html/toc-SmootLight.behaviors.EchoBehavior-module.html create mode 100644 html/toc-SmootLight.behaviors.Expand-module.html create mode 100644 html/toc-SmootLight.behaviors.ExpandingColorZones-module.html create mode 100644 html/toc-SmootLight.behaviors.Flasher-module.html create mode 100644 html/toc-SmootLight.behaviors.MITDoors-module.html create mode 100644 html/toc-SmootLight.behaviors.MobileShakeBehavior-module.html create mode 100644 html/toc-SmootLight.behaviors.ModifyParam-module.html create mode 100644 html/toc-SmootLight.behaviors.ModulateColor-module.html create mode 100644 html/toc-SmootLight.behaviors.MoveBehavior-module.html create mode 100644 html/toc-SmootLight.behaviors.MrmrSetColor-module.html create mode 100644 html/toc-SmootLight.behaviors.Oval-module.html create mode 100644 html/toc-SmootLight.behaviors.RandomSetBrightColorBehavior-module.html create mode 100644 html/toc-SmootLight.behaviors.RandomWalk-module.html create mode 100644 html/toc-SmootLight.behaviors.RecursiveDecay-module.html create mode 100644 html/toc-SmootLight.behaviors.ResponseMover-module.html create mode 100644 html/toc-SmootLight.behaviors.RestrictLocation-module.html create mode 100644 html/toc-SmootLight.behaviors.RiseFall-module.html create mode 100644 html/toc-SmootLight.behaviors.RunningBehavior-module.html create mode 100644 html/toc-SmootLight.behaviors.Sink-module.html create mode 100644 html/toc-SmootLight.behaviors.SmootWind-module.html create mode 100644 html/toc-SmootLight.behaviors.Square-module.html create mode 100644 html/toc-SmootLight.behaviors.SwitchBehavior-module.html create mode 100644 html/toc-SmootLight.behaviors.SynchTest-module.html create mode 100644 html/toc-SmootLight.behaviors.TimeSwitch-module.html create mode 100644 html/toc-SmootLight.behaviors.TimedDie-module.html create mode 100644 html/toc-SmootLight.behaviors.Timeout-module.html create mode 100644 html/toc-SmootLight.behaviors.TouchOSC-module.html create mode 100644 html/toc-SmootLight.behaviors.VerticalBar-module.html create mode 100644 html/toc-SmootLight.behaviors.XYMove-module.html create mode 100644 html/toc-SmootLight.inputs-module.html create mode 100644 html/toc-SmootLight.inputs.ContinuousCenterInput-module.html create mode 100644 html/toc-SmootLight.inputs.ContinuousLocationInput-module.html create mode 100644 html/toc-SmootLight.inputs.HTMLInput-module.html create mode 100644 html/toc-SmootLight.inputs.OSCInput-module.html create mode 100644 html/toc-SmootLight.inputs.PygameInput-module.html create mode 100644 html/toc-SmootLight.inputs.RandomLocs-module.html create mode 100644 html/toc-SmootLight.inputs.TCPInput-module.html create mode 100644 html/toc-SmootLight.inputs.TCPInput_backup-module.html create mode 100644 html/toc-SmootLight.inputs.UDPInput-module.html create mode 100644 html/toc-SmootLight.layouts-module.html create mode 100644 html/toc-SmootLight.layouts.LineLayout-module.html create mode 100644 html/toc-SmootLight.layouts.SpecifiedLayout-module.html create mode 100644 html/toc-SmootLight.layouts.ZigzagLayout-module.html create mode 100644 html/toc-SmootLight.logger-module.html create mode 100644 html/toc-SmootLight.logger.Logger-module.html create mode 100644 html/toc-SmootLight.logger.UTF8LogFormatter-module.html create mode 100644 html/toc-SmootLight.operationscore-module.html create mode 100644 html/toc-SmootLight.operationscore.Behavior-module.html create mode 100644 html/toc-SmootLight.operationscore.Input-module.html create mode 100644 html/toc-SmootLight.operationscore.PixelAssembler-module.html create mode 100644 html/toc-SmootLight.operationscore.PixelEvent-module.html create mode 100644 html/toc-SmootLight.operationscore.PixelMapper-module.html create mode 100644 html/toc-SmootLight.operationscore.Renderer-module.html create mode 100644 html/toc-SmootLight.operationscore.SmootCoreObject-module.html create mode 100644 html/toc-SmootLight.operationscore.ThreadedSmootCoreObject-module.html create mode 100644 html/toc-SmootLight.pixelcore-module.html create mode 100644 html/toc-SmootLight.pixelcore.Pixel-module.html create mode 100644 html/toc-SmootLight.pixelcore.PixelStrip-module.html create mode 100644 html/toc-SmootLight.pixelcore.Screen-module.html create mode 100644 html/toc-SmootLight.pixelevents-module.html create mode 100644 html/toc-SmootLight.pixelevents.DecayEvent-module.html create mode 100644 html/toc-SmootLight.pixelevents.SingleFrameEvent-module.html create mode 100644 html/toc-SmootLight.pixelevents.StepEvent-module.html create mode 100644 html/toc-SmootLight.pixelevents.SynchTestEvent-module.html create mode 100644 html/toc-SmootLight.pixelmappers-module.html create mode 100644 html/toc-SmootLight.pixelmappers.C5SignMapper-module.html create mode 100644 html/toc-SmootLight.pixelmappers.GaussianMapper-module.html create mode 100644 html/toc-SmootLight.pixelmappers.SimpleMapper-module.html create mode 100644 html/toc-SmootLight.pixelmappers.WindGaussianMapper-module.html create mode 100644 html/toc-SmootLight.renderers-module.html create mode 100644 html/toc-SmootLight.renderers.IndoorRenderer-module.html create mode 100644 html/toc-SmootLight.renderers.PygameRenderer-module.html create mode 100644 html/toc-SmootLight.tests-module.html create mode 100644 html/toc-SmootLight.tests.TestBQS'-module.html create mode 100644 html/toc-SmootLight.tests.TestComponentRegistry'-module.html create mode 100644 html/toc-SmootLight.tests.TestConfigLoaders'-module.html create mode 100644 html/toc-SmootLight.tests.TestSwitchBehavior-module.html create mode 100644 html/toc-SmootLight.tests.testosc-module.html create mode 100644 html/toc-SmootLight.util-module.html create mode 100644 html/toc-SmootLight.util.BehaviorQuerySystem-module.html create mode 100644 html/toc-SmootLight.util.ColorOps-module.html create mode 100644 html/toc-SmootLight.util.ComponentRegistry-module.html create mode 100644 html/toc-SmootLight.util.Config-module.html create mode 100644 html/toc-SmootLight.util.Geo-module.html create mode 100644 html/toc-SmootLight.util.NetworkOps-module.html create mode 100644 html/toc-SmootLight.util.PacketComposition-module.html create mode 100644 html/toc-SmootLight.util.Search-module.html create mode 100644 html/toc-SmootLight.util.Strings-module.html create mode 100644 html/toc-SmootLight.util.TimeOps-module.html create mode 100644 html/toc-everything.html create mode 100644 html/toc.html diff --git a/html/SmootLight-module.html b/html/SmootLight-module.html new file mode 100644 index 0000000..62f8252 --- /dev/null +++ b/html/SmootLight-module.html @@ -0,0 +1,291 @@ + + + + + SmootLight + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Package SmootLight

source code

+ + + + + + + +
+ + + + + +
Submodules[hide private]
+
+
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = None +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight-pysrc.html b/html/SmootLight-pysrc.html new file mode 100644 index 0000000..e84b68c --- /dev/null +++ b/html/SmootLight-pysrc.html @@ -0,0 +1,111 @@ + + + + + SmootLight + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Package SmootLight

+
+1   
+2   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.LightInstallation-module.html b/html/SmootLight.LightInstallation-module.html new file mode 100644 index 0000000..67eedbc --- /dev/null +++ b/html/SmootLight.LightInstallation-module.html @@ -0,0 +1,188 @@ + + + + + SmootLight.LightInstallation + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Module LightInstallation + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module LightInstallation

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + LightInstallation +
+ + + + + + + + + +
+ + + + + +
Functions[hide private]
+
+   + + + + + + +
main(argv) + source code + +
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.LightInstallation-pysrc.html b/html/SmootLight.LightInstallation-pysrc.html new file mode 100644 index 0000000..7448dbc --- /dev/null +++ b/html/SmootLight.LightInstallation-pysrc.html @@ -0,0 +1,930 @@ + + + + + SmootLight.LightInstallation + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Module LightInstallation + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.LightInstallation

+
+  1  #!/usr/bin/python 
+  2   
+  3  from xml.etree.ElementTree import ElementTree 
+  4  from pixelcore.Screen import *  
+  5  from pixelcore.PixelStrip import * 
+  6  import pdb, sys, time, thread 
+  7  import util.TimeOps as clock 
+  8  import util.Config as configGetter  
+  9  import util.ComponentRegistry as compReg 
+ 10  import util.BehaviorQuerySystem as bqs 
+ 11  from logger import main_log 
+ 12  #Python class to instantiate and drive a Screen through different patterns, 
+ 13  #and effects. 
+
14 -class LightInstallation(object): +
15 - def __init__(self, configFileName): +
16 main_log.info("System Initialization began based on: " + str(configFileName)) + 17 self.timer = clock.Stopwatch() + 18 self.timer.start() + 19 self.inputs = {} #dict of inputs and their bound behaviors, keyed by InputId + 20 self.behaviors = {} + 21 self.lock = thread.allocate_lock() + 22 self.behaviorOutputs = {} #key: [list of output destinations] + 23 self.behaviorInputs = {} + 24 self.componentDict = {} + 25 self.inputBehaviorRegistry = {} #inputid -> behaviors listening to that + 26 self.dieNow = False + 27 #input + 28 self.screen = Screen() + 29 compReg.initRegistry() + 30 compReg.registerComponent(self.screen, 'Screen') #TODO: move to constants file + 31 + 32 bqs.initBQS() #initialize the behavior query system + 33 #read configs from xml + 34 config = configGetter.loadConfigFile(configFileName) + 35 + 36 rendererConfig = config.find('RendererConfiguration') + 37 self.initializeRenderers(rendererConfig) + 38 + 39 pixelConfig = config.find('PixelConfiguration') + 40 self.initializeScreen(pixelConfig) + 41 + 42 inputConfig = config.find('InputConfiguration') + 43 self.initializeInputs(inputConfig) + 44 + 45 behaviorConfig = config.find('BehaviorConfiguration') + 46 self.initializeBehaviors(behaviorConfig) + 47 + 48 mapperConfig = config.find('PixelMapperConfiguration') + 49 self.initializeMapper(mapperConfig) + 50 + 51 #inits + 52 main_log.info('All components initialized') + 53 # + 54 self.registerAllComponents() + 55 + 56 installationConfig = config.find('InstallationConfiguration') + 57 self.configureInstallation(installationConfig) + 58 #Done initializing. Lets start this thing! + 59 self.timer.stop() + 60 #main_log.info('Initialization done. Time: ', self.timer.elapsed(), 'ms') + 61 self.mainLoop() +
62 +
63 - def registerAllComponents(self): +
64 #registration in dict + 65 self.registerComponents(self.renderers) + 66 self.registerComponents(self.inputs) + 67 self.registerComponents(self.behaviors) + 68 self.registerComponents(self.mappers) +
69 + 70 +
71 - def configureInstallation(self, installationConfig): +
72 defaults = configGetter.generateArgDict(installationConfig.find('Defaults')) + 73 for defaultSelection in defaults: + 74 componentToMap = compReg.getComponent(defaults[defaultSelection]) + 75 compReg.registerComponent(compReg.getComponent(defaults[defaultSelection]),\ + 76 'Default'+defaultSelection) + 77 main_log.debug('Default Set: ' + defaultSelection + 'set to ' +\ + 78 defaults[defaultSelection]) +
79 +
80 - def initializeMapper(self, mapperConfig): +
81 self.mappers = self.initializeComponent(mapperConfig) +
82 +
83 - def initializeScreen(self, layoutConfig): +
84 pixelAssemblers = self.initializeComponent(layoutConfig) + 85 [self.addPixelStrip(l) for l in pixelAssemblers] +
86 +
87 - def addPixelStrip(self, layoutEngine): +
88 pixelStrip = PixelStrip(layoutEngine) + 89 self.screen.addStrip(pixelStrip) +
90 +
91 - def initializeInputs(self, inputConfig): +
92 inputs = self.initializeComponent(inputConfig) + 93 self.inputs = inputs + 94 for inputClass in inputs: + 95 inputClass.start() + 96 self.inputBehaviorRegistry[inputClass['Id']] = [] #Bound behaviors will be added to this +
97 #list + 98 +
99 - def initializeRenderers(self, rendererConfig): +
100 self.renderers = self.initializeComponent(rendererConfig) +
101 +
102 - def registerComponents(self, components): +
103 for component in components: +104 cid = compReg.registerComponent(component) +105 main_log.info(cid + ' registered') +
106 - def initializeComponent(self, config): +
107 components = [] +108 if config != None: +109 for configItem in config.getchildren(): +110 try: +111 [module,className] = configItem.find('Class').text.split('.') +112 except: +113 main_log.error('Module must have Class element') +114 continue +115 try: +116 exec('from ' + module+'.'+className + ' import *') +117 main_log.debug(module +'.' +className + 'imported') +118 except Exception as inst: +119 main_log.error('Error importing ' + module+'.'+className+ '. Component not\ +120 initialized.') +121 main_log.error(str(inst)) +122 continue +123 args = configGetter.pullArgsFromItem(configItem) +124 args['parentScope'] = self +125 try: +126 new_component = eval(className+'(args)') +127 new_component.addDieListener(self) +128 components.append(new_component) +129 main_log.info(className + 'initialized with args ' + str(args)) +130 except Exception as inst: +131 main_log.error('Failure while initializing ' + className + ' with ' + str(args)) +132 main_log.error(str(inst)) +133 +134 return components +
135 +
136 - def alive(self): +
137 return True +
138 +
139 - def mainLoop(self): +
140 lastLoopTime = clock.time() +141 refreshInterval = 30 +142 while not self.dieNow: #dieNow is set if one of its constituents sends a die request. +143 loopStart = clock.time() +144 responses = self.evaluateBehaviors() +145 self.timer.start() +146 [self.screen.respond(response) for response in responses if +147 response != []] +148 self.screen.timeStep(loopStart) +149 [r.render(self.screen, loopStart) for r in self.renderers] +150 loopElapsed = clock.time()-loopStart +151 sleepTime = max(0,refreshInterval-loopElapsed) +152 main_log.debug('Loop complete in ' + str(loopElapsed) + 'ms. Sleeping for ' +\ +153 str(sleepTime)) +154 self.timer.stop() +155 if sleepTime > 0: +156 time.sleep(sleepTime/1000) +
157 +
158 - def evaluateBehaviors(self): +
159 """Evaluates all the behaviors (including inter-dependencies) and returns a list of responses to +160 go to the screen""" +161 responses = {} +162 responses['Screen'] = [] #responses to the screen +163 for behavior in self.behaviors: +164 if behavior['RenderToScreen'] == True: +165 responses[behavior['Id']] = behavior.timeStep() +166 responses['Screen'] += responses[behavior['Id']] +167 return responses['Screen'] +
168 +
169 - def initializeBehaviors(self, behaviorConfig): +
170 self.behaviors = self.initializeComponent(behaviorConfig) +171 for behavior in self.behaviors: +172 self.addBehavior(behavior) +173 bqs.addBehavior(behavior) +
174 +
175 - def addBehavior(self, behavior): +
176 """Does work needed to add a behavior: currently -- maps behavior inputs into the input behavior +177 registry""" +178 for inputId in behavior.argDict['Inputs']: +179 if inputId in self.inputBehaviorRegistry: #it could be a behavior +180 self.inputBehaviorRegistry[inputId].append(behavior['Id']) +
181 +
182 - def processResponse(self,inputDict, responseDict): +
183 inputId = inputDict['Id'] +184 boundBehaviorIds = self.inputBehaviorRegistry[inputId] +185 try: +186 [compReg.getComponent(b).addInput(responseDict) for b in boundBehaviorIds] +187 except: +188 pass +
189 #Behavior run before loading. Not a big deal. +190 +
191 - def handleDie(self, caller): +
192 self.dieNow = True +
193 +
194 -def main(argv): +
195 if len(argv) == 1: +196 l = LightInstallation('config/6thFloor.xml') +197 else: +198 l = LightInstallation(argv[1]) +
199 +200 if __name__ == "__main__": +201 try: +202 main(sys.argv) +203 except KeyboardInterrupt: +204 main_log.info('Terminated by keyboard.') +205 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.LightInstallation.LightInstallation-class.html b/html/SmootLight.LightInstallation.LightInstallation-class.html new file mode 100644 index 0000000..380c053 --- /dev/null +++ b/html/SmootLight.LightInstallation.LightInstallation-class.html @@ -0,0 +1,509 @@ + + + + + SmootLight.LightInstallation.LightInstallation + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Module LightInstallation :: + Class LightInstallation + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class LightInstallation

source code

+
+object --+
+         |
+        LightInstallation
+
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
__init__(self, + configFileName)
+ x.__init__(...) initializes x; see x.__class__.__doc__ for signature
+ source code + +
+ +
+   + + + + + + +
registerAllComponents(self) + source code + +
+ +
+   + + + + + + +
configureInstallation(self, + installationConfig) + source code + +
+ +
+   + + + + + + +
initializeMapper(self, + mapperConfig) + source code + +
+ +
+   + + + + + + +
initializeScreen(self, + layoutConfig) + source code + +
+ +
+   + + + + + + +
addPixelStrip(self, + layoutEngine) + source code + +
+ +
+   + + + + + + +
initializeInputs(self, + inputConfig) + source code + +
+ +
+   + + + + + + +
initializeRenderers(self, + rendererConfig) + source code + +
+ +
+   + + + + + + +
registerComponents(self, + components) + source code + +
+ +
+   + + + + + + +
initializeComponent(self, + config) + source code + +
+ +
+   + + + + + + +
alive(self) + source code + +
+ +
+   + + + + + + +
mainLoop(self) + source code + +
+ +
+   + + + + + + +
evaluateBehaviors(self)
+ Evaluates all the behaviors (including inter-dependencies) and + returns a list of responses to go to the screen
+ source code + +
+ +
+   + + + + + + +
initializeBehaviors(self, + behaviorConfig) + source code + +
+ +
+   + + + + + + +
addBehavior(self, + behavior)
+ Does work needed to add a behavior: currently -- maps behavior inputs + into the input behavior registry
+ source code + +
+ +
+   + + + + + + +
processResponse(self, + inputDict, + responseDict) + source code + +
+ +
+   + + + + + + +
handleDie(self, + caller) + source code + +
+ +
+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

__init__(self, + configFileName) +
(Constructor) +

+
source code  +
+ +

x.__init__(...) initializes x; see x.__class__.__doc__ for + signature

+
+
Overrides: + object.__init__ +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.Profile-module.html b/html/SmootLight.Profile-module.html new file mode 100644 index 0000000..39a7dd2 --- /dev/null +++ b/html/SmootLight.Profile-module.html @@ -0,0 +1,129 @@ + + + + + SmootLight.Profile + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Module Profile + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Profile

source code

+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + command = """main(['', 'config/6thFloorOSC.xml'])""" +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.Profile-pysrc.html b/html/SmootLight.Profile-pysrc.html new file mode 100644 index 0000000..7be9a28 --- /dev/null +++ b/html/SmootLight.Profile-pysrc.html @@ -0,0 +1,118 @@ + + + + + SmootLight.Profile + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Module Profile + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.Profile

+
+1  import cProfile 
+2  from LightInstallation import main 
+3  command = """main(['', 'config/6thFloorOSC.xml'])""" 
+4  cProfile.runctx(command, globals(), locals(), filename="smootlight.profile") 
+5   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.TestAll-module.html b/html/SmootLight.TestAll-module.html new file mode 100644 index 0000000..9c3efe8 --- /dev/null +++ b/html/SmootLight.TestAll-module.html @@ -0,0 +1,189 @@ + + + + + SmootLight.TestAll + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Module TestAll + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module TestAll

source code

+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + testSuite = <unittest.TestSuite tests=[<unittest.TestSuite tes... +
+   + + __package__ = 'SmootLight' +
+ + + + + + +
+ + + + + +
Variables Details[hide private]
+
+ +
+ +
+

testSuite

+ +
+
+
+
Value:
+
+<unittest.TestSuite tests=[<unittest.TestSuite tests=[<SmootLight.test\
+s.TestBQS.TestBQS testMethod=test_complex_queries>, <SmootLight.tests.\
+TestBQS.TestBQS testMethod=test_dist_query>, <SmootLight.tests.TestBQS\
+.TestBQS testMethod=test_simple_query>]>, <unittest.TestSuite tests=[<\
+SmootLight.tests.TestComponentRegistry.TestComponentRegistry testMetho\
+d=test_register_component_id_specified>, <SmootLight.tests.TestCompone\
+ntRegistry.TestComponentRegistry testMethod=test_register_new_id>]>, <\
+unittest.TestSuite tests=[<SmootLight.tests.TestConfigLoaders.TestConf\
+...
+
+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.TestAll-pysrc.html b/html/SmootLight.TestAll-pysrc.html new file mode 100644 index 0000000..3af17a9 --- /dev/null +++ b/html/SmootLight.TestAll-pysrc.html @@ -0,0 +1,117 @@ + + + + + SmootLight.TestAll + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Module TestAll + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.TestAll

+
+1  import unittest 
+2  from unittest import TestLoader 
+3  import tests 
+4   
+5  testSuite = TestLoader().loadTestsFromModule(tests) 
+6  unittest.TextTestRunner(verbosity=2).run(testSuite) 
+7   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.TestProfile-module.html b/html/SmootLight.TestProfile-module.html new file mode 100644 index 0000000..410caa9 --- /dev/null +++ b/html/SmootLight.TestProfile-module.html @@ -0,0 +1,376 @@ + + + + + SmootLight.TestProfile + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Module TestProfile + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module TestProfile

source code

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Functions[hide private]
+
+   + + + + + + +
main1() + source code + +
+ +
+   + + + + + + +
main2() + source code + +
+ +
+   + + + + + + +
abc1() + source code + +
+ +
+   + + + + + + +
abc2() + source code + +
+ +
+   + + + + + + +
strucpack() + source code + +
+ +
+   + + + + + + +
dictlookup() + source code + +
+ +
+   + + + + + + +
dist1() + source code + +
+ +
+   + + + + + + +
dist2() + source code + +
+ +
+   + + + + + + +
exptest() + source code + +
+ +
+   + + + + + + +
expapprox() + source code + +
+ +
+   + + + + + + +
normal_python() + source code + +
+ +
+   + + + + + + +
weave_outloop() + source code + +
+ +
+   + + + + + + +
weave_inloop() + source code + +
+ +
+ + + + + + + + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + numiter = 1000000 +
+   + + x = [1, 2, 3] +
+   + + a = [] +
+   + + command = """weave_inloop()""" +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.TestProfile-pysrc.html b/html/SmootLight.TestProfile-pysrc.html new file mode 100644 index 0000000..fbe0329 --- /dev/null +++ b/html/SmootLight.TestProfile-pysrc.html @@ -0,0 +1,206 @@ + + + + + SmootLight.TestProfile + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Module TestProfile + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.TestProfile

+
+ 1  import cProfile 
+ 2  import struct 
+ 3  import random 
+ 4  import scipy.weave as weave 
+ 5  import math 
+ 6  #from LightInstallation import main 
+ 7  numiter = 1000000 
+
8 -def main1(): +
9 for i in xrange(0,numiter): +10 if 'abc' == 'def': +11 pass +12 if 'abc' == 'abc': +13 pass +
14 +
15 -def main2(): +
16 for i in xrange(0,numiter): +17 if 1 == 2: +18 pass +19 if 1 == 1: +20 pass +
21 +22 x = [1,2,3] +23 a = [] +
24 -def abc1(): +
25 for i in range(0,numiter): +26 a = min(4, 255) +27 b = min(257, 255) +
28 +
29 -def abc2(): +
30 for i in range(0,numiter): +31 a = 4 if 4 < 255 else 255 +32 b = 257 if 257 < 255 else 255 +
33 -def strucpack(): +
34 for i in xrange(0,numiter): +35 b = struct.pack('B', random.randint(0,255)) +
36 -def dictlookup(): +
37 lookup = {} +38 for i in xrange(0,256): +39 lookup[i] = struct.pack('B', random.randint(0,255)) +40 for i in xrange(0,numiter): +41 b = lookup[random.randint(0,255)] +
42 -def dist1(): +
43 l1 = [21.43, 5423.123] +44 l2 = [123, 12312345] +45 for i in xrange(0,numiter): +46 d = math.sqrt(sum([(l1[i]-l2[i])**2 for i in range(len(l1))])) +
47 -def dist2(): +
48 l1 = [21.43, 5423.123] +49 l2 = [123, 12312345] +50 for i in xrange(0,numiter): +51 d = math.sqrt((l1[0]-l2[0])**2+(l1[1]-l2[1])**2) +
52 -def exptest(): +
53 for i in xrange(0, numiter): +54 a = math.exp(-1) +55 print a +
56 -def expapprox(): +
57 for i in xrange(0, numiter): +58 a = 1+-1+(-1)**2/float(2) +59 print a +
60 +
61 -def normal_python(): +
62 for i in xrange(0,numiter): +63 a = math.sqrt(3 + 4 + 5) +
64 +
65 -def weave_outloop(): +
66 code = """ +67 float x = 0; +68 for (int i = 0;i < numiter;i++) { +69 x = sqrt(3 + 4 + 5); +70 } +71 """ +72 weave.inline(code, ['numiter']) +
73 +
74 -def weave_inloop(): +
75 code = """ +76 x = sqrt(3 + 4 + 5); +77 """ +78 x = 0.0 +79 for i in xrange(0,numiter): +80 weave.inline(code, ['x']) +
81 +82 command = """normal_python()""" +83 cProfile.runctx(command, globals(), locals()) +84 +85 command = """weave_outloop()""" +86 cProfile.runctx(command, globals(), locals()) +87 +88 command = """weave_inloop()""" +89 cProfile.runctx(command, globals(), locals()) +90 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors-module.html b/html/SmootLight.behaviors-module.html new file mode 100644 index 0000000..d3cd7b1 --- /dev/null +++ b/html/SmootLight.behaviors-module.html @@ -0,0 +1,191 @@ + + + + + SmootLight.behaviors + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Package behaviors

source code

+ + + + + + + +
+ + + + + +
Submodules[hide private]
+
+
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = None +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors-pysrc.html b/html/SmootLight.behaviors-pysrc.html new file mode 100644 index 0000000..d5d80f7 --- /dev/null +++ b/html/SmootLight.behaviors-pysrc.html @@ -0,0 +1,112 @@ + + + + + SmootLight.behaviors + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Package SmootLight.behaviors

+
+1   
+2   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.AddPixelEvent-module.html b/html/SmootLight.behaviors.AddPixelEvent-module.html new file mode 100644 index 0000000..57ff931 --- /dev/null +++ b/html/SmootLight.behaviors.AddPixelEvent-module.html @@ -0,0 +1,157 @@ + + + + + SmootLight.behaviors.AddPixelEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module AddPixelEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module AddPixelEvent

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + AddPixelEvent
+ AddPixelEvent is a behavior to append an arbitrary PixelEvent to a + behavior response. +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.AddPixelEvent-pysrc.html b/html/SmootLight.behaviors.AddPixelEvent-pysrc.html new file mode 100644 index 0000000..b1d5c60 --- /dev/null +++ b/html/SmootLight.behaviors.AddPixelEvent-pysrc.html @@ -0,0 +1,271 @@ + + + + + SmootLight.behaviors.AddPixelEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module AddPixelEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.AddPixelEvent

+
+ 1  from operationscore.Behavior import * 
+ 2  import util.Strings as Strings 
+ 3  from logger import main_log 
+
4 -class AddPixelEvent(Behavior): +
5 """AddPixelEvent is a behavior to append an arbitrary PixelEvent to a behavior response. The + 6 classname of the PixelEvent should be specified in the Class field of Args. All arguments normally + 7 passed to the PixelEvent should also be specified in Args.""" +
8 - def behaviorInit(self): +
9 [module, className] = self['Class'].split('.') +10 try: +11 exec('from ' + module+'.'+className + ' import *', globals()) +12 except Exception as inst: +13 main_log.error('Error importing ' + module+'.'+className+ '. Component not\ +14 initialized.') +15 main_log.error(str(inst)) +16 self.eventGenerator = eval('lambda args:'+className+'(args)') +
17 +18 #^lambda function to do generate new event (takes args) +19 +
20 - def processResponse(self, sensors, recurses): +
21 ret = [] +22 for sensory in sensors: +23 outDict = {} +24 outDict[Strings.LOCATION] = sensory[Strings.LOCATION] +25 settingsDict = dict(self.argDict) +26 settingsDict['Color'] = sensory['Color'] +27 outDict['PixelEvent'] = self.eventGenerator(settingsDict) +28 ret.append(outDict) +29 return (ret, recurses) +
30 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.AddPixelEvent.AddPixelEvent-class.html b/html/SmootLight.behaviors.AddPixelEvent.AddPixelEvent-class.html new file mode 100644 index 0000000..b595071 --- /dev/null +++ b/html/SmootLight.behaviors.AddPixelEvent.AddPixelEvent-class.html @@ -0,0 +1,333 @@ + + + + + SmootLight.behaviors.AddPixelEvent.AddPixelEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module AddPixelEvent :: + Class AddPixelEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class AddPixelEvent

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    AddPixelEvent
+
+ +
+

AddPixelEvent is a behavior to append an arbitrary PixelEvent to a + behavior response. The classname of the PixelEvent should be specified + in the Class field of Args. All arguments normally passed to the + PixelEvent should also be specified in Args.

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
behaviorInit(self) + source code + +
+ +
+   + + + + + + +
processResponse(self, + sensors, + recurses) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

behaviorInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.behaviorInit +
+
+
+
+ +
+ +
+ + +
+

processResponse(self, + sensors, + recurses) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.AllPixels-module.html b/html/SmootLight.behaviors.AllPixels-module.html new file mode 100644 index 0000000..777f7b1 --- /dev/null +++ b/html/SmootLight.behaviors.AllPixels-module.html @@ -0,0 +1,163 @@ + + + + + SmootLight.behaviors.AllPixels + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module AllPixels + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module AllPixels

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + AllPixels
+ Turns on all Pixels in the installation. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.AllPixels-pysrc.html b/html/SmootLight.behaviors.AllPixels-pysrc.html new file mode 100644 index 0000000..c7bd4cf --- /dev/null +++ b/html/SmootLight.behaviors.AllPixels-pysrc.html @@ -0,0 +1,122 @@ + + + + + SmootLight.behaviors.AllPixels + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module AllPixels + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.AllPixels

+
+ 1  from operationscore.Behavior import * 
+
2 -class AllPixels(Behavior): +
3 """Turns on all Pixels in the installation. Must use SimpleMapper, or other Mapper supporting + 4 conditional pixel locations.""" + 5 +
6 - def processResponse(self, sensorInputs, recursiveInputs): +
7 for sensory in sensorInputs:#TODO: consider replicating the dict + 8 sensory['Location'] = 'True' + 9 return (sensorInputs, recursiveInputs) +
10 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.AllPixels.AllPixels-class.html b/html/SmootLight.behaviors.AllPixels.AllPixels-class.html new file mode 100644 index 0000000..151c764 --- /dev/null +++ b/html/SmootLight.behaviors.AllPixels.AllPixels-class.html @@ -0,0 +1,294 @@ + + + + + SmootLight.behaviors.AllPixels.AllPixels + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module AllPixels :: + Class AllPixels + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class AllPixels

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    AllPixels
+
+ +
+

Turns on all Pixels in the installation. Must use SimpleMapper, or + other Mapper supporting conditional pixel locations.

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.AllPixelsLeft-module.html b/html/SmootLight.behaviors.AllPixelsLeft-module.html new file mode 100644 index 0000000..11fa4a7 --- /dev/null +++ b/html/SmootLight.behaviors.AllPixelsLeft-module.html @@ -0,0 +1,163 @@ + + + + + SmootLight.behaviors.AllPixelsLeft + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module AllPixelsLeft + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module AllPixelsLeft

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + AllPixelsLeft
+ Behavior which returns all points left of its input. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.AllPixelsLeft-pysrc.html b/html/SmootLight.behaviors.AllPixelsLeft-pysrc.html new file mode 100644 index 0000000..191c66c --- /dev/null +++ b/html/SmootLight.behaviors.AllPixelsLeft-pysrc.html @@ -0,0 +1,123 @@ + + + + + SmootLight.behaviors.AllPixelsLeft + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module AllPixelsLeft + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.AllPixelsLeft

+
+ 1  from operationscore.Behavior import * 
+ 2  import util.ComponentRegistry as compReg 
+ 3  import pdb 
+
4 -class AllPixelsLeft(Behavior): +
5 """Behavior which returns all points left of its input. No Args.""" +
6 - def processResponse(self, sensorInputs, recursiveInputs): +
7 for sensory in sensorInputs: + 8 xLoc = sensory['Location'][0] + 9 sensory['Location'] = '{x}<' + str(xLoc) +10 return (sensorInputs, recursiveInputs) +
11 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.AllPixelsLeft.AllPixelsLeft-class.html b/html/SmootLight.behaviors.AllPixelsLeft.AllPixelsLeft-class.html new file mode 100644 index 0000000..aaa6759 --- /dev/null +++ b/html/SmootLight.behaviors.AllPixelsLeft.AllPixelsLeft-class.html @@ -0,0 +1,293 @@ + + + + + SmootLight.behaviors.AllPixelsLeft.AllPixelsLeft + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module AllPixelsLeft :: + Class AllPixelsLeft + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class AllPixelsLeft

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    AllPixelsLeft
+
+ +
+

Behavior which returns all points left of its input. No Args.

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.BehaviorChain-module.html b/html/SmootLight.behaviors.BehaviorChain-module.html new file mode 100644 index 0000000..19b46ab --- /dev/null +++ b/html/SmootLight.behaviors.BehaviorChain-module.html @@ -0,0 +1,156 @@ + + + + + SmootLight.behaviors.BehaviorChain + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module BehaviorChain + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module BehaviorChain

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + BehaviorChain
+ BehaviorChain is a class which chains together multiple behavior. +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.BehaviorChain-pysrc.html b/html/SmootLight.behaviors.BehaviorChain-pysrc.html new file mode 100644 index 0000000..832decc --- /dev/null +++ b/html/SmootLight.behaviors.BehaviorChain-pysrc.html @@ -0,0 +1,254 @@ + + + + + SmootLight.behaviors.BehaviorChain + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module BehaviorChain + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.BehaviorChain

+
+ 1  from operationscore.Behavior import * 
+ 2  import util.ComponentRegistry as compReg 
+ 3  from logger import main_log 
+ 4  import pdb 
+
5 -class BehaviorChain(Behavior): +
6 """BehaviorChain is a class which chains together multiple behavior. BehaviorChain is in itself a + 7 behavior, and behaves and can be used accordingly. BehaviorChain also supports recursive hooks to + 8 be set on its constituent behaviors. ChainedBehaviors should be specified in <Args> as follows: + 9 +10 <ChainedBehaviors> +11 <Id>behavior1Id</Id> +12 <Id>behavior2Id</Id> +13 </ChainedBehaviors> +14 +15 Behaviors may also be appended programmatically via the appendBehavior method. +16 +17 Recursive hooks should be specified with Python dict syntax as follows: +18 +19 <RecursiveHooks>{'behavior1Id':'hookid'}</RecursiveHooks> +20 +21 Behavior Chain manages all recurrences that its constituents propogate. At this point, it does not +22 support recurrences in its hooks.""" +23 +
24 - def behaviorInit(self): +
25 self.feedback = {} #dictionary to allow feedback of recursives +26 self.hooks = self['RecursiveHooks'] +27 if self.hooks == None: +28 self.hooks = {} +
29 +
30 - def processResponse(self, sensorInputs, recursiveInputs): +
31 response = sensorInputs +32 for behaviorId in self['ChainedBehaviors']: +33 behavior = compReg.getComponent(behaviorId) +34 if behaviorId in self.feedback: +35 recurrence = self.feedback[behaviorId] +36 else: +37 recurrence = [] +38 (response,recurrence) = behavior.immediateProcessInput(response,\ +39 recurrence) +40 +41 if behaviorId in self.hooks: #process recursive hook if there is one +42 hookBehavior = compReg.getComponent(self.hooks[behaviorId]) +43 #we feed its recurrence in as input to the behavior. +44 (recurrence, hookRecurrence) = \ +45 hookBehavior.immediateProcessInput(recurrence, \ +46 []) +47 if hookRecurrence != []: +48 main_log.warn('Hook recurrences are not currently supported.') +49 self.feedback[behaviorId] = recurrence +50 return (response, []) +
51 +
52 - def appendBehavior(behavior): +
53 bid = compReg.registerComponent(behavior) #register behavior (will make +54 #a new id if there isn't one) +55 self['ChainedBehaviors'].append(bid) +
56 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.BehaviorChain.BehaviorChain-class.html b/html/SmootLight.behaviors.BehaviorChain.BehaviorChain-class.html new file mode 100644 index 0000000..7098a13 --- /dev/null +++ b/html/SmootLight.behaviors.BehaviorChain.BehaviorChain-class.html @@ -0,0 +1,365 @@ + + + + + SmootLight.behaviors.BehaviorChain.BehaviorChain + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module BehaviorChain :: + Class BehaviorChain + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class BehaviorChain

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    BehaviorChain
+
+ +
+
+BehaviorChain is a class which chains together multiple behavior.  BehaviorChain is in itself a
+behavior, and behaves and can be used accordingly.  BehaviorChain also supports recursive hooks to
+be set on its constituent behaviors.  ChainedBehaviors should be specified in <Args> as follows:
+
+<ChainedBehaviors>
+    <Id>behavior1Id</Id>
+    <Id>behavior2Id</Id>
+</ChainedBehaviors>
+
+Behaviors may also be appended programmatically via the appendBehavior method.
+
+Recursive hooks should be specified with Python dict syntax as follows:
+
+<RecursiveHooks>{'behavior1Id':'hookid'}</RecursiveHooks>
+
+Behavior Chain manages all recurrences that its constituents propogate.  At this point, it does not
+support recurrences in its hooks.
+
+
+ + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
behaviorInit(self) + source code + +
+ +
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+   + + + + + + +
appendBehavior(behavior) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

behaviorInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.behaviorInit +
+
+
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Circle-module.html b/html/SmootLight.behaviors.Circle-module.html new file mode 100644 index 0000000..b5f32da --- /dev/null +++ b/html/SmootLight.behaviors.Circle-module.html @@ -0,0 +1,162 @@ + + + + + SmootLight.behaviors.Circle + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Circle + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Circle

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Circle +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Circle-pysrc.html b/html/SmootLight.behaviors.Circle-pysrc.html new file mode 100644 index 0000000..9afff9e --- /dev/null +++ b/html/SmootLight.behaviors.Circle-pysrc.html @@ -0,0 +1,143 @@ + + + + + SmootLight.behaviors.Circle + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Circle + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.Circle

+
+ 1  from operationscore.Behavior import * 
+
2 -class Circle(Behavior): +
3 - def processResponse(self, sensors, recurs): +
4 ret = [] + 5 for data in sensors: + 6 #import pdb; pdb.set_trace() + 7 if 'CenterLoc' in data: + 8 xLoc = data['CenterLoc'][0] + 9 yLoc = data['CenterLoc'][1] +10 else: +11 data['CenterLoc'] = tuple(data['Location']) +12 xLoc = data['Location'][0] +13 yLoc = data['Location'][1] +14 if not self['Id']+'Radius' in data: +15 data[self['Id']+'Radius'] = self['Radius'] +16 rad = data[self['Id']+'Radius'] +17 cond = '>=' if self['Outside'] else '<=' +18 circleStr = 'math.sqrt(({x}-'+str(xLoc)+')**2+(({y}-'+str(yLoc)+')**2))'+cond+str(rad) +19 if self['Combine']: +20 data['Location'] += ',' + circleStr +21 else: +22 data['Location'] = circleStr +23 ret.append(data) +24 return (ret, []) +
25 - def setLastOutput(self, output): +
26 coutput = Behavior.deepCopyPacket(output) +27 for data in coutput: +28 data['Location'] = data['CenterLoc'] +29 return coutput +
30 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Circle.Circle-class.html b/html/SmootLight.behaviors.Circle.Circle-class.html new file mode 100644 index 0000000..f8e2da6 --- /dev/null +++ b/html/SmootLight.behaviors.Circle.Circle-class.html @@ -0,0 +1,338 @@ + + + + + SmootLight.behaviors.Circle.Circle + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Circle :: + Class Circle + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Circle

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    Circle
+
+ +
+ + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensors, + recurs) + source code + +
+ +
+   + + + + + + +
setLastOutput(self, + output)
+ Override to modify state.
+ source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensors, + recurs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+ +
+ +
+ + +
+

setLastOutput(self, + output) +

+
source code  +
+ +

Override to modify state. For example: if you are using a behavior + that does uses strings for location specification, you will want to + override this to point to a single location. Make sure you keep + lastState as a [] of {}. (List of dicts). Additonally, ensure that you + call Behavior.deepCopyPacket on the packet before hand to avoid + inadvertent down-stream modifications. Look at Square.py for an example + of this.

+
+
Overrides: + operationscore.Behavior.Behavior.setLastOutput +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ColorChangerBehavior-module.html b/html/SmootLight.behaviors.ColorChangerBehavior-module.html new file mode 100644 index 0000000..7264cb7 --- /dev/null +++ b/html/SmootLight.behaviors.ColorChangerBehavior-module.html @@ -0,0 +1,163 @@ + + + + + SmootLight.behaviors.ColorChangerBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ColorChangerBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module ColorChangerBehavior

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + ColorChangerBehavior
+ ColorChangerBehavior is a behavior for adding colors to responses. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ColorChangerBehavior-pysrc.html b/html/SmootLight.behaviors.ColorChangerBehavior-pysrc.html new file mode 100644 index 0000000..a7e15df --- /dev/null +++ b/html/SmootLight.behaviors.ColorChangerBehavior-pysrc.html @@ -0,0 +1,141 @@ + + + + + SmootLight.behaviors.ColorChangerBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ColorChangerBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.ColorChangerBehavior

+
+ 1  from operationscore.Behavior import * 
+ 2  import util.ColorOps as color 
+ 3  import pdb 
+
4 -class ColorChangerBehavior(Behavior): +
5 """ColorChangerBehavior is a behavior for adding colors to responses. If given no arguments, it + 6 will generate a random color. If it is given a list of colors [as below] it will pick randomly + 7 from them. + 8 + 9 <ColorList> +10 <Color>(255,0,0)</Color> +11 <Color>(30,79,200)</Color> +12 </ColorList> +13 +14 ColorList also supports specification of a single color.""" +15 +
16 - def processResponse(self, sensorInputs, recursiveInputs): +
17 ret = [] +18 for sensory in sensorInputs: +19 newDict = dict(sensory) +20 if self['ColorList'] != None: +21 if isinstance(self['ColorList'], list): +22 newDict['Color'] = color.chooseRandomColor(self['ColorList']) #Pick randomly +23 else: +24 newDict['Color'] = self['ColorList'] #Unless there is only one +25 else: +26 newDict['Color'] = color.randomColor() +27 ret.append(newDict) +28 return (ret, []) +
29 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ColorChangerBehavior.ColorChangerBehavior-class.html b/html/SmootLight.behaviors.ColorChangerBehavior.ColorChangerBehavior-class.html new file mode 100644 index 0000000..558002d --- /dev/null +++ b/html/SmootLight.behaviors.ColorChangerBehavior.ColorChangerBehavior-class.html @@ -0,0 +1,305 @@ + + + + + SmootLight.behaviors.ColorChangerBehavior.ColorChangerBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ColorChangerBehavior :: + Class ColorChangerBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class ColorChangerBehavior

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    ColorChangerBehavior
+
+ +
+
+ColorChangerBehavior is a behavior for adding colors to responses.  If given no arguments, it
+will generate a random color.  If it is given a list of colors [as below] it will pick randomly
+from them.
+
+<ColorList>
+    <Color>(255,0,0)</Color>
+    <Color>(30,79,200)</Color>
+</ColorList>
+
+ColorList also supports specification of a single color.
+
+
+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ColorShift-module.html b/html/SmootLight.behaviors.ColorShift-module.html new file mode 100644 index 0000000..f81bd71 --- /dev/null +++ b/html/SmootLight.behaviors.ColorShift-module.html @@ -0,0 +1,162 @@ + + + + + SmootLight.behaviors.ColorShift + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ColorShift + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module ColorShift

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + ColorShift +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ColorShift-pysrc.html b/html/SmootLight.behaviors.ColorShift-pysrc.html new file mode 100644 index 0000000..34a97b3 --- /dev/null +++ b/html/SmootLight.behaviors.ColorShift-pysrc.html @@ -0,0 +1,129 @@ + + + + + SmootLight.behaviors.ColorShift + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ColorShift + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.ColorShift

+
+ 1  import util.ColorOps as colorOps 
+ 2  from operationscore.Behavior import * 
+ 3  import colorsys 
+
4 -class ColorShift(Behavior): +
5 - def processResponse(self, sensor, recurs): +
6 ret = [] + 7 for data in sensor: + 8 if not 'HSV' in data: + 9 data['HSV'] = list(colorsys.rgb_to_hsv(*data['Color'])) +10 +11 data['HSV'][0] += .01 +12 if data['HSV'][0] >= 360: +13 data['HSV'][0] = 0 +14 data['Color'] = colorsys.hsv_to_rgb(*data['HSV']) +15 ret.append(data) +16 return (ret,[]) +
17 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ColorShift.ColorShift-class.html b/html/SmootLight.behaviors.ColorShift.ColorShift-class.html new file mode 100644 index 0000000..2e440eb --- /dev/null +++ b/html/SmootLight.behaviors.ColorShift.ColorShift-class.html @@ -0,0 +1,291 @@ + + + + + SmootLight.behaviors.ColorShift.ColorShift + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ColorShift :: + Class ColorShift + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class ColorShift

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    ColorShift
+
+ +
+ + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensor, + recurs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensor, + recurs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ControllerOSC-module.html b/html/SmootLight.behaviors.ControllerOSC-module.html new file mode 100644 index 0000000..da11ffd --- /dev/null +++ b/html/SmootLight.behaviors.ControllerOSC-module.html @@ -0,0 +1,204 @@ + + + + + SmootLight.behaviors.ControllerOSC + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ControllerOSC + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module ControllerOSC

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + ControllerOSC +
+ + + + + + + + + +
+ + + + + +
Functions[hide private]
+
+   + + + + + + +
constrainLocation(v, + c) + source code + +
+ +
+ + + + + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + speedfactor = 15 +
+   + + vel_decay = 0.9 +
+   + + __package__ = 'SmootLight.behaviors' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ControllerOSC-pysrc.html b/html/SmootLight.behaviors.ControllerOSC-pysrc.html new file mode 100644 index 0000000..38d434e --- /dev/null +++ b/html/SmootLight.behaviors.ControllerOSC-pysrc.html @@ -0,0 +1,261 @@ + + + + + SmootLight.behaviors.ControllerOSC + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ControllerOSC + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.ControllerOSC

+
+ 1  from operationscore.Behavior import *  
+ 2  from logger import main_log 
+ 3  #import util.ColorOps as color  
+ 4  import colorsys 
+ 5  from numpy import array 
+ 6  import pdb 
+ 7  import util.ComponentRegistry as compReg 
+ 8   
+ 9  speedfactor = 15 
+10  vel_decay = .9 
+11   
+
12 -def constrainLocation(v,c): +
13 if v[0] > c[0]: +14 v[0] = c[0] +15 elif v[0]<0: +16 v[0] = 0 +17 +18 if v[1] > c[1]: +19 v[1] = c[1] +20 elif v[1]<0: +21 v[1] = 0 +22 +23 return v +
24 +
25 -class ControllerOSC(Behavior): +
26 - def behaviorInit(self): +
27 self.xy = array((0,0)) +28 self.v_xy = array((0,0)) +29 self.v_decay = vel_decay +30 +31 self.start_hsv = [0,1,1] +32 self.dest_hsv = [0,1,1] +33 self.ssize = compReg.getComponent('Screen').getSize()[-2:] #896 x 310 +
34 +
35 - def processResponse(self, sensorInputs, recursiveInputs): +
36 ret = [] +37 if sensorInputs: +38 data = sensorInputs[-1]#for data in sensorInputs: +39 if data['Path'] == '/sixaxis/xy': +40 #try: +41 x = data['Value'][0] +42 y = data['Value'][1] +43 if y < 0: +44 self.start_hsv[1] = 1.0+y #s +45 else: +46 self.start_hsv[2] = 1.0-y +47 self.start_hsv[0] = (x+1)/2. +48 elif data['Path'] == '/sixaxis/lrud': +49 val=data['Value'] +50 vy = val[3]-val[2] +51 vx = val[1]-val[0] +52 #pdb.set_trace() +53 #self.v_xy = (val[1]*ssize[0], (1.0-val[0])*ssize[1]) +54 self.v_xy = array((vx, vy)) * speedfactor +55 else: +56 main_log.error('Sensor Inputs: ' + str(sensorInputs)) +57 self.xy = self.xy + self.v_xy +58 constrainLocation(self.xy,self.ssize) +59 self.v_xy *= self.v_decay +60 ret.append({'Color':[i*255. for i in colorsys.hsv_to_rgb(*self.start_hsv)],'Location':(int(self.xy[0]), int(self.xy[1]))}) +61 +62 return (ret, []) +
63 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ControllerOSC.ControllerOSC-class.html b/html/SmootLight.behaviors.ControllerOSC.ControllerOSC-class.html new file mode 100644 index 0000000..b6dcc7d --- /dev/null +++ b/html/SmootLight.behaviors.ControllerOSC.ControllerOSC-class.html @@ -0,0 +1,328 @@ + + + + + SmootLight.behaviors.ControllerOSC.ControllerOSC + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ControllerOSC :: + Class ControllerOSC + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class ControllerOSC

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    ControllerOSC
+
+ +
+ + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
behaviorInit(self) + source code + +
+ +
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

behaviorInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.behaviorInit +
+
+
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.DebugBehavior-module.html b/html/SmootLight.behaviors.DebugBehavior-module.html new file mode 100644 index 0000000..18b38f8 --- /dev/null +++ b/html/SmootLight.behaviors.DebugBehavior-module.html @@ -0,0 +1,157 @@ + + + + + SmootLight.behaviors.DebugBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module DebugBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module DebugBehavior

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + DebugBehavior
+ DebugBehavior simply writes all of its inputs to the logs, + currently at the ERROR level for easy visibility. +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.DebugBehavior-pysrc.html b/html/SmootLight.behaviors.DebugBehavior-pysrc.html new file mode 100644 index 0000000..ab6181c --- /dev/null +++ b/html/SmootLight.behaviors.DebugBehavior-pysrc.html @@ -0,0 +1,210 @@ + + + + + SmootLight.behaviors.DebugBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module DebugBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.DebugBehavior

+
+ 1  from operationscore.Behavior import *  
+ 2  from logger import main_log 
+ 3  import pdb 
+
4 -class DebugBehavior(Behavior): +
5 """DebugBehavior simply writes all of its inputs to the logs, currently at the ERROR level for + 6 easy visibility. Will be changed to DEBUG or INFO in the future""" + 7 +
8 - def processResponse(self, sensorInputs, recursiveInputs): +
9 if sensorInputs != []: +10 main_log.error('Sensor Inputs: ' + str(sensorInputs)) +11 return ([], []) +
12 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.DebugBehavior.DebugBehavior-class.html b/html/SmootLight.behaviors.DebugBehavior.DebugBehavior-class.html new file mode 100644 index 0000000..2cc2e46 --- /dev/null +++ b/html/SmootLight.behaviors.DebugBehavior.DebugBehavior-class.html @@ -0,0 +1,295 @@ + + + + + SmootLight.behaviors.DebugBehavior.DebugBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module DebugBehavior :: + Class DebugBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class DebugBehavior

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    DebugBehavior
+
+ +
+

DebugBehavior simply writes all of its inputs to the logs, currently + at the ERROR level for easy visibility. Will be changed to DEBUG or INFO + in the future

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.DecayBehavior-module.html b/html/SmootLight.behaviors.DecayBehavior-module.html new file mode 100644 index 0000000..82f2aba --- /dev/null +++ b/html/SmootLight.behaviors.DecayBehavior-module.html @@ -0,0 +1,163 @@ + + + + + SmootLight.behaviors.DecayBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module DecayBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module DecayBehavior

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + DecayBehavior
+ DecayBehavior is obsolete. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.DecayBehavior-pysrc.html b/html/SmootLight.behaviors.DecayBehavior-pysrc.html new file mode 100644 index 0000000..030d2d6 --- /dev/null +++ b/html/SmootLight.behaviors.DecayBehavior-pysrc.html @@ -0,0 +1,131 @@ + + + + + SmootLight.behaviors.DecayBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module DecayBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.DecayBehavior

+
+ 1  from operationscore.Behavior import * 
+ 2  from pixelevents.DecayEvent import * 
+ 3  import util.Strings as Strings 
+ 4  import pdb 
+
5 -class DecayBehavior(Behavior): +
6 """DecayBehavior is obsolete. Use AddPixelEvent instead""" +
7 - def processResponse(self, sensorInputs, recursiveInputs): +
8 ret = [] + 9 for sensory in sensorInputs: +10 outDict = {} +11 outDict[Strings.LOCATION] = sensory[Strings.LOCATION] +12 outDict['PixelEvent'] = \ +13 DecayEvent.generate(self['DecayType'],self['Coefficient'], sensory['Color']) +14 ret.append(outDict) +15 return (ret, recursiveInputs) +
16 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.DecayBehavior.DecayBehavior-class.html b/html/SmootLight.behaviors.DecayBehavior.DecayBehavior-class.html new file mode 100644 index 0000000..8b43c7d --- /dev/null +++ b/html/SmootLight.behaviors.DecayBehavior.DecayBehavior-class.html @@ -0,0 +1,293 @@ + + + + + SmootLight.behaviors.DecayBehavior.DecayBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module DecayBehavior :: + Class DecayBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class DecayBehavior

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    DecayBehavior
+
+ +
+

DecayBehavior is obsolete. Use AddPixelEvent instead

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.EchoBehavior-module.html b/html/SmootLight.behaviors.EchoBehavior-module.html new file mode 100644 index 0000000..7f8b89d --- /dev/null +++ b/html/SmootLight.behaviors.EchoBehavior-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.behaviors.EchoBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module EchoBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module EchoBehavior

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + EchoBehavior
+ EchoBehavior generates a RED response at all locations specified in + sensorInputs. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.EchoBehavior-pysrc.html b/html/SmootLight.behaviors.EchoBehavior-pysrc.html new file mode 100644 index 0000000..274cd6a --- /dev/null +++ b/html/SmootLight.behaviors.EchoBehavior-pysrc.html @@ -0,0 +1,130 @@ + + + + + SmootLight.behaviors.EchoBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module EchoBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.EchoBehavior

+
+ 1  from operationscore.Behavior import * 
+ 2  import util.Strings as Strings 
+ 3  import pdb 
+
4 -class EchoBehavior(Behavior): +
5 """EchoBehavior generates a RED response at all locations specified in sensorInputs. Useful for + 6 debugging""" +
7 - def processResponse(self, sensorInputs, recursiveInputs): +
8 ret = [] + 9 for sensory in sensorInputs: +10 outDict = {} +11 outDict[Strings.LOCATION] = sensory[Strings.LOCATION] +12 if self['Color'] != None: +13 outDict['Color'] = self['Color'] +14 else: +15 outDict['Color'] = (255,0,0) +16 ret.append(outDict) +17 return (ret, []) +
18 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.EchoBehavior.EchoBehavior-class.html b/html/SmootLight.behaviors.EchoBehavior.EchoBehavior-class.html new file mode 100644 index 0000000..da21642 --- /dev/null +++ b/html/SmootLight.behaviors.EchoBehavior.EchoBehavior-class.html @@ -0,0 +1,294 @@ + + + + + SmootLight.behaviors.EchoBehavior.EchoBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module EchoBehavior :: + Class EchoBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class EchoBehavior

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    EchoBehavior
+
+ +
+

EchoBehavior generates a RED response at all locations specified in + sensorInputs. Useful for debugging

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Expand-module.html b/html/SmootLight.behaviors.Expand-module.html new file mode 100644 index 0000000..669f43f --- /dev/null +++ b/html/SmootLight.behaviors.Expand-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.behaviors.Expand + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Expand + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Expand

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Expand
+ Expand is a behavior that generates a response that grows + horizontally starting a location specifed in input. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Expand-pysrc.html b/html/SmootLight.behaviors.Expand-pysrc.html new file mode 100644 index 0000000..8272e98 --- /dev/null +++ b/html/SmootLight.behaviors.Expand-pysrc.html @@ -0,0 +1,134 @@ + + + + + SmootLight.behaviors.Expand + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Expand + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.Expand

+
+ 1  from operationscore.Behavior import * 
+
2 -class Expand(Behavior): +
3 """Expand is a behavior that generates a response that grows horizontally starting a location + 4 specifed in input. Required Args: + 5 <ExpandRate>123</ExpandRate> which is the expandrate in units/response""" + 6 +
7 - def processResponse(self, sensorInputs, recurs): +
8 ret = [] + 9 for data in sensorInputs: +10 if not 'Left' in data: #If this is the first time we have seen this input +11 data['Left'] = data['Location'][0] +12 data['Right'] = data['Location'][0] +13 data['ExpandRate'] = self['ExpandRate'] +14 +15 data = dict(data) +16 data['Left'] -= data['ExpandRate'] +17 data['Right'] += data['ExpandRate'] +18 data['Location'] = "{x}>" + str(data['Left']) + ", {x}<" +\ +19 str(data['Right'])+", {y}<50" +20 ret.append(data) +21 return (ret, []) +
22 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Expand.Expand-class.html b/html/SmootLight.behaviors.Expand.Expand-class.html new file mode 100644 index 0000000..0787009 --- /dev/null +++ b/html/SmootLight.behaviors.Expand.Expand-class.html @@ -0,0 +1,296 @@ + + + + + SmootLight.behaviors.Expand.Expand + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Expand :: + Class Expand + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Expand

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    Expand
+
+ +
+

Expand is a behavior that generates a response that grows horizontally + starting a location specifed in input. Required Args: + <ExpandRate>123</ExpandRate> which is the expandrate in + units/response

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recurs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recurs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ExpandingColorZones-module.html b/html/SmootLight.behaviors.ExpandingColorZones-module.html new file mode 100644 index 0000000..d791eb2 --- /dev/null +++ b/html/SmootLight.behaviors.ExpandingColorZones-module.html @@ -0,0 +1,155 @@ + + + + + SmootLight.behaviors.ExpandingColorZones + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ExpandingColorZones + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module ExpandingColorZones

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + ExpandingColorZones +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ExpandingColorZones-pysrc.html b/html/SmootLight.behaviors.ExpandingColorZones-pysrc.html new file mode 100644 index 0000000..9826689 --- /dev/null +++ b/html/SmootLight.behaviors.ExpandingColorZones-pysrc.html @@ -0,0 +1,220 @@ + + + + + SmootLight.behaviors.ExpandingColorZones + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ExpandingColorZones + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.ExpandingColorZones

+
+ 1  from operationscore.Behavior import * 
+ 2  from logger import main_log 
+
3 -class ExpandingColorZones(Behavior): +
4 - def behaviorInit(self): +
5 self.mapping = {'s001':[(132,0),(255,0,0)], 's002':[(400,0), (0,255,0)], + 6 's003':[(668,0), + 7 (0,0,255)]} + 8 self.mappingkey = 'data' +
9 - def processResponse(self, sensorInputs, recursiveInputs): +
10 ret = [] +11 for data in sensorInputs: +12 print data +13 data = dict(data) +14 if self.mappingkey in data: +15 try: +16 data['Location'], data['Color'] =\ +17 self.mapping[data[self.mappingkey]] +18 ret.append(data) +19 except: +20 main_log.warn('Bad mapping key. Expanding Color Zones.') +21 return (ret,[]) +
22 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ExpandingColorZones.ExpandingColorZones-class.html b/html/SmootLight.behaviors.ExpandingColorZones.ExpandingColorZones-class.html new file mode 100644 index 0000000..bbf539c --- /dev/null +++ b/html/SmootLight.behaviors.ExpandingColorZones.ExpandingColorZones-class.html @@ -0,0 +1,328 @@ + + + + + SmootLight.behaviors.ExpandingColorZones.ExpandingColorZones + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ExpandingColorZones :: + Class ExpandingColorZones + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class ExpandingColorZones

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    ExpandingColorZones
+
+ +
+ + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
behaviorInit(self) + source code + +
+ +
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

behaviorInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.behaviorInit +
+
+
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Flasher-module.html b/html/SmootLight.behaviors.Flasher-module.html new file mode 100644 index 0000000..ef7895d --- /dev/null +++ b/html/SmootLight.behaviors.Flasher-module.html @@ -0,0 +1,163 @@ + + + + + SmootLight.behaviors.Flasher + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Flasher + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Flasher

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Flasher
+ Implements a pulsing/flashing behavior. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Flasher-pysrc.html b/html/SmootLight.behaviors.Flasher-pysrc.html new file mode 100644 index 0000000..57e100a --- /dev/null +++ b/html/SmootLight.behaviors.Flasher-pysrc.html @@ -0,0 +1,154 @@ + + + + + SmootLight.behaviors.Flasher + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Flasher + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.Flasher

+
+ 1   
+ 2  from operationscore.Behavior import * 
+ 3  import util.ColorOps as colorops 
+ 4  import pdb 
+
5 -class Flasher(Behavior): +
6 """Implements a pulsing/flashing behavior. + 7 Jim Salem + 8 + 9 Args: +10 Factor - The speed of flashing. Must be b/w 0 and 1. Default is .95 +11 """ +
12 - def processResponse(self, sensorInputs, recursiveInputs): +
13 ret = [] +14 for response in sensorInputs: +15 # Get the multiplier +16 if self['Factor'] != None: +17 factor = self['Factor'] +18 else: +19 factor = 0.95 +20 # Initialize the first time +21 if not 'FireflyStartColor' in response: +22 response['FireflyValue'] = 1.0 +23 response['FireflyDir'] = 1 +24 response['FireflyStartColor'] = response['Color']; +25 else: +26 # Update the current value +27 if response['FireflyDir'] == 1: +28 response['FireflyValue'] = response['FireflyValue'] * factor +29 if response['FireflyValue'] <= 0.01: +30 response['FireflyValue'] = 0.01 +31 response['FireflyDir'] = 0 +32 else: +33 response['FireflyValue'] = response['FireflyValue'] / factor +34 if response['FireflyValue'] >= 1.0: +35 response['FireflyValue'] = 1.0 +36 response['FireflyDir'] = 1 +37 +38 # Compute the color +39 response['Color'] = colorops.multiplyColor(response['FireflyStartColor'], response['FireflyValue']) +40 ret.append(response) +41 return (ret, []) #no direct ouput +
42 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Flasher.Flasher-class.html b/html/SmootLight.behaviors.Flasher.Flasher-class.html new file mode 100644 index 0000000..7f218dd --- /dev/null +++ b/html/SmootLight.behaviors.Flasher.Flasher-class.html @@ -0,0 +1,300 @@ + + + + + SmootLight.behaviors.Flasher.Flasher + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Flasher :: + Class Flasher + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Flasher

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    Flasher
+
+ +
+
+Implements a pulsing/flashing behavior.
+Jim Salem 
+
+Args:
+  Factor - The speed of flashing. Must be b/w 0 and 1.  Default is .95
+
+
+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.MITDoors-module.html b/html/SmootLight.behaviors.MITDoors-module.html new file mode 100644 index 0000000..b087c17 --- /dev/null +++ b/html/SmootLight.behaviors.MITDoors-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.behaviors.MITDoors + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module MITDoors + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module MITDoors

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + MITDoors
+ MITDoors is a case-specific behavior to map keypresses to specific + locations. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.MITDoors-pysrc.html b/html/SmootLight.behaviors.MITDoors-pysrc.html new file mode 100644 index 0000000..00ae93e --- /dev/null +++ b/html/SmootLight.behaviors.MITDoors-pysrc.html @@ -0,0 +1,141 @@ + + + + + SmootLight.behaviors.MITDoors + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module MITDoors + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.MITDoors

+
+ 1  from operationscore.Behavior import * 
+ 2  import math 
+ 3  import util.ComponentRegistry as compReg 
+
4 -class MITDoors(Behavior): +
5 """MITDoors is a case-specific behavior to map keypresses to specific locations. Written for + 6 Kuan 1/26/11 by RCOH""" + 7 +
8 - def behaviorInit(self): +
9 self.keymapping = {'q':[2,19], 'w':[22,36], 'e':[37,49], 'r':[52,69], 't':[76,91], 'y':[94,105], +10 'u':[106,117], 'i':[123,154], 'o':[158,161], 'p':[164,167], '[':[172,184]} +11 screenWidth = compReg.getComponent('Screen').getSize()[2] #(minx, miny,maxx, maxy) +12 maxKey = max([max(self.keymapping[v]) for v in self.keymapping]) +13 mult = screenWidth / float(maxKey) +14 for k in self.keymapping: +15 self.keymapping[k] = [int(val*mult) for val in self.keymapping[k]] +
16 - def processResponse(self, sensorInputs, recursiveInputs): +
17 ret = [] +18 for data in sensorInputs: +19 key = chr(data['Key']) +20 if key in self.keymapping: +21 bounds = self.keymapping[key] +22 data = dict(data) +23 data['Left'], data['Right'] = bounds +24 data['Bottom'] = self['Bottom'] +25 data['Location'] = (sum(bounds) / 2., self['Bottom']) +26 data['Oscillate'] = False +27 ret.append(data) +28 return (ret, []) +
29 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.MITDoors.MITDoors-class.html b/html/SmootLight.behaviors.MITDoors.MITDoors-class.html new file mode 100644 index 0000000..0dbaaf6 --- /dev/null +++ b/html/SmootLight.behaviors.MITDoors.MITDoors-class.html @@ -0,0 +1,331 @@ + + + + + SmootLight.behaviors.MITDoors.MITDoors + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module MITDoors :: + Class MITDoors + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class MITDoors

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    MITDoors
+
+ +
+

MITDoors is a case-specific behavior to map keypresses to specific + locations. Written for Kuan 1/26/11 by RCOH

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
behaviorInit(self) + source code + +
+ +
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

behaviorInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.behaviorInit +
+
+
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.MobileShakeBehavior-module.html b/html/SmootLight.behaviors.MobileShakeBehavior-module.html new file mode 100644 index 0000000..15115bc --- /dev/null +++ b/html/SmootLight.behaviors.MobileShakeBehavior-module.html @@ -0,0 +1,162 @@ + + + + + SmootLight.behaviors.MobileShakeBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module MobileShakeBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module MobileShakeBehavior

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + MobileShakeBehavior +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.MobileShakeBehavior-pysrc.html b/html/SmootLight.behaviors.MobileShakeBehavior-pysrc.html new file mode 100644 index 0000000..58fac59 --- /dev/null +++ b/html/SmootLight.behaviors.MobileShakeBehavior-pysrc.html @@ -0,0 +1,139 @@ + + + + + SmootLight.behaviors.MobileShakeBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module MobileShakeBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.MobileShakeBehavior

+
+ 1  from operationscore.Behavior import * 
+ 2  import util.ComponentRegistry as compReg 
+ 3  import util.Strings as Strings 
+ 4   
+
5 -class MobileShakeBehavior(Behavior): +
6 - def behaviorInit(self): +
7 self.mapper = None +
8 +
9 - def processResponse(self, sensorInputs, recursiveInputs): +
10 if self.mapper == None: +11 try: +12 self.mapper = compReg.getComponent('mobilegaussmap') +13 except KeyError: +14 pass +15 +16 #print sensorInputs +17 for sInput in sensorInputs: +18 if 'Shake' in sInput and sInput['Shake'] == 1: +19 #print 'increase!' +20 self.mapper.argDict['Width'] += 30 +21 #self.mapper.argDict['CutoffDist'] += 20 +22 sInput['Shake'] = 0 +23 print 'Width:' + str(compReg.getComponent('mobilegaussmap').argDict['Width']) +24 #print 'CutoffDist: '+ str(compReg.getComponent('mobilegaussmap').argDict['CutoffDist']) +25 +26 return (sensorInputs, recursiveInputs) +
27 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.MobileShakeBehavior.MobileShakeBehavior-class.html b/html/SmootLight.behaviors.MobileShakeBehavior.MobileShakeBehavior-class.html new file mode 100644 index 0000000..dcd8182 --- /dev/null +++ b/html/SmootLight.behaviors.MobileShakeBehavior.MobileShakeBehavior-class.html @@ -0,0 +1,328 @@ + + + + + SmootLight.behaviors.MobileShakeBehavior.MobileShakeBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module MobileShakeBehavior :: + Class MobileShakeBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class MobileShakeBehavior

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    MobileShakeBehavior
+
+ +
+ + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
behaviorInit(self) + source code + +
+ +
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

behaviorInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.behaviorInit +
+
+
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ModifyParam-module.html b/html/SmootLight.behaviors.ModifyParam-module.html new file mode 100644 index 0000000..9c24b23 --- /dev/null +++ b/html/SmootLight.behaviors.ModifyParam-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.behaviors.ModifyParam + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ModifyParam + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module ModifyParam

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + ModifyParam
+ ModifyParam is a powerful class to perform an action on a specified + key in the Argument Dictionary of a response. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ModifyParam-pysrc.html b/html/SmootLight.behaviors.ModifyParam-pysrc.html new file mode 100644 index 0000000..30cdc88 --- /dev/null +++ b/html/SmootLight.behaviors.ModifyParam-pysrc.html @@ -0,0 +1,149 @@ + + + + + SmootLight.behaviors.ModifyParam + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ModifyParam + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.ModifyParam

+
+ 1  from operationscore.Behavior import * 
+ 2  import math 
+ 3  #Class to perform a given operation on some element of an argDict.  Designed to be used a recursive hook, but can serve sensor-based functions as well.  Specify ParamType (Sensor or Recurse), ParamName, and ParamOp, (a valid python statement with the old value represented as {val}) 
+
4 -class ModifyParam(Behavior): +
5 """ModifyParam is a powerful class to perform an action on a specified key in the Argument + 6 Dictionary of a response. Specify: + 7 <ParamType> -- Sensor or Recurse + 8 <ParamName> -- The name of the parameter you wish to modify + 9 <ParamOp> -- The modification you wish to do. Use {val} to specify the current value of the +10 parameter in question. Special hooks for {x} and {y} also exist to access the x and y +11 locations.""" +12 +
13 - def processResponse(self, sensorInputs, recursiveInputs): +
14 paramType = self['ParamType'] +15 if paramType == None: +16 paramType = 'Sensor' +17 paramName = self['ParamName'] +18 paramOp = str(self['ParamOp']) +19 if paramType == 'Sensor': +20 searchSet = sensorInputs +21 elif paramType == 'Recurse': +22 searchSet = recursiveInputs +23 else: +24 raise Exception('Unknown Param Type') +25 for behaviorInput in searchSet: +26 if paramName in behaviorInput: #TODO: copy -> modify instead of just +27 #copying +28 paramOp = paramOp.replace('{val}', 'behaviorInput[paramName]') #convert the {val} marker to something we can execute +29 #TODO: move elsewhere +30 paramOp = paramOp.replace('{y}', "behaviorInput['Location'][1]") +31 paramOp = paramOp.replace('{x}', "behaviorInput['Location'][0]") +32 behaviorInput[paramName] = eval(paramOp) +33 if paramType == 'Sensor': #return accordingly +34 return (searchSet, recursiveInputs) +35 if paramType == 'Recurse': +36 return (sensorInputs, searchSet) +
37 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ModifyParam.ModifyParam-class.html b/html/SmootLight.behaviors.ModifyParam.ModifyParam-class.html new file mode 100644 index 0000000..1a7ea2f --- /dev/null +++ b/html/SmootLight.behaviors.ModifyParam.ModifyParam-class.html @@ -0,0 +1,298 @@ + + + + + SmootLight.behaviors.ModifyParam.ModifyParam + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ModifyParam :: + Class ModifyParam + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class ModifyParam

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    ModifyParam
+
+ +
+

ModifyParam is a powerful class to perform an action on a specified + key in the Argument Dictionary of a response. Specify: <ParamType> + -- Sensor or Recurse <ParamName> -- The name of the parameter you + wish to modify <ParamOp> -- The modification you wish to do. Use + {val} to specify the current value of the parameter in question. Special + hooks for {x} and {y} also exist to access the x and y locations.

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ModulateColor-module.html b/html/SmootLight.behaviors.ModulateColor-module.html new file mode 100644 index 0000000..4aec01b --- /dev/null +++ b/html/SmootLight.behaviors.ModulateColor-module.html @@ -0,0 +1,162 @@ + + + + + SmootLight.behaviors.ModulateColor + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ModulateColor + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module ModulateColor

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + ColorShift +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ModulateColor-pysrc.html b/html/SmootLight.behaviors.ModulateColor-pysrc.html new file mode 100644 index 0000000..0b43228 --- /dev/null +++ b/html/SmootLight.behaviors.ModulateColor-pysrc.html @@ -0,0 +1,129 @@ + + + + + SmootLight.behaviors.ModulateColor + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ModulateColor + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.ModulateColor

+
+ 1  import util.ColorOps as colorOps 
+ 2  from operationscore.Behavior import * 
+ 3  import colorsys 
+
4 -class ColorShift(Behavior): +
5 - def processResponse(self, sensor, recurs): +
6 ret = [] + 7 for data in sensor: + 8 if not 'HSV' in data: + 9 data['HSV'] = colorsys.rgb_to_hsv(data['Color']) +10 +11 data['HSV'][0] += .5 +12 if data['HSV'][0] >= 360: +13 data['HSV'][0] = 0 +14 data['Color'] = colorsys.hsv_to_rgb(data['HSV']) +15 ret.append(data) +16 return (ret,[]) +
17 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ModulateColor.ColorShift-class.html b/html/SmootLight.behaviors.ModulateColor.ColorShift-class.html new file mode 100644 index 0000000..3c01257 --- /dev/null +++ b/html/SmootLight.behaviors.ModulateColor.ColorShift-class.html @@ -0,0 +1,291 @@ + + + + + SmootLight.behaviors.ModulateColor.ColorShift + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ModulateColor :: + Class ColorShift + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class ColorShift

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    ColorShift
+
+ +
+ + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensor, + recurs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensor, + recurs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.MoveBehavior-module.html b/html/SmootLight.behaviors.MoveBehavior-module.html new file mode 100644 index 0000000..1d6a54e --- /dev/null +++ b/html/SmootLight.behaviors.MoveBehavior-module.html @@ -0,0 +1,163 @@ + + + + + SmootLight.behaviors.MoveBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module MoveBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module MoveBehavior

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + MoveBehavior
+ Moves current location by the x and y components of sensorInput. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.MoveBehavior-pysrc.html b/html/SmootLight.behaviors.MoveBehavior-pysrc.html new file mode 100644 index 0000000..30fe34c --- /dev/null +++ b/html/SmootLight.behaviors.MoveBehavior-pysrc.html @@ -0,0 +1,148 @@ + + + + + SmootLight.behaviors.MoveBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module MoveBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.MoveBehavior

+
+ 1  from operationscore.Behavior import * 
+ 2  #import util.ComponentRegistry as compReg 
+ 3  #import util.Geo as Geo 
+ 4  #import util.Strings as Strings 
+ 5   
+
6 -class MoveBehavior(Behavior): +
7 """Moves current location by the x and y components of sensorInput. Uses recurrences to track + 8 current input. @Author: Euguene""" + 9 +
10 - def processResponse(self, sensorInputs, recursiveInputs): +
11 if recursiveInputs: +12 currRecLocs = recursiveInputs +13 else: +14 currRecLocs = [{'Location' : (5, 5), 'Color' : [255, 255, 255]}] +15 +16 if sensorInputs: # if input exists, change location +17 ret = [] +18 for currRecLoc in currRecLocs: +19 currDict = dict(currRecLoc) +20 for sensorInput in sensorInputs: +21 if 'type' in sensorInput and sensorInput['type'] == 1: +22 currDict['Shake'] = 0 +23 currDict['Location'] = (currDict['Location'][0] - sensorInput['x'] * self['XStep'], \ +24 currDict['Location'][1] + sensorInput['y'] * self['YStep']) +25 currDict['Color'] = [sensorInput['r'], sensorInput['g'], sensorInput['b']] +26 elif sensorInput['type'] == 2: +27 currDict['Shake'] = 1 +28 #currDict['Force'] = sensorInput['force'] +29 ret.append(currDict) +30 #print ret +31 return (ret, ret) +32 +33 else: # if not, return current recursive location. +34 #print currRecLocs +35 return (currRecLocs, currRecLocs) +
36 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.MoveBehavior.MoveBehavior-class.html b/html/SmootLight.behaviors.MoveBehavior.MoveBehavior-class.html new file mode 100644 index 0000000..4d6710b --- /dev/null +++ b/html/SmootLight.behaviors.MoveBehavior.MoveBehavior-class.html @@ -0,0 +1,294 @@ + + + + + SmootLight.behaviors.MoveBehavior.MoveBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module MoveBehavior :: + Class MoveBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class MoveBehavior

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    MoveBehavior
+
+ +
+

Moves current location by the x and y components of sensorInput. Uses + recurrences to track current input. @Author: Euguene

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.MrmrSetColor-module.html b/html/SmootLight.behaviors.MrmrSetColor-module.html new file mode 100644 index 0000000..fc7d290 --- /dev/null +++ b/html/SmootLight.behaviors.MrmrSetColor-module.html @@ -0,0 +1,155 @@ + + + + + SmootLight.behaviors.MrmrSetColor + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module MrmrSetColor + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module MrmrSetColor

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + MrmrSetColor +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.MrmrSetColor-pysrc.html b/html/SmootLight.behaviors.MrmrSetColor-pysrc.html new file mode 100644 index 0000000..24b14dc --- /dev/null +++ b/html/SmootLight.behaviors.MrmrSetColor-pysrc.html @@ -0,0 +1,220 @@ + + + + + SmootLight.behaviors.MrmrSetColor + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module MrmrSetColor + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.MrmrSetColor

+
+ 1  from operationscore.Behavior import *  
+ 2  from logger import main_log 
+ 3  #import util.ColorOps as color  
+ 4  import colorsys 
+ 5  import pdb 
+
6 -class MrmrSetColor(Behavior): +
7 - def behaviorInit(self): +
8 self.h=0 + 9 self.s=0 +10 self.v=0 +
11 - def processResponse(self, sensorInputs, recursiveInputs): +
12 ret = [] +13 for data in sensorInputs: +14 if data['Path'].find('horizontal') != -1: +15 self.h = data['Value'] / 2.78 +16 elif data['Path'].find('vertical') != -1: +17 self.s = data['Value'] / 1000.0 +18 else: +19 main_log.error('Sensor Inputs: ' + str(sensorInputs)) +20 ret.append({'Color':[i*255 for i in colorsys.hsv_to_rgb(self.h,self.s,self.v)]}) +21 return (ret, []) +
22 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.MrmrSetColor.MrmrSetColor-class.html b/html/SmootLight.behaviors.MrmrSetColor.MrmrSetColor-class.html new file mode 100644 index 0000000..c7a3372 --- /dev/null +++ b/html/SmootLight.behaviors.MrmrSetColor.MrmrSetColor-class.html @@ -0,0 +1,328 @@ + + + + + SmootLight.behaviors.MrmrSetColor.MrmrSetColor + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module MrmrSetColor :: + Class MrmrSetColor + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class MrmrSetColor

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    MrmrSetColor
+
+ +
+ + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
behaviorInit(self) + source code + +
+ +
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

behaviorInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.behaviorInit +
+
+
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Oval-module.html b/html/SmootLight.behaviors.Oval-module.html new file mode 100644 index 0000000..2329bb5 --- /dev/null +++ b/html/SmootLight.behaviors.Oval-module.html @@ -0,0 +1,162 @@ + + + + + SmootLight.behaviors.Oval + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Oval + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Oval

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Oval +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Oval-pysrc.html b/html/SmootLight.behaviors.Oval-pysrc.html new file mode 100644 index 0000000..95bc7f0 --- /dev/null +++ b/html/SmootLight.behaviors.Oval-pysrc.html @@ -0,0 +1,150 @@ + + + + + SmootLight.behaviors.Oval + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Oval + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.Oval

+
+ 1  from operationscore.Behavior import * 
+
2 -class Oval(Behavior): +
3 - def processResponse(self, sensors, recurs): +
4 ret = [] + 5 for data in sensors: + 6 #import pdb; pdb.set_trace() + 7 height = width = 1 + 8 if 'Height' in self: + 9 height = 1/float(self['Height']) +10 if 'Width' in self: +11 width = 1/float(self['Width']) +12 if 'CenterLoc' in data: +13 xLoc = data['CenterLoc'][0] +14 yLoc = data['CenterLoc'][1] +15 else: +16 data['CenterLoc'] = tuple(data['Location']) +17 xLoc = data['Location'][0] +18 yLoc = data['Location'][1] +19 if not self['Id']+'Radius' in data: +20 data[self['Id']+'Radius'] = self['Radius'] +21 rad = data[self['Id']+'Radius'] +22 cond = '>=' if self['Outside'] else '<=' +23 circleStr = \ +24 'math.sqrt((({x}-%(xLoc)d))**2*%(width)d+(({y}-%(yLoc)d)**2)*%(height)d)%(cond)s%(rad)d' % \ +25 locals() +26 if self['Combine']: +27 data['Location'] += ',' + circleStr +28 else: +29 data['Location'] = circleStr +30 ret.append(data) +31 return (ret, []) +
32 - def setLastOutput(self, output): +
33 coutput = Behavior.deepCopyPacket(output) +34 for data in coutput: +35 data['Location'] = data['CenterLoc'] +36 return coutput +
37 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Oval.Oval-class.html b/html/SmootLight.behaviors.Oval.Oval-class.html new file mode 100644 index 0000000..6516838 --- /dev/null +++ b/html/SmootLight.behaviors.Oval.Oval-class.html @@ -0,0 +1,338 @@ + + + + + SmootLight.behaviors.Oval.Oval + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Oval :: + Class Oval + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Oval

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    Oval
+
+ +
+ + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensors, + recurs) + source code + +
+ +
+   + + + + + + +
setLastOutput(self, + output)
+ Override to modify state.
+ source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensors, + recurs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+ +
+ +
+ + +
+

setLastOutput(self, + output) +

+
source code  +
+ +

Override to modify state. For example: if you are using a behavior + that does uses strings for location specification, you will want to + override this to point to a single location. Make sure you keep + lastState as a [] of {}. (List of dicts). Additonally, ensure that you + call Behavior.deepCopyPacket on the packet before hand to avoid + inadvertent down-stream modifications. Look at Square.py for an example + of this.

+
+
Overrides: + operationscore.Behavior.Behavior.setLastOutput +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RandomSetBrightColorBehavior-module.html b/html/SmootLight.behaviors.RandomSetBrightColorBehavior-module.html new file mode 100644 index 0000000..ff712f3 --- /dev/null +++ b/html/SmootLight.behaviors.RandomSetBrightColorBehavior-module.html @@ -0,0 +1,163 @@ + + + + + SmootLight.behaviors.RandomSetBrightColorBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RandomSetBrightColorBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module RandomSetBrightColorBehavior

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + RandomSetBrightColorBehavior
+ Sets a random color that is bright. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RandomSetBrightColorBehavior-pysrc.html b/html/SmootLight.behaviors.RandomSetBrightColorBehavior-pysrc.html new file mode 100644 index 0000000..fb474c1 --- /dev/null +++ b/html/SmootLight.behaviors.RandomSetBrightColorBehavior-pysrc.html @@ -0,0 +1,127 @@ + + + + + SmootLight.behaviors.RandomSetBrightColorBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RandomSetBrightColorBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.RandomSetBrightColorBehavior

+
+ 1  from operationscore.Behavior import * 
+ 2  import util.ColorOps as color 
+ 3  import pdb 
+ 4  import colorsys 
+ 5  import random 
+
6 -class RandomSetBrightColorBehavior(Behavior): +
7 """Sets a random color that is bright.""" +
8 - def processResponse(self, sensorInputs, recursiveInputs): +
9 ret = [] +10 for sensory in sensorInputs: +11 newDict = dict(sensory) +12 newDict['Color'] = color.randomBrightColor() +13 ret.append(newDict) +14 return (ret, []) +
15 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RandomSetBrightColorBehavior.RandomSetBrightColorBehavior-class.html b/html/SmootLight.behaviors.RandomSetBrightColorBehavior.RandomSetBrightColorBehavior-class.html new file mode 100644 index 0000000..8654506 --- /dev/null +++ b/html/SmootLight.behaviors.RandomSetBrightColorBehavior.RandomSetBrightColorBehavior-class.html @@ -0,0 +1,293 @@ + + + + + SmootLight.behaviors.RandomSetBrightColorBehavior.RandomSetBrightColorBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RandomSetBrightColorBehavior :: + Class RandomSetBrightColorBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class RandomSetBrightColorBehavior

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    RandomSetBrightColorBehavior
+
+ +
+

Sets a random color that is bright.

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RandomWalk-module.html b/html/SmootLight.behaviors.RandomWalk-module.html new file mode 100644 index 0000000..8af1e4f --- /dev/null +++ b/html/SmootLight.behaviors.RandomWalk-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.behaviors.RandomWalk + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RandomWalk + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module RandomWalk

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + RandomWalk
+ Behavior to move the curent location by a random distance specified + by <StepSize> -- StepSize in units/response +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RandomWalk-pysrc.html b/html/SmootLight.behaviors.RandomWalk-pysrc.html new file mode 100644 index 0000000..625710b --- /dev/null +++ b/html/SmootLight.behaviors.RandomWalk-pysrc.html @@ -0,0 +1,132 @@ + + + + + SmootLight.behaviors.RandomWalk + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RandomWalk + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.RandomWalk

+
+ 1  from operationscore.Behavior import * 
+ 2  import util.ComponentRegistry as compReg 
+ 3  import util.Geo as Geo 
+ 4  import util.Strings as Strings 
+ 5  import random 
+ 6  import pdb 
+
7 -class RandomWalk(Behavior): +
8 """Behavior to move the curent location by a random distance specified by + 9 <StepSize> -- StepSize in units/response""" +10 +
11 - def processResponse(self, sensors, recursives): +
12 ret = [] +13 s = self['StepSize'] +14 for sensory in sensors: +15 step = [random.randint(-s,s), random.randint(-s,s)] +16 outdict = dict(sensory) +17 outdict[Strings.LOCATION] = Geo.addLocations(step, outdict[Strings.LOCATION]) +18 ret.append(outdict) +19 return (ret,recursives) +
20 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RandomWalk.RandomWalk-class.html b/html/SmootLight.behaviors.RandomWalk.RandomWalk-class.html new file mode 100644 index 0000000..a31efa6 --- /dev/null +++ b/html/SmootLight.behaviors.RandomWalk.RandomWalk-class.html @@ -0,0 +1,294 @@ + + + + + SmootLight.behaviors.RandomWalk.RandomWalk + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RandomWalk :: + Class RandomWalk + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class RandomWalk

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    RandomWalk
+
+ +
+

Behavior to move the curent location by a random distance specified by + <StepSize> -- StepSize in units/response

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensors, + recursives) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensors, + recursives) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RecursiveDecay-module.html b/html/SmootLight.behaviors.RecursiveDecay-module.html new file mode 100644 index 0000000..45d3a9a --- /dev/null +++ b/html/SmootLight.behaviors.RecursiveDecay-module.html @@ -0,0 +1,165 @@ + + + + + SmootLight.behaviors.RecursiveDecay + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RecursiveDecay + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module RecursiveDecay

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + RecursiveDecay
+ RecursiveDecay is an event to allow recursive hooks to stop + recursing after a certain number of iterations specified in + <InitialResponseCount> -- Int, number of total responses. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RecursiveDecay-pysrc.html b/html/SmootLight.behaviors.RecursiveDecay-pysrc.html new file mode 100644 index 0000000..ee3cc8a --- /dev/null +++ b/html/SmootLight.behaviors.RecursiveDecay-pysrc.html @@ -0,0 +1,131 @@ + + + + + SmootLight.behaviors.RecursiveDecay + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RecursiveDecay + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.RecursiveDecay

+
+ 1  from operationscore.Behavior import * 
+ 2  import pdb 
+
3 -class RecursiveDecay(Behavior): +
4 """RecursiveDecay is an event to allow recursive hooks to stop recursing after a certain number + 5 of iterations specified in + 6 <InitialResponseCount> -- Int, number of total responses. + 7 Designed to be used as part of a recursive hook. + 8 """ +
9 - def processResponse(self, sensorInputs, recursiveInputs): +
10 ret = [] +11 for response in sensorInputs: +12 if not 'ResponsesLeft' in response: +13 response['ResponsesLeft'] = self['InitialResponseCount'] +14 else: +15 response['ResponsesLeft'] -= 1 +16 if response['ResponsesLeft'] > 0: +17 ret.append(response) +18 return (ret, []) #no direct ouput +
19 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RecursiveDecay.RecursiveDecay-class.html b/html/SmootLight.behaviors.RecursiveDecay.RecursiveDecay-class.html new file mode 100644 index 0000000..be642b6 --- /dev/null +++ b/html/SmootLight.behaviors.RecursiveDecay.RecursiveDecay-class.html @@ -0,0 +1,296 @@ + + + + + SmootLight.behaviors.RecursiveDecay.RecursiveDecay + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RecursiveDecay :: + Class RecursiveDecay + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class RecursiveDecay

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    RecursiveDecay
+
+ +
+

RecursiveDecay is an event to allow recursive hooks to stop recursing + after a certain number of iterations specified in + <InitialResponseCount> -- Int, number of total responses. Designed + to be used as part of a recursive hook.

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ResponseMover-module.html b/html/SmootLight.behaviors.ResponseMover-module.html new file mode 100644 index 0000000..2820437 --- /dev/null +++ b/html/SmootLight.behaviors.ResponseMover-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.behaviors.ResponseMover + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ResponseMover + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module ResponseMover

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + ResponseMover
+ ResponseMover is a scaffold for behaviors that spawn 'walkers' + which act autonomously on input. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ResponseMover-pysrc.html b/html/SmootLight.behaviors.ResponseMover-pysrc.html new file mode 100644 index 0000000..c8a6c54 --- /dev/null +++ b/html/SmootLight.behaviors.ResponseMover-pysrc.html @@ -0,0 +1,123 @@ + + + + + SmootLight.behaviors.ResponseMover + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ResponseMover + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.ResponseMover

+
+ 1  import pdb 
+ 2  from operationscore.Behavior import * 
+ 3  import util.ComponentRegistry as compReg 
+
4 -class ResponseMover(Behavior): +
5 """ResponseMover is a scaffold for behaviors that spawn 'walkers' which act autonomously on input. + 6 To control the movment, use the behavior as part of a BehaviorChain and add a recursive hook which + 7 modulates the location.""" + 8 +
9 - def processResponse(self, sensorInputs, recursiveInputs): +
10 return (recursiveInputs, recursiveInputs+sensorInputs) +
11 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.ResponseMover.ResponseMover-class.html b/html/SmootLight.behaviors.ResponseMover.ResponseMover-class.html new file mode 100644 index 0000000..b7c447a --- /dev/null +++ b/html/SmootLight.behaviors.ResponseMover.ResponseMover-class.html @@ -0,0 +1,296 @@ + + + + + SmootLight.behaviors.ResponseMover.ResponseMover + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module ResponseMover :: + Class ResponseMover + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class ResponseMover

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    ResponseMover
+
+ +
+

ResponseMover is a scaffold for behaviors that spawn 'walkers' which + act autonomously on input. To control the movment, use the behavior as + part of a BehaviorChain and add a recursive hook which modulates the + location.

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RestrictLocation-module.html b/html/SmootLight.behaviors.RestrictLocation-module.html new file mode 100644 index 0000000..ec07681 --- /dev/null +++ b/html/SmootLight.behaviors.RestrictLocation-module.html @@ -0,0 +1,165 @@ + + + + + SmootLight.behaviors.RestrictLocation + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RestrictLocation + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module RestrictLocation

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + RestrictLocation
+ RestrictLocation is a Behavior which does an action -- A + ModifyParam, actually, when a certain location based condition is + met. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RestrictLocation-pysrc.html b/html/SmootLight.behaviors.RestrictLocation-pysrc.html new file mode 100644 index 0000000..8cdae37 --- /dev/null +++ b/html/SmootLight.behaviors.RestrictLocation-pysrc.html @@ -0,0 +1,159 @@ + + + + + SmootLight.behaviors.RestrictLocation + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RestrictLocation + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.RestrictLocation

+
+ 1  from operationscore.Behavior import * 
+ 2  import util.ComponentRegistry as compReg 
+ 3  from behaviors.ModifyParam import * 
+ 4  import util.Geo as Geo 
+ 5  import util.Strings as Strings 
+ 6  import random 
+ 7  import pdb 
+
8 -class RestrictLocation(Behavior): +
9 """RestrictLocation is a Behavior which does an action -- A ModifyParam, actually, when a certain +10 location based condition is met. It takes arguments as follows: +11 +12 <Action> -- Operation to perform, using ModifyParam syntax. Use {val} to reference the variable +13 specified by ParamName. +14 <ParamName> -- the name of the parameter to modify. +15 <LocationRestriction> -- either a tuple of (xmin,ymin,xmax,ymax) or a python-correct conditional. Use {x} and +16 {y} to reference x and y. Use &lt; and &gt; to get < and > in XML. EG: +17 <LocationRestriction>{x}&lt;0 or {x}&gt;800</LocationRestriction>""" +18 +
19 - def behaviorInit(self): +
20 action = self['Action'] +21 modifyParamArgs = {'ParamType': 'Sensor', +22 'ParamName':self['ParamName'],'ParamOp':self['Action']} +23 self.locBounds = self['LocationRestriction'] +24 self.paramModifier = ModifyParam(modifyParamArgs) +25 if isinstance(self.locBounds, str): +26 self.locBounds = self.locBounds.replace('{x}', 'l[0]') +27 self.locBounds = self.locBounds.replace('{y}', 'l[1]') +28 self.locEval = eval('lambda l:'+self.locBounds) +29 elif isinstance(self.locBounds, tuple): +30 if len(self.locBounds) != 4: +31 raise Exception('Must be in form (xmin,yin,xmax,ymax)') +32 else: +33 self.locEval = lambda l:Geo.pointWithinBoundingBox(l,\ +34 self.LocBounds) +
35 - def processResponse(self, sensorInputs, recursiveInputs): +
36 ret = [] +37 for data in sensorInputs: +38 if self.locEval(data['Location']): +39 (dataOut, recur) = self.paramModifier.immediateProcessInput([data], []) +40 #behaviors expect lists ^[] +41 ret += dataOut +42 else: +43 ret.append(data) +44 return (ret, []) +
45 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RestrictLocation.RestrictLocation-class.html b/html/SmootLight.behaviors.RestrictLocation.RestrictLocation-class.html new file mode 100644 index 0000000..a2bec09 --- /dev/null +++ b/html/SmootLight.behaviors.RestrictLocation.RestrictLocation-class.html @@ -0,0 +1,339 @@ + + + + + SmootLight.behaviors.RestrictLocation.RestrictLocation + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RestrictLocation :: + Class RestrictLocation + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class RestrictLocation

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    RestrictLocation
+
+ +
+

RestrictLocation is a Behavior which does an action -- A ModifyParam, + actually, when a certain location based condition is met. It takes + arguments as follows:

+

<Action> -- Operation to perform, using ModifyParam syntax. Use + {val} to reference the variable specified by ParamName. <ParamName> + -- the name of the parameter to modify. <LocationRestriction> -- + either a tuple of (xmin,ymin,xmax,ymax) or a python-correct conditional. + Use {x} and {y} to reference x and y. Use &lt; and &gt; to get + < and > in XML. EG: <LocationRestriction>{x}&lt;0 or + {x}&gt;800</LocationRestriction>

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
behaviorInit(self) + source code + +
+ +
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

behaviorInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.behaviorInit +
+
+
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RiseFall-module.html b/html/SmootLight.behaviors.RiseFall-module.html new file mode 100644 index 0000000..57c55a0 --- /dev/null +++ b/html/SmootLight.behaviors.RiseFall-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.behaviors.RiseFall + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RiseFall + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module RiseFall

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + RiseFall
+ RiseFall is a behavior that creates a rising and falling column of + light. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RiseFall-pysrc.html b/html/SmootLight.behaviors.RiseFall-pysrc.html new file mode 100644 index 0000000..c64e98e --- /dev/null +++ b/html/SmootLight.behaviors.RiseFall-pysrc.html @@ -0,0 +1,157 @@ + + + + + SmootLight.behaviors.RiseFall + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RiseFall + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.RiseFall

+
+ 1  from operationscore.Behavior import * 
+ 2  import math 
+ 3  import util.TimeOps as timeOps 
+ 4  #Required Args: 
+ 5  #Period (ms), MaxHeight, Width 
+
6 -class RiseFall(Behavior): +
7 """RiseFall is a behavior that creates a rising and falling column of light. Specify: + 8 <MaxHeight> -- the maximum height that it rises to. + 9 <Width> -- the width of the column OR <Left> and <Right> +10 <Period> -- the period of oscillation in ms +11 +12 Designed to be used as part of a recursive hook. +13 """ +14 +
15 - def processResponse(self, sensorInputs, recurInputs): +
16 ret = [] +17 for data in sensorInputs: +18 #first time with behavior: +19 data = dict(data) +20 if not 'StartTime' in data: +21 data['StartTime'] = timeOps.time() +22 data['Period'] = self['Period'] +23 data['MaxHeight'] = self['MaxHeight'] #Consider just using += +24 if not 'Bottom' in data: +25 data['Bottom'] = data['Location'][1] +26 if 'Width' in self: #TODO: improve +27 data['Width'] = self['Width'] +28 data['Left'] = data['Location'][0]-data['Width']/2. +29 data['Right'] = data['Location'][0]+data['Width']/2. +30 currentTime = timeOps.time() +31 deltaTime = currentTime-data['StartTime'] +32 #if data['Oscillate'] == True: +33 data['Height'] = data['MaxHeight']*math.sin(deltaTime/data['Period']*(math.pi*2)) +34 #else: +35 # data['Height'] = data['MaxHeight'] +36 #if (currentTime-data['StartTime']) > data['Period']: +37 # del data['StartTime'] +38 +39 data['Location'] = "{x}>"+str(data['Left']) + ", " +\ +40 "{x}<"+str(data['Right'])+", {y}<" + str(data['Bottom']) + ",\ +41 {y}>"+str(data['Bottom']-data['Height']) +42 +43 ret.append(data) +44 return (ret, []) +
45 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RiseFall.RiseFall-class.html b/html/SmootLight.behaviors.RiseFall.RiseFall-class.html new file mode 100644 index 0000000..ef08b2f --- /dev/null +++ b/html/SmootLight.behaviors.RiseFall.RiseFall-class.html @@ -0,0 +1,297 @@ + + + + + SmootLight.behaviors.RiseFall.RiseFall + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RiseFall :: + Class RiseFall + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class RiseFall

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    RiseFall
+
+ +
+

RiseFall is a behavior that creates a rising and falling column of + light. Specify: <MaxHeight> -- the maximum height that it rises + to. <Width> -- the width of the column OR <Left> and + <Right> <Period> -- the period of oscillation in ms

+

Designed to be used as part of a recursive hook.

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recurInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recurInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RunningBehavior-module.html b/html/SmootLight.behaviors.RunningBehavior-module.html new file mode 100644 index 0000000..7bd2ac0 --- /dev/null +++ b/html/SmootLight.behaviors.RunningBehavior-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.behaviors.RunningBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RunningBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module RunningBehavior

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + RunningBehavior
+ RunningBehavior is a straightforward behavior that makes a Location + run back and forth across a screen. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RunningBehavior-pysrc.html b/html/SmootLight.behaviors.RunningBehavior-pysrc.html new file mode 100644 index 0000000..80e3bca --- /dev/null +++ b/html/SmootLight.behaviors.RunningBehavior-pysrc.html @@ -0,0 +1,142 @@ + + + + + SmootLight.behaviors.RunningBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RunningBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.RunningBehavior

+
+ 1  from operationscore.Behavior import * 
+ 2  import util.ComponentRegistry as compReg 
+ 3  import util.Geo as Geo 
+ 4  import pdb 
+
5 -class RunningBehavior(Behavior): +
6 """RunningBehavior is a straightforward behavior that makes a Location run back and forth across + 7 a screen. Specify: + 8 <StepSize> -- the length of movment in units when the response moves. + 9 """ +10 +
11 - def processResponse(self, sensorInputs, recursiveInputs): +
12 newResponses = sensorInputs +13 ret = [] +14 ret += newResponses +15 for recurInput in recursiveInputs: +16 outDict = dict(recurInput) +17 if not 'Dir' in outDict: +18 outDict['Dir'] = 1 #to the right +19 if not 'StepSize' in outDict: +20 outDict['StepSize'] = self['StepSize'] +21 outDict['Location']= Geo.addLocations(outDict['Location'], +22 (outDict['StepSize']*outDict['Dir'],0)) +23 +24 if not Geo.pointWithinBoundingBox(outDict['Location'], \ +25 compReg.getComponent('Screen').getSize()): +26 outDict['Dir'] *= -1 +27 ret.append(outDict) +28 ret += newResponses +29 return (ret, ret) +
30 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.RunningBehavior.RunningBehavior-class.html b/html/SmootLight.behaviors.RunningBehavior.RunningBehavior-class.html new file mode 100644 index 0000000..f159f6e --- /dev/null +++ b/html/SmootLight.behaviors.RunningBehavior.RunningBehavior-class.html @@ -0,0 +1,295 @@ + + + + + SmootLight.behaviors.RunningBehavior.RunningBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module RunningBehavior :: + Class RunningBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class RunningBehavior

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    RunningBehavior
+
+ +
+

RunningBehavior is a straightforward behavior that makes a Location + run back and forth across a screen. Specify: <StepSize> -- the + length of movment in units when the response moves.

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Sink-module.html b/html/SmootLight.behaviors.Sink-module.html new file mode 100644 index 0000000..1def54d --- /dev/null +++ b/html/SmootLight.behaviors.Sink-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.behaviors.Sink + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Sink + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Sink

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Sink
+ RiseFall is a behavior that creates a rising and falling column of + light. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Sink-pysrc.html b/html/SmootLight.behaviors.Sink-pysrc.html new file mode 100644 index 0000000..0669a89 --- /dev/null +++ b/html/SmootLight.behaviors.Sink-pysrc.html @@ -0,0 +1,153 @@ + + + + + SmootLight.behaviors.Sink + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Sink + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.Sink

+
+ 1   
+ 2  from operationscore.Behavior import * 
+ 3  import math 
+ 4  import util.TimeOps as timeOps 
+ 5  #Required Args: 
+ 6  #Period (ms), MaxHeight, Width 
+
7 -class Sink(Behavior): +
8 """RiseFall is a behavior that creates a rising and falling column of light. Specify: + 9 <MaxHeight> -- the maximum height that it rises to. +10 <Width> -- the width of the column OR <Left> and <Right> +11 <Period> -- the period of oscillation in ms +12 +13 Designed to be used as part of a recursive hook. +14 """ +15 +
16 - def processResponse(self, sensorInputs, recurInputs): +
17 ret = [] +18 for data in sensorInputs: +19 #first time with behavior: +20 data = dict(data) +21 if not 'StartTime' in data: +22 data['StartTime'] = timeOps.time() +23 data['Period'] = self['Period'] +24 data['MaxHeight'] = self['MaxHeight'] #Consider just using += +25 if not 'Bottom' in data: +26 data['Bottom'] = data['Location'][1] +27 if 'Width' in self: #TODO: improve +28 data['Width'] = self['Width'] +29 data['Left'] = data['Location'][0]-data['Width']/2. +30 data['Right'] = data['Location'][0]+data['Width']/2. +31 currentTime = timeOps.time() +32 deltaTime = currentTime-data['StartTime'] +33 data['Height'] = data['MaxHeight']*math.cos(deltaTime/data['Period']*(math.pi*2)) +34 +35 data['Location'] = "{x}>"+str(data['Left']) + ", " +\ +36 "{x}<"+str(data['Right'])+", {y}<" + str(data['Bottom']) + ",\ +37 {y}>"+str(data['Bottom']-data['Height']) +38 +39 ret.append(data) +40 return (ret, []) +
41 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Sink.Sink-class.html b/html/SmootLight.behaviors.Sink.Sink-class.html new file mode 100644 index 0000000..49b068b --- /dev/null +++ b/html/SmootLight.behaviors.Sink.Sink-class.html @@ -0,0 +1,297 @@ + + + + + SmootLight.behaviors.Sink.Sink + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Sink :: + Class Sink + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Sink

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    Sink
+
+ +
+

RiseFall is a behavior that creates a rising and falling column of + light. Specify: <MaxHeight> -- the maximum height that it rises + to. <Width> -- the width of the column OR <Left> and + <Right> <Period> -- the period of oscillation in ms

+

Designed to be used as part of a recursive hook.

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recurInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recurInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.SmootWind-module.html b/html/SmootLight.behaviors.SmootWind-module.html new file mode 100644 index 0000000..f159e20 --- /dev/null +++ b/html/SmootLight.behaviors.SmootWind-module.html @@ -0,0 +1,162 @@ + + + + + SmootLight.behaviors.SmootWind + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module SmootWind + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module SmootWind

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + SmootWind +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.SmootWind-pysrc.html b/html/SmootLight.behaviors.SmootWind-pysrc.html new file mode 100644 index 0000000..695f302 --- /dev/null +++ b/html/SmootLight.behaviors.SmootWind-pysrc.html @@ -0,0 +1,156 @@ + + + + + SmootLight.behaviors.SmootWind + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module SmootWind + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.SmootWind

+
+ 1  from operationscore.Behavior import * 
+ 2  import util.ComponentRegistry as compReg 
+ 3  import random 
+ 4  
 
+
5 -class SmootWind(Behavior): +
6 - def behaviorInit(self): +
7 self.mapper = None + 8 self.xFor = None +
9 +
10 - def processResponse(self, sensorInputs, recursiveInputs): +
11 if self.mapper == None: +12 try: +13 self.mapper = compReg.getComponent('windgaussmap') +14 except KeyError: +15 pass +16 if self.xFor == None: +17 try: +18 self.xFor = compReg.getComponent('xfor') +19 except KeyError: +20 pass +21 +22 for sensory in sensorInputs: +23 print sensory +24 # input[0] is windspeed, [1] is dir +25 if 0 in sensory and 1 in sensory: +26 windSpeed = sensory[0] +27 windDir = sensory[1] +28 #print self.mapper.argDict +29 self.mapper.argDict['Width'] = self.mapper.argDict['Width']+float(windSpeed)*2+20 +30 self.xFor.argDict['ParamOp'] = self.xFor.argDict['ParamOp']+float(windSpeed)*3+10*random.random(); +31 #print 'Width: ' + str(self.mapper.argDict['Width']) +32 #print 'xFor: ' + str(self.xFor.argDict['ParamOp']) +33 +34 elif 'Key' in sensory: +35 if sensory['Key'] == 273: +36 self.mapper.argDict['Width'] = self.mapper.argDict['Width']+10; +37 self.xFor.argDict['ParamOp'] = self.xFor.argDict['ParamOp']+5; +38 +39 elif sensory['Key'] == 274: +40 self.mapper.argDict['Width'] = self.mapper.argDict['Width']-10; +41 self.xFor.argDict['ParamOp'] = self.xFor.argDict['ParamOp']-5; +42 +43 return (sensorInputs, recursiveInputs) +
44 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.SmootWind.SmootWind-class.html b/html/SmootLight.behaviors.SmootWind.SmootWind-class.html new file mode 100644 index 0000000..24f5354 --- /dev/null +++ b/html/SmootLight.behaviors.SmootWind.SmootWind-class.html @@ -0,0 +1,328 @@ + + + + + SmootLight.behaviors.SmootWind.SmootWind + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module SmootWind :: + Class SmootWind + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class SmootWind

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    SmootWind
+
+ +
+ + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
behaviorInit(self) + source code + +
+ +
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

behaviorInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.behaviorInit +
+
+
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Square-module.html b/html/SmootLight.behaviors.Square-module.html new file mode 100644 index 0000000..74c0d1a --- /dev/null +++ b/html/SmootLight.behaviors.Square-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.behaviors.Square + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Square + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Square

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Square
+ Square is a simple behavior that makes a square with side lengths + Width*2 around locations in the sensor input. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Square-pysrc.html b/html/SmootLight.behaviors.Square-pysrc.html new file mode 100644 index 0000000..56d0841 --- /dev/null +++ b/html/SmootLight.behaviors.Square-pysrc.html @@ -0,0 +1,138 @@ + + + + + SmootLight.behaviors.Square + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Square + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.Square

+
+ 1  from operationscore.Behavior import * 
+
2 -class Square(Behavior): +
3 """Square is a simple behavior that makes a square with side lengths Width*2 around locations in + 4 the sensor input. Specify: + 5 <Width> -- the sidelength/2 + 6 """ + 7 +
8 - def processResponse(self, sensorInputs, recursiveInputs): +
9 for sensory in sensorInputs:#TODO: consider replicating the dict +10 sensory['CenterLoc'] = list(sensory['Location']) +11 xLoc = sensory['Location'][0] +12 yLoc = sensory['Location'][1] +13 width = self['Width'] +14 #sensory['Location'] = 'True' +15 sensory['Location'] =\ +16 '{x}<'+str(xLoc+width)+',{x}>'+str(xLoc-width)+\ +17 ',{y}<'+str(yLoc+width)+',{y}>'+str(yLoc-width) +18 return (sensorInputs, recursiveInputs) +
19 +
20 - def setLastOutput(self, output): +
21 coutput = Behavior.deepCopyPacket(output) +22 for data in coutput: +23 data['Location'] = data['CenterLoc'] +24 return coutput +
25 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Square.Square-class.html b/html/SmootLight.behaviors.Square.Square-class.html new file mode 100644 index 0000000..bdec0d5 --- /dev/null +++ b/html/SmootLight.behaviors.Square.Square-class.html @@ -0,0 +1,342 @@ + + + + + SmootLight.behaviors.Square.Square + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Square :: + Class Square + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Square

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    Square
+
+ +
+

Square is a simple behavior that makes a square with side lengths + Width*2 around locations in the sensor input. Specify: <Width> -- + the sidelength/2

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+   + + + + + + +
setLastOutput(self, + output)
+ Override to modify state.
+ source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+ +
+ +
+ + +
+

setLastOutput(self, + output) +

+
source code  +
+ +

Override to modify state. For example: if you are using a behavior + that does uses strings for location specification, you will want to + override this to point to a single location. Make sure you keep + lastState as a [] of {}. (List of dicts). Additonally, ensure that you + call Behavior.deepCopyPacket on the packet before hand to avoid + inadvertent down-stream modifications. Look at Square.py for an example + of this.

+
+
Overrides: + operationscore.Behavior.Behavior.setLastOutput +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.SwitchBehavior-module.html b/html/SmootLight.behaviors.SwitchBehavior-module.html new file mode 100644 index 0000000..eec6784 --- /dev/null +++ b/html/SmootLight.behaviors.SwitchBehavior-module.html @@ -0,0 +1,163 @@ + + + + + SmootLight.behaviors.SwitchBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module SwitchBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module SwitchBehavior

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + SwitchBehavior
+ SwitchBehavior is a behavior that transform into different behaviors base on the input data. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.SwitchBehavior-pysrc.html b/html/SmootLight.behaviors.SwitchBehavior-pysrc.html new file mode 100644 index 0000000..c8d2f63 --- /dev/null +++ b/html/SmootLight.behaviors.SwitchBehavior-pysrc.html @@ -0,0 +1,190 @@ + + + + + SmootLight.behaviors.SwitchBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module SwitchBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.SwitchBehavior

+
+ 1  from operationscore.Behavior import * 
+ 2  import util.ComponentRegistry as compReg 
+ 3  import json 
+ 4   
+
5 -class SwitchBehavior(Behavior): +
6 """ + 7 SwitchBehavior is a behavior that transform into different behaviors base on the input data. + 8 The behavior expects a JSON formatted argument 'PrefixToBehavior' that maps prefixes to behaviors. The behavior detects the prefix on the data and use the corresponding Behavior to process the data and return the outputs. + 9 In Config file, include: +10 <PrefixToBehavior>JSON format dict with prefix keys and behavior ID values</PrefixToBehavior> +11 <DefaultBehavior>Default behavior's ID</DefaultBehavior> +12 An example config excerpt: +13 <Behavior> +14 <Class>behaviors.SwitchBehavior</Class> +15 <Args> +16 <Id>switch</Id> +17 <PrefixToBehavior>{'@':'game1', '#':'game2', '$':'game3'}</PrefixToBehavior> +18 <DefaultBehavior>game1</DefaultBehavior> +19 </Args> +20 </Behavior> +21 """ +
22 - def behaviorInit(self): +
23 self.defaultBehavior = compReg.getComponent(self['DefaultBehavior']) +24 self.prefixDict = json.loads(self['PrefixToBehavior']) +25 self.currBehavior = None +26 self.setBehavior(self.defaultBehavior) +
27 +
28 - def processResponse(self, sInputs, rInputs): +
29 dataStr = sInputs[-1]['Data'] +30 if dataStr[0] in self.prefixDict: +31 self.setBehavior(compReg.getComponent(self.prefixDict[dataStr[0]])) +32 sInputs[-1]['Data'] = sInputs[-1]['Data'][1:] # remove prefix +33 return self.currBehavior.processResponse(sInputs, rInputs) +
34 +
35 - def setBehavior(self, behavior): +
36 self.currBehavior = behavior +
37 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.SwitchBehavior.SwitchBehavior-class.html b/html/SmootLight.behaviors.SwitchBehavior.SwitchBehavior-class.html new file mode 100644 index 0000000..be5c1ad --- /dev/null +++ b/html/SmootLight.behaviors.SwitchBehavior.SwitchBehavior-class.html @@ -0,0 +1,364 @@ + + + + + SmootLight.behaviors.SwitchBehavior.SwitchBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module SwitchBehavior :: + Class SwitchBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class SwitchBehavior

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    SwitchBehavior
+
+ +
+
+
+SwitchBehavior is a behavior that transform into different behaviors base on the input data.
+The behavior expects a JSON formatted argument 'PrefixToBehavior' that maps prefixes to behaviors. The behavior detects the prefix on the data and use the corresponding Behavior to process the data and return the outputs.
+In Config file, include:
+  <PrefixToBehavior>JSON format dict with prefix keys and behavior ID values</PrefixToBehavior>
+  <DefaultBehavior>Default behavior's ID</DefaultBehavior>
+An example config excerpt:
+  <Behavior>
+    <Class>behaviors.SwitchBehavior</Class>
+      <Args>
+        <Id>switch</Id>
+        <PrefixToBehavior>{'@':'game1', '#':'game2', '$':'game3'}</PrefixToBehavior>
+        <DefaultBehavior>game1</DefaultBehavior>
+      </Args>
+  </Behavior>
+
+
+ + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
behaviorInit(self) + source code + +
+ +
+   + + + + + + +
processResponse(self, + sInputs, + rInputs) + source code + +
+ +
+   + + + + + + +
setBehavior(self, + behavior) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

behaviorInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.behaviorInit +
+
+
+
+ +
+ +
+ + +
+

processResponse(self, + sInputs, + rInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.SynchTest-module.html b/html/SmootLight.behaviors.SynchTest-module.html new file mode 100644 index 0000000..16676eb --- /dev/null +++ b/html/SmootLight.behaviors.SynchTest-module.html @@ -0,0 +1,162 @@ + + + + + SmootLight.behaviors.SynchTest + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module SynchTest + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module SynchTest

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + SynchTest +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.SynchTest-pysrc.html b/html/SmootLight.behaviors.SynchTest-pysrc.html new file mode 100644 index 0000000..9f9f0e7 --- /dev/null +++ b/html/SmootLight.behaviors.SynchTest-pysrc.html @@ -0,0 +1,127 @@ + + + + + SmootLight.behaviors.SynchTest + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module SynchTest + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.SynchTest

+
+ 1  from operationscore.Behavior import * 
+ 2  from pixelevents.SynchTestEvent import * 
+ 3  import pdb 
+
4 -class SynchTest(Behavior): +
5 - def behaviorInit(self): +
6 self.rendered = False +
7 - def processResponse(self, sensorInputs, recurs): +
8 if not self.rendered: + 9 self.rendered = True +10 print 'here1' +11 return ([{'Location':'True', 'PixelEvent':SynchTestEvent({'Color':(255,0,0)})}], []) +12 return ([], []) +
13 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.SynchTest.SynchTest-class.html b/html/SmootLight.behaviors.SynchTest.SynchTest-class.html new file mode 100644 index 0000000..70e1413 --- /dev/null +++ b/html/SmootLight.behaviors.SynchTest.SynchTest-class.html @@ -0,0 +1,328 @@ + + + + + SmootLight.behaviors.SynchTest.SynchTest + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module SynchTest :: + Class SynchTest + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class SynchTest

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    SynchTest
+
+ +
+ + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
behaviorInit(self) + source code + +
+ +
+   + + + + + + +
processResponse(self, + sensorInputs, + recurs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

behaviorInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.behaviorInit +
+
+
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recurs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.TimeSwitch-module.html b/html/SmootLight.behaviors.TimeSwitch-module.html new file mode 100644 index 0000000..73a4d2c --- /dev/null +++ b/html/SmootLight.behaviors.TimeSwitch-module.html @@ -0,0 +1,157 @@ + + + + + SmootLight.behaviors.TimeSwitch + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module TimeSwitch + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module TimeSwitch

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + TimeSwitch
+ TimeSwitch is a behavior that alternates between different behaviors for a set amount of time +(specify time in seconds. +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.TimeSwitch-pysrc.html b/html/SmootLight.behaviors.TimeSwitch-pysrc.html new file mode 100644 index 0000000..ab577fc --- /dev/null +++ b/html/SmootLight.behaviors.TimeSwitch-pysrc.html @@ -0,0 +1,223 @@ + + + + + SmootLight.behaviors.TimeSwitch + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module TimeSwitch + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.TimeSwitch

+
+ 1  from operationscore.Behavior import * 
+ 2  import util.TimeOps as clock 
+ 3  import util.ComponentRegistry as compReg 
+ 4  from logger import main_log 
+
5 -class TimeSwitch(Behavior): +
6 """TimeSwitch is a behavior that alternates between different behaviors for a set amount of time + 7 (specify time in seconds. Specify in a python-style dict: + 8 <Behaviors>{'behaviorId1':60, 'behaviorId2':120}</Behaviors> + 9 Would alternate between the 2 behaviors, spending 1 minute on b1 and 2 minutes on b2. +10 """ +
11 - def behaviorInit(self): +
12 self.keyIndex = 0 +13 self.currentBehaviorId = self['TimeMap'].keys()[self.keyIndex] +14 self.behaviorStart = clock.time() +
15 +
16 - def processResponse(self, sensors, recurs): +
17 if self.behaviorStart + self['TimeMap'][self.currentBehaviorId]*1000 <= clock.time(): +18 self.keyIndex += 1 +19 self.keyIndex = self.keyIndex % len(self['TimeMap']) +20 self.currentBehaviorId = self['TimeMap'].keys()[self.keyIndex] +21 self.behaviorStart = clock.time() +22 main_log.info('Switching behaviors') +23 sensors = [s for s in sensors if s['InputId'] == self['InputMap'][self.currentBehaviorId]] +24 return compReg.getComponent(self.currentBehaviorId).immediateProcessInput(sensors, recurs) +
25 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.TimeSwitch.TimeSwitch-class.html b/html/SmootLight.behaviors.TimeSwitch.TimeSwitch-class.html new file mode 100644 index 0000000..bb5fcfc --- /dev/null +++ b/html/SmootLight.behaviors.TimeSwitch.TimeSwitch-class.html @@ -0,0 +1,336 @@ + + + + + SmootLight.behaviors.TimeSwitch.TimeSwitch + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module TimeSwitch :: + Class TimeSwitch + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class TimeSwitch

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    TimeSwitch
+
+ +
+
+TimeSwitch is a behavior that alternates between different behaviors for a set amount of time
+(specify time in seconds.  Specify in a python-style dict:
+    <Behaviors>{'behaviorId1':60, 'behaviorId2':120}</Behaviors>
+Would alternate between the 2 behaviors, spending 1 minute on b1 and 2 minutes on b2.
+
+
+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
behaviorInit(self) + source code + +
+ +
+   + + + + + + +
processResponse(self, + sensors, + recurs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

behaviorInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.behaviorInit +
+
+
+
+ +
+ +
+ + +
+

processResponse(self, + sensors, + recurs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.TimedDie-module.html b/html/SmootLight.behaviors.TimedDie-module.html new file mode 100644 index 0000000..36c2c53 --- /dev/null +++ b/html/SmootLight.behaviors.TimedDie-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.behaviors.TimedDie + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module TimedDie + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module TimedDie

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Timeout
+ Timeout is a behavior designed to be used in recursive hooks to + stop responses after a certain amount of time. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.TimedDie-pysrc.html b/html/SmootLight.behaviors.TimedDie-pysrc.html new file mode 100644 index 0000000..7977a6b --- /dev/null +++ b/html/SmootLight.behaviors.TimedDie-pysrc.html @@ -0,0 +1,128 @@ + + + + + SmootLight.behaviors.TimedDie + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module TimedDie + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.TimedDie

+
+ 1  from operationscore.Behavior import * 
+
2 -class Timeout(Behavior): +
3 """Timeout is a behavior designed to be used in recursive hooks to stop responses after a certain + 4 amount of time. It is the Time-version of RecursiveDecay. Specify: + 5 <TimeOut> -- the time in ms that the response will run. + 6 """ + 7 +
8 - def processResponse(self, sensorInputs, recur): +
9 ret = [] +10 for data in sensorInputs: +11 if not 'StartTime' in data: +12 data['StartTime'] = timeops.time() +13 if timeops.time()-data['StartTime'] < self['Timeout']: +14 ret.append(data) +15 return (ret, []) +
16 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.TimedDie.Timeout-class.html b/html/SmootLight.behaviors.TimedDie.Timeout-class.html new file mode 100644 index 0000000..974997f --- /dev/null +++ b/html/SmootLight.behaviors.TimedDie.Timeout-class.html @@ -0,0 +1,296 @@ + + + + + SmootLight.behaviors.TimedDie.Timeout + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module TimedDie :: + Class Timeout + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Timeout

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    Timeout
+
+ +
+

Timeout is a behavior designed to be used in recursive hooks to stop + responses after a certain amount of time. It is the Time-version of + RecursiveDecay. Specify: <TimeOut> -- the time in ms that the + response will run.

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recur) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recur) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Timeout-module.html b/html/SmootLight.behaviors.Timeout-module.html new file mode 100644 index 0000000..5381905 --- /dev/null +++ b/html/SmootLight.behaviors.Timeout-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.behaviors.Timeout + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Timeout + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Timeout

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Timeout
+ Timeout is a behavior designed to be used in recursive hooks to + stop responses after a certain amount of time. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Timeout-pysrc.html b/html/SmootLight.behaviors.Timeout-pysrc.html new file mode 100644 index 0000000..18b9b32 --- /dev/null +++ b/html/SmootLight.behaviors.Timeout-pysrc.html @@ -0,0 +1,129 @@ + + + + + SmootLight.behaviors.Timeout + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Timeout + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.Timeout

+
+ 1  from operationscore.Behavior import * 
+ 2  import util.TimeOps as timeops 
+
3 -class Timeout(Behavior): +
4 """Timeout is a behavior designed to be used in recursive hooks to stop responses after a certain + 5 amount of time. It is the Time-version of RecursiveDecay. Specify: + 6 <TimeOut> -- the time in ms that the response will run. + 7 """ + 8 +
9 - def processResponse(self,sensorInputs, recur): +
10 ret = [] +11 for data in sensorInputs: +12 if not 'StartTime' in data: +13 data['StartTime'] = timeops.time() +14 if timeops.time()-data['StartTime'] < self['Timeout']: +15 ret.append(data) +16 return (ret,[]) +
17 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.Timeout.Timeout-class.html b/html/SmootLight.behaviors.Timeout.Timeout-class.html new file mode 100644 index 0000000..cf4f5a3 --- /dev/null +++ b/html/SmootLight.behaviors.Timeout.Timeout-class.html @@ -0,0 +1,296 @@ + + + + + SmootLight.behaviors.Timeout.Timeout + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module Timeout :: + Class Timeout + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Timeout

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    Timeout
+
+ +
+

Timeout is a behavior designed to be used in recursive hooks to stop + responses after a certain amount of time. It is the Time-version of + RecursiveDecay. Specify: <TimeOut> -- the time in ms that the + response will run.

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensorInputs, + recur) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recur) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.TouchOSC-module.html b/html/SmootLight.behaviors.TouchOSC-module.html new file mode 100644 index 0000000..d026b1b --- /dev/null +++ b/html/SmootLight.behaviors.TouchOSC-module.html @@ -0,0 +1,155 @@ + + + + + SmootLight.behaviors.TouchOSC + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module TouchOSC + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module TouchOSC

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + TouchOSC +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.TouchOSC-pysrc.html b/html/SmootLight.behaviors.TouchOSC-pysrc.html new file mode 100644 index 0000000..4137a70 --- /dev/null +++ b/html/SmootLight.behaviors.TouchOSC-pysrc.html @@ -0,0 +1,233 @@ + + + + + SmootLight.behaviors.TouchOSC + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module TouchOSC + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.TouchOSC

+
+ 1  from operationscore.Behavior import *  
+ 2  from logger import main_log 
+ 3  #import util.ColorOps as color  
+ 4  import colorsys 
+ 5  import pdb 
+ 6  import util.ComponentRegistry as compReg 
+
7 -class TouchOSC(Behavior): +
8 - def behaviorInit(self): +
9 self.h=0 +10 self.s=0 +11 self.v=0 +12 self.xy = (-1,-1) +
13 - def processResponse(self, sensorInputs, recursiveInputs): +
14 ret = [] +15 if sensorInputs: +16 data = sensorInputs[-1]#for data in sensorInputs: +17 if data['Path'] == '/1/fader1': +18 try: +19 self.h = data['Value'][0] +20 except: +21 pdb.set_trace() +22 elif data['Path'] == '/1/fader2': +23 self.s = data['Value'][0] +24 elif data['Path'] == '/1/fader3': +25 self.v = data['Value'][0] +26 elif data['Path'] == '/1/xy': +27 val=data['Value'] +28 ssize = compReg.getComponent('Screen').getSize()[-2:] #896 x 310 +29 self.xy = (val[1]*ssize[0], (1.0-val[0])*ssize[1]) +30 else: +31 main_log.error('Sensor Inputs: ' + str(sensorInputs)) +32 ret.append({'Color':[i*255 for i in colorsys.hsv_to_rgb(self.h,self.s,self.v)],'Location':self.xy}) +33 +34 return (ret, []) +
35 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.TouchOSC.TouchOSC-class.html b/html/SmootLight.behaviors.TouchOSC.TouchOSC-class.html new file mode 100644 index 0000000..6ebbc30 --- /dev/null +++ b/html/SmootLight.behaviors.TouchOSC.TouchOSC-class.html @@ -0,0 +1,328 @@ + + + + + SmootLight.behaviors.TouchOSC.TouchOSC + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module TouchOSC :: + Class TouchOSC + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class TouchOSC

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    TouchOSC
+
+ +
+ + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
behaviorInit(self) + source code + +
+ +
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

behaviorInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.behaviorInit +
+
+
+
+ +
+ +
+ + +
+

processResponse(self, + sensorInputs, + recursiveInputs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.VerticalBar-module.html b/html/SmootLight.behaviors.VerticalBar-module.html new file mode 100644 index 0000000..750e035 --- /dev/null +++ b/html/SmootLight.behaviors.VerticalBar-module.html @@ -0,0 +1,162 @@ + + + + + SmootLight.behaviors.VerticalBar + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module VerticalBar + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module VerticalBar

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + VerticalBar +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.VerticalBar-pysrc.html b/html/SmootLight.behaviors.VerticalBar-pysrc.html new file mode 100644 index 0000000..866cee7 --- /dev/null +++ b/html/SmootLight.behaviors.VerticalBar-pysrc.html @@ -0,0 +1,134 @@ + + + + + SmootLight.behaviors.VerticalBar + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module VerticalBar + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.VerticalBar

+
+ 1  from operationscore.Behavior import * 
+
2 -class VerticalBar(Behavior): +
3 +
4 - def processResponse(self, inputs, recurs): +
5 ret = [] + 6 inputs = list(inputs) + 7 for inputset in inputs: + 8 inputset = dict(inputset) + 9 if 'xLoc' not in inputset: +10 inputset['xLoc'] = inputset['Location'][0] +11 xLoc = inputset['xLoc'] +12 +13 condition = '{x} == ' + str(xLoc) +14 +15 if self['Combine']: +16 inputset['Location'] += ',' + condition +17 else: +18 inputset['Location'] = condition +19 +20 ret.append(inputset) +21 return (ret, []) +
22 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.VerticalBar.VerticalBar-class.html b/html/SmootLight.behaviors.VerticalBar.VerticalBar-class.html new file mode 100644 index 0000000..ab56c9d --- /dev/null +++ b/html/SmootLight.behaviors.VerticalBar.VerticalBar-class.html @@ -0,0 +1,291 @@ + + + + + SmootLight.behaviors.VerticalBar.VerticalBar + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module VerticalBar :: + Class VerticalBar + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class VerticalBar

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    VerticalBar
+
+ +
+ + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + inputs, + recurs) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + inputs, + recurs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.XYMove-module.html b/html/SmootLight.behaviors.XYMove-module.html new file mode 100644 index 0000000..4444daf --- /dev/null +++ b/html/SmootLight.behaviors.XYMove-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.behaviors.XYMove + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module XYMove + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module XYMove

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + XYMove
+ XYMove is a behavior designed to be used as a recursive hook to + ResponseMover to move pixels by XStep and YStep. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.behaviors' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.XYMove-pysrc.html b/html/SmootLight.behaviors.XYMove-pysrc.html new file mode 100644 index 0000000..31aee5b --- /dev/null +++ b/html/SmootLight.behaviors.XYMove-pysrc.html @@ -0,0 +1,136 @@ + + + + + SmootLight.behaviors.XYMove + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module XYMove + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.behaviors.XYMove

+
+ 1  from operationscore.Behavior import * 
+ 2  import util.Geo as Geo 
+
3 -class XYMove(Behavior): +
4 """XYMove is a behavior designed to be used as a recursive hook to ResponseMover to move pixels by + 5 XStep and YStep. As XStep and YStep are maintained in the responses itself, they can be + 6 modulated to facilitate, acceleration, modulation, bouncing, etc. Specify: + 7 <XStep> -- the starting XStep + 8 <YStep> -- the starting YStep + 9 """ +10 +
11 - def processResponse(self, sensor, recurs): +
12 ret = [] +13 for loc in sensor: +14 oploc = dict(loc) +15 self.insertStepIfMissing(oploc) +16 oploc['Location'] = Geo.addLocations((oploc['XStep'], oploc['YStep']), oploc['Location']) +17 ret.append(oploc) +18 return (ret, []) +
19 - def insertStepIfMissing(self, data): +
20 if not 'XStep' in data: +21 data['XStep'] = self['XStep'] +22 if not 'YStep' in data: +23 data['YStep'] = self['YStep'] +
24 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.behaviors.XYMove.XYMove-class.html b/html/SmootLight.behaviors.XYMove.XYMove-class.html new file mode 100644 index 0000000..c738852 --- /dev/null +++ b/html/SmootLight.behaviors.XYMove.XYMove-class.html @@ -0,0 +1,314 @@ + + + + + SmootLight.behaviors.XYMove.XYMove + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package behaviors :: + Module XYMove :: + Class XYMove + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class XYMove

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Behavior.Behavior --+
+                                                     |
+                                                    XYMove
+
+ +
+

XYMove is a behavior designed to be used as a recursive hook to + ResponseMover to move pixels by XStep and YStep. As XStep and YStep are + maintained in the responses itself, they can be modulated to facilitate, + acceleration, modulation, bouncing, etc. Specify: <XStep> -- the + starting XStep <YStep> -- the starting YStep

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
processResponse(self, + sensor, + recurs) + source code + +
+ +
+   + + + + + + +
insertStepIfMissing(self, + data) + source code + +
+ +
+

Inherited from operationscore.Behavior.Behavior: + addInput, + addInputs, + addMapper, + addMapperToResponse, + behaviorInit, + getLastOutput, + immediateProcessInput, + init, + setLastOutput, + timeStep +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.Behavior.Behavior: + deepCopyPacket +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

processResponse(self, + sensor, + recurs) +

+
source code  +
+ + +
+
Overrides: + operationscore.Behavior.Behavior.processResponse +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs-module.html b/html/SmootLight.inputs-module.html new file mode 100644 index 0000000..057ae18 --- /dev/null +++ b/html/SmootLight.inputs-module.html @@ -0,0 +1,161 @@ + + + + + SmootLight.inputs + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Package inputs

source code

+ + + + + + + +
+ + + + + +
Submodules[hide private]
+
+
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = None +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs-pysrc.html b/html/SmootLight.inputs-pysrc.html new file mode 100644 index 0000000..a76786c --- /dev/null +++ b/html/SmootLight.inputs-pysrc.html @@ -0,0 +1,112 @@ + + + + + SmootLight.inputs + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Package SmootLight.inputs

+
+1   
+2   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.ContinuousCenterInput-module.html b/html/SmootLight.inputs.ContinuousCenterInput-module.html new file mode 100644 index 0000000..2678a74 --- /dev/null +++ b/html/SmootLight.inputs.ContinuousCenterInput-module.html @@ -0,0 +1,169 @@ + + + + + SmootLight.inputs.ContinuousCenterInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module ContinuousCenterInput + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module ContinuousCenterInput

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + ContinuousCenterInput +
+ + + + + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.inputs' +
+   + + exception_log = logging.getLogger("exception") +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.ContinuousCenterInput-pysrc.html b/html/SmootLight.inputs.ContinuousCenterInput-pysrc.html new file mode 100644 index 0000000..0a2a3d3 --- /dev/null +++ b/html/SmootLight.inputs.ContinuousCenterInput-pysrc.html @@ -0,0 +1,126 @@ + + + + + SmootLight.inputs.ContinuousCenterInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module ContinuousCenterInput + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.inputs.ContinuousCenterInput

+
+ 1  import util.TimeOps as clock 
+ 2  import util.ComponentRegistry as compReg 
+ 3  import util.Strings as Strings 
+ 4  from operationscore.Input import * 
+
5 -class ContinuousCenterInput(Input): +
6 - def inputInit(self): +
7 compReg.getLock().acquire() + 8 minX,minY,maxX,maxY = compReg.getComponent('Screen').getSize() + 9 compReg.getLock().release() +10 self.center = ((minX+maxX) / 2, (minY+maxY) / 2) +
11 - def sensingLoop(self): +
12 self.respond({Strings.LOCATION: self.center}) +
13 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.ContinuousCenterInput.ContinuousCenterInput-class.html b/html/SmootLight.inputs.ContinuousCenterInput.ContinuousCenterInput-class.html new file mode 100644 index 0000000..d36b153 --- /dev/null +++ b/html/SmootLight.inputs.ContinuousCenterInput.ContinuousCenterInput-class.html @@ -0,0 +1,326 @@ + + + + + SmootLight.inputs.ContinuousCenterInput.ContinuousCenterInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module ContinuousCenterInput :: + Class ContinuousCenterInput + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class ContinuousCenterInput

source code

+
+                                                object --+            
+                                                         |            
+            operationscore.SmootCoreObject.SmootCoreObject --+        
+                                                             |        
+                                            object --+       |        
+                                                     |       |        
+                                    threading._Verbose --+   |        
+                                                         |   |        
+                                          threading.Thread --+        
+                                                             |        
+operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject --+    
+                                                                 |    
+                                        operationscore.Input.Input --+
+                                                                     |
+                                                                    ContinuousCenterInput
+
+ +
+ + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
inputInit(self) + source code + +
+ +
+   + + + + + + +
sensingLoop(self) + source code + +
+ +
+

Inherited from operationscore.Input.Input: + init, + parentAlive, + respond, + run +

+

Inherited from operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject: + __init__ +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from threading.Thread: + __repr__, + getName, + isAlive, + isDaemon, + is_alive, + join, + setDaemon, + setName, + start +

+

Inherited from threading.Thread (private): + _set_daemon, + _set_ident +

+

Inherited from threading._Verbose (private): + _note +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from threading.Thread: + daemon, + ident, + name +

+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

inputInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Input.Input.inputInit +
+
+
+
+ +
+ +
+ + +
+

sensingLoop(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Input.Input.sensingLoop +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.ContinuousLocationInput-module.html b/html/SmootLight.inputs.ContinuousLocationInput-module.html new file mode 100644 index 0000000..e6e4afc --- /dev/null +++ b/html/SmootLight.inputs.ContinuousLocationInput-module.html @@ -0,0 +1,172 @@ + + + + + SmootLight.inputs.ContinuousLocationInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module ContinuousLocationInput + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module ContinuousLocationInput

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + ContinuousLocationInput
+ Continuously returns one of nine positions on the screen as + specified by the xloc and yloc arguments, which can take values + 'min', 'max', and 'center'. +
+ + + + + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.inputs' +
+   + + exception_log = logging.getLogger("exception") +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.ContinuousLocationInput-pysrc.html b/html/SmootLight.inputs.ContinuousLocationInput-pysrc.html new file mode 100644 index 0000000..788665b --- /dev/null +++ b/html/SmootLight.inputs.ContinuousLocationInput-pysrc.html @@ -0,0 +1,133 @@ + + + + + SmootLight.inputs.ContinuousLocationInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module ContinuousLocationInput + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.inputs.ContinuousLocationInput

+
+ 1  import util.TimeOps as clock 
+ 2  import util.ComponentRegistry as compReg 
+ 3  import util.Strings as Strings 
+ 4  from operationscore.Input import * 
+
5 -class ContinuousLocationInput(Input): +
6 '''Continuously returns one of nine positions on the screen as specified by the xloc + 7 and yloc arguments, which can take values 'min', 'max', and 'center'. ''' +
8 - def inputInit(self): +
9 xvals = {} +10 yvals = {} +11 compReg.getLock().acquire() +12 xvals['left'], yvals['bottom'], xvals['right'], yvals['top'] = compReg.getComponent('Screen').getSize() +13 compReg.getLock().release() +14 (xvals['center'], yvals['center']) = ((xvals['left']+xvals['right']) / 2, (yvals['top']+yvals['bottom']) / 2) +15 +16 self.location = (xvals[self['xloc']], yvals[self['yloc']]) +
17 +
18 - def sensingLoop(self): +
19 self.respond({Strings.LOCATION: self.location}) +
20 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.ContinuousLocationInput.ContinuousLocationInput-class.html b/html/SmootLight.inputs.ContinuousLocationInput.ContinuousLocationInput-class.html new file mode 100644 index 0000000..618b606 --- /dev/null +++ b/html/SmootLight.inputs.ContinuousLocationInput.ContinuousLocationInput-class.html @@ -0,0 +1,330 @@ + + + + + SmootLight.inputs.ContinuousLocationInput.ContinuousLocationInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module ContinuousLocationInput :: + Class ContinuousLocationInput + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class ContinuousLocationInput

source code

+
+                                                object --+            
+                                                         |            
+            operationscore.SmootCoreObject.SmootCoreObject --+        
+                                                             |        
+                                            object --+       |        
+                                                     |       |        
+                                    threading._Verbose --+   |        
+                                                         |   |        
+                                          threading.Thread --+        
+                                                             |        
+operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject --+    
+                                                                 |    
+                                        operationscore.Input.Input --+
+                                                                     |
+                                                                    ContinuousLocationInput
+
+ +
+

Continuously returns one of nine positions on the screen as specified + by the xloc and yloc arguments, which can take values 'min', 'max', and + 'center'.

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
inputInit(self) + source code + +
+ +
+   + + + + + + +
sensingLoop(self) + source code + +
+ +
+

Inherited from operationscore.Input.Input: + init, + parentAlive, + respond, + run +

+

Inherited from operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject: + __init__ +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from threading.Thread: + __repr__, + getName, + isAlive, + isDaemon, + is_alive, + join, + setDaemon, + setName, + start +

+

Inherited from threading.Thread (private): + _set_daemon, + _set_ident +

+

Inherited from threading._Verbose (private): + _note +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from threading.Thread: + daemon, + ident, + name +

+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

inputInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Input.Input.inputInit +
+
+
+
+ +
+ +
+ + +
+

sensingLoop(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Input.Input.sensingLoop +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.HTMLInput-module.html b/html/SmootLight.inputs.HTMLInput-module.html new file mode 100644 index 0000000..0603fe1 --- /dev/null +++ b/html/SmootLight.inputs.HTMLInput-module.html @@ -0,0 +1,169 @@ + + + + + SmootLight.inputs.HTMLInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module HTMLInput + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module HTMLInput

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + HTMLInput +
+ + + + + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.inputs' +
+   + + exception_log = logging.getLogger("exception") +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.HTMLInput-pysrc.html b/html/SmootLight.inputs.HTMLInput-pysrc.html new file mode 100644 index 0000000..44e7e06 --- /dev/null +++ b/html/SmootLight.inputs.HTMLInput-pysrc.html @@ -0,0 +1,142 @@ + + + + + SmootLight.inputs.HTMLInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module HTMLInput + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.inputs.HTMLInput

+
+ 1  from operationscore.Input import * 
+ 2  import urllib, re 
+ 3   
+ 4  """ 
+ 5  HTML Input, which takes 2 arguments: 
+ 6  - 'Src': a URL to a web page, and 
+ 7  - 'Regex': a Regex to parse data out of the web page. 
+ 8  The input parses the source code of the web page according to the regex, and processes the parsed regex groups. 
+ 9  """ 
+
10 -class HTMLInput(Input): +
11 - def inputInit(self): +
12 self.src = self.argDict['Src'] +13 self.regex = self.argDict['Regex'] +
14 +
15 - def getHTML(self): +
16 self.sock = urllib.urlopen(self.src); +17 self.html = self.sock.read() +18 self.sock.close() +
19 +
20 - def sensingLoop(self): +
21 self.getHTML() +22 self.dataList = [] +23 +24 pattern = re.compile(self.regex) +25 matchObj = pattern.search(self.html) +26 self.dataList = matchObj.groups() +27 +28 self.respond(self.dataList) +
29 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.HTMLInput.HTMLInput-class.html b/html/SmootLight.inputs.HTMLInput.HTMLInput-class.html new file mode 100644 index 0000000..0fef4f2 --- /dev/null +++ b/html/SmootLight.inputs.HTMLInput.HTMLInput-class.html @@ -0,0 +1,342 @@ + + + + + SmootLight.inputs.HTMLInput.HTMLInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module HTMLInput :: + Class HTMLInput + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class HTMLInput

source code

+
+                                                object --+            
+                                                         |            
+            operationscore.SmootCoreObject.SmootCoreObject --+        
+                                                             |        
+                                            object --+       |        
+                                                     |       |        
+                                    threading._Verbose --+   |        
+                                                         |   |        
+                                          threading.Thread --+        
+                                                             |        
+operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject --+    
+                                                                 |    
+                                        operationscore.Input.Input --+
+                                                                     |
+                                                                    HTMLInput
+
+ +
+ + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
inputInit(self) + source code + +
+ +
+   + + + + + + +
getHTML(self) + source code + +
+ +
+   + + + + + + +
sensingLoop(self) + source code + +
+ +
+

Inherited from operationscore.Input.Input: + init, + parentAlive, + respond, + run +

+

Inherited from operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject: + __init__ +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from threading.Thread: + __repr__, + getName, + isAlive, + isDaemon, + is_alive, + join, + setDaemon, + setName, + start +

+

Inherited from threading.Thread (private): + _set_daemon, + _set_ident +

+

Inherited from threading._Verbose (private): + _note +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from threading.Thread: + daemon, + ident, + name +

+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

inputInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Input.Input.inputInit +
+
+
+
+ +
+ +
+ + +
+

sensingLoop(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Input.Input.sensingLoop +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.OSCInput-module.html b/html/SmootLight.inputs.OSCInput-module.html new file mode 100644 index 0000000..e484e60 --- /dev/null +++ b/html/SmootLight.inputs.OSCInput-module.html @@ -0,0 +1,162 @@ + + + + + SmootLight.inputs.OSCInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module OSCInput + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module OSCInput

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + OSCInput +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.inputs' +
+   + + exception_log = logging.getLogger("exception") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.OSCInput-pysrc.html b/html/SmootLight.inputs.OSCInput-pysrc.html new file mode 100644 index 0000000..2350415 --- /dev/null +++ b/html/SmootLight.inputs.OSCInput-pysrc.html @@ -0,0 +1,179 @@ + + + + + SmootLight.inputs.OSCInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module OSCInput + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.inputs.OSCInput

+
+ 1  from operationscore.Input import * 
+ 2  import liblo 
+ 3  from logger import main_log 
+ 4   
+ 5   
+
6 -class OSCInput(Input): +
7 - def inputInit(self): +
8 HOST = '' # Symbolic name meaning all available interfaces + 9 PORT = self['Port'] # Arbitrary non-privileged port +10 self.server = liblo.Server(PORT) +11 self.server.add_method(None,None, self.fallback) +
12 # except liblo.ServerError, err: +13 # main_log.error(str(err)) +14 +
15 - def fallback(self,path,args,types, src): +
16 self.respond({'Path':path,'Type':types,'Value':args}) +
17 - def sensingLoop(self): +
18 self.server.recv(100) +19 pass#(data,address) = self.sock.recvfrom(1024) +
20 #dataDict = {'data':data, 'address':address} +21 #self.respond(dataDict) +22 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.OSCInput.OSCInput-class.html b/html/SmootLight.inputs.OSCInput.OSCInput-class.html new file mode 100644 index 0000000..0d6db92 --- /dev/null +++ b/html/SmootLight.inputs.OSCInput.OSCInput-class.html @@ -0,0 +1,346 @@ + + + + + SmootLight.inputs.OSCInput.OSCInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module OSCInput :: + Class OSCInput + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class OSCInput

source code

+
+                                                object --+            
+                                                         |            
+            operationscore.SmootCoreObject.SmootCoreObject --+        
+                                                             |        
+                                            object --+       |        
+                                                     |       |        
+                                    threading._Verbose --+   |        
+                                                         |   |        
+                                          threading.Thread --+        
+                                                             |        
+operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject --+    
+                                                                 |    
+                                        operationscore.Input.Input --+
+                                                                     |
+                                                                    OSCInput
+
+ +
+ + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
inputInit(self) + source code + +
+ +
+   + + + + + + +
fallback(self, + path, + args, + types, + src) + source code + +
+ +
+   + + + + + + +
sensingLoop(self) + source code + +
+ +
+

Inherited from operationscore.Input.Input: + init, + parentAlive, + respond, + run +

+

Inherited from operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject: + __init__ +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from threading.Thread: + __repr__, + getName, + isAlive, + isDaemon, + is_alive, + join, + setDaemon, + setName, + start +

+

Inherited from threading.Thread (private): + _set_daemon, + _set_ident +

+

Inherited from threading._Verbose (private): + _note +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from threading.Thread: + daemon, + ident, + name +

+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

inputInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Input.Input.inputInit +
+
+
+
+ +
+ +
+ + +
+

sensingLoop(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Input.Input.sensingLoop +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.PygameInput-module.html b/html/SmootLight.inputs.PygameInput-module.html new file mode 100644 index 0000000..7a593bc --- /dev/null +++ b/html/SmootLight.inputs.PygameInput-module.html @@ -0,0 +1,1948 @@ + + + + + SmootLight.inputs.PygameInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module PygameInput + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module PygameInput

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + PygameInput
+ PygameInput is an input tied to the PygameDisplay. +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + ACTIVEEVENT = 1 +
+   + + ANYFORMAT = 268435456 +
+   + + ASYNCBLIT = 4 +
+   + + AUDIO_S16 = 32784 +
+   + + AUDIO_S16LSB = 32784 +
+   + + AUDIO_S16MSB = 36880 +
+   + + AUDIO_S16SYS = 32784 +
+   + + AUDIO_S8 = 32776 +
+   + + AUDIO_U16 = 16 +
+   + + AUDIO_U16LSB = 16 +
+   + + AUDIO_U16MSB = 4112 +
+   + + AUDIO_U16SYS = 16 +
+   + + AUDIO_U8 = 8 +
+   + + BIG_ENDIAN = 4321 +
+   + + BLEND_ADD = 1 +
+   + + BLEND_MAX = 5 +
+   + + BLEND_MIN = 4 +
+   + + BLEND_MULT = 3 +
+   + + BLEND_RGBA_ADD = 6 +
+   + + BLEND_RGBA_MAX = 16 +
+   + + BLEND_RGBA_MIN = 9 +
+   + + BLEND_RGBA_MULT = 8 +
+   + + BLEND_RGBA_SUB = 7 +
+   + + BLEND_RGB_ADD = 1 +
+   + + BLEND_RGB_MAX = 5 +
+   + + BLEND_RGB_MIN = 4 +
+   + + BLEND_RGB_MULT = 3 +
+   + + BLEND_RGB_SUB = 2 +
+   + + BLEND_SUB = 2 +
+   + + BUTTON_X1 = 6 +
+   + + BUTTON_X2 = 7 +
+   + + DOUBLEBUF = 1073741824 +
+   + + FULLSCREEN = -2147483648 +
+   + + GL_ACCELERATED_VISUAL = 15 +
+   + + GL_ACCUM_ALPHA_SIZE = 11 +
+   + + GL_ACCUM_BLUE_SIZE = 10 +
+   + + GL_ACCUM_GREEN_SIZE = 9 +
+   + + GL_ACCUM_RED_SIZE = 8 +
+   + + GL_ALPHA_SIZE = 3 +
+   + + GL_BLUE_SIZE = 2 +
+   + + GL_BUFFER_SIZE = 4 +
+   + + GL_DEPTH_SIZE = 6 +
+   + + GL_DOUBLEBUFFER = 5 +
+   + + GL_GREEN_SIZE = 1 +
+   + + GL_MULTISAMPLEBUFFERS = 13 +
+   + + GL_MULTISAMPLESAMPLES = 14 +
+   + + GL_RED_SIZE = 0 +
+   + + GL_STENCIL_SIZE = 7 +
+   + + GL_STEREO = 12 +
+   + + GL_SWAP_CONTROL = 16 +
+   + + HAT_CENTERED = 0 +
+   + + HAT_DOWN = 4 +
+   + + HAT_LEFT = 8 +
+   + + HAT_LEFTDOWN = 12 +
+   + + HAT_LEFTUP = 9 +
+   + + HAT_RIGHT = 2 +
+   + + HAT_RIGHTDOWN = 6 +
+   + + HAT_RIGHTUP = 3 +
+   + + HAT_UP = 1 +
+   + + HWACCEL = 256 +
+   + + HWPALETTE = 536870912 +
+   + + HWSURFACE = 1 +
+   + + IYUV_OVERLAY = 1448433993 +
+   + + JOYAXISMOTION = 7 +
+   + + JOYBALLMOTION = 8 +
+   + + JOYBUTTONDOWN = 10 +
+   + + JOYBUTTONUP = 11 +
+   + + JOYHATMOTION = 9 +
+   + + KEYDOWN = 2 +
+   + + KEYUP = 3 +
+   + + KMOD_ALT = 768 +
+   + + KMOD_CAPS = 8192 +
+   + + KMOD_CTRL = 192 +
+   + + KMOD_LALT = 256 +
+   + + KMOD_LCTRL = 64 +
+   + + KMOD_LMETA = 1024 +
+   + + KMOD_LSHIFT = 1 +
+   + + KMOD_META = 3072 +
+   + + KMOD_MODE = 16384 +
+   + + KMOD_NONE = 0 +
+   + + KMOD_NUM = 4096 +
+   + + KMOD_RALT = 512 +
+   + + KMOD_RCTRL = 128 +
+   + + KMOD_RMETA = 2048 +
+   + + KMOD_RSHIFT = 2 +
+   + + KMOD_SHIFT = 3 +
+   + + K_0 = 48 +
+   + + K_1 = 49 +
+   + + K_2 = 50 +
+   + + K_3 = 51 +
+   + + K_4 = 52 +
+   + + K_5 = 53 +
+   + + K_6 = 54 +
+   + + K_7 = 55 +
+   + + K_8 = 56 +
+   + + K_9 = 57 +
+   + + K_AMPERSAND = 38 +
+   + + K_ASTERISK = 42 +
+   + + K_AT = 64 +
+   + + K_BACKQUOTE = 96 +
+   + + K_BACKSLASH = 92 +
+   + + K_BACKSPACE = 8 +
+   + + K_BREAK = 318 +
+   + + K_CAPSLOCK = 301 +
+   + + K_CARET = 94 +
+   + + K_CLEAR = 12 +
+   + + K_COLON = 58 +
+   + + K_COMMA = 44 +
+   + + K_DELETE = 127 +
+   + + K_DOLLAR = 36 +
+   + + K_DOWN = 274 +
+   + + K_END = 279 +
+   + + K_EQUALS = 61 +
+   + + K_ESCAPE = 27 +
+   + + K_EURO = 321 +
+   + + K_EXCLAIM = 33 +
+   + + K_F1 = 282 +
+   + + K_F10 = 291 +
+   + + K_F11 = 292 +
+   + + K_F12 = 293 +
+   + + K_F13 = 294 +
+   + + K_F14 = 295 +
+   + + K_F15 = 296 +
+   + + K_F2 = 283 +
+   + + K_F3 = 284 +
+   + + K_F4 = 285 +
+   + + K_F5 = 286 +
+   + + K_F6 = 287 +
+   + + K_F7 = 288 +
+   + + K_F8 = 289 +
+   + + K_F9 = 290 +
+   + + K_FIRST = 0 +
+   + + K_GREATER = 62 +
+   + + K_HASH = 35 +
+   + + K_HELP = 315 +
+   + + K_HOME = 278 +
+   + + K_INSERT = 277 +
+   + + K_KP0 = 256 +
+   + + K_KP1 = 257 +
+   + + K_KP2 = 258 +
+   + + K_KP3 = 259 +
+   + + K_KP4 = 260 +
+   + + K_KP5 = 261 +
+   + + K_KP6 = 262 +
+   + + K_KP7 = 263 +
+   + + K_KP8 = 264 +
+   + + K_KP9 = 265 +
+   + + K_KP_DIVIDE = 267 +
+   + + K_KP_ENTER = 271 +
+   + + K_KP_EQUALS = 272 +
+   + + K_KP_MINUS = 269 +
+   + + K_KP_MULTIPLY = 268 +
+   + + K_KP_PERIOD = 266 +
+   + + K_KP_PLUS = 270 +
+   + + K_LALT = 308 +
+   + + K_LAST = 323 +
+   + + K_LCTRL = 306 +
+   + + K_LEFT = 276 +
+   + + K_LEFTBRACKET = 91 +
+   + + K_LEFTPAREN = 40 +
+   + + K_LESS = 60 +
+   + + K_LMETA = 310 +
+   + + K_LSHIFT = 304 +
+   + + K_LSUPER = 311 +
+   + + K_MENU = 319 +
+   + + K_MINUS = 45 +
+   + + K_MODE = 313 +
+   + + K_NUMLOCK = 300 +
+   + + K_PAGEDOWN = 281 +
+   + + K_PAGEUP = 280 +
+   + + K_PAUSE = 19 +
+   + + K_PERIOD = 46 +
+   + + K_PLUS = 43 +
+   + + K_POWER = 320 +
+   + + K_PRINT = 316 +
+   + + K_QUESTION = 63 +
+   + + K_QUOTE = 39 +
+   + + K_QUOTEDBL = 34 +
+   + + K_RALT = 307 +
+   + + K_RCTRL = 305 +
+   + + K_RETURN = 13 +
+   + + K_RIGHT = 275 +
+   + + K_RIGHTBRACKET = 93 +
+   + + K_RIGHTPAREN = 41 +
+   + + K_RMETA = 309 +
+   + + K_RSHIFT = 303 +
+   + + K_RSUPER = 312 +
+   + + K_SCROLLOCK = 302 +
+   + + K_SEMICOLON = 59 +
+   + + K_SLASH = 47 +
+   + + K_SPACE = 32 +
+   + + K_SYSREQ = 317 +
+   + + K_TAB = 9 +
+   + + K_UNDERSCORE = 95 +
+   + + K_UNKNOWN = 0 +
+   + + K_UP = 273 +
+   + + K_a = 97 +
+   + + K_b = 98 +
+   + + K_c = 99 +
+   + + K_d = 100 +
+   + + K_e = 101 +
+   + + K_f = 102 +
+   + + K_g = 103 +
+   + + K_h = 104 +
+   + + K_i = 105 +
+   + + K_j = 106 +
+   + + K_k = 107 +
+   + + K_l = 108 +
+   + + K_m = 109 +
+   + + K_n = 110 +
+   + + K_o = 111 +
+   + + K_p = 112 +
+   + + K_q = 113 +
+   + + K_r = 114 +
+   + + K_s = 115 +
+   + + K_t = 116 +
+   + + K_u = 117 +
+   + + K_v = 118 +
+   + + K_w = 119 +
+   + + K_x = 120 +
+   + + K_y = 121 +
+   + + K_z = 122 +
+   + + LIL_ENDIAN = 1234 +
+   + + MOUSEBUTTONDOWN = 5 +
+   + + MOUSEBUTTONUP = 6 +
+   + + MOUSEMOTION = 4 +
+   + + NOEVENT = 0 +
+   + + NOFRAME = 32 +
+   + + NUMEVENTS = 32 +
+   + + OPENGL = 2 +
+   + + OPENGLBLIT = 10 +
+   + + PREALLOC = 16777216 +
+   + + QUIT = 12 +
+   + + RESIZABLE = 16 +
+   + + RLEACCEL = 16384 +
+   + + RLEACCELOK = 8192 +
+   + + SCRAP_BMP = 'image/bmp' +
+   + + SCRAP_CLIPBOARD = 0 +
+   + + SCRAP_PBM = 'image/pbm' +
+   + + SCRAP_PPM = 'image/ppm' +
+   + + SCRAP_SELECTION = 1 +
+   + + SCRAP_TEXT = 'text/plain' +
+   + + SRCALPHA = 65536 +
+   + + SRCCOLORKEY = 4096 +
+   + + SWSURFACE = 0 +
+   + + SYSWMEVENT = 13 +
+   + + TIMER_RESOLUTION = 10 +
+   + + USEREVENT = 24 +
+   + + UYVY_OVERLAY = 1498831189 +
+   + + VIDEOEXPOSE = 17 +
+   + + VIDEORESIZE = 16 +
+   + + YUY2_OVERLAY = 844715353 +
+   + + YV12_OVERLAY = 842094169 +
+   + + YVYU_OVERLAY = 1431918169 +
+   + + __package__ = 'SmootLight.inputs' +
+   + + exception_log = logging.getLogger("exception") +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.PygameInput-pysrc.html b/html/SmootLight.inputs.PygameInput-pysrc.html new file mode 100644 index 0000000..dafcbff --- /dev/null +++ b/html/SmootLight.inputs.PygameInput-pysrc.html @@ -0,0 +1,160 @@ + + + + + SmootLight.inputs.PygameInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module PygameInput + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.inputs.PygameInput

+
+ 1  import time 
+ 2  import util.Strings as Strings 
+ 3  from operationscore.Input import * 
+ 4  import pygame 
+ 5  from pygame.locals import * 
+ 6  #This class processes input from an already running pygame instance and passes 
+ 7  #it to the parent.  This class requires an already running pygame instance. 
+
8 -class PygameInput(Input): +
9 """PygameInput is an input tied to the PygameDisplay. Specify: +10 <FollowMouse>True</FollowMouse> to receive an input every frame specifying the current mouse +11 position. +12 <Keyboard>True</Keyboard> to grab keystrokes +13 <Clicks>True</Clicks> to grab clicks. +14 +15 NB: If follow mouse is enabled, PygameInput will not return mouse and keypresses. You can, however, +16 instantiate other PygameInputs in the XML that will capture mouse and keypresses.""" +
17 - def sensingLoop(self): +
18 if 'Scale' in self: +19 scale = self['Scale'] +20 else: +21 scale = 1 +22 if self['FollowMouse']: +23 self.respond({Strings.LOCATION: pygame.mouse.get_pos()}) +24 return +25 for event in pygame.event.get(): +26 if event.type is KEYDOWN: +27 if event.key == 27: +28 self.die() +29 if self['Keyboard']: +30 try: +31 self.respond({'Key': event.key, 'KeyChar': chr(event.key)}) +32 except: +33 self.respond({'Key': event.key}) +34 return +35 else: +36 pygame.event.post(event) +37 if event.type is MOUSEBUTTONDOWN: +38 if self['Clicks']: +39 self.respond({Strings.LOCATION: pygame.mouse.get_pos()}) +40 else: +41 pygame.event.post(event) +
42 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.PygameInput.PygameInput-class.html b/html/SmootLight.inputs.PygameInput.PygameInput-class.html new file mode 100644 index 0000000..8ec4ab3 --- /dev/null +++ b/html/SmootLight.inputs.PygameInput.PygameInput-class.html @@ -0,0 +1,298 @@ + + + + + SmootLight.inputs.PygameInput.PygameInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module PygameInput :: + Class PygameInput + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class PygameInput

source code

+
+                                                object --+            
+                                                         |            
+            operationscore.SmootCoreObject.SmootCoreObject --+        
+                                                             |        
+                                            object --+       |        
+                                                     |       |        
+                                    threading._Verbose --+   |        
+                                                         |   |        
+                                          threading.Thread --+        
+                                                             |        
+operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject --+    
+                                                                 |    
+                                        operationscore.Input.Input --+
+                                                                     |
+                                                                    PygameInput
+
+ +
+

PygameInput is an input tied to the PygameDisplay. Specify: + <FollowMouse>True</FollowMouse> to receive an input every + frame specifying the current mouse position. + <Keyboard>True</Keyboard> to grab keystrokes + <Clicks>True</Clicks> to grab clicks.

+

NB: If follow mouse is enabled, PygameInput will not return mouse and + keypresses. You can, however, instantiate other PygameInputs in the XML + that will capture mouse and keypresses.

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
sensingLoop(self) + source code + +
+ +
+

Inherited from operationscore.Input.Input: + init, + inputInit, + parentAlive, + respond, + run +

+

Inherited from operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject: + __init__ +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from threading.Thread: + __repr__, + getName, + isAlive, + isDaemon, + is_alive, + join, + setDaemon, + setName, + start +

+

Inherited from threading.Thread (private): + _set_daemon, + _set_ident +

+

Inherited from threading._Verbose (private): + _note +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from threading.Thread: + daemon, + ident, + name +

+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

sensingLoop(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Input.Input.sensingLoop +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.RandomLocs-module.html b/html/SmootLight.inputs.RandomLocs-module.html new file mode 100644 index 0000000..3ff9ad7 --- /dev/null +++ b/html/SmootLight.inputs.RandomLocs-module.html @@ -0,0 +1,171 @@ + + + + + SmootLight.inputs.RandomLocs + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module RandomLocs + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module RandomLocs

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + RandomLocs
+ RandomLocs is an Input that generates RandomLocations at a preset + but randomly changing time interval. +
+ + + + + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.inputs' +
+   + + exception_log = logging.getLogger("exception") +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.RandomLocs-pysrc.html b/html/SmootLight.inputs.RandomLocs-pysrc.html new file mode 100644 index 0000000..a17e072 --- /dev/null +++ b/html/SmootLight.inputs.RandomLocs-pysrc.html @@ -0,0 +1,130 @@ + + + + + SmootLight.inputs.RandomLocs + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module RandomLocs + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.inputs.RandomLocs

+
+ 1  import util.TimeOps as clock 
+ 2  import random 
+ 3  import util.Geo as Geo 
+ 4  import util.Strings as Strings 
+ 5  from operationscore.Input import * 
+
6 -class RandomLocs(Input): +
7 """RandomLocs is an Input that generates RandomLocations at a preset but randomly changing time interval. Just a + 8 prototype, some assembly required.""" + 9 +
10 - def inputInit(self): +
11 self['LastEvent'] = clock.time() +
12 - def sensingLoop(self): #TODO: move to params +
13 currentTime = clock.time() +14 if currentTime - self['LastEvent'] > 200+500*random.random(): +15 self.respond({Strings.LOCATION: Geo.randomLoc((200,200))}) +16 self['LastEvent'] = currentTime +
17 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.RandomLocs.RandomLocs-class.html b/html/SmootLight.inputs.RandomLocs.RandomLocs-class.html new file mode 100644 index 0000000..b5c2b8d --- /dev/null +++ b/html/SmootLight.inputs.RandomLocs.RandomLocs-class.html @@ -0,0 +1,330 @@ + + + + + SmootLight.inputs.RandomLocs.RandomLocs + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module RandomLocs :: + Class RandomLocs + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class RandomLocs

source code

+
+                                                object --+            
+                                                         |            
+            operationscore.SmootCoreObject.SmootCoreObject --+        
+                                                             |        
+                                            object --+       |        
+                                                     |       |        
+                                    threading._Verbose --+   |        
+                                                         |   |        
+                                          threading.Thread --+        
+                                                             |        
+operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject --+    
+                                                                 |    
+                                        operationscore.Input.Input --+
+                                                                     |
+                                                                    RandomLocs
+
+ +
+

RandomLocs is an Input that generates RandomLocations at a preset but + randomly changing time interval. Just a prototype, some assembly + required.

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
inputInit(self) + source code + +
+ +
+   + + + + + + +
sensingLoop(self) + source code + +
+ +
+

Inherited from operationscore.Input.Input: + init, + parentAlive, + respond, + run +

+

Inherited from operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject: + __init__ +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from threading.Thread: + __repr__, + getName, + isAlive, + isDaemon, + is_alive, + join, + setDaemon, + setName, + start +

+

Inherited from threading.Thread (private): + _set_daemon, + _set_ident +

+

Inherited from threading._Verbose (private): + _note +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from threading.Thread: + daemon, + ident, + name +

+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

inputInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Input.Input.inputInit +
+
+
+
+ +
+ +
+ + +
+

sensingLoop(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Input.Input.sensingLoop +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.TCPInput-module.html b/html/SmootLight.inputs.TCPInput-module.html new file mode 100644 index 0000000..a59e9c1 --- /dev/null +++ b/html/SmootLight.inputs.TCPInput-module.html @@ -0,0 +1,163 @@ + + + + + SmootLight.inputs.TCPInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module TCPInput + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module TCPInput

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + TCPInput
+ TCPInput is a input to receive input on a TCP port. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.inputs' +
+   + + exception_log = logging.getLogger("exception") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.TCPInput-pysrc.html b/html/SmootLight.inputs.TCPInput-pysrc.html new file mode 100644 index 0000000..0eb3266 --- /dev/null +++ b/html/SmootLight.inputs.TCPInput-pysrc.html @@ -0,0 +1,310 @@ + + + + + SmootLight.inputs.TCPInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module TCPInput + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.inputs.TCPInput

+
+ 1  import util.Strings as Strings 
+ 2  import pdb 
+ 3  from operationscore.Input import * 
+ 4  import socket, json, time 
+ 5  import logging as main_log 
+ 6  import string 
+ 7  from select import select 
+ 8   
+
9 -class TCPInput(Input): +
10 """TCPInput is a input to receive input on a TCP port. In its current incarnation, it parses +11 json data into python dicts. Warning: contains a bug where init will hang until it receives a +12 connection. Specify: +13 <Port> -- Port number to listen on.""" +
14 - def inputInit(self): +
15 self.HOST = '' # Symbolic name meaning all available interfaces +16 self.PORT = self.argDict['Port'] # Arbitrary non-privileged port +17 self.BUFFER_SIZE = 1024 +18 self.IS_RESPONDING = 1 +19 +20 self.sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM) +21 self.sock.setsockopt(socket.SOL_SOCKET, socket.SO_REUSEADDR, 1) +22 self.sock.bind((self.HOST, self.PORT)) +23 self.sock.listen(1) +24 +25 isreadable=select([self.sock],[],[], 0)[0] +26 self.conn = None +27 if isreadable: +28 (self.conn, self.address) = self.sock.accept() +
29 +
30 - def sensingLoop(self): +
31 if self.conn == None: +32 isreadable=select([self.sock],[],[], 0)[0] +33 if isreadable: +34 (self.conn, self.address) = self.sock.accept() +35 else: +36 return +37 +38 data = self.conn.recv(self.BUFFER_SIZE) +39 main_log.debug('Incoming data', data) +40 +41 if not data or 'end' in data: # data end, close socket +42 main_log.debug('End in data') +43 print 'end of stream' +44 self.IS_RESPONDING = 0 +45 self.conn.close() +46 self.sock.close() +47 +48 if self.IS_RESPONDING == 1: # if 'responding', respond to the received data +49 try: +50 for datagroup in data.split('\n'): +51 if datagroup != None and datagroup != '': +52 dataDict = json.loads(datagroup) +53 #if dataDict['type'] != 1: +54 #print dataDict +55 self.respond(dataDict) +56 except Exception as exp: +57 print str(exp) +58 else: +59 # if not 'responding', don't respond to data and restart socket +60 # * an incomplete hack for now. will be changed if same-type-multi-Input is implemented. +61 +62 self.IS_RESPONDING = 1 +63 self.sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM) +64 self.sock.setsockopt(socket.SOL_SOCKET, socket.SO_REUSEADDR, 1) +65 self.sock.bind((self.HOST, self.PORT)) +66 self.sock.listen(1) +67 (self.conn, self.address) = self.sock.accept() +
68 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.TCPInput.TCPInput-class.html b/html/SmootLight.inputs.TCPInput.TCPInput-class.html new file mode 100644 index 0000000..49a478b --- /dev/null +++ b/html/SmootLight.inputs.TCPInput.TCPInput-class.html @@ -0,0 +1,331 @@ + + + + + SmootLight.inputs.TCPInput.TCPInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module TCPInput :: + Class TCPInput + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class TCPInput

source code

+
+                                                object --+            
+                                                         |            
+            operationscore.SmootCoreObject.SmootCoreObject --+        
+                                                             |        
+                                            object --+       |        
+                                                     |       |        
+                                    threading._Verbose --+   |        
+                                                         |   |        
+                                          threading.Thread --+        
+                                                             |        
+operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject --+    
+                                                                 |    
+                                        operationscore.Input.Input --+
+                                                                     |
+                                                                    TCPInput
+
+ +
+

TCPInput is a input to receive input on a TCP port. In its current + incarnation, it parses json data into python dicts. Warning: contains a + bug where init will hang until it receives a connection. Specify: + <Port> -- Port number to listen on.

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
inputInit(self) + source code + +
+ +
+   + + + + + + +
sensingLoop(self) + source code + +
+ +
+

Inherited from operationscore.Input.Input: + init, + parentAlive, + respond, + run +

+

Inherited from operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject: + __init__ +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from threading.Thread: + __repr__, + getName, + isAlive, + isDaemon, + is_alive, + join, + setDaemon, + setName, + start +

+

Inherited from threading.Thread (private): + _set_daemon, + _set_ident +

+

Inherited from threading._Verbose (private): + _note +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from threading.Thread: + daemon, + ident, + name +

+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

inputInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Input.Input.inputInit +
+
+
+
+ +
+ +
+ + +
+

sensingLoop(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Input.Input.sensingLoop +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.TCPInput_backup-module.html b/html/SmootLight.inputs.TCPInput_backup-module.html new file mode 100644 index 0000000..efec497 --- /dev/null +++ b/html/SmootLight.inputs.TCPInput_backup-module.html @@ -0,0 +1,130 @@ + + + + + SmootLight.inputs.TCPInput_backup + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module TCPInput_backup + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module TCPInput_backup

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + TCPInput +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.TCPInput_backup-pysrc.html b/html/SmootLight.inputs.TCPInput_backup-pysrc.html new file mode 100644 index 0000000..3604e82 --- /dev/null +++ b/html/SmootLight.inputs.TCPInput_backup-pysrc.html @@ -0,0 +1,163 @@ + + + + + SmootLight.inputs.TCPInput_backup + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module TCPInput_backup + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.inputs.TCPInput_backup

+
+ 1  import SocketServer 
+ 2  from operationscore.Input import * 
+ 3   
+ 4  """ 
+ 5  A rough sketch about how a TCP socket server receives data from the phone (or other stuff). 
+ 6  Some corrections are probably needed from Russell. 
+ 7  Looks good to me -- not really the way I envisioned it, but since the server 
+ 8  we're using has a built in loop.  When we call the reponse method to pass the 
+ 9  data up the pipe, we should use the sensingLoop so that everything stays 
+10  thread-safe. 
+11  """ 
+
12 -class TCPInput(Input.Input): +
13 - class InputTCPHandler(SocketServer.BaseRequestHandler): +
14 - def handle(self): +
15 # get data from the TCP socket connected to the client +16 self.data = self.request.recv(1024).strip() +17 +18 pydict = json.loads(self.data) # decode and add to queue +19 self.responseQueue.append(pydict) +20 +21 """ +22 do something to the dict +23 """ +24 +25 self.request.send("yes") # send back confirmation. +
26 +
27 - def inputInit(self): +
28 # initialize +29 self.host = "localhost" +30 self.port = 9999 +31 self.responseQueue = [] +32 # start server +33 self.server = SocketServer.TCPServer((self.host, self.port), InputTCPHandler) +34 self.server.responseQueue = self.responseQueue +35 self.server.serve_forever() # server keeps running till Ctrl+C or self.server.shutdown() is called. +
36 +
37 - def sensingLoop(self): +
38 # loop action handled through TCPHandler? +39 # if check says to shut down the server, shut it. +40 if self.doShutDown(): +41 self.server.shutdown() +42 else: +43 for event in self.responseQueue: +44 self.respond(event) +45 self.responseQueue = [] +
46 +
47 - def doShutDown(self): +
48 # do some checks to see if server should be shut down +49 return False; +
50 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.TCPInput_backup.TCPInput-class.html b/html/SmootLight.inputs.TCPInput_backup.TCPInput-class.html new file mode 100644 index 0000000..5cc9b7b --- /dev/null +++ b/html/SmootLight.inputs.TCPInput_backup.TCPInput-class.html @@ -0,0 +1,204 @@ + + + + + SmootLight.inputs.TCPInput_backup.TCPInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module TCPInput_backup :: + Class TCPInput + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class TCPInput

source code

+
+??-12 --+
+        |
+       TCPInput
+
+ +
+ + + + + + + + + +
+ + + + + +
Nested Classes[hide private]
+
+   + + InputTCPHandler +
+ + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
inputInit(self) + source code + +
+ +
+   + + + + + + +
sensingLoop(self) + source code + +
+ +
+   + + + + + + +
doShutDown(self) + source code + +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.TCPInput_backup.TCPInput.InputTCPHandler-class.html b/html/SmootLight.inputs.TCPInput_backup.TCPInput.InputTCPHandler-class.html new file mode 100644 index 0000000..b386752 --- /dev/null +++ b/html/SmootLight.inputs.TCPInput_backup.TCPInput.InputTCPHandler-class.html @@ -0,0 +1,198 @@ + + + + + SmootLight.inputs.TCPInput_backup.TCPInput.InputTCPHandler + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module TCPInput_backup :: + Class TCPInput :: + Class InputTCPHandler + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class InputTCPHandler

source code

+
+SocketServer.BaseRequestHandler --+
+                                  |
+                                 TCPInput.InputTCPHandler
+
+ +
+ + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
handle(self) + source code + +
+ +
+

Inherited from SocketServer.BaseRequestHandler: + __init__, + finish, + setup +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

handle(self) +

+
source code  +
+ + +
+
Overrides: + SocketServer.BaseRequestHandler.handle +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.UDPInput-module.html b/html/SmootLight.inputs.UDPInput-module.html new file mode 100644 index 0000000..d60da10 --- /dev/null +++ b/html/SmootLight.inputs.UDPInput-module.html @@ -0,0 +1,170 @@ + + + + + SmootLight.inputs.UDPInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module UDPInput + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module UDPInput

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + UDPInput
+ UDPInput is a barebones UDP Input class. +
+ + + + + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.inputs' +
+   + + exception_log = logging.getLogger("exception") +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.UDPInput-pysrc.html b/html/SmootLight.inputs.UDPInput-pysrc.html new file mode 100644 index 0000000..ca913aa --- /dev/null +++ b/html/SmootLight.inputs.UDPInput-pysrc.html @@ -0,0 +1,130 @@ + + + + + SmootLight.inputs.UDPInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module UDPInput + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.inputs.UDPInput

+
+ 1  from operationscore.Input import * 
+ 2  import socket 
+
3 -class UDPInput(Input): +
4 """UDPInput is a barebones UDP Input class. It takes any data it receives and adds it to the + 5 'data' element of the response dict. It also notes the 'address'. Specify: + 6 <Port> -- the Port to listen on.""" + 7 +
8 - def inputInit(self): +
9 HOST = '' # Symbolic name meaning all available interfaces +10 PORT = self.argDict['Port'] # Arbitrary non-privileged port +11 self.sock = socket.socket(socket.AF_INET, socket.SOCK_DGRAM) +12 self.sock.bind((HOST, PORT)) +
13 - def sensingLoop(self): +
14 (data,address) = self.sock.recvfrom(1024) +15 dataDict = {'data':data, 'address':address} +16 self.respond(dataDict) +
17 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.inputs.UDPInput.UDPInput-class.html b/html/SmootLight.inputs.UDPInput.UDPInput-class.html new file mode 100644 index 0000000..3fb0159 --- /dev/null +++ b/html/SmootLight.inputs.UDPInput.UDPInput-class.html @@ -0,0 +1,330 @@ + + + + + SmootLight.inputs.UDPInput.UDPInput + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package inputs :: + Module UDPInput :: + Class UDPInput + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class UDPInput

source code

+
+                                                object --+            
+                                                         |            
+            operationscore.SmootCoreObject.SmootCoreObject --+        
+                                                             |        
+                                            object --+       |        
+                                                     |       |        
+                                    threading._Verbose --+   |        
+                                                         |   |        
+                                          threading.Thread --+        
+                                                             |        
+operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject --+    
+                                                                 |    
+                                        operationscore.Input.Input --+
+                                                                     |
+                                                                    UDPInput
+
+ +
+

UDPInput is a barebones UDP Input class. It takes any data it + receives and adds it to the 'data' element of the response dict. It also + notes the 'address'. Specify: <Port> -- the Port to listen on.

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
inputInit(self) + source code + +
+ +
+   + + + + + + +
sensingLoop(self) + source code + +
+ +
+

Inherited from operationscore.Input.Input: + init, + parentAlive, + respond, + run +

+

Inherited from operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject: + __init__ +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from threading.Thread: + __repr__, + getName, + isAlive, + isDaemon, + is_alive, + join, + setDaemon, + setName, + start +

+

Inherited from threading.Thread (private): + _set_daemon, + _set_ident +

+

Inherited from threading._Verbose (private): + _note +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from threading.Thread: + daemon, + ident, + name +

+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

inputInit(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Input.Input.inputInit +
+
+
+
+ +
+ +
+ + +
+

sensingLoop(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Input.Input.sensingLoop +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.layouts-module.html b/html/SmootLight.layouts-module.html new file mode 100644 index 0000000..0658d2f --- /dev/null +++ b/html/SmootLight.layouts-module.html @@ -0,0 +1,155 @@ + + + + + SmootLight.layouts + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package layouts + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Package layouts

source code

+ + + + + + + +
+ + + + + +
Submodules[hide private]
+
+
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = None +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.layouts-pysrc.html b/html/SmootLight.layouts-pysrc.html new file mode 100644 index 0000000..c05d1e4 --- /dev/null +++ b/html/SmootLight.layouts-pysrc.html @@ -0,0 +1,112 @@ + + + + + SmootLight.layouts + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package layouts + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Package SmootLight.layouts

+
+1   
+2   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.layouts.LineLayout-module.html b/html/SmootLight.layouts.LineLayout-module.html new file mode 100644 index 0000000..c65b917 --- /dev/null +++ b/html/SmootLight.layouts.LineLayout-module.html @@ -0,0 +1,156 @@ + + + + + SmootLight.layouts.LineLayout + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package layouts :: + Module LineLayout + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module LineLayout

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + LineLayout
+ LineLayout is a layout class that makes a line of LEDs +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.layouts' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.layouts.LineLayout-pysrc.html b/html/SmootLight.layouts.LineLayout-pysrc.html new file mode 100644 index 0000000..da1a076 --- /dev/null +++ b/html/SmootLight.layouts.LineLayout-pysrc.html @@ -0,0 +1,118 @@ + + + + + SmootLight.layouts.LineLayout + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package layouts :: + Module LineLayout + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.layouts.LineLayout

+
+1  from operationscore.PixelAssembler import * 
+
2 -class LineLayout(PixelAssembler): +
3 """LineLayout is a layout class that makes a line of LEDs""" +
4 - def layoutFunc(self, lastLocation): +
5 return (lastLocation[0]+self.argDict['spacing'], lastLocation[1]) +
6 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.layouts.LineLayout.LineLayout-class.html b/html/SmootLight.layouts.LineLayout.LineLayout-class.html new file mode 100644 index 0000000..fa49b4f --- /dev/null +++ b/html/SmootLight.layouts.LineLayout.LineLayout-class.html @@ -0,0 +1,260 @@ + + + + + SmootLight.layouts.LineLayout.LineLayout + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package layouts :: + Module LineLayout :: + Class LineLayout + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class LineLayout

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+      operationscore.PixelAssembler.PixelAssembler --+
+                                                     |
+                                                    LineLayout
+
+ +
+

LineLayout is a layout class that makes a line of LEDs

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
layoutFunc(self, + lastLocation) + source code + +
+ +
+

Inherited from operationscore.PixelAssembler.PixelAssembler: + getPixelLocations, + getStripArgs, + init, + initLayout +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

layoutFunc(self, + lastLocation) +

+
source code  +
+ + +
+
Overrides: + operationscore.PixelAssembler.PixelAssembler.layoutFunc +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.layouts.SpecifiedLayout-module.html b/html/SmootLight.layouts.SpecifiedLayout-module.html new file mode 100644 index 0000000..6906c28 --- /dev/null +++ b/html/SmootLight.layouts.SpecifiedLayout-module.html @@ -0,0 +1,156 @@ + + + + + SmootLight.layouts.SpecifiedLayout + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package layouts :: + Module SpecifiedLayout + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module SpecifiedLayout

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + SpecifiedLayout
+ SpecifiedLayout is a class that allows precise specification of each individual LED. +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.layouts' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.layouts.SpecifiedLayout-pysrc.html b/html/SmootLight.layouts.SpecifiedLayout-pysrc.html new file mode 100644 index 0000000..58e1418 --- /dev/null +++ b/html/SmootLight.layouts.SpecifiedLayout-pysrc.html @@ -0,0 +1,133 @@ + + + + + SmootLight.layouts.SpecifiedLayout + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package layouts :: + Module SpecifiedLayout + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.layouts.SpecifiedLayout

+
+ 1  from operationscore.PixelAssembler import * 
+
2 -class SpecifiedLayout(PixelAssembler): +
3 """SpecifiedLayout is a class that allows precise specification of each individual LED. + 4 Configure with a <Locations> tag in the args dict as follows': + 5 <Args> + 6 <Locations> + 7 <Loc>(1,1)</Loc> + 8 <Loc>(50,50)</Loc> + 9 </Locations> +10 etc. +11 </Args> +12 You may put attributes on the Locs so that you don't get confused. +13 """ +14 +
15 - def initLayout(self): +
16 self.lightNum = -1 +
17 +
18 - def layoutFunc(self, lastLocation): +
19 self.lightNum += 1 +20 return self['Locations'][self.lightNum] +
21 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.layouts.SpecifiedLayout.SpecifiedLayout-class.html b/html/SmootLight.layouts.SpecifiedLayout.SpecifiedLayout-class.html new file mode 100644 index 0000000..171ae48 --- /dev/null +++ b/html/SmootLight.layouts.SpecifiedLayout.SpecifiedLayout-class.html @@ -0,0 +1,309 @@ + + + + + SmootLight.layouts.SpecifiedLayout.SpecifiedLayout + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package layouts :: + Module SpecifiedLayout :: + Class SpecifiedLayout + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class SpecifiedLayout

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+      operationscore.PixelAssembler.PixelAssembler --+
+                                                     |
+                                                    SpecifiedLayout
+
+ +
+
+SpecifiedLayout is a class that allows precise specification of each individual LED.
+Configure with a <Locations> tag in the args dict as follows':
+<Args>
+    <Locations>
+        <Loc>(1,1)</Loc>
+        <Loc>(50,50)</Loc>
+    </Locations>
+    etc.
+</Args>
+You may put attributes on the Locs so that you don't get confused.
+
+
+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
initLayout(self) + source code + +
+ +
+   + + + + + + +
layoutFunc(self, + lastLocation) + source code + +
+ +
+

Inherited from operationscore.PixelAssembler.PixelAssembler: + getPixelLocations, + getStripArgs, + init +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

initLayout(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.PixelAssembler.PixelAssembler.initLayout +
+
+
+
+ +
+ +
+ + +
+

layoutFunc(self, + lastLocation) +

+
source code  +
+ + +
+
Overrides: + operationscore.PixelAssembler.PixelAssembler.layoutFunc +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.layouts.ZigzagLayout-module.html b/html/SmootLight.layouts.ZigzagLayout-module.html new file mode 100644 index 0000000..aeca44d --- /dev/null +++ b/html/SmootLight.layouts.ZigzagLayout-module.html @@ -0,0 +1,158 @@ + + + + + SmootLight.layouts.ZigzagLayout + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package layouts :: + Module ZigzagLayout + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module ZigzagLayout

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + ZigzagLayout
+ ZigZagLayout is a slightly more complex layout class that makes a zig-Zag Led Pattern +Inheriting classes must specify zigLength, the length in lights of a of a zig +and zig Axis, the direction of the long X axis (X or Y). +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.layouts' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.layouts.ZigzagLayout-pysrc.html b/html/SmootLight.layouts.ZigzagLayout-pysrc.html new file mode 100644 index 0000000..6d71eca --- /dev/null +++ b/html/SmootLight.layouts.ZigzagLayout-pysrc.html @@ -0,0 +1,156 @@ + + + + + SmootLight.layouts.ZigzagLayout + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package layouts :: + Module ZigzagLayout + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.layouts.ZigzagLayout

+
+ 1  from operationscore.PixelAssembler import * 
+ 2  import pdb 
+
3 -class ZigzagLayout(PixelAssembler): +
4 """ZigZagLayout is a slightly more complex layout class that makes a zig-Zag Led Pattern + 5 Inheriting classes must specify zigLength, the length in lights of a of a zig + 6 and zig Axis, the direction of the long X axis (X or Y). + 7 EG: zig length = 4, zig Axis = X would give: + 8 X-X-X-X + 9 | +10 X-X-X-X +11 | +12 X-X-X-X etc.""" +
13 - def initLayout(self): +
14 if not 'zigLength' in self.argDict: +15 raise Exception('zigLength must be defined in argDict') +16 if not 'zigAxis' in self.argDict: +17 raise Exception('zigAxis must be defined in argDict') +18 if not 'xDirection' in self.argDict: +19 self.argDict['xDirection'] = 1 #right +20 if not 'yDirection' in self.argDict: +21 self.argDict['yDirection'] = 1 #down +
22 - def layoutFunc(self, lastLocation): +
23 if not 'buildQueue' in self.argDict: +24 self.argDict['buildQueue'] = self.argDict['zigLength'] +25 +26 newLoc = list(lastLocation) +27 if self.argDict['buildQueue'] > 1: +28 if self.argDict['zigAxis'] == 'X': +29 newLoc[0] += self.argDict['spacing'] * self.argDict['xDirection'] +30 else: +31 newLoc[1] += self.argDict['spacing'] * self.argDict['yDirection'] +32 self.argDict['buildQueue'] -= 1 +33 else: +34 self.argDict['buildQueue'] = self.argDict['zigLength'] +35 if self.argDict['zigAxis'] == 'X': +36 newLoc[1] += self.argDict['spacing'] * self.argDict['yDirection'] +37 else: +38 newLoc[0] += self.argDict['spacing'] * self.argDict['xDirection'] +39 if self.argDict['zigAxis'] == 'X': +40 self.argDict['xDirection'] *= -1 +41 else: +42 self.argDict['yDirection'] *= -1 +43 return newLoc +
44 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.layouts.ZigzagLayout.ZigzagLayout-class.html b/html/SmootLight.layouts.ZigzagLayout.ZigzagLayout-class.html new file mode 100644 index 0000000..b1eff8a --- /dev/null +++ b/html/SmootLight.layouts.ZigzagLayout.ZigzagLayout-class.html @@ -0,0 +1,308 @@ + + + + + SmootLight.layouts.ZigzagLayout.ZigzagLayout + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package layouts :: + Module ZigzagLayout :: + Class ZigzagLayout + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class ZigzagLayout

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+      operationscore.PixelAssembler.PixelAssembler --+
+                                                     |
+                                                    ZigzagLayout
+
+ +
+
+ZigZagLayout is a slightly more complex layout class that makes a zig-Zag Led Pattern
+Inheriting classes must specify zigLength, the length in lights of a of a zig
+and zig Axis, the direction of the long X axis (X or Y).
+EG: zig length = 4, zig Axis = X would give:
+ X-X-X-X
+       |
+ X-X-X-X
+ |
+ X-X-X-X etc.
+
+
+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
initLayout(self) + source code + +
+ +
+   + + + + + + +
layoutFunc(self, + lastLocation) + source code + +
+ +
+

Inherited from operationscore.PixelAssembler.PixelAssembler: + getPixelLocations, + getStripArgs, + init +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

initLayout(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.PixelAssembler.PixelAssembler.initLayout +
+
+
+
+ +
+ +
+ + +
+

layoutFunc(self, + lastLocation) +

+
source code  +
+ + +
+
Overrides: + operationscore.PixelAssembler.PixelAssembler.layoutFunc +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.logger-module.html b/html/SmootLight.logger-module.html new file mode 100644 index 0000000..9103fb5 --- /dev/null +++ b/html/SmootLight.logger-module.html @@ -0,0 +1,154 @@ + + + + + SmootLight.logger + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package logger + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Package logger

source code

+ + + + + + + +
+ + + + + +
Submodules[hide private]
+
+
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.logger' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.logger-pysrc.html b/html/SmootLight.logger-pysrc.html new file mode 100644 index 0000000..ada97f4 --- /dev/null +++ b/html/SmootLight.logger-pysrc.html @@ -0,0 +1,163 @@ + + + + + SmootLight.logger + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package logger + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Package SmootLight.logger

+
+1  from Logger import screen_log, main_log, exception_log 
+2   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.logger.Logger-module.html b/html/SmootLight.logger.Logger-module.html new file mode 100644 index 0000000..9fe2fa9 --- /dev/null +++ b/html/SmootLight.logger.Logger-module.html @@ -0,0 +1,151 @@ + + + + + SmootLight.logger.Logger + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package logger :: + Module Logger + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Logger

source code

+ + + + + + + + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + screen_log = logging.getLogger("root") +
+   + + main_log = logging.getLogger("smoot_light") +
+   + + exception_log = logging.getLogger("exception") +
+   + + __package__ = 'SmootLight.logger' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.logger.Logger-pysrc.html b/html/SmootLight.logger.Logger-pysrc.html new file mode 100644 index 0000000..8f21c97 --- /dev/null +++ b/html/SmootLight.logger.Logger-pysrc.html @@ -0,0 +1,181 @@ + + + + + SmootLight.logger.Logger + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package logger :: + Module Logger + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.logger.Logger

+
+ 1  import logging 
+ 2  import logging.config 
+ 3   
+ 4  logging.config.fileConfig("logger/loggingConfig.ini") 
+ 5   
+ 6  # create logger 
+ 7  screen_log = logging.getLogger("root") 
+ 8  main_log = logging.getLogger("smoot_light") 
+ 9  exception_log = logging.getLogger("exception") 
+10   
+11  #test code -- won't work unless file is imported by a file from the directory above this "logger" directory 
+12  #main_log.debug("debug mesage") 
+13  #main_log.info("info message") 
+14  #main_log.warn("warn message") 
+15  #main_log.error("error message") 
+16  #main_log.critical("critical message") 
+17  #exception_log.critical("hi") 
+18  #screen_log.error("whoa hello") 
+19   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.logger.UTF8LogFormatter-module.html b/html/SmootLight.logger.UTF8LogFormatter-module.html new file mode 100644 index 0000000..d482e93 --- /dev/null +++ b/html/SmootLight.logger.UTF8LogFormatter-module.html @@ -0,0 +1,155 @@ + + + + + SmootLight.logger.UTF8LogFormatter + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package logger :: + Module UTF8LogFormatter + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module UTF8LogFormatter

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + UTF8LogFormatter +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.logger' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.logger.UTF8LogFormatter-pysrc.html b/html/SmootLight.logger.UTF8LogFormatter-pysrc.html new file mode 100644 index 0000000..1003543 --- /dev/null +++ b/html/SmootLight.logger.UTF8LogFormatter-pysrc.html @@ -0,0 +1,120 @@ + + + + + SmootLight.logger.UTF8LogFormatter + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package logger :: + Module UTF8LogFormatter + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.logger.UTF8LogFormatter

+
+ 1  from logging import Formatter 
+ 2   
+
3 -class UTF8LogFormatter(Formatter): +
4 - def format(self, record): +
5 try: + 6 return Formatter.format(self, record) + 7 except Exception, e: + 8 return Formatter.format(self, record).encode('utf8') +
9 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.logger.UTF8LogFormatter.UTF8LogFormatter-class.html b/html/SmootLight.logger.UTF8LogFormatter.UTF8LogFormatter-class.html new file mode 100644 index 0000000..c1f1433 --- /dev/null +++ b/html/SmootLight.logger.UTF8LogFormatter.UTF8LogFormatter-class.html @@ -0,0 +1,209 @@ + + + + + SmootLight.logger.UTF8LogFormatter.UTF8LogFormatter + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package logger :: + Module UTF8LogFormatter :: + Class UTF8LogFormatter + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class UTF8LogFormatter

source code

+
+logging.Formatter --+
+                    |
+                   UTF8LogFormatter
+
+ +
+ + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
format(self, + record)
+ Format the specified record as text.
+ source code + +
+ +
+

Inherited from logging.Formatter: + __init__, + converter, + formatException, + formatTime +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

format(self, + record) +

+
source code  +
+ +

Format the specified record as text.

+

The record's attribute dictionary is used as the operand to a string + formatting operation which yields the returned string. Before formatting + the dictionary, a couple of preparatory steps are carried out. The + message attribute of the record is computed using LogRecord.getMessage(). + If the formatting string contains "%(asctime)", formatTime() is + called to format the event time. If there is exception information, it is + formatted using formatException() and appended to the message.

+
+
Overrides: + logging.Formatter.format +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore-module.html b/html/SmootLight.operationscore-module.html new file mode 100644 index 0000000..84ff4df --- /dev/null +++ b/html/SmootLight.operationscore-module.html @@ -0,0 +1,160 @@ + + + + + SmootLight.operationscore + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Package operationscore

source code

+ + + + + + + +
+ + + + + +
Submodules[hide private]
+
+
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = None +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore-pysrc.html b/html/SmootLight.operationscore-pysrc.html new file mode 100644 index 0000000..712872b --- /dev/null +++ b/html/SmootLight.operationscore-pysrc.html @@ -0,0 +1,112 @@ + + + + + SmootLight.operationscore + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Package SmootLight.operationscore

+
+1   
+2   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.Behavior-module.html b/html/SmootLight.operationscore.Behavior-module.html new file mode 100644 index 0000000..828d89a --- /dev/null +++ b/html/SmootLight.operationscore.Behavior-module.html @@ -0,0 +1,156 @@ + + + + + SmootLight.operationscore.Behavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module Behavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Behavior

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Behavior
+ Abstract class for a behavior. +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.operationscore' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.Behavior-pysrc.html b/html/SmootLight.operationscore.Behavior-pysrc.html new file mode 100644 index 0000000..ff47613 --- /dev/null +++ b/html/SmootLight.operationscore.Behavior-pysrc.html @@ -0,0 +1,390 @@ + + + + + SmootLight.operationscore.Behavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module Behavior + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.operationscore.Behavior

+
+ 1  import pdb 
+ 2  from operationscore.SmootCoreObject import * 
+ 3  from logger import main_log 
+
4 -class Behavior(SmootCoreObject): +
5 """Abstract class for a behavior. On every time step, the behavior is passed the + 6 inputs from all sensors it is bound to as well as any recursive inputs that it + 7 spawned during the last time step. Inheriting classes MUST define + 8 processResponse. processResponse should return a list of dictionaries which + 9 define the properties of the light response, (outputs, recursions). They must give a location and +10 color. They may define a PixelEvent to more closely control the outgoing +11 data, however, this is normally handled by routing the event to a behavior +12 specifically designed to do this (like AddPixelEvent). +13 timeStep is called on every iteration of the LightInstallation +14 addInput is called on each individual input received, and the inputs queue""" +15 +
16 - def init(self): +
17 self.validateArgs('Behavior.params') +18 if type(self['Inputs']) != type([]): +19 self['Inputs'] = [self['Inputs']] +20 self.recursiveResponseQueue = [] +21 self.sensorResponseQueue = [] +22 self.outGoingQueue = [] +23 self.lastState = None +24 self.behaviorInit() +
25 +
26 - def behaviorInit(self): +
27 pass +
28 +
29 - def addMapper(fn): +
30 def withmap(fn): +31 return self.addMapperToResponse(fn()) +
32 return withmap +
33 +
34 - def processResponse(self, sensorInputs, recursiveInputs): +
35 raise Exception('ProcessResponse not defined!') +
36 +
37 - def addInput(self, sensorInput): +
38 self.sensorResponseQueue.append(sensorInput) +
39 +40 #used for behavior chaining +41 +
42 - def immediateProcessInput(self, sensorInputs, recursiveInputs=[]): +
43 (outputs,recursions) = self.processResponse(sensorInputs, \ +44 recursiveInputs) +45 return self.addMapperToResponse((outputs,recursions)) +46 +
47 - def addInputs(self, sensorInputs): +
48 if type(sensorInputs) == type([]): +49 [self.addInput(sensorInput) for sensorInput in sensorInputs] +50 else: +51 self.addInput(sensorInputs) +
52 +53 @staticmethod +
54 - def deepCopyPacket(datapacket): +
55 """Returns a deep copy of a behavior data packet (a list of dicts) so that modifying the +56 returned packet will not modify the incoming packet.""" +57 ret = [] +58 for d in datapacket: +59 d = dict(d) +60 ret.append(d) +61 return ret +
62 +
63 - def getLastOutput(self): +
64 return self.lastState +
65 +
66 - def setLastOutput(self, output): +
67 """Override to modify state. For example: if you are using a behavior that does uses +68 strings for location specification, you will want to override this to point to a single +69 location. Make sure you keep lastState as a [] of {}. (List of dicts). Additonally, +70 ensure that you call Behavior.deepCopyPacket on the packet before hand to avoid inadvertent +71 down-stream modifications. Look at Square.py for an example of this.""" +72 self.lastState = Behavior.deepCopyPacket(output) +
73 +
74 - def addMapperToResponse(self, responses): +
75 if self['Mapper'] != None: +76 if type(responses) == type(tuple): +77 (out, recurs) = responses +78 return (self.addMapperToResponse(out), self.addMapperToResponse(recurs)) +79 if type(responses) == type([]): +80 for r in responses: +81 r['Mapper'] = self['Mapper'] +82 return responses +83 return responses +
84 +
85 - def timeStep(self): #TODO: type checking. clean this up +
86 (outputs, recursions) = self.processResponse(self.sensorResponseQueue, \ +87 self.recursiveResponseQueue) +88 self.sensorResponseQueue = [] +89 self.recursiveResponseQueue = recursions +90 self.setLastOutput(outputs) +91 main_log.debug(self['Id'] + ' Ouputs ' + str(outputs)) +92 return self.addMapperToResponse(outputs) +93 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.Behavior.Behavior-class.html b/html/SmootLight.operationscore.Behavior.Behavior-class.html new file mode 100644 index 0000000..d020214 --- /dev/null +++ b/html/SmootLight.operationscore.Behavior.Behavior-class.html @@ -0,0 +1,492 @@ + + + + + SmootLight.operationscore.Behavior.Behavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module Behavior :: + Class Behavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Behavior

source code

+
+                                    object --+    
+                                             |    
+operationscore.SmootCoreObject.SmootCoreObject --+
+                                                 |
+                                                Behavior
+
+ +
+

Abstract class for a behavior. On every time step, the behavior is + passed the inputs from all sensors it is bound to as well as any + recursive inputs that it spawned during the last time step. Inheriting + classes MUST define processResponse. processResponse should return a + list of dictionaries which define the properties of the light response, + (outputs, recursions). They must give a location and color. They may + define a PixelEvent to more closely control the outgoing data, however, + this is normally handled by routing the event to a behavior specifically + designed to do this (like AddPixelEvent). timeStep is called on every + iteration of the LightInstallation addInput is called on each individual + input received, and the inputs queue

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
init(self) + source code + +
+ +
+   + + + + + + +
behaviorInit(self) + source code + +
+ +
+   + + + + + + +
addMapper(fn) + source code + +
+ +
+   + + + + + + +
processResponse(self, + sensorInputs, + recursiveInputs) + source code + +
+ +
+   + + + + + + +
addInput(self, + sensorInput) + source code + +
+ +
+   + + + + + + +
immediateProcessInput(self, + sensorInputs, + recursiveInputs=[]) + source code + +
+ +
+   + + + + + + +
addInputs(self, + sensorInputs) + source code + +
+ +
+   + + + + + + +
getLastOutput(self) + source code + +
+ +
+   + + + + + + +
setLastOutput(self, + output)
+ Override to modify state.
+ source code + +
+ +
+   + + + + + + +
addMapperToResponse(self, + responses) + source code + +
+ +
+   + + + + + + +
timeStep(self) + source code + +
+ +
+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+   + + + + + + +
deepCopyPacket(datapacket)
+ Returns a deep copy of a behavior data packet (a list of dicts) so + that modifying the returned packet will not modify the incoming + packet.
+ source code + +
+ +
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

init(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.SmootCoreObject.SmootCoreObject.init +
+
+
+
+ +
+ +
+ + +
+

setLastOutput(self, + output) +

+
source code  +
+ +

Override to modify state. For example: if you are using a behavior + that does uses strings for location specification, you will want to + override this to point to a single location. Make sure you keep + lastState as a [] of {}. (List of dicts). Additonally, ensure that you + call Behavior.deepCopyPacket on the packet before hand to avoid + inadvertent down-stream modifications. Look at Square.py for an example + of this.

+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.Input-module.html b/html/SmootLight.operationscore.Input-module.html new file mode 100644 index 0000000..a021fd3 --- /dev/null +++ b/html/SmootLight.operationscore.Input-module.html @@ -0,0 +1,156 @@ + + + + + SmootLight.operationscore.Input + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module Input + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Input

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Input
+ Abstract class for inputs. +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.operationscore' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.Input-pysrc.html b/html/SmootLight.operationscore.Input-pysrc.html new file mode 100644 index 0000000..f100d38 --- /dev/null +++ b/html/SmootLight.operationscore.Input-pysrc.html @@ -0,0 +1,271 @@ + + + + + SmootLight.operationscore.Input + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module Input + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.operationscore.Input

+
+ 1  import threading,time 
+ 2  from logger import main_log, exception_log 
+ 3  from operationscore.ThreadedSmootCoreObject import ThreadedSmootCoreObject 
+ 4  import pdb 
+
5 -class Input(ThreadedSmootCoreObject): +
6 """Abstract class for inputs. Inheriting classes should call "respond" to raise + 7 their event. Inheriting classes MUST define sensingLoop. Called at the + 8 interval specified in RefreshInterval while the input is active. For example, if you are writing + 9 webserver, this is where the loop should go. +10 Inheriting classes MAY define inputInit. This is called before the loop +11 begins.""" +
12 - def init(self): +
13 self.eventQueue = [] +14 if not 'RefreshInterval' in self.argDict: +15 self.argDict['RefreshInterval'] = 500 +16 self.parentScope = self.argDict['parentScope'] +17 self.inputInit() +
18 +
19 - def respond(self, eventDict): +
20 eventDict['InputId'] = self['Id'] +21 self.parentScope.lock.acquire() +22 self.parentScope.processResponse(self.argDict, eventDict) +23 self.parentScope.lock.release() +24 time.sleep(.001) +
25 +
26 - def parentAlive(self): +
27 try: +28 parentAlive = self.parentScope.alive() +29 return parentAlive +30 except: +31 return False +
32 +
33 - def run(self): +
34 while 1: +35 try: +36 die = self.parentAlive() +37 except: +38 break +39 time.sleep(self.argDict['RefreshInterval']/float(1000)) +40 self.acquireLock() +41 self.sensingLoop() +42 self.releaseLock() +
43 +
44 - def sensingLoop(self): +
45 pass +
46 +
47 - def inputInit(self): +
48 pass +
49 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.Input.Input-class.html b/html/SmootLight.operationscore.Input.Input-class.html new file mode 100644 index 0000000..892e09f --- /dev/null +++ b/html/SmootLight.operationscore.Input.Input-class.html @@ -0,0 +1,390 @@ + + + + + SmootLight.operationscore.Input.Input + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module Input :: + Class Input + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Input

source code

+
+                                                object --+        
+                                                         |        
+            operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                             |    
+                                            object --+       |    
+                                                     |       |    
+                                    threading._Verbose --+   |    
+                                                         |   |    
+                                          threading.Thread --+    
+                                                             |    
+operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject --+
+                                                                 |
+                                                                Input
+
+ +
+

Abstract class for inputs. Inheriting classes should call + "respond" to raise their event. Inheriting classes MUST define + sensingLoop. Called at the interval specified in RefreshInterval while + the input is active. For example, if you are writing webserver, this is + where the loop should go. Inheriting classes MAY define inputInit. This + is called before the loop begins.

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
init(self) + source code + +
+ +
+   + + + + + + +
respond(self, + eventDict) + source code + +
+ +
+   + + + + + + +
parentAlive(self) + source code + +
+ +
+   + + + + + + +
run(self) + source code + +
+ +
+   + + + + + + +
sensingLoop(self) + source code + +
+ +
+   + + + + + + +
inputInit(self) + source code + +
+ +
+

Inherited from operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject: + __init__ +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from threading.Thread: + __repr__, + getName, + isAlive, + isDaemon, + is_alive, + join, + setDaemon, + setName, + start +

+

Inherited from threading.Thread (private): + _set_daemon, + _set_ident +

+

Inherited from threading._Verbose (private): + _note +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from threading.Thread: + daemon, + ident, + name +

+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

init(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.SmootCoreObject.SmootCoreObject.init +
+
+
+
+ +
+ +
+ + +
+

run(self) +

+
source code  +
+ + +
+
Overrides: + threading.Thread.run +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.PixelAssembler-module.html b/html/SmootLight.operationscore.PixelAssembler-module.html new file mode 100644 index 0000000..6fee335 --- /dev/null +++ b/html/SmootLight.operationscore.PixelAssembler-module.html @@ -0,0 +1,155 @@ + + + + + SmootLight.operationscore.PixelAssembler + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module PixelAssembler + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module PixelAssembler

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + PixelAssembler +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.operationscore' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.PixelAssembler-pysrc.html b/html/SmootLight.operationscore.PixelAssembler-pysrc.html new file mode 100644 index 0000000..b025ba0 --- /dev/null +++ b/html/SmootLight.operationscore.PixelAssembler-pysrc.html @@ -0,0 +1,151 @@ + + + + + SmootLight.operationscore.PixelAssembler + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module PixelAssembler + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.operationscore.PixelAssembler

+
+ 1  from operationscore.SmootCoreObject import * 
+ 2  import util.Geo as Geo 
+ 3  import pdb 
+
4 -class PixelAssembler(SmootCoreObject): +
5 - def init(self): +
6 self.validateArgs('PixelAssembler.params') + 7 self.initLayout() +
8 - def layoutFunc(self, lastLocation): #Must be defined by inheriting class. +
9 #Returns tuple pair (x,y) +10 pass +
11 - def getPixelLocations(self): #returns a complete list of locations of Pixels +
12 #for a strip +13 locations = [self.argDict['originLocation']] +14 for pixelIndex in range(self['numPixels']-1): #-1 because origin +15 #already exists +16 newLocation = self.layoutFunc(locations[-1]) +17 if newLocation == None: +18 raise Exception('Location cannot be null. layoutFunc not \ +19 defined or improperly defined.') +20 if Geo.dist(newLocation, locations[-1]) > \ +21 self['pixelToPixelSpacing']: +22 raise Exception('Illegal pixel location. Distance \ +23 between adjacent pixels must be less than \ +24 pixelToPixelSpacing. Illegal distance is between '+str(pixelIndex) + ' and'\ +25 + str(pixelIndex+1)) +26 locations.append(newLocation) +27 if self['Reverse']: +28 locations.reverse() +29 return locations +
30 - def initLayout(self): +
31 pass +
32 - def getStripArgs(self): #TODO: triage and remove +
33 return self.argDict +34 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.PixelAssembler.PixelAssembler-class.html b/html/SmootLight.operationscore.PixelAssembler.PixelAssembler-class.html new file mode 100644 index 0000000..83d0ded --- /dev/null +++ b/html/SmootLight.operationscore.PixelAssembler.PixelAssembler-class.html @@ -0,0 +1,313 @@ + + + + + SmootLight.operationscore.PixelAssembler.PixelAssembler + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module PixelAssembler :: + Class PixelAssembler + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class PixelAssembler

source code

+
+                                    object --+    
+                                             |    
+operationscore.SmootCoreObject.SmootCoreObject --+
+                                                 |
+                                                PixelAssembler
+
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
init(self) + source code + +
+ +
+   + + + + + + +
layoutFunc(self, + lastLocation) + source code + +
+ +
+   + + + + + + +
getPixelLocations(self) + source code + +
+ +
+   + + + + + + +
initLayout(self) + source code + +
+ +
+   + + + + + + +
getStripArgs(self) + source code + +
+ +
+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

init(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.SmootCoreObject.SmootCoreObject.init +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.PixelEvent-module.html b/html/SmootLight.operationscore.PixelEvent-module.html new file mode 100644 index 0000000..8e3eef1 --- /dev/null +++ b/html/SmootLight.operationscore.PixelEvent-module.html @@ -0,0 +1,159 @@ + + + + + SmootLight.operationscore.PixelEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module PixelEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module PixelEvent

source code

+

PixelEvent is a class defining a light response. Inheriting classes + should define state, which should return a color, or None if the response + is complete. Consider requiring a generate event.

+ + + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + PixelEvent +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.operationscore' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.PixelEvent-pysrc.html b/html/SmootLight.operationscore.PixelEvent-pysrc.html new file mode 100644 index 0000000..6e8b9c0 --- /dev/null +++ b/html/SmootLight.operationscore.PixelEvent-pysrc.html @@ -0,0 +1,149 @@ + + + + + SmootLight.operationscore.PixelEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module PixelEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.operationscore.PixelEvent

+
+ 1  """PixelEvent is a class defining a light response.  Inheriting classes should define state, 
+ 2  which should return a color, or None if the response is complete.  Consider 
+ 3  requiring a generate event.""" 
+ 4  from operationscore.SmootCoreObject import * 
+ 5  from pixelevents.StepEvent import * 
+ 6  import util.ColorOps as color 
+
7 -class PixelEvent(SmootCoreObject): +
8 - def init(self): +
9 self.validateArgs('PixelEvent.params') +10 self.initEvent() +
11 - def initEvent(self): +
12 pass +
13 #Returns a new PixelEvent, but with a response scaled by c. +
14 - def scale(self,c): +
15 if c == 1: +16 return self +17 newDict = dict(self.argDict) +18 newDict['Color'] = color.multiplyColor(newDict['Color'], c) +19 return self.__class__(newDict) +
20 - def state(self,timeDelay): +
21 pass +
22 @staticmethod +
23 - def addPixelEventIfMissing(responseDict): +
24 if not 'PixelEvent' in responseDict: +25 if 'Color' in responseDict: +26 color = responseDict['Color'] +27 else: +28 raise Exception('Need Color. Probably') +29 responseDict['PixelEvent'] = StepEvent.generate(300, color) +
30 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.PixelEvent.PixelEvent-class.html b/html/SmootLight.operationscore.PixelEvent.PixelEvent-class.html new file mode 100644 index 0000000..75d5d28 --- /dev/null +++ b/html/SmootLight.operationscore.PixelEvent.PixelEvent-class.html @@ -0,0 +1,332 @@ + + + + + SmootLight.operationscore.PixelEvent.PixelEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module PixelEvent :: + Class PixelEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class PixelEvent

source code

+
+                                    object --+    
+                                             |    
+operationscore.SmootCoreObject.SmootCoreObject --+
+                                                 |
+                                                PixelEvent
+
+ +
+ + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
init(self) + source code + +
+ +
+   + + + + + + +
initEvent(self) + source code + +
+ +
+   + + + + + + +
scale(self, + c) + source code + +
+ +
+   + + + + + + +
state(self, + timeDelay) + source code + +
+ +
+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+   + + + + + + +
addPixelEventIfMissing(responseDict) + source code + +
+ +
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

init(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.SmootCoreObject.SmootCoreObject.init +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.PixelMapper-module.html b/html/SmootLight.operationscore.PixelMapper-module.html new file mode 100644 index 0000000..3df5221 --- /dev/null +++ b/html/SmootLight.operationscore.PixelMapper-module.html @@ -0,0 +1,156 @@ + + + + + SmootLight.operationscore.PixelMapper + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module PixelMapper + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module PixelMapper

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + PixelMapper
+ PixelMapper is the parent class for PixelMappers. +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.operationscore' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.PixelMapper-pysrc.html b/html/SmootLight.operationscore.PixelMapper-pysrc.html new file mode 100644 index 0000000..7aa5428 --- /dev/null +++ b/html/SmootLight.operationscore.PixelMapper-pysrc.html @@ -0,0 +1,231 @@ + + + + + SmootLight.operationscore.PixelMapper + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module PixelMapper + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.operationscore.PixelMapper

+
+ 1  from operationscore.SmootCoreObject import * 
+ 2  from logger import main_log 
+ 3  import pdb 
+
4 -class PixelMapper(SmootCoreObject): +
5 """PixelMapper is the parent class for PixelMappers. Inheriting classes should define + 6 mappingFunction which takes an eventLocation and a screen and returns a list of (weight, pixels). PixelMapper + 7 handles caching automatically.""" +
8 - def init(self): +
9 self.mem = {} #Dictionary of all seen events +10 self.totalCalls = 0 +11 self.cachehits = 0 +
12 - def mapEvent(self, eventLocation, screen): +
13 self.totalCalls += 1 +14 if self.totalCalls % 100 == 0: +15 main_log.info('Cache percentage for :', self['Id'], self.cachehits /\ +16 float(self.totalCalls)) +17 if eventLocation in self.mem: +18 self.cachehits += 1 +19 return self.mem[eventLocation] +20 else: +21 self.mem[eventLocation] = self.mappingFunction(eventLocation, screen) +22 return self.mem[eventLocation] +
23 #Takes a Screen and returns a list of tuples +24 #(pixel, weight), with the sum of weights = 1 +
25 - def mappingFunction(self,eventLocation, screen): +
26 """Takes a Screen and event location and returns a list of tuples (pixel,weight) with +27 sum(weights)=1""" +28 raise Exception('Mapping function not defined!') +
29 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.PixelMapper.PixelMapper-class.html b/html/SmootLight.operationscore.PixelMapper.PixelMapper-class.html new file mode 100644 index 0000000..cec7e90 --- /dev/null +++ b/html/SmootLight.operationscore.PixelMapper.PixelMapper-class.html @@ -0,0 +1,291 @@ + + + + + SmootLight.operationscore.PixelMapper.PixelMapper + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module PixelMapper :: + Class PixelMapper + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class PixelMapper

source code

+
+                                    object --+    
+                                             |    
+operationscore.SmootCoreObject.SmootCoreObject --+
+                                                 |
+                                                PixelMapper
+
+ +
+

PixelMapper is the parent class for PixelMappers. Inheriting classes + should define mappingFunction which takes an eventLocation and a screen + and returns a list of (weight, pixels). PixelMapper handles caching + automatically.

+ + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
init(self) + source code + +
+ +
+   + + + + + + +
mapEvent(self, + eventLocation, + screen) + source code + +
+ +
+   + + + + + + +
mappingFunction(self, + eventLocation, + screen)
+ Takes a Screen and event location and returns a list of tuples + (pixel,weight) with sum(weights)=1
+ source code + +
+ +
+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

init(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.SmootCoreObject.SmootCoreObject.init +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.Renderer-module.html b/html/SmootLight.operationscore.Renderer-module.html new file mode 100644 index 0000000..805fd29 --- /dev/null +++ b/html/SmootLight.operationscore.Renderer-module.html @@ -0,0 +1,156 @@ + + + + + SmootLight.operationscore.Renderer + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module Renderer + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Renderer

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Renderer
+ Renderer abstract class. +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.operationscore' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.Renderer-pysrc.html b/html/SmootLight.operationscore.Renderer-pysrc.html new file mode 100644 index 0000000..a4d1a28 --- /dev/null +++ b/html/SmootLight.operationscore.Renderer-pysrc.html @@ -0,0 +1,128 @@ + + + + + SmootLight.operationscore.Renderer + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module Renderer + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.operationscore.Renderer

+
+ 1  #TODO: multithreaded-rendering 
+ 2  from operationscore.SmootCoreObject import * 
+
3 -class Renderer(SmootCoreObject): +
4 """Renderer abstract class. Doesn't do much now, but might do more later. + 5 Inheriting classes MUST define render which takes a light system and renders it. + 6 Inheriting classes may define initRenderer which is called after the dictionary + 7 is pulled from config.""" +
8 - def init(self): +
9 self.initRenderer() +
10 - def render(lightSystem): +
11 pass +
12 - def initRenderer(self): +
13 pass +
14 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.Renderer.Renderer-class.html b/html/SmootLight.operationscore.Renderer.Renderer-class.html new file mode 100644 index 0000000..272e9f9 --- /dev/null +++ b/html/SmootLight.operationscore.Renderer.Renderer-class.html @@ -0,0 +1,285 @@ + + + + + SmootLight.operationscore.Renderer.Renderer + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module Renderer :: + Class Renderer + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Renderer

source code

+
+                                    object --+    
+                                             |    
+operationscore.SmootCoreObject.SmootCoreObject --+
+                                                 |
+                                                Renderer
+
+ +
+

Renderer abstract class. Doesn't do much now, but might do more + later. Inheriting classes MUST define render which takes a light system + and renders it. Inheriting classes may define initRenderer which is + called after the dictionary is pulled from config.

+ + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
init(self) + source code + +
+ +
+   + + + + + + +
render(lightSystem) + source code + +
+ +
+   + + + + + + +
initRenderer(self) + source code + +
+ +
+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

init(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.SmootCoreObject.SmootCoreObject.init +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.SmootCoreObject-module.html b/html/SmootLight.operationscore.SmootCoreObject-module.html new file mode 100644 index 0000000..cd71012 --- /dev/null +++ b/html/SmootLight.operationscore.SmootCoreObject-module.html @@ -0,0 +1,157 @@ + + + + + SmootLight.operationscore.SmootCoreObject + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module SmootCoreObject + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module SmootCoreObject

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + SmootCoreObject
+ SmootCoreObject is essentially a super-object class which grants us + some niceties. +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.operationscore' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.SmootCoreObject-pysrc.html b/html/SmootLight.operationscore.SmootCoreObject-pysrc.html new file mode 100644 index 0000000..f8ae4ab --- /dev/null +++ b/html/SmootLight.operationscore.SmootCoreObject-pysrc.html @@ -0,0 +1,191 @@ + + + + + SmootLight.operationscore.SmootCoreObject + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module SmootCoreObject + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.operationscore.SmootCoreObject

+
+ 1  import pdb 
+ 2  import threading 
+ 3  import thread 
+ 4  import util.Config as configGetter 
+ 5  import types 
+ 6   
+
7 -class SmootCoreObject(object): +
8 """SmootCoreObject is essentially a super-object class which grants us some niceties. It allows + 9 us to use objects as if they are dictionaries -- we use this to store their arguments +10 convienently -- note that querying for a parameter that does not exist will return None. It +11 also offers some basic ThreadSafety.""" +
12 - def __init__(self, argDict, skipValidation = False): +
13 self.dieListeners = [] +14 self.argDict = argDict +15 self.validateArgs(self.className()+'.params') +16 self.lock = thread.allocate_lock() +17 #put everything into attributes for speed +18 for key in argDict: +19 setattr(self, key, argDict[key]) +20 self.init() #call init of inheriting class +
21 +
22 - def init(self): +
23 pass +
24 +
25 - def acquireLock(self): +
26 self.lock = thread.allocate_lock() #TODO: fix. -- investigate this, it should only have to be run once in the initialization. +27 self.lock.acquire() +
28 +
29 - def releaseLock(self): +
30 self.lock.release() +
31 +
32 - def className(self): +
33 return self.__class__.__name__ +
34 +
35 - def __setitem__(self,k, item): +
36 self.argDict[k] = item +
37 +
38 - def __getitem__(self, key): +
39 if key in self.argDict: +40 item = self.argDict[key] +41 if isinstance(item, types.FunctionType): +42 return item(self.argDict) #resolve the lambda function, if it exists +43 #elif isinstance(item, list): #if its a list of items +44 # pass #TODO: consider doing resolution of lambda funcs for items in lists +45 else: +46 return item +47 else: +48 return None +
49 - def __contains__(self, item): +
50 return item in self.argDict +
51 - def __getiter__(self): +
52 return self.argDict.__getiter__() +
53 +
54 - def validateArgs(self, argFileName): +
55 self.validateArgDict(configGetter.loadParamRequirementDict(argFileName))#util +
56 #caches for us, woo! +57 +
58 - def validateArgDict(self, validationDict): +
59 for item in validationDict: +60 if not item in self.argDict: +61 raise Exception(validationDict[item]) +
62 +
63 - def addDieListener(self, listener): +
64 if listener not in self.dieListeners: +65 self.dieListeners.append(listener) +
66 +
67 - def removeDieListener(self, listener): +
68 if listener in self.dieListeners: +69 self.dieListeners.remove(listener) +
70 +
71 - def die(self): +
72 for listener in self.dieListeners: +73 listener.handleDie(self) +
74 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html b/html/SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html new file mode 100644 index 0000000..63832df --- /dev/null +++ b/html/SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html @@ -0,0 +1,461 @@ + + + + + SmootLight.operationscore.SmootCoreObject.SmootCoreObject + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module SmootCoreObject :: + Class SmootCoreObject + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class SmootCoreObject

source code

+
+object --+
+         |
+        SmootCoreObject
+
+ +
+

SmootCoreObject is essentially a super-object class which grants us + some niceties. It allows us to use objects as if they are dictionaries + -- we use this to store their arguments convienently -- note that + querying for a parameter that does not exist will return None. It also + offers some basic ThreadSafety.

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
__init__(self, + argDict, + skipValidation=False)
+ x.__init__(...) initializes x; see x.__class__.__doc__ for signature
+ source code + +
+ +
+   + + + + + + +
init(self) + source code + +
+ +
+   + + + + + + +
acquireLock(self) + source code + +
+ +
+   + + + + + + +
releaseLock(self) + source code + +
+ +
+   + + + + + + +
className(self) + source code + +
+ +
+   + + + + + + +
__setitem__(self, + k, + item) + source code + +
+ +
+   + + + + + + +
__getitem__(self, + key) + source code + +
+ +
+   + + + + + + +
__contains__(self, + item) + source code + +
+ +
+   + + + + + + +
__getiter__(self) + source code + +
+ +
+   + + + + + + +
validateArgs(self, + argFileName) + source code + +
+ +
+   + + + + + + +
validateArgDict(self, + validationDict) + source code + +
+ +
+   + + + + + + +
addDieListener(self, + listener) + source code + +
+ +
+   + + + + + + +
removeDieListener(self, + listener) + source code + +
+ +
+   + + + + + + +
die(self) + source code + +
+ +
+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

__init__(self, + argDict, + skipValidation=False) +
(Constructor) +

+
source code  +
+ +

x.__init__(...) initializes x; see x.__class__.__doc__ for + signature

+
+
Overrides: + object.__init__ +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.ThreadedSmootCoreObject-module.html b/html/SmootLight.operationscore.ThreadedSmootCoreObject-module.html new file mode 100644 index 0000000..2514c71 --- /dev/null +++ b/html/SmootLight.operationscore.ThreadedSmootCoreObject-module.html @@ -0,0 +1,157 @@ + + + + + SmootLight.operationscore.ThreadedSmootCoreObject + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module ThreadedSmootCoreObject + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module ThreadedSmootCoreObject

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + ThreadedSmootCoreObject
+ ThreadedSmootCoreObject is a version of SmootCoreObject for objects + that want to run on their own thread +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.operationscore' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.ThreadedSmootCoreObject-pysrc.html b/html/SmootLight.operationscore.ThreadedSmootCoreObject-pysrc.html new file mode 100644 index 0000000..1bf1bc6 --- /dev/null +++ b/html/SmootLight.operationscore.ThreadedSmootCoreObject-pysrc.html @@ -0,0 +1,143 @@ + + + + + SmootLight.operationscore.ThreadedSmootCoreObject + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module ThreadedSmootCoreObject + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.operationscore.ThreadedSmootCoreObject

+
+ 1  import pdb 
+ 2  import threading 
+ 3  import thread 
+ 4  import util.Config as configGetter 
+ 5  from operationscore.SmootCoreObject import SmootCoreObject 
+
6 -class ThreadedSmootCoreObject(SmootCoreObject, threading.Thread): +
7 """ThreadedSmootCoreObject is a version of SmootCoreObject for objects that want to run on their + 8 own thread""" +
9 - def __init__(self, argDict, skipValidation = False): +
10 SmootCoreObject.__init__(self, argDict, skipValidation) +11 threading.Thread.__init__(self) +12 self.daemon = True #This kills this thread when the main thread stops +
13 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject-class.html b/html/SmootLight.operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject-class.html new file mode 100644 index 0000000..d657bbe --- /dev/null +++ b/html/SmootLight.operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject-class.html @@ -0,0 +1,288 @@ + + + + + SmootLight.operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package operationscore :: + Module ThreadedSmootCoreObject :: + Class ThreadedSmootCoreObject + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class ThreadedSmootCoreObject

source code

+
+                                    object --+    
+                                             |    
+operationscore.SmootCoreObject.SmootCoreObject --+
+                                                 |
+                                object --+       |
+                                         |       |
+                        threading._Verbose --+   |
+                                             |   |
+                              threading.Thread --+
+                                                 |
+                                                ThreadedSmootCoreObject
+
+ +
+

ThreadedSmootCoreObject is a version of SmootCoreObject for objects + that want to run on their own thread

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
__init__(self, + argDict, + skipValidation=False)
+ x.__init__(...) initializes x; see x.__class__.__doc__ for signature
+ source code + +
+ +
+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + init, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from threading.Thread: + __repr__, + getName, + isAlive, + isDaemon, + is_alive, + join, + run, + setDaemon, + setName, + start +

+

Inherited from threading.Thread (private): + _set_daemon, + _set_ident +

+

Inherited from threading._Verbose (private): + _note +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from threading.Thread: + daemon, + ident, + name +

+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

__init__(self, + argDict, + skipValidation=False) +
(Constructor) +

+
source code  +
+ +

x.__init__(...) initializes x; see x.__class__.__doc__ for + signature

+
+
Overrides: + object.__init__ +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelcore-module.html b/html/SmootLight.pixelcore-module.html new file mode 100644 index 0000000..a889d8f --- /dev/null +++ b/html/SmootLight.pixelcore-module.html @@ -0,0 +1,155 @@ + + + + + SmootLight.pixelcore + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelcore + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Package pixelcore

source code

+ + + + + + + +
+ + + + + +
Submodules[hide private]
+
+
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = None +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelcore-pysrc.html b/html/SmootLight.pixelcore-pysrc.html new file mode 100644 index 0000000..11958b9 --- /dev/null +++ b/html/SmootLight.pixelcore-pysrc.html @@ -0,0 +1,112 @@ + + + + + SmootLight.pixelcore + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelcore + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Package SmootLight.pixelcore

+
+1   
+2   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelcore.Pixel-module.html b/html/SmootLight.pixelcore.Pixel-module.html new file mode 100644 index 0000000..270e544 --- /dev/null +++ b/html/SmootLight.pixelcore.Pixel-module.html @@ -0,0 +1,157 @@ + + + + + SmootLight.pixelcore.Pixel + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelcore :: + Module Pixel + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Pixel

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Pixel
+ Pixel keeps a queue of events (PixelEvent objects) (actually a + dictionary keyed by event time). +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.pixelcore' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelcore.Pixel-pysrc.html b/html/SmootLight.pixelcore.Pixel-pysrc.html new file mode 100644 index 0000000..94c355e --- /dev/null +++ b/html/SmootLight.pixelcore.Pixel-pysrc.html @@ -0,0 +1,282 @@ + + + + + SmootLight.pixelcore.Pixel + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelcore :: + Module Pixel + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.pixelcore.Pixel

+
+ 1  import util.ColorOps as color 
+ 2  from logger import main_log 
+ 3  import pdb 
+ 4  from pixelevents.StepEvent import * 
+ 5  import util.TimeOps as timeops 
+
6 -class Pixel: +
7 """Pixel keeps a queue of events (PixelEvent objects) (actually a dictionary + 8 keyed by event time). Every time is state is + 9 requested, it processes all the members of its queue. If a member returns none, +10 it is removed from the queue. Otherwise, its value added to the Pixels color +11 weighted by z-index. To get the current color of the pixel, call the state method.""" +12 +13 radius = 2 +14 timeOff = -1 +15 +
16 - def __init__(self, location): +
17 self.location = location +18 self.events = [] +19 self.lastRenderTime = timeops.time() +20 self.lastRender = (0,0,0) +
21 +
22 - def turnOn(self): +
23 self.turnOnFor(-1) +
24 +25 #Turn the light white for 'time' ms. Really only meant for testing. Use +26 #processInput instead. Also, you shouldn't use this anyway. You should be +27 #using the input method on the screen! +
28 - def turnOnFor(self, time): +
29 event = StepEvent.generate(time, (255,255,255)) +30 self.processInput(event, 0) +
31 +32 #Add a pixelEvent to the list of active events +
33 - def processInput(self,pixelEvent,zindex, scale=1,currentTime=None): #consider migrating arg to dict +
34 if currentTime == None: +35 currentTime = timeops.time() +36 self.events.append((currentTime, zindex, scale, pixelEvent)) #TODO: clean this up, maybe? +
37 - def clearAllEvents(self): +
38 self.events = [] +
39 +
40 - def state(self, currentTime=None): +
41 """Combines all PixelEvents currently active and computes the current color of +42 the pixel.""" +43 if currentTime == None: +44 currentTime = timeops.time() +45 if currentTime-self.lastRenderTime < 5: +46 return self.lastRender +47 if self.events == []: +48 self.lastRenderTime = currentTime +49 return (0,0,0) +50 deadEvents = [] +51 resultingColor = (0,0,0) +52 colors = [] +53 for eventObj in self.events: #TODO: right color weighting code +54 if len(self.events) > 50: +55 main_log.error('High pixel event count! Investigate!') +56 eventTime, zindex, scale, pixelEvent = eventObj +57 eventResult = pixelEvent.state(currentTime-eventTime) +58 if eventResult != None: +59 scaledEvent = color.multiplyColor(eventResult,scale) +60 if (scaledEvent[0] + scaledEvent[1] + scaledEvent[2]) < 5: +61 pass +62 #deadEvents.append(eventObj) +63 else: +64 colors.append(scaledEvent) +65 else: +66 deadEvents.append(eventObj) +67 +68 resultingColor = color.combineColors(colors) +69 [self.events.remove(event) for event in deadEvents] +70 resultingColor = [int(round(c)) for c in resultingColor] +71 self.lastRender = tuple(resultingColor) +72 self.lastRenderTime = currentTime +73 return tuple(resultingColor) +74 +
75 - def __str__(self): +
76 return 'Loc: ' + str(self.location) +
77 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelcore.Pixel.Pixel-class.html b/html/SmootLight.pixelcore.Pixel.Pixel-class.html new file mode 100644 index 0000000..15e50dc --- /dev/null +++ b/html/SmootLight.pixelcore.Pixel.Pixel-class.html @@ -0,0 +1,284 @@ + + + + + SmootLight.pixelcore.Pixel.Pixel + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelcore :: + Module Pixel :: + Class Pixel + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Pixel

source code

+

Pixel keeps a queue of events (PixelEvent objects) (actually a + dictionary keyed by event time). Every time is state is requested, it + processes all the members of its queue. If a member returns none, it is + removed from the queue. Otherwise, its value added to the Pixels color + weighted by z-index. To get the current color of the pixel, call the + state method.

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
__init__(self, + location) + source code + +
+ +
+   + + + + + + +
turnOn(self) + source code + +
+ +
+   + + + + + + +
turnOnFor(self, + time) + source code + +
+ +
+   + + + + + + +
processInput(self, + pixelEvent, + zindex, + scale=1, + currentTime=None) + source code + +
+ +
+   + + + + + + +
clearAllEvents(self) + source code + +
+ +
+   + + + + + + +
state(self, + currentTime=None)
+ Combines all PixelEvents currently active and computes the current + color of the pixel.
+ source code + +
+ +
+   + + + + + + +
__str__(self) + source code + +
+ +
+ + + + + + + + + + + + +
+ + + + + +
Class Variables[hide private]
+
+   + + radius = 2 +
+   + + timeOff = -1 +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelcore.PixelStrip-module.html b/html/SmootLight.pixelcore.PixelStrip-module.html new file mode 100644 index 0000000..67ac331 --- /dev/null +++ b/html/SmootLight.pixelcore.PixelStrip-module.html @@ -0,0 +1,163 @@ + + + + + SmootLight.pixelcore.PixelStrip + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelcore :: + Module PixelStrip + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module PixelStrip

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + PixelStrip
+ Python class representing a single Pixel strip (usually 50 Pixels) +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.pixelcore' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelcore.PixelStrip-pysrc.html b/html/SmootLight.pixelcore.PixelStrip-pysrc.html new file mode 100644 index 0000000..e12ca76 --- /dev/null +++ b/html/SmootLight.pixelcore.PixelStrip-pysrc.html @@ -0,0 +1,135 @@ + + + + + SmootLight.pixelcore.PixelStrip + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelcore :: + Module PixelStrip + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.pixelcore.PixelStrip

+
+ 1  from pixelcore.Pixel import * 
+ 2  import util.Strings as Strings 
+ 3  import util.Geo as Geo 
+ 4  from pixelevents.StepEvent import * 
+ 5  import math 
+ 6  import pdb 
+
7 -class PixelStrip: +
8 """Python class representing a single Pixel strip (usually 50 Pixels)""" + 9 +
10 - def __init__(self, layoutEngine): +
11 self.initStrip(layoutEngine) +12 self.argDict = layoutEngine.getStripArgs() +
13 +
14 - def initStrip(self, layoutEngine): +
15 pixelLocations = layoutEngine.getPixelLocations() +16 self.pixels = [Pixel(l) for l in pixelLocations] +
17 +
18 - def __iter__(self): +
19 return self.pixels.__iter__() +
20 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelcore.PixelStrip.PixelStrip-class.html b/html/SmootLight.pixelcore.PixelStrip.PixelStrip-class.html new file mode 100644 index 0000000..0e561cf --- /dev/null +++ b/html/SmootLight.pixelcore.PixelStrip.PixelStrip-class.html @@ -0,0 +1,176 @@ + + + + + SmootLight.pixelcore.PixelStrip.PixelStrip + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelcore :: + Module PixelStrip :: + Class PixelStrip + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class PixelStrip

source code

+

Python class representing a single Pixel strip (usually 50 Pixels)

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
__init__(self, + layoutEngine) + source code + +
+ +
+   + + + + + + +
initStrip(self, + layoutEngine) + source code + +
+ +
+   + + + + + + +
__iter__(self) + source code + +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelcore.Screen-module.html b/html/SmootLight.pixelcore.Screen-module.html new file mode 100644 index 0000000..7607789 --- /dev/null +++ b/html/SmootLight.pixelcore.Screen-module.html @@ -0,0 +1,156 @@ + + + + + SmootLight.pixelcore.Screen + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelcore :: + Module Screen + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Screen

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Screen
+ Class representing a collection of Pixels grouped into PixelStrips. +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.pixelcore' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelcore.Screen-pysrc.html b/html/SmootLight.pixelcore.Screen-pysrc.html new file mode 100644 index 0000000..ea55b73 --- /dev/null +++ b/html/SmootLight.pixelcore.Screen-pysrc.html @@ -0,0 +1,345 @@ + + + + + SmootLight.pixelcore.Screen + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelcore :: + Module Screen + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.pixelcore.Screen

+
+  1  from pixelcore.Pixel import *  
+  2  from pixelcore.PixelStrip import * 
+  3  from operationscore.PixelEvent import * 
+  4  from operationscore.PixelMapper import * 
+  5  import util.Search as Search 
+  6  import util.ComponentRegistry as compReg 
+  7  import util.Strings as Strings 
+  8  import util.TimeOps as timeops 
+  9  import itertools 
+ 10  import sys 
+ 11  import pdb 
+ 12  from logger import main_log 
+
13 -class Screen: +
14 """Class representing a collection of Pixels grouped into PixelStrips. Needs a + 15 PixelMapper, currently set via setMapper by may be migrated into the argDict.""" + 16 +
17 - def __init__(self): +
18 self.responseQueue = [] + 19 self.pixelStrips = [] + 20 self.xSortedPixels = [] + 21 self.xPixelLocs = [] + 22 sizeValid = False + 23 self.pixelsSorted = False +
24 +
25 - def addStrip(self, strip): +
26 self.pixelStrips.append(strip) + 27 self.sizeValid = False #keep track of whether or not our screen size has + 28 self.pixelsSorted = False +
29 #been invalidated by adding more pixels + 30 +
31 - def pixelsInRange(self, minX, maxX): +
32 """Returns (pixelIndex, pixel). Does a binary search. Sorts first if neccesary.""" + 33 if not self.pixelsSorted: + 34 self.computeXSortedPixels() + 35 minIndex = Search.find_ge(self.xPixelLocs, minX) + 36 maxIndex = Search.find_le(self.xPixelLocs, maxX)+1 + 37 return self.xSortedPixels[minIndex:maxIndex] +
38 +
39 - def computeXSortedPixels(self): +
40 self.xSortedPixels = [] + 41 for pixel in self: + 42 self.xSortedPixels.append((pixel.location[0], pixel)) + 43 self.xSortedPixels.sort() + 44 self.xPixelLocs = [p[0] for p in self.xSortedPixels] + 45 self.pixelsSorted = True +
46 +
47 - def __iter__(self): #the iterator of all our pixel strips chained togther +
48 return itertools.chain(*[strip.__iter__() for strip in \ + 49 self.pixelStrips]) #the * operator breaks the list into args +
50 + 51 #SUBVERTING DESIGN FOR EFFICIENCY 1/24/11, RCOH -- It would be cleaner to store the time on the responses + 52 #themselves, however, it is faster to just pass it in. +
53 - def timeStep(self, currentTime=None): +
54 """Increments time -- This processes all queued responses, adding that to a queue that will + 55 be processed on the next time step.""" + 56 if currentTime == None: + 57 currentTime = timeops.time() + 58 tempQueue = list(self.responseQueue) + 59 self.responseQueue = [] + 60 for response in tempQueue: + 61 self.processResponse(response, currentTime) +
62 + 63 #public +
64 - def respond(self, responseInfo): +
65 self.responseQueue.append(responseInfo) +
66 +
67 - def getSize(self): +
68 """Returns the size of the screen in the form: (minx, miny, maxx, maxy)""" + 69 if self.sizeValid: + 70 return self.size + 71 (minX, minY, maxX, maxY) = (sys.maxint,sys.maxint,-sys.maxint,-sys.maxint) + 72 for light in self: + 73 (x,y) = light.location + 74 + 75 minX = min(x, minX) + 76 maxX = max(x, maxX) + 77 + 78 minY = min(y, minY) + 79 maxY = max(y, maxY) + 80 self.size = (0,0, maxX, maxY) + 81 self.sizeValid = True + 82 return (minX, minY, maxX, maxY) +
83 + 84 #private +
85 - def processResponse(self, responseInfo, currentTime=None): #we need to make a new dict for +
86 #each to prevent interference + 87 if currentTime == None: + 88 currentTime = timeops.time() + 89 if type(responseInfo) != type(dict()): + 90 pass + 91 if 'Mapper' in responseInfo: + 92 mapper = compReg.getComponent(responseInfo['Mapper']) + 93 else: + 94 mapper = compReg.getComponent(Strings.DEFAULT_MAPPER) + 95 pixelWeightList = mapper.mapEvent(responseInfo['Location'], self) + 96 main_log.debug('Screen processing response. ' + str(len(pixelWeightList)) + ' events\ + 97 generated') + 98 PixelEvent.addPixelEventIfMissing(responseInfo) + 99 for (pixel, weight) in pixelWeightList: +100 pixel.processInput(responseInfo['PixelEvent'], 0,weight, currentTime) #TODO: z-index +101 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelcore.Screen.Screen-class.html b/html/SmootLight.pixelcore.Screen.Screen-class.html new file mode 100644 index 0000000..c458c6e --- /dev/null +++ b/html/SmootLight.pixelcore.Screen.Screen-class.html @@ -0,0 +1,324 @@ + + + + + SmootLight.pixelcore.Screen.Screen + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelcore :: + Module Screen :: + Class Screen + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Screen

source code

+

Class representing a collection of Pixels grouped into PixelStrips. + Needs a PixelMapper, currently set via setMapper by may be migrated into + the argDict.

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
__init__(self) + source code + +
+ +
+   + + + + + + +
addStrip(self, + strip) + source code + +
+ +
+   + + + + + + +
pixelsInRange(self, + minX, + maxX)
+ Returns (pixelIndex, pixel).
+ source code + +
+ +
+   + + + + + + +
computeXSortedPixels(self) + source code + +
+ +
+   + + + + + + +
__iter__(self) + source code + +
+ +
+   + + + + + + +
timeStep(self, + currentTime=None)
+ Increments time -- This processes all queued responses, adding that + to a queue that will be processed on the next time step.
+ source code + +
+ +
+   + + + + + + +
respond(self, + responseInfo) + source code + +
+ +
+   + + + + + + +
getSize(self)
+ Returns the size of the screen in the form: (minx, miny, maxx, maxy)
+ source code + +
+ +
+   + + + + + + +
processResponse(self, + responseInfo, + currentTime=None) + source code + +
+ +
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

pixelsInRange(self, + minX, + maxX) +

+
source code  +
+ +

Returns (pixelIndex, pixel). Does a binary search. Sorts first if + neccesary.

+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelevents-module.html b/html/SmootLight.pixelevents-module.html new file mode 100644 index 0000000..ff50b17 --- /dev/null +++ b/html/SmootLight.pixelevents-module.html @@ -0,0 +1,156 @@ + + + + + SmootLight.pixelevents + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelevents + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Package pixelevents

source code

+ + + + + + + +
+ + + + + +
Submodules[hide private]
+
+
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = None +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelevents-pysrc.html b/html/SmootLight.pixelevents-pysrc.html new file mode 100644 index 0000000..d16b273 --- /dev/null +++ b/html/SmootLight.pixelevents-pysrc.html @@ -0,0 +1,112 @@ + + + + + SmootLight.pixelevents + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelevents + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Package SmootLight.pixelevents

+
+1   
+2   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelevents.DecayEvent-module.html b/html/SmootLight.pixelevents.DecayEvent-module.html new file mode 100644 index 0000000..61c6f9f --- /dev/null +++ b/html/SmootLight.pixelevents.DecayEvent-module.html @@ -0,0 +1,157 @@ + + + + + SmootLight.pixelevents.DecayEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelevents :: + Module DecayEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module DecayEvent

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + DecayEvent
+ DecayEvent is a pixel event that can decay either Exponentially or + Proportionally. +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.pixelevents' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelevents.DecayEvent-pysrc.html b/html/SmootLight.pixelevents.DecayEvent-pysrc.html new file mode 100644 index 0000000..17266f2 --- /dev/null +++ b/html/SmootLight.pixelevents.DecayEvent-pysrc.html @@ -0,0 +1,144 @@ + + + + + SmootLight.pixelevents.DecayEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelevents :: + Module DecayEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.pixelevents.DecayEvent

+
+ 1  from operationscore.PixelEvent import * 
+ 2  import math 
+ 3  from util.ColorOps import *  
+ 4  import util.Geo as Geo 
+
5 -class DecayEvent(PixelEvent): +
6 """DecayEvent is a pixel event that can decay either Exponentially or Proportionally. Specify: + 7 <DecayType> -- Exponential or Proportional + 8 <Coefficient> -- Controls the speed of decay.""" + 9 +
10 - def initEvent(self): +
11 self.coefficient = float(abs(self.Coefficient)) +12 if self.DecayType == 'Exponential': +13 self.decayType = 1 +14 else: +15 self.decayType = 2 +16 self.color = self.Color +
17 +18 #SUBVERTING DESIGN FOR THE SAKE OF EFFICIENCY -- RUSSELL COHEN (2011-01-03-23:18) +
19 - def state(self,timeDelay): +
20 if self.decayType == 1: +21 decay = Geo.approxexp(timeDelay*-1*self.coefficient) +22 if self.decayType == 2: +23 decay = self.coefficient / timeDelay +24 color = multiplyColor(self.color, decay) +25 return color if (color[0] + color[1] + color[2]) > 5 else None +
26 +27 @staticmethod +
28 - def generate(decayType, coefficient, color): +
29 args = {'DecayType': decayType, 'Coefficient':coefficient, 'Color':color} +30 return DecayEvent(args) +
31 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelevents.DecayEvent.DecayEvent-class.html b/html/SmootLight.pixelevents.DecayEvent.DecayEvent-class.html new file mode 100644 index 0000000..f11285d --- /dev/null +++ b/html/SmootLight.pixelevents.DecayEvent.DecayEvent-class.html @@ -0,0 +1,341 @@ + + + + + SmootLight.pixelevents.DecayEvent.DecayEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelevents :: + Module DecayEvent :: + Class DecayEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class DecayEvent

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+              operationscore.PixelEvent.PixelEvent --+
+                                                     |
+                                                    DecayEvent
+
+ +
+

DecayEvent is a pixel event that can decay either Exponentially or + Proportionally. Specify: <DecayType> -- Exponential or + Proportional <Coefficient> -- Controls the speed of decay.

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
initEvent(self) + source code + +
+ +
+   + + + + + + +
state(self, + timeDelay) + source code + +
+ +
+

Inherited from operationscore.PixelEvent.PixelEvent: + init, + scale +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+   + + + + + + +
generate(decayType, + coefficient, + color) + source code + +
+ +
+

Inherited from operationscore.PixelEvent.PixelEvent: + addPixelEventIfMissing +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

initEvent(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.PixelEvent.PixelEvent.initEvent +
+
+
+
+ +
+ +
+ + +
+

state(self, + timeDelay) +

+
source code  +
+ + +
+
Overrides: + operationscore.PixelEvent.PixelEvent.state +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelevents.SingleFrameEvent-module.html b/html/SmootLight.pixelevents.SingleFrameEvent-module.html new file mode 100644 index 0000000..ce95b9b --- /dev/null +++ b/html/SmootLight.pixelevents.SingleFrameEvent-module.html @@ -0,0 +1,157 @@ + + + + + SmootLight.pixelevents.SingleFrameEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelevents :: + Module SingleFrameEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module SingleFrameEvent

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + SingleFrameEvent
+ SingleFrameEvent is a PixelEvent that will only render for the + first frame on which it is queried +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.pixelevents' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelevents.SingleFrameEvent-pysrc.html b/html/SmootLight.pixelevents.SingleFrameEvent-pysrc.html new file mode 100644 index 0000000..43432a0 --- /dev/null +++ b/html/SmootLight.pixelevents.SingleFrameEvent-pysrc.html @@ -0,0 +1,126 @@ + + + + + SmootLight.pixelevents.SingleFrameEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelevents :: + Module SingleFrameEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.pixelevents.SingleFrameEvent

+
+ 1  from operationscore.PixelEvent import * 
+
2 -class SingleFrameEvent(PixelEvent): +
3 """SingleFrameEvent is a PixelEvent that will only render for the first frame on which it is + 4 queried""" + 5 +
6 - def initEvent(self): +
7 self.timeState = -1 +
8 - def state(self, timeDelay): +
9 if self.timeState == -1: +10 self.timeState = timeDelay +11 if self.timeState == timeDelay: +12 return self.Color +13 return None +
14 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelevents.SingleFrameEvent.SingleFrameEvent-class.html b/html/SmootLight.pixelevents.SingleFrameEvent.SingleFrameEvent-class.html new file mode 100644 index 0000000..1575388 --- /dev/null +++ b/html/SmootLight.pixelevents.SingleFrameEvent.SingleFrameEvent-class.html @@ -0,0 +1,322 @@ + + + + + SmootLight.pixelevents.SingleFrameEvent.SingleFrameEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelevents :: + Module SingleFrameEvent :: + Class SingleFrameEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class SingleFrameEvent

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+              operationscore.PixelEvent.PixelEvent --+
+                                                     |
+                                                    SingleFrameEvent
+
+ +
+

SingleFrameEvent is a PixelEvent that will only render for the first + frame on which it is queried

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
initEvent(self) + source code + +
+ +
+   + + + + + + +
state(self, + timeDelay) + source code + +
+ +
+

Inherited from operationscore.PixelEvent.PixelEvent: + init, + scale +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.PixelEvent.PixelEvent: + addPixelEventIfMissing +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

initEvent(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.PixelEvent.PixelEvent.initEvent +
+
+
+
+ +
+ +
+ + +
+

state(self, + timeDelay) +

+
source code  +
+ + +
+
Overrides: + operationscore.PixelEvent.PixelEvent.state +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelevents.StepEvent-module.html b/html/SmootLight.pixelevents.StepEvent-module.html new file mode 100644 index 0000000..b997719 --- /dev/null +++ b/html/SmootLight.pixelevents.StepEvent-module.html @@ -0,0 +1,155 @@ + + + + + SmootLight.pixelevents.StepEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelevents :: + Module StepEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module StepEvent

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + StepEvent +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.pixelevents' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelevents.StepEvent-pysrc.html b/html/SmootLight.pixelevents.StepEvent-pysrc.html new file mode 100644 index 0000000..0473b41 --- /dev/null +++ b/html/SmootLight.pixelevents.StepEvent-pysrc.html @@ -0,0 +1,127 @@ + + + + + SmootLight.pixelevents.StepEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelevents :: + Module StepEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.pixelevents.StepEvent

+
+ 1  from operationscore.PixelEvent import * 
+
2 -class StepEvent(PixelEvent): +
3 - def initEvent(self): +
4 self.validateArgs('StepEvent.params') +
5 - def state(self,timeDelay): +
6 if timeDelay < self['LightTime'] or self['LightTime'] == -1: + 7 return self['Color'] + 8 else: + 9 return None +
10 @staticmethod +
11 - def generate(onTime, color): +
12 args = {'LightTime': onTime, 'Color': color} +13 return StepEvent(args) +
14 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelevents.StepEvent.StepEvent-class.html b/html/SmootLight.pixelevents.StepEvent.StepEvent-class.html new file mode 100644 index 0000000..0511516 --- /dev/null +++ b/html/SmootLight.pixelevents.StepEvent.StepEvent-class.html @@ -0,0 +1,336 @@ + + + + + SmootLight.pixelevents.StepEvent.StepEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelevents :: + Module StepEvent :: + Class StepEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class StepEvent

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+              operationscore.PixelEvent.PixelEvent --+
+                                                     |
+                                                    StepEvent
+
+ +
+ + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
initEvent(self) + source code + +
+ +
+   + + + + + + +
state(self, + timeDelay) + source code + +
+ +
+

Inherited from operationscore.PixelEvent.PixelEvent: + init, + scale +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+   + + + + + + +
generate(onTime, + color) + source code + +
+ +
+

Inherited from operationscore.PixelEvent.PixelEvent: + addPixelEventIfMissing +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

initEvent(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.PixelEvent.PixelEvent.initEvent +
+
+
+
+ +
+ +
+ + +
+

state(self, + timeDelay) +

+
source code  +
+ + +
+
Overrides: + operationscore.PixelEvent.PixelEvent.state +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelevents.SynchTestEvent-module.html b/html/SmootLight.pixelevents.SynchTestEvent-module.html new file mode 100644 index 0000000..0edf4bd --- /dev/null +++ b/html/SmootLight.pixelevents.SynchTestEvent-module.html @@ -0,0 +1,157 @@ + + + + + SmootLight.pixelevents.SynchTestEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelevents :: + Module SynchTestEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module SynchTestEvent

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + SynchTestEvent
+ SynchTestEvent is an event to test the synchronization of the power + supplies +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.pixelevents' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelevents.SynchTestEvent-pysrc.html b/html/SmootLight.pixelevents.SynchTestEvent-pysrc.html new file mode 100644 index 0000000..5cf3325 --- /dev/null +++ b/html/SmootLight.pixelevents.SynchTestEvent-pysrc.html @@ -0,0 +1,128 @@ + + + + + SmootLight.pixelevents.SynchTestEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelevents :: + Module SynchTestEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.pixelevents.SynchTestEvent

+
+ 1  from operationscore.PixelEvent import * 
+
2 -class SynchTestEvent(PixelEvent): +
3 """SynchTestEvent is an event to test the synchronization of the power supplies""" +
4 - def initEvent(self): +
5 self.eventstate = 0 + 6 self.cachedDelay = 0 +
7 - def state(self, timeDelay): +
8 if timeDelay != self.cachedDelay: + 9 self.eventstate += 1 +10 self.cachedDelay = timeDelay +11 color = [0]*3 +12 color[self.eventstate % 3] = 150 +13 if self.eventstate > 500: +14 self.eventstate = 0 +15 return color +
16 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelevents.SynchTestEvent.SynchTestEvent-class.html b/html/SmootLight.pixelevents.SynchTestEvent.SynchTestEvent-class.html new file mode 100644 index 0000000..fbb569f --- /dev/null +++ b/html/SmootLight.pixelevents.SynchTestEvent.SynchTestEvent-class.html @@ -0,0 +1,322 @@ + + + + + SmootLight.pixelevents.SynchTestEvent.SynchTestEvent + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelevents :: + Module SynchTestEvent :: + Class SynchTestEvent + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class SynchTestEvent

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+              operationscore.PixelEvent.PixelEvent --+
+                                                     |
+                                                    SynchTestEvent
+
+ +
+

SynchTestEvent is an event to test the synchronization of the power + supplies

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
initEvent(self) + source code + +
+ +
+   + + + + + + +
state(self, + timeDelay) + source code + +
+ +
+

Inherited from operationscore.PixelEvent.PixelEvent: + init, + scale +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Static Methods[hide private]
+
+

Inherited from operationscore.PixelEvent.PixelEvent: + addPixelEventIfMissing +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

initEvent(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.PixelEvent.PixelEvent.initEvent +
+
+
+
+ +
+ +
+ + +
+

state(self, + timeDelay) +

+
source code  +
+ + +
+
Overrides: + operationscore.PixelEvent.PixelEvent.state +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelmappers-module.html b/html/SmootLight.pixelmappers-module.html new file mode 100644 index 0000000..cc34093 --- /dev/null +++ b/html/SmootLight.pixelmappers-module.html @@ -0,0 +1,156 @@ + + + + + SmootLight.pixelmappers + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelmappers + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Package pixelmappers

source code

+ + + + + + + +
+ + + + + +
Submodules[hide private]
+
+
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = None +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelmappers-pysrc.html b/html/SmootLight.pixelmappers-pysrc.html new file mode 100644 index 0000000..38f6c6c --- /dev/null +++ b/html/SmootLight.pixelmappers-pysrc.html @@ -0,0 +1,112 @@ + + + + + SmootLight.pixelmappers + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelmappers + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Package SmootLight.pixelmappers

+
+1   
+2   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelmappers.C5SignMapper-module.html b/html/SmootLight.pixelmappers.C5SignMapper-module.html new file mode 100644 index 0000000..f39987a --- /dev/null +++ b/html/SmootLight.pixelmappers.C5SignMapper-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.pixelmappers.C5SignMapper + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelmappers :: + Module C5SignMapper + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module C5SignMapper

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + C5SignMapper
+ C5SignMapper is a modification to SimpleMapper which maps events to + the nearest Pixel. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.pixelmappers' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelmappers.C5SignMapper-pysrc.html b/html/SmootLight.pixelmappers.C5SignMapper-pysrc.html new file mode 100644 index 0000000..906b261 --- /dev/null +++ b/html/SmootLight.pixelmappers.C5SignMapper-pysrc.html @@ -0,0 +1,242 @@ + + + + + SmootLight.pixelmappers.C5SignMapper + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelmappers :: + Module C5SignMapper + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.pixelmappers.C5SignMapper

+
+  1  from operationscore.PixelMapper import * 
+  2  import util.Geo as Geo 
+  3  import sys 
+  4  import math 
+
5 -class C5SignMapper(PixelMapper): +
6 """C5SignMapper is a modification to SimpleMapper which maps events to the + 7 nearest Pixel. In addtion, it also maps sign artifacts (letters, logo, etc) + 8 to their representative locations if given in the form "ts rs :: conditions" + 9 It also supports strings of the form: {x}>5, {y}<10, {x}*{y}<{x}, etc. + 10 (Conditons, separated by commas. and and or may also be used).""" + 11 + 12 signPosition = { + 13 "ls" : { + 14 'all' : [(2,2),(2,8), (2,14), (2,20)], + 15 '1' : [(2,2)], + 16 '2' : [(2,8)], + 17 '3' : [(2,14)], + 18 '4' : [(2,20)] }, + 19 "ts" : { + 20 'all' : [(4,22), (10,22), (16,22), (22,22), (27, 22), (33, 22), (39,22), (44, 22)], + 21 '1' : [(4,22)], + 22 '2' : [(10,22)], + 23 '3' : [(16,22)], + 24 '4' : [(22,22)], + 25 '5' : [(27,22)], + 26 '6' : [(33,22)], + 27 '7' : [(39,22)], + 28 '8' : [(44,22)] }, + 29 "rs" : { + 30 'all' : [(45,2), (45, 8), (45,14), (45,20)], + 31 '1' : [(45,2)], + 32 '2' : [(45,8)], + 33 '3' : [(45,14)], + 34 '4' : [(45,20)] }, + 35 "bs" : { + 36 'all' : [(4,2), (10,2), (16,2), (22, 2), (27,2), (34,2), (39,2), (44,2)], + 37 '1' : [(4,2)], + 38 '2' : [(10,2)], + 39 '3' : [(16,2)], + 40 '4' : [(22,2)], + 41 '5' : [(27,2)], + 42 '6' : [(33,2)], + 43 '7' : [(39,2)], + 44 '8' : [(44,2)] }, + 45 "wt" : { + 46 'all' : [(12,5), (13, 5), (16,5), (18,5), (21,5), (23,5), (26,5), (27,5), (30,5), (34,5), (37,5)], + 47 '1' : [(12,5), (13,5)], + 48 '2' : [(16,5)], + 49 '3' : [(18,5)], + 50 '4' : [(21,5)], + 51 '5' : [(23,5)], + 52 '6' : [(26,5),(27,5)], + 53 '7' : [(30,5)], + 54 '8' : [(34,5)], + 55 '9' : [(37,5)] }, + 56 "cl" : { + 57 'all' : [(17,8), (21,10), (24,10), (26,12), (31,12)], + 58 'in' : [(21,10),(24,10),(26,12)], + 59 'out' : [(17,8),(31,12)], + 60 '1' : [(17,8)], + 61 '2' : [(21,10)], + 62 '3' : [(24,10)], + 63 '4' : [(26,12)], + 64 '5' : [(31,12)] }, + 65 "c5" : { + 66 'all' : [(6,17), (11,17), (15,17), (19,17), (22, 17), (27,17), (33,16), (34, 16), (38,17), (42,17)], + 67 'con' : [(6,17), (11,17), (15,17), (19,17), (22, 17), (27,17)], + 68 'five': [(33,16), (34, 16), (38,17), (42,17)], + 69 '1' : [(6,17)], + 70 '2' : [(11,17)], + 71 '3' : [(15,17)], + 72 '4' : [(19,17)], + 73 '5' : [(22,17)], + 74 '6' : [(27,17)], + 75 '7' : [(33,16)], + 76 '8' : [(34,16)], + 77 '9' : [(38,17)], + 78 '10' : [(42,17)] }, + 79 } + 80 +
81 - def mappingFunction(self, eventLocation, screen): +
82 if type(eventLocation) == type(tuple()): + 83 bestDist = sys.maxint + 84 bestPixel = None + 85 [x,y] = eventLocation + 86 for (x,pixel) in screen.pixelsInRange(x-self['CutoffDist'], \ + 87 x+self['CutoffDist']): + 88 pixelDist = Geo.dist(pixel.location, eventLocation) + 89 if pixelDist < bestDist: + 90 bestPixel = pixel + 91 bestDist = pixelDist + 92 if bestPixel != None: + 93 return [(bestPixel,1)] + 94 else: + 95 return [] + 96 else: + 97 #pixel locs + 98 eventLocSplit = eventLocation.split('@') + 99 if len(eventLocSplit) == 2: +100 [eventLocation, signPart] = eventLocSplit +101 signParts = signPart.split('.') +102 pixelLocs = signPosition[signParts[0]][signParts[1]] +103 screenPixels = [p for p in screen if (p.location in pixelLocs)] +104 else: +105 screenPixels = [p for p in screen] +106 +107 +108 #{x}>5,{y}<k +109 ret = [] +110 eventLocation = eventLocation.replace('{x}', 'pixel.location[0]') +111 eventLocation = eventLocation.replace('{y}', 'pixel.location[1]') +112 if len(eventLocation) > 0: +113 conditions = eventLocation.split(',') +114 conditionLambdas = [eval('lambda pixel:'+condition) for condition in conditions] +115 else: +116 conditionLambdas = [] +117 for pixel in screenPixels: +118 try: +119 pixelValid = True +120 for p in conditionLambdas: +121 if p(pixel) == False: +122 pixelValid = False +123 continue +124 if pixelValid: +125 ret.append((pixel, 1)) +126 except Exception as exp: +127 import pdb; pdb.set_trace() +128 raise Exception('Bad event condition') +129 return ret +
130 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelmappers.C5SignMapper.C5SignMapper-class.html b/html/SmootLight.pixelmappers.C5SignMapper.C5SignMapper-class.html new file mode 100644 index 0000000..7eef0ea --- /dev/null +++ b/html/SmootLight.pixelmappers.C5SignMapper.C5SignMapper-class.html @@ -0,0 +1,347 @@ + + + + + SmootLight.pixelmappers.C5SignMapper.C5SignMapper + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelmappers :: + Module C5SignMapper :: + Class C5SignMapper + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class C5SignMapper

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+            operationscore.PixelMapper.PixelMapper --+
+                                                     |
+                                                    C5SignMapper
+
+ +
+

C5SignMapper is a modification to SimpleMapper which maps events to + the nearest Pixel. In addtion, it also maps sign artifacts (letters, + logo, etc) to their representative locations if given in the form + "ts rs :: conditions" It also supports strings of the form: + {x}>5, {y}<10, {x}*{y}<{x}, etc. (Conditons, separated by + commas. and and or may also be used).

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
mappingFunction(self, + eventLocation, + screen)
+ Takes a Screen and event location and returns a list of tuples + (pixel,weight) with sum(weights)=1
+ source code + +
+ +
+

Inherited from operationscore.PixelMapper.PixelMapper: + init, + mapEvent +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Class Variables[hide private]
+
+   + + signPosition = {'bs': {'1': [(4, 2)], '2': [(10, 2)], '3': [(1... +
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

mappingFunction(self, + eventLocation, + screen) +

+
source code  +
+ +

Takes a Screen and event location and returns a list of tuples + (pixel,weight) with sum(weights)=1

+
+
Overrides: + operationscore.PixelMapper.PixelMapper.mappingFunction +
(inherited documentation)
+ +
+
+
+
+ + + + + + +
+ + + + + +
Class Variable Details[hide private]
+
+ +
+ +
+

signPosition

+ +
+
+
+
Value:
+
+{'bs': {'1': [(4, 2)],
+        '2': [(10, 2)],
+        '3': [(16, 2)],
+        '4': [(22, 2)],
+        '5': [(27, 2)],
+        '6': [(33, 2)],
+        '7': [(39, 2)],
+        '8': [(44, 2)],
+...
+
+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelmappers.GaussianMapper-module.html b/html/SmootLight.pixelmappers.GaussianMapper-module.html new file mode 100644 index 0000000..7677bbf --- /dev/null +++ b/html/SmootLight.pixelmappers.GaussianMapper-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.pixelmappers.GaussianMapper + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelmappers :: + Module GaussianMapper + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module GaussianMapper

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + GaussianMapper
+ GaussianMapper is a PixelMapper which weights pixels around an + event proportional to a gaussian surface. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.pixelmappers' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelmappers.GaussianMapper-pysrc.html b/html/SmootLight.pixelmappers.GaussianMapper-pysrc.html new file mode 100644 index 0000000..9295c07 --- /dev/null +++ b/html/SmootLight.pixelmappers.GaussianMapper-pysrc.html @@ -0,0 +1,137 @@ + + + + + SmootLight.pixelmappers.GaussianMapper + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelmappers :: + Module GaussianMapper + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.pixelmappers.GaussianMapper

+
+ 1  from operationscore.PixelMapper import * 
+ 2  import util.Geo as Geo 
+
3 -class GaussianMapper(PixelMapper): +
4 """GaussianMapper is a PixelMapper which weights pixels around an event proportional to a + 5 gaussian surface. Specify: + 6 <Height> -- The height of the gaussian surface + 7 <Width> -- The width of the gaussian surface + 8 <MinWeight> -- the minimum weight event that can be returned + 9 <CutoffDist> -- the maximum radius considered +10 """ +11 +
12 - def mappingFunction(self, eventLocation, screen): +
13 returnPixels = [] +14 [x,y] = eventLocation +15 potentialPixels = screen.pixelsInRange(x-self.CutoffDist, \ +16 x+self.CutoffDist) +17 for (x,pixel) in screen.pixelsInRange(x-self.CutoffDist, \ +18 x+self.CutoffDist): +19 pixelDist = Geo.dist(pixel.location, eventLocation) +20 if pixelDist < self.CutoffDist: +21 w = Geo.gaussian(pixelDist, self.Height, 0, self.Width) +22 if w > self.MinWeight: +23 returnPixels.append((pixel, w)) +24 return returnPixels +
25 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelmappers.GaussianMapper.GaussianMapper-class.html b/html/SmootLight.pixelmappers.GaussianMapper.GaussianMapper-class.html new file mode 100644 index 0000000..ea17fec --- /dev/null +++ b/html/SmootLight.pixelmappers.GaussianMapper.GaussianMapper-class.html @@ -0,0 +1,268 @@ + + + + + SmootLight.pixelmappers.GaussianMapper.GaussianMapper + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelmappers :: + Module GaussianMapper :: + Class GaussianMapper + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class GaussianMapper

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+            operationscore.PixelMapper.PixelMapper --+
+                                                     |
+                                                    GaussianMapper
+
+ +
+

GaussianMapper is a PixelMapper which weights pixels around an event + proportional to a gaussian surface. Specify: <Height> -- The + height of the gaussian surface <Width> -- The width of the gaussian + surface <MinWeight> -- the minimum weight event that can be + returned <CutoffDist> -- the maximum radius considered

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
mappingFunction(self, + eventLocation, + screen)
+ Takes a Screen and event location and returns a list of tuples + (pixel,weight) with sum(weights)=1
+ source code + +
+ +
+

Inherited from operationscore.PixelMapper.PixelMapper: + init, + mapEvent +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

mappingFunction(self, + eventLocation, + screen) +

+
source code  +
+ +

Takes a Screen and event location and returns a list of tuples + (pixel,weight) with sum(weights)=1

+
+
Overrides: + operationscore.PixelMapper.PixelMapper.mappingFunction +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelmappers.SimpleMapper-module.html b/html/SmootLight.pixelmappers.SimpleMapper-module.html new file mode 100644 index 0000000..6bc4eb3 --- /dev/null +++ b/html/SmootLight.pixelmappers.SimpleMapper-module.html @@ -0,0 +1,164 @@ + + + + + SmootLight.pixelmappers.SimpleMapper + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelmappers :: + Module SimpleMapper + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module SimpleMapper

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + SimpleMapper
+ SimpleMapper is a PixelMapper which maps events to the nearest + Pixel. +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.pixelmappers' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelmappers.SimpleMapper-pysrc.html b/html/SmootLight.pixelmappers.SimpleMapper-pysrc.html new file mode 100644 index 0000000..b2a183f --- /dev/null +++ b/html/SmootLight.pixelmappers.SimpleMapper-pysrc.html @@ -0,0 +1,162 @@ + + + + + SmootLight.pixelmappers.SimpleMapper + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelmappers :: + Module SimpleMapper + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.pixelmappers.SimpleMapper

+
+ 1  from operationscore.PixelMapper import * 
+ 2  import util.Geo as Geo 
+ 3  import math 
+ 4  import sys 
+
5 -class SimpleMapper(PixelMapper): +
6 """SimpleMapper is a PixelMapper which maps events to the nearest Pixel. It also supports + 7 strings of the form: + 8 {x}>5, {y}<10, {x}*{y}<{x}, etc. (Conditions, separated by commas. Standard python syntax such + 9 as and and or may also be +10 used). You may use 'math.' functions such as math.sqrt, etc. It also accepts lists of strings""" +
11 - def mappingFunction(self, eventLocation, screen): +
12 if type(eventLocation) == type(tuple()): +13 bestDist = sys.maxint +14 bestPixel = None +15 [x,y] = eventLocation +16 for (x,pixel) in screen.pixelsInRange(x-self['CutoffDist'], \ +17 x+self['CutoffDist']): +18 pixelDist = Geo.dist(pixel.location, eventLocation) +19 if pixelDist < bestDist: +20 bestPixel = pixel +21 bestDist = pixelDist +22 if bestPixel != None: +23 return [(bestPixel,1)] +24 else: +25 return [] +26 else: +27 #{x}>5,{y}<k +28 ret = [] +29 if not isinstance(eventLocation, list): +30 eventLocation = eventLocation.replace('{x}', 'pixel.location[0]') +31 eventLocation = eventLocation.replace('{y}', 'pixel.location[1]') +32 conditions = eventLocation.split(',') +33 else: +34 conditions = eventLocation #TODO: check for lists of strings +35 conditionLambdas = [eval('lambda pixel:'+condition) for condition in conditions] +36 +37 for pixel in screen: +38 try: +39 pixelValid = True +40 for p in conditionLambdas: +41 if p(pixel) == False: +42 pixelValid = False +43 continue +44 if pixelValid: +45 ret.append((pixel, 1)) +46 except Exception as exp: +47 exp.message += 'Bad Event Condition' +48 raise exp +49 return ret +
50 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelmappers.SimpleMapper.SimpleMapper-class.html b/html/SmootLight.pixelmappers.SimpleMapper.SimpleMapper-class.html new file mode 100644 index 0000000..3e489a1 --- /dev/null +++ b/html/SmootLight.pixelmappers.SimpleMapper.SimpleMapper-class.html @@ -0,0 +1,268 @@ + + + + + SmootLight.pixelmappers.SimpleMapper.SimpleMapper + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelmappers :: + Module SimpleMapper :: + Class SimpleMapper + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class SimpleMapper

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+            operationscore.PixelMapper.PixelMapper --+
+                                                     |
+                                                    SimpleMapper
+
+ +
+

SimpleMapper is a PixelMapper which maps events to the nearest Pixel. + It also supports strings of the form: {x}>5, {y}<10, + {x}*{y}<{x}, etc. (Conditions, separated by commas. Standard python + syntax such as and and or may also be used). You may use 'math.' + functions such as math.sqrt, etc. It also accepts lists of strings

+ + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
mappingFunction(self, + eventLocation, + screen)
+ Takes a Screen and event location and returns a list of tuples + (pixel,weight) with sum(weights)=1
+ source code + +
+ +
+

Inherited from operationscore.PixelMapper.PixelMapper: + init, + mapEvent +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

mappingFunction(self, + eventLocation, + screen) +

+
source code  +
+ +

Takes a Screen and event location and returns a list of tuples + (pixel,weight) with sum(weights)=1

+
+
Overrides: + operationscore.PixelMapper.PixelMapper.mappingFunction +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelmappers.WindGaussianMapper-module.html b/html/SmootLight.pixelmappers.WindGaussianMapper-module.html new file mode 100644 index 0000000..f403bdb --- /dev/null +++ b/html/SmootLight.pixelmappers.WindGaussianMapper-module.html @@ -0,0 +1,162 @@ + + + + + SmootLight.pixelmappers.WindGaussianMapper + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelmappers :: + Module WindGaussianMapper + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module WindGaussianMapper

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + WindGaussianMapper +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.pixelmappers' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelmappers.WindGaussianMapper-pysrc.html b/html/SmootLight.pixelmappers.WindGaussianMapper-pysrc.html new file mode 100644 index 0000000..9d54b36 --- /dev/null +++ b/html/SmootLight.pixelmappers.WindGaussianMapper-pysrc.html @@ -0,0 +1,131 @@ + + + + + SmootLight.pixelmappers.WindGaussianMapper + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelmappers :: + Module WindGaussianMapper + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.pixelmappers.WindGaussianMapper

+
+ 1  from operationscore.PixelMapper import * 
+ 2  import util.Geo as Geo 
+ 3  import math 
+
4 -class WindGaussianMapper(PixelMapper): +
5 - def mappingFunction(self, eventLocation, screen): +
6 returnPixels = [] #TODO: consider preallocation and trimming + 7 [x,y] = eventLocation + 8 potentialPixels = screen.pixelsInRange(x-self.CutoffDist, x) + 9 for (xloc,pixel) in screen.pixelsInRange(x-self.CutoffDist, x): +10 pixelDistx = math.fabs(pixel.location[0] - x) +11 pixelDisty = math.fabs(pixel.location[1] - y) +12 if pixelDistx < self.CutoffDist: +13 if pixelDisty < 30: +14 w = Geo.windtrail(pixelDistx, pixelDisty, self.Height, 0, self.Width) +15 if w > self.MinWeight: +16 returnPixels.append((pixel, w)) +17 +18 return returnPixels +
19 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.pixelmappers.WindGaussianMapper.WindGaussianMapper-class.html b/html/SmootLight.pixelmappers.WindGaussianMapper.WindGaussianMapper-class.html new file mode 100644 index 0000000..0bfe3a4 --- /dev/null +++ b/html/SmootLight.pixelmappers.WindGaussianMapper.WindGaussianMapper-class.html @@ -0,0 +1,262 @@ + + + + + SmootLight.pixelmappers.WindGaussianMapper.WindGaussianMapper + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package pixelmappers :: + Module WindGaussianMapper :: + Class WindGaussianMapper + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class WindGaussianMapper

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+            operationscore.PixelMapper.PixelMapper --+
+                                                     |
+                                                    WindGaussianMapper
+
+ +
+ + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
mappingFunction(self, + eventLocation, + screen)
+ Takes a Screen and event location and returns a list of tuples + (pixel,weight) with sum(weights)=1
+ source code + +
+ +
+

Inherited from operationscore.PixelMapper.PixelMapper: + init, + mapEvent +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

mappingFunction(self, + eventLocation, + screen) +

+
source code  +
+ +

Takes a Screen and event location and returns a list of tuples + (pixel,weight) with sum(weights)=1

+
+
Overrides: + operationscore.PixelMapper.PixelMapper.mappingFunction +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.renderers-module.html b/html/SmootLight.renderers-module.html new file mode 100644 index 0000000..5676da2 --- /dev/null +++ b/html/SmootLight.renderers-module.html @@ -0,0 +1,154 @@ + + + + + SmootLight.renderers + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package renderers + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Package renderers

source code

+ + + + + + + +
+ + + + + +
Submodules[hide private]
+
+
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = None +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.renderers-pysrc.html b/html/SmootLight.renderers-pysrc.html new file mode 100644 index 0000000..45a1f75 --- /dev/null +++ b/html/SmootLight.renderers-pysrc.html @@ -0,0 +1,112 @@ + + + + + SmootLight.renderers + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package renderers + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Package SmootLight.renderers

+
+1   
+2   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.renderers.IndoorRenderer-module.html b/html/SmootLight.renderers.IndoorRenderer-module.html new file mode 100644 index 0000000..0953dac --- /dev/null +++ b/html/SmootLight.renderers.IndoorRenderer-module.html @@ -0,0 +1,163 @@ + + + + + SmootLight.renderers.IndoorRenderer + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package renderers :: + Module IndoorRenderer + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module IndoorRenderer

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + IndoorRenderer
+ IndoorRenderer is a renderer for a specific Light System +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + sock_port = 6038 +
+   + + __package__ = 'SmootLight.renderers' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.renderers.IndoorRenderer-pysrc.html b/html/SmootLight.renderers.IndoorRenderer-pysrc.html new file mode 100644 index 0000000..26a51cc --- /dev/null +++ b/html/SmootLight.renderers.IndoorRenderer-pysrc.html @@ -0,0 +1,151 @@ + + + + + SmootLight.renderers.IndoorRenderer + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package renderers :: + Module IndoorRenderer + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.renderers.IndoorRenderer

+
+ 1  from operationscore.Renderer import * 
+ 2  import util.PacketComposition as composer  
+ 3  import util.NetworkOps as network 
+ 4  import util.TimeOps as timeops 
+ 5  import socket,pdb 
+ 6  sock_port = 6038 
+
7 -class IndoorRenderer(Renderer): +
8 """IndoorRenderer is a renderer for a specific Light System""" + 9 +
10 - def initRenderer(self): +
11 self.stripLocations = {} #Dict that stores info necessary to render to +12 #strips +13 self.sockets = {} #dict of (IP)->Socket +14 #a strip +15 powerSupplies = self.argDict['PowerSupply'] +16 if not type(powerSupplies) == type([]): +17 powerSupplies = [powerSupplies] +18 for powerSupply in powerSupplies: +19 ip = powerSupply['IP'] +20 stripsInPowerSupply = powerSupply['PortMapping'] +21 for stripId in stripsInPowerSupply: +22 self.stripLocations[stripId] = (ip, \ +23 stripsInPowerSupply[stripId]) +24 self.broadSocket = network.getBroadcastSocket(6038) +
25 - def render(self, lightSystem, currentTime=timeops.time()): +
26 #try: +27 for pixelStrip in lightSystem.pixelStrips: +28 stripId = pixelStrip.argDict['Id'] +29 (ip, port) = self.stripLocations[stripId] +30 if not ip in self.sockets: #do we have a socket to this +31 #strip? if not, spin off a new one +32 self.sockets[ip] = network.getConnectedSocket(ip,sock_port) +33 packet = composer.composePixelStripPacket(pixelStrip, port, currentTime) +34 self.sockets[ip].send(packet, 0x00) +35 +36 synchPacket = composer.composeSynchPacket() +
37 #pdb.set_trace() +38 #self.broadSocket.sendto(synchPacket, ('10.0.32.255', 6038)) +39 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.renderers.IndoorRenderer.IndoorRenderer-class.html b/html/SmootLight.renderers.IndoorRenderer.IndoorRenderer-class.html new file mode 100644 index 0000000..3293f7c --- /dev/null +++ b/html/SmootLight.renderers.IndoorRenderer.IndoorRenderer-class.html @@ -0,0 +1,297 @@ + + + + + SmootLight.renderers.IndoorRenderer.IndoorRenderer + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package renderers :: + Module IndoorRenderer :: + Class IndoorRenderer + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class IndoorRenderer

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Renderer.Renderer --+
+                                                     |
+                                                    IndoorRenderer
+
+ +
+

IndoorRenderer is a renderer for a specific Light System

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
initRenderer(self) + source code + +
+ +
+   + + + + + + +
render(self, + lightSystem, + currentTime=1.29806611913e+12) + source code + +
+ +
+

Inherited from operationscore.Renderer.Renderer: + init +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

initRenderer(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Renderer.Renderer.initRenderer +
+
+
+
+ +
+ +
+ + +
+

render(self, + lightSystem, + currentTime=1.29806611913e+12) +

+
source code  +
+ + +
+
Overrides: + operationscore.Renderer.Renderer.render +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.renderers.PygameRenderer-module.html b/html/SmootLight.renderers.PygameRenderer-module.html new file mode 100644 index 0000000..a1066fb --- /dev/null +++ b/html/SmootLight.renderers.PygameRenderer-module.html @@ -0,0 +1,1935 @@ + + + + + SmootLight.renderers.PygameRenderer + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package renderers :: + Module PygameRenderer + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module PygameRenderer

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + PygameRenderer
+ PygameRenderer is a renderer which renders the LightSystem to a + pygame display +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + ACTIVEEVENT = 1 +
+   + + ANYFORMAT = 268435456 +
+   + + ASYNCBLIT = 4 +
+   + + AUDIO_S16 = 32784 +
+   + + AUDIO_S16LSB = 32784 +
+   + + AUDIO_S16MSB = 36880 +
+   + + AUDIO_S16SYS = 32784 +
+   + + AUDIO_S8 = 32776 +
+   + + AUDIO_U16 = 16 +
+   + + AUDIO_U16LSB = 16 +
+   + + AUDIO_U16MSB = 4112 +
+   + + AUDIO_U16SYS = 16 +
+   + + AUDIO_U8 = 8 +
+   + + BIG_ENDIAN = 4321 +
+   + + BLEND_ADD = 1 +
+   + + BLEND_MAX = 5 +
+   + + BLEND_MIN = 4 +
+   + + BLEND_MULT = 3 +
+   + + BLEND_RGBA_ADD = 6 +
+   + + BLEND_RGBA_MAX = 16 +
+   + + BLEND_RGBA_MIN = 9 +
+   + + BLEND_RGBA_MULT = 8 +
+   + + BLEND_RGBA_SUB = 7 +
+   + + BLEND_RGB_ADD = 1 +
+   + + BLEND_RGB_MAX = 5 +
+   + + BLEND_RGB_MIN = 4 +
+   + + BLEND_RGB_MULT = 3 +
+   + + BLEND_RGB_SUB = 2 +
+   + + BLEND_SUB = 2 +
+   + + BUTTON_X1 = 6 +
+   + + BUTTON_X2 = 7 +
+   + + DOUBLEBUF = 1073741824 +
+   + + FULLSCREEN = -2147483648 +
+   + + GL_ACCELERATED_VISUAL = 15 +
+   + + GL_ACCUM_ALPHA_SIZE = 11 +
+   + + GL_ACCUM_BLUE_SIZE = 10 +
+   + + GL_ACCUM_GREEN_SIZE = 9 +
+   + + GL_ACCUM_RED_SIZE = 8 +
+   + + GL_ALPHA_SIZE = 3 +
+   + + GL_BLUE_SIZE = 2 +
+   + + GL_BUFFER_SIZE = 4 +
+   + + GL_DEPTH_SIZE = 6 +
+   + + GL_DOUBLEBUFFER = 5 +
+   + + GL_GREEN_SIZE = 1 +
+   + + GL_MULTISAMPLEBUFFERS = 13 +
+   + + GL_MULTISAMPLESAMPLES = 14 +
+   + + GL_RED_SIZE = 0 +
+   + + GL_STENCIL_SIZE = 7 +
+   + + GL_STEREO = 12 +
+   + + GL_SWAP_CONTROL = 16 +
+   + + HAT_CENTERED = 0 +
+   + + HAT_DOWN = 4 +
+   + + HAT_LEFT = 8 +
+   + + HAT_LEFTDOWN = 12 +
+   + + HAT_LEFTUP = 9 +
+   + + HAT_RIGHT = 2 +
+   + + HAT_RIGHTDOWN = 6 +
+   + + HAT_RIGHTUP = 3 +
+   + + HAT_UP = 1 +
+   + + HWACCEL = 256 +
+   + + HWPALETTE = 536870912 +
+   + + HWSURFACE = 1 +
+   + + IYUV_OVERLAY = 1448433993 +
+   + + JOYAXISMOTION = 7 +
+   + + JOYBALLMOTION = 8 +
+   + + JOYBUTTONDOWN = 10 +
+   + + JOYBUTTONUP = 11 +
+   + + JOYHATMOTION = 9 +
+   + + KEYDOWN = 2 +
+   + + KEYUP = 3 +
+   + + KMOD_ALT = 768 +
+   + + KMOD_CAPS = 8192 +
+   + + KMOD_CTRL = 192 +
+   + + KMOD_LALT = 256 +
+   + + KMOD_LCTRL = 64 +
+   + + KMOD_LMETA = 1024 +
+   + + KMOD_LSHIFT = 1 +
+   + + KMOD_META = 3072 +
+   + + KMOD_MODE = 16384 +
+   + + KMOD_NONE = 0 +
+   + + KMOD_NUM = 4096 +
+   + + KMOD_RALT = 512 +
+   + + KMOD_RCTRL = 128 +
+   + + KMOD_RMETA = 2048 +
+   + + KMOD_RSHIFT = 2 +
+   + + KMOD_SHIFT = 3 +
+   + + K_0 = 48 +
+   + + K_1 = 49 +
+   + + K_2 = 50 +
+   + + K_3 = 51 +
+   + + K_4 = 52 +
+   + + K_5 = 53 +
+   + + K_6 = 54 +
+   + + K_7 = 55 +
+   + + K_8 = 56 +
+   + + K_9 = 57 +
+   + + K_AMPERSAND = 38 +
+   + + K_ASTERISK = 42 +
+   + + K_AT = 64 +
+   + + K_BACKQUOTE = 96 +
+   + + K_BACKSLASH = 92 +
+   + + K_BACKSPACE = 8 +
+   + + K_BREAK = 318 +
+   + + K_CAPSLOCK = 301 +
+   + + K_CARET = 94 +
+   + + K_CLEAR = 12 +
+   + + K_COLON = 58 +
+   + + K_COMMA = 44 +
+   + + K_DELETE = 127 +
+   + + K_DOLLAR = 36 +
+   + + K_DOWN = 274 +
+   + + K_END = 279 +
+   + + K_EQUALS = 61 +
+   + + K_ESCAPE = 27 +
+   + + K_EURO = 321 +
+   + + K_EXCLAIM = 33 +
+   + + K_F1 = 282 +
+   + + K_F10 = 291 +
+   + + K_F11 = 292 +
+   + + K_F12 = 293 +
+   + + K_F13 = 294 +
+   + + K_F14 = 295 +
+   + + K_F15 = 296 +
+   + + K_F2 = 283 +
+   + + K_F3 = 284 +
+   + + K_F4 = 285 +
+   + + K_F5 = 286 +
+   + + K_F6 = 287 +
+   + + K_F7 = 288 +
+   + + K_F8 = 289 +
+   + + K_F9 = 290 +
+   + + K_FIRST = 0 +
+   + + K_GREATER = 62 +
+   + + K_HASH = 35 +
+   + + K_HELP = 315 +
+   + + K_HOME = 278 +
+   + + K_INSERT = 277 +
+   + + K_KP0 = 256 +
+   + + K_KP1 = 257 +
+   + + K_KP2 = 258 +
+   + + K_KP3 = 259 +
+   + + K_KP4 = 260 +
+   + + K_KP5 = 261 +
+   + + K_KP6 = 262 +
+   + + K_KP7 = 263 +
+   + + K_KP8 = 264 +
+   + + K_KP9 = 265 +
+   + + K_KP_DIVIDE = 267 +
+   + + K_KP_ENTER = 271 +
+   + + K_KP_EQUALS = 272 +
+   + + K_KP_MINUS = 269 +
+   + + K_KP_MULTIPLY = 268 +
+   + + K_KP_PERIOD = 266 +
+   + + K_KP_PLUS = 270 +
+   + + K_LALT = 308 +
+   + + K_LAST = 323 +
+   + + K_LCTRL = 306 +
+   + + K_LEFT = 276 +
+   + + K_LEFTBRACKET = 91 +
+   + + K_LEFTPAREN = 40 +
+   + + K_LESS = 60 +
+   + + K_LMETA = 310 +
+   + + K_LSHIFT = 304 +
+   + + K_LSUPER = 311 +
+   + + K_MENU = 319 +
+   + + K_MINUS = 45 +
+   + + K_MODE = 313 +
+   + + K_NUMLOCK = 300 +
+   + + K_PAGEDOWN = 281 +
+   + + K_PAGEUP = 280 +
+   + + K_PAUSE = 19 +
+   + + K_PERIOD = 46 +
+   + + K_PLUS = 43 +
+   + + K_POWER = 320 +
+   + + K_PRINT = 316 +
+   + + K_QUESTION = 63 +
+   + + K_QUOTE = 39 +
+   + + K_QUOTEDBL = 34 +
+   + + K_RALT = 307 +
+   + + K_RCTRL = 305 +
+   + + K_RETURN = 13 +
+   + + K_RIGHT = 275 +
+   + + K_RIGHTBRACKET = 93 +
+   + + K_RIGHTPAREN = 41 +
+   + + K_RMETA = 309 +
+   + + K_RSHIFT = 303 +
+   + + K_RSUPER = 312 +
+   + + K_SCROLLOCK = 302 +
+   + + K_SEMICOLON = 59 +
+   + + K_SLASH = 47 +
+   + + K_SPACE = 32 +
+   + + K_SYSREQ = 317 +
+   + + K_TAB = 9 +
+   + + K_UNDERSCORE = 95 +
+   + + K_UNKNOWN = 0 +
+   + + K_UP = 273 +
+   + + K_a = 97 +
+   + + K_b = 98 +
+   + + K_c = 99 +
+   + + K_d = 100 +
+   + + K_e = 101 +
+   + + K_f = 102 +
+   + + K_g = 103 +
+   + + K_h = 104 +
+   + + K_i = 105 +
+   + + K_j = 106 +
+   + + K_k = 107 +
+   + + K_l = 108 +
+   + + K_m = 109 +
+   + + K_n = 110 +
+   + + K_o = 111 +
+   + + K_p = 112 +
+   + + K_q = 113 +
+   + + K_r = 114 +
+   + + K_s = 115 +
+   + + K_t = 116 +
+   + + K_u = 117 +
+   + + K_v = 118 +
+   + + K_w = 119 +
+   + + K_x = 120 +
+   + + K_y = 121 +
+   + + K_z = 122 +
+   + + LIL_ENDIAN = 1234 +
+   + + MOUSEBUTTONDOWN = 5 +
+   + + MOUSEBUTTONUP = 6 +
+   + + MOUSEMOTION = 4 +
+   + + NOEVENT = 0 +
+   + + NOFRAME = 32 +
+   + + NUMEVENTS = 32 +
+   + + OPENGL = 2 +
+   + + OPENGLBLIT = 10 +
+   + + PREALLOC = 16777216 +
+   + + QUIT = 12 +
+   + + RESIZABLE = 16 +
+   + + RLEACCEL = 16384 +
+   + + RLEACCELOK = 8192 +
+   + + SCRAP_BMP = 'image/bmp' +
+   + + SCRAP_CLIPBOARD = 0 +
+   + + SCRAP_PBM = 'image/pbm' +
+   + + SCRAP_PPM = 'image/ppm' +
+   + + SCRAP_SELECTION = 1 +
+   + + SCRAP_TEXT = 'text/plain' +
+   + + SRCALPHA = 65536 +
+   + + SRCCOLORKEY = 4096 +
+   + + SWSURFACE = 0 +
+   + + SYSWMEVENT = 13 +
+   + + TIMER_RESOLUTION = 10 +
+   + + USEREVENT = 24 +
+   + + UYVY_OVERLAY = 1498831189 +
+   + + VIDEOEXPOSE = 17 +
+   + + VIDEORESIZE = 16 +
+   + + YUY2_OVERLAY = 844715353 +
+   + + YV12_OVERLAY = 842094169 +
+   + + YVYU_OVERLAY = 1431918169 +
+   + + __package__ = 'SmootLight.renderers' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.renderers.PygameRenderer-pysrc.html b/html/SmootLight.renderers.PygameRenderer-pysrc.html new file mode 100644 index 0000000..41e0024 --- /dev/null +++ b/html/SmootLight.renderers.PygameRenderer-pysrc.html @@ -0,0 +1,158 @@ + + + + + SmootLight.renderers.PygameRenderer + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package renderers :: + Module PygameRenderer + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.renderers.PygameRenderer

+
+ 1  from operationscore.Renderer import * 
+ 2  import util.TimeOps as timeops  
+ 3  import pygame 
+ 4  from pygame.locals import * 
+ 5  import pdb 
+
6 -class PygameRenderer(Renderer): +
7 """PygameRenderer is a renderer which renders the LightSystem to a pygame display""" + 8 +
9 - def initRenderer(self): +
10 pygame.init() +11 self.screen = pygame.display.set_mode((1300,500)) +12 self.background = pygame.Surface(self.screen.get_size()) +13 self.background = self.background.convert() +14 self.background.fill(Color(0,0,0)) +15 self.stopwatch = timeops.Stopwatch() +16 self.stopwatch.start() +
17 +
18 - def render(self, lightSystem, currentTime=timeops.time()): +
19 self.background.fill(Color(0,0,0)) +20 #print 'drawing color:',light.color +21 if 'Scale' in self: +22 scale = self['Scale'] +23 else: +24 scale = 1 +25 for light in lightSystem: +26 scaledLoc = [l*scale for l in light.location] +27 pygame.draw.circle(self.background, light.state(currentTime), scaledLoc, \ +28 5) +29 +30 self.screen.blit(self.background, (0,0)) +31 pygame.display.flip() +32 self.stopwatch.stop() +33 pygame.display.set_caption(str(int(1000/self.stopwatch.elapsed()))) +34 self.stopwatch.start() +
35 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.renderers.PygameRenderer.PygameRenderer-class.html b/html/SmootLight.renderers.PygameRenderer.PygameRenderer-class.html new file mode 100644 index 0000000..843b940 --- /dev/null +++ b/html/SmootLight.renderers.PygameRenderer.PygameRenderer-class.html @@ -0,0 +1,298 @@ + + + + + SmootLight.renderers.PygameRenderer.PygameRenderer + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package renderers :: + Module PygameRenderer :: + Class PygameRenderer + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class PygameRenderer

source code

+
+                                    object --+        
+                                             |        
+operationscore.SmootCoreObject.SmootCoreObject --+    
+                                                 |    
+                  operationscore.Renderer.Renderer --+
+                                                     |
+                                                    PygameRenderer
+
+ +
+

PygameRenderer is a renderer which renders the LightSystem to a pygame + display

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
initRenderer(self) + source code + +
+ +
+   + + + + + + +
render(self, + lightSystem, + currentTime=1.29806611922e+12) + source code + +
+ +
+

Inherited from operationscore.Renderer.Renderer: + init +

+

Inherited from operationscore.SmootCoreObject.SmootCoreObject: + __contains__, + __getitem__, + __getiter__, + __init__, + __setitem__, + acquireLock, + addDieListener, + className, + die, + releaseLock, + removeDieListener, + validateArgDict, + validateArgs +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

initRenderer(self) +

+
source code  +
+ + +
+
Overrides: + operationscore.Renderer.Renderer.initRenderer +
+
+
+
+ +
+ +
+ + +
+

render(self, + lightSystem, + currentTime=1.29806611922e+12) +

+
source code  +
+ + +
+
Overrides: + operationscore.Renderer.Renderer.render +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests-module.html b/html/SmootLight.tests-module.html new file mode 100644 index 0000000..2a1753d --- /dev/null +++ b/html/SmootLight.tests-module.html @@ -0,0 +1,160 @@ + + + + + SmootLight.tests + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Package tests

source code

+ + + + + + + +
+ + + + + +
Submodules[hide private]
+
+
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.tests' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests-pysrc.html b/html/SmootLight.tests-pysrc.html new file mode 100644 index 0000000..e1662ea --- /dev/null +++ b/html/SmootLight.tests-pysrc.html @@ -0,0 +1,114 @@ + + + + + SmootLight.tests + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Package SmootLight.tests

+
+1  from TestComponentRegistry import TestComponentRegistry  
+2  from TestConfigLoaders import TestConfigLoaders 
+3  from TestBQS import TestBQS 
+4   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests.TestBQS'-module.html b/html/SmootLight.tests.TestBQS'-module.html new file mode 100644 index 0000000..97694f9 --- /dev/null +++ b/html/SmootLight.tests.TestBQS'-module.html @@ -0,0 +1,162 @@ + + + + + SmootLight.tests.TestBQS' + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests :: + Module TestBQS' + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module TestBQS'

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + TestBQS +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.tests' +
+   + + main_log = logging.getLogger("smoot_light") +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests.TestBQS'-pysrc.html b/html/SmootLight.tests.TestBQS'-pysrc.html new file mode 100644 index 0000000..48af701 --- /dev/null +++ b/html/SmootLight.tests.TestBQS'-pysrc.html @@ -0,0 +1,160 @@ + + + + + SmootLight.tests.TestBQS' + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests :: + Module TestBQS' + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.tests.TestBQS'

+
+ 1  import unittest 
+ 2  import util.BehaviorQuerySystem as bqs 
+ 3  from behaviors.ColorChangerBehavior import * 
+ 4  import util.Geo as geo 
+
5 -class TestBQS(unittest.TestCase): +
6 - def setUp(self): +
7 bqs.initBQS() + 8 b = ColorChangerBehavior({'Id': 'color','ColorList':[(255,0,0)]}) + 9 c = ColorChangerBehavior({'Id': 'color2', 'ColorList':[(0,0,255)]}) +10 bqs.addBehavior(b) +11 bqs.addBehavior(c) +12 b.addInput({'Location':(3,4)}) +13 c.addInput({'Location':(5,12)}) +14 b.timeStep() +15 c.timeStep() +
16 +
17 - def tearDown(self): +
18 bqs.initBQS() +
19 +
20 - def test_simple_query(self): +
21 validQuery = lambda args:args['Color']==(255,0,0) +22 invalidQuery = lambda args:args['Color']==(254,0,0) +23 assert bqs.query(validQuery) == [{'Color':(255,0,0), 'Location':(3,4)}] +24 assert bqs.query(invalidQuery) == [] +
25 +
26 - def test_dist_query(self): +
27 validDist = lambda args:geo.dist(args['Location'], (0,0)) <= 5 +28 invalidDist = lambda args:geo.dist(args['Location'], (0,0)) <= 2 +29 doubleDist = lambda args:geo.dist(args['Location'], (0,0)) <= 20 +30 +31 assert bqs.query(validDist) == [{'Color':(255,0,0), 'Location':(3,4)}] +32 assert bqs.query(invalidDist) == [] +33 assert bqs.query(doubleDist) == [{'Color':(255,0,0), 'Location':(3,4)}, {'Color':(0,0,255),\ +34 'Location':(5,12)}] +
35 - def test_complex_queries(self): +
36 validQuery = lambda args:args['Color']==(255,0,0) +37 doubleDist = lambda args:geo.dist(args['Location'], (0,0)) <= 20 +38 +39 twoPartPredicate = lambda args:doubleDist(args) and validQuery(args) +40 assert bqs.query(twoPartPredicate) == [{'Color':(255,0,0), 'Location':(3,4)}] +41 assert bqs.query([validQuery, doubleDist]) == [{'Color':(255,0,0), 'Location':(3,4)}] +
42 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests.TestBQS'.TestBQS-class.html b/html/SmootLight.tests.TestBQS'.TestBQS-class.html new file mode 100644 index 0000000..f43342f --- /dev/null +++ b/html/SmootLight.tests.TestBQS'.TestBQS-class.html @@ -0,0 +1,383 @@ + + + + + SmootLight.tests.TestBQS'.TestBQS + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests :: + Module TestBQS' :: + Class TestBQS + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class TestBQS

source code

+
+       object --+    
+                |    
+unittest.TestCase --+
+                    |
+                   TestBQS
+
+ +
+ + + + + + + + + +
+ + + + + +
Nested Classes[hide private]
+
+

Inherited from unittest.TestCase: + failureException +

+
+ + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
setUp(self)
+ Hook method for setting up the test fixture before exercising it.
+ source code + +
+ +
+   + + + + + + +
tearDown(self)
+ Hook method for deconstructing the test fixture after testing it.
+ source code + +
+ +
+   + + + + + + +
test_complex_queries(self) + source code + +
+ +
+   + + + + + + +
test_dist_query(self) + source code + +
+ +
+   + + + + + + +
test_simple_query(self) + source code + +
+ +
+

Inherited from unittest.TestCase: + __call__, + __eq__, + __hash__, + __init__, + __ne__, + __repr__, + __str__, + assertAlmostEqual, + assertAlmostEquals, + assertEqual, + assertEquals, + assertFalse, + assertNotAlmostEqual, + assertNotAlmostEquals, + assertNotEqual, + assertNotEquals, + assertRaises, + assertTrue, + assert_, + countTestCases, + debug, + defaultTestResult, + fail, + failIf, + failIfAlmostEqual, + failIfEqual, + failUnless, + failUnlessAlmostEqual, + failUnlessEqual, + failUnlessRaises, + id, + run, + shortDescription +

+

Inherited from unittest.TestCase (private): + _exc_info +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __new__, + __reduce__, + __reduce_ex__, + __setattr__, + __sizeof__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

setUp(self) +

+
source code  +
+ +

Hook method for setting up the test fixture before exercising it.

+
+
Overrides: + unittest.TestCase.setUp +
(inherited documentation)
+ +
+
+
+ +
+ +
+ + +
+

tearDown(self) +

+
source code  +
+ +

Hook method for deconstructing the test fixture after testing it.

+
+
Overrides: + unittest.TestCase.tearDown +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests.TestComponentRegistry'-module.html b/html/SmootLight.tests.TestComponentRegistry'-module.html new file mode 100644 index 0000000..17f21a7 --- /dev/null +++ b/html/SmootLight.tests.TestComponentRegistry'-module.html @@ -0,0 +1,155 @@ + + + + + SmootLight.tests.TestComponentRegistry' + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests :: + Module TestComponentRegistry' + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module TestComponentRegistry'

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + TestComponentRegistry +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.tests' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests.TestComponentRegistry'-pysrc.html b/html/SmootLight.tests.TestComponentRegistry'-pysrc.html new file mode 100644 index 0000000..6ef4258 --- /dev/null +++ b/html/SmootLight.tests.TestComponentRegistry'-pysrc.html @@ -0,0 +1,137 @@ + + + + + SmootLight.tests.TestComponentRegistry' + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests :: + Module TestComponentRegistry' + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.tests.TestComponentRegistry'

+
+ 1  import unittest 
+ 2  import util.ComponentRegistry as compReg 
+ 3  from operationscore.SmootCoreObject import SmootCoreObject  
+
4 -class TestComponentRegistry(unittest.TestCase): +
5 - def setUp(self): +
6 compReg.initRegistry() +
7 +
8 - def tearDown(self): +
9 compReg.clearRegistry() +
10 +
12 comp = SmootCoreObject({'Id': 'obj1'}) +13 compReg.registerComponent(comp) +14 newcomp = compReg.getComponent('obj1') +15 assert comp == newcomp +
16 +
17 - def test_register_new_id(self): +
18 comp = SmootCoreObject({}) +19 cid =compReg.registerComponent(comp) +20 newcomp = compReg.getComponent(cid) +21 assert comp == newcomp +
22 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests.TestComponentRegistry'.TestComponentRegistry-class.html b/html/SmootLight.tests.TestComponentRegistry'.TestComponentRegistry-class.html new file mode 100644 index 0000000..7c4950a --- /dev/null +++ b/html/SmootLight.tests.TestComponentRegistry'.TestComponentRegistry-class.html @@ -0,0 +1,367 @@ + + + + + SmootLight.tests.TestComponentRegistry'.TestComponentRegistry + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests :: + Module TestComponentRegistry' :: + Class TestComponentRegistry + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class TestComponentRegistry

source code

+
+       object --+    
+                |    
+unittest.TestCase --+
+                    |
+                   TestComponentRegistry
+
+ +
+ + + + + + + + + +
+ + + + + +
Nested Classes[hide private]
+
+

Inherited from unittest.TestCase: + failureException +

+
+ + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
setUp(self)
+ Hook method for setting up the test fixture before exercising it.
+ source code + +
+ +
+   + + + + + + +
tearDown(self)
+ Hook method for deconstructing the test fixture after testing it.
+ source code + +
+ +
+   + + + + + + +
test_register_component_id_specified(self) + source code + +
+ +
+   + + + + + + +
test_register_new_id(self) + source code + +
+ +
+

Inherited from unittest.TestCase: + __call__, + __eq__, + __hash__, + __init__, + __ne__, + __repr__, + __str__, + assertAlmostEqual, + assertAlmostEquals, + assertEqual, + assertEquals, + assertFalse, + assertNotAlmostEqual, + assertNotAlmostEquals, + assertNotEqual, + assertNotEquals, + assertRaises, + assertTrue, + assert_, + countTestCases, + debug, + defaultTestResult, + fail, + failIf, + failIfAlmostEqual, + failIfEqual, + failUnless, + failUnlessAlmostEqual, + failUnlessEqual, + failUnlessRaises, + id, + run, + shortDescription +

+

Inherited from unittest.TestCase (private): + _exc_info +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __new__, + __reduce__, + __reduce_ex__, + __setattr__, + __sizeof__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

setUp(self) +

+
source code  +
+ +

Hook method for setting up the test fixture before exercising it.

+
+
Overrides: + unittest.TestCase.setUp +
(inherited documentation)
+ +
+
+
+ +
+ +
+ + +
+

tearDown(self) +

+
source code  +
+ +

Hook method for deconstructing the test fixture after testing it.

+
+
Overrides: + unittest.TestCase.tearDown +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests.TestConfigLoaders'-module.html b/html/SmootLight.tests.TestConfigLoaders'-module.html new file mode 100644 index 0000000..5602fbc --- /dev/null +++ b/html/SmootLight.tests.TestConfigLoaders'-module.html @@ -0,0 +1,162 @@ + + + + + SmootLight.tests.TestConfigLoaders' + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests :: + Module TestConfigLoaders' + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module TestConfigLoaders'

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + TestConfigLoaders +
+ + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + VERSION = '1.2.6' +
+   + + __package__ = 'SmootLight.tests' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests.TestConfigLoaders'-pysrc.html b/html/SmootLight.tests.TestConfigLoaders'-pysrc.html new file mode 100644 index 0000000..e6a5f72 --- /dev/null +++ b/html/SmootLight.tests.TestConfigLoaders'-pysrc.html @@ -0,0 +1,160 @@ + + + + + SmootLight.tests.TestConfigLoaders' + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests :: + Module TestConfigLoaders' + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.tests.TestConfigLoaders'

+
+ 1  import unittest 
+ 2  import util.Config as Config 
+ 3  import pdb 
+ 4  from xml.etree.ElementTree import * 
+ 5  import filecmp 
+ 6  import xml 
+
7 -class TestConfigLoaders(unittest.TestCase): +
8 - def setUp(self): +
9 pass +
10 +
11 - def tearDown(self): +
12 pass +
13 +
14 - def test_composite(self): +
15 parent = ElementTree() +16 overrider = ElementTree() +17 +18 parent.parse('tests/testdata/parent.xml') +19 overrider.parse('tests/testdata/override.xml') +20 +21 result = Config.compositeXMLTrees(parent,overrider) +22 result = ElementTree(result) +23 result.write('tests/testdata/compositeTESTout.xml') +24 assert filecmp.cmp('tests/testdata/compositeTESTout.xml','tests/testdata/compositeTRUTH.xml') +
25 +
26 - def test_inheritance(self): +
27 result = Config.loadConfigFile('tests/testdata/inheritanceTEST.xml') +28 +29 result.write('tests/testdata/inheritanceTESTout.xml') +30 assert filecmp.cmp('tests/testdata/inheritanceTESTout.xml',\ +31 'tests/testdata/inheritanceTRUTH.xml') +
32 #Tests our fancy new XML Eval Function +
33 - def test_eval(self): +
34 assert Config.attemptEval('5') == 5 +35 assert Config.attemptEval('{5:10, 12:15}') == {5:10, 12:15} +36 singleLayerLambda = Config.attemptEval('${Val}$*5') +37 assert singleLayerLambda({'Val':2}) == 10 +38 doubleLayerLambda = Config.attemptEval("${Val1}$*'${Val2}$'") +39 assert doubleLayerLambda({'Val1':3})({'Val2':7}) == 21 +40 +41 conditional = Config.attemptEval("${Val1}$*5=='${Val2}$'") +42 assert conditional({'Val1':5})({'Val2':25}) == True +43 assert conditional({'Val1':5})({'Val2':26}) == False +44 +45 onlyDouble = Config.attemptEval("'${Val1}$'*'${Val2}$'") +46 assert onlyDouble({})({'Val1':3, 'Val2':7}) == 21 +
47 if __name__ == '__main__': +48 unittest.main() +49 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests.TestConfigLoaders'.TestConfigLoaders-class.html b/html/SmootLight.tests.TestConfigLoaders'.TestConfigLoaders-class.html new file mode 100644 index 0000000..2ebcc5b --- /dev/null +++ b/html/SmootLight.tests.TestConfigLoaders'.TestConfigLoaders-class.html @@ -0,0 +1,383 @@ + + + + + SmootLight.tests.TestConfigLoaders'.TestConfigLoaders + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests :: + Module TestConfigLoaders' :: + Class TestConfigLoaders + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class TestConfigLoaders

source code

+
+       object --+    
+                |    
+unittest.TestCase --+
+                    |
+                   TestConfigLoaders
+
+ +
+ + + + + + + + + +
+ + + + + +
Nested Classes[hide private]
+
+

Inherited from unittest.TestCase: + failureException +

+
+ + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
setUp(self)
+ Hook method for setting up the test fixture before exercising it.
+ source code + +
+ +
+   + + + + + + +
tearDown(self)
+ Hook method for deconstructing the test fixture after testing it.
+ source code + +
+ +
+   + + + + + + +
test_composite(self) + source code + +
+ +
+   + + + + + + +
test_eval(self) + source code + +
+ +
+   + + + + + + +
test_inheritance(self) + source code + +
+ +
+

Inherited from unittest.TestCase: + __call__, + __eq__, + __hash__, + __init__, + __ne__, + __repr__, + __str__, + assertAlmostEqual, + assertAlmostEquals, + assertEqual, + assertEquals, + assertFalse, + assertNotAlmostEqual, + assertNotAlmostEquals, + assertNotEqual, + assertNotEquals, + assertRaises, + assertTrue, + assert_, + countTestCases, + debug, + defaultTestResult, + fail, + failIf, + failIfAlmostEqual, + failIfEqual, + failUnless, + failUnlessAlmostEqual, + failUnlessEqual, + failUnlessRaises, + id, + run, + shortDescription +

+

Inherited from unittest.TestCase (private): + _exc_info +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __new__, + __reduce__, + __reduce_ex__, + __setattr__, + __sizeof__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

setUp(self) +

+
source code  +
+ +

Hook method for setting up the test fixture before exercising it.

+
+
Overrides: + unittest.TestCase.setUp +
(inherited documentation)
+ +
+
+
+ +
+ +
+ + +
+

tearDown(self) +

+
source code  +
+ +

Hook method for deconstructing the test fixture after testing it.

+
+
Overrides: + unittest.TestCase.tearDown +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests.TestSwitchBehavior-module.html b/html/SmootLight.tests.TestSwitchBehavior-module.html new file mode 100644 index 0000000..4ecae23 --- /dev/null +++ b/html/SmootLight.tests.TestSwitchBehavior-module.html @@ -0,0 +1,155 @@ + + + + + SmootLight.tests.TestSwitchBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests :: + Module TestSwitchBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module TestSwitchBehavior

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + TestSwitchBehavior +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.tests' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests.TestSwitchBehavior-pysrc.html b/html/SmootLight.tests.TestSwitchBehavior-pysrc.html new file mode 100644 index 0000000..00f6ce5 --- /dev/null +++ b/html/SmootLight.tests.TestSwitchBehavior-pysrc.html @@ -0,0 +1,285 @@ + + + + + SmootLight.tests.TestSwitchBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests :: + Module TestSwitchBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.tests.TestSwitchBehavior

+
+ 1  import unittest 
+ 2  import util.ComponentRegistry as compReg 
+ 3   
+ 4  from behaviors.SwitchBehavior import SwitchBehavior 
+ 5  from behaviors.EchoBehavior import EchoBehavior 
+ 6  from behaviors.DebugBehavior import DebugBehavior 
+ 7   
+
8 -class TestSwitchBehavior(unittest.TestCase): +
9 - def setUp(self): +
10 compReg.initRegistry() +11 +12 # add a test registry +13 self.behavior1 = EchoBehavior({'Id': 'behavior1'}) +14 self.behavior2 = DebugBehavior({'Id': 'behavior2'}) +15 compReg.registerComponent(self.behavior1) +16 compReg.registerComponent(self.behavior2) +17 +18 self.switchBehavior = SwitchBehavior({'Id': 'switch', 'PrefixToBehavior': '{"@": "behavior1", "#": "behavior2"}', 'DefaultBehavior': 'behavior1'}) +19 compReg.registerComponent(self.switchBehavior) +
20 +
21 - def tearDown(self): +
22 pass +
23 +
24 - def test_switch_to_behavior1(self): +
25 inputs = [{'Data': '@something', 'Location': 'someloc'}] +26 returned = self.switchBehavior.processResponse(inputs, []) +27 assert returned[0][0]['Location'] == 'someloc' +
28 +
29 - def test_switch_to_behavior2(self): +
30 inputs = [{'Data': '#something'}] +31 returned = self.switchBehavior.processResponse(inputs, []) +32 assert returned[0] == [] +
33 +
34 - def test_default_behavior(self): +
35 inputs = [{'Data': 'something', 'Location': 'someloc'}] +36 returned = self.switchBehavior.processResponse(inputs, []) +37 assert returned[0][0]['Location'] == 'someloc' +
38 +39 +40 if __name__ == '__main__': +41 unittest.main() +42 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior-class.html b/html/SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior-class.html new file mode 100644 index 0000000..d66d801 --- /dev/null +++ b/html/SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior-class.html @@ -0,0 +1,383 @@ + + + + + SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests :: + Module TestSwitchBehavior :: + Class TestSwitchBehavior + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class TestSwitchBehavior

source code

+
+       object --+    
+                |    
+unittest.TestCase --+
+                    |
+                   TestSwitchBehavior
+
+ +
+ + + + + + + + + +
+ + + + + +
Nested Classes[hide private]
+
+

Inherited from unittest.TestCase: + failureException +

+
+ + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
setUp(self)
+ Hook method for setting up the test fixture before exercising it.
+ source code + +
+ +
+   + + + + + + +
tearDown(self)
+ Hook method for deconstructing the test fixture after testing it.
+ source code + +
+ +
+   + + + + + + +
test_switch_to_behavior1(self) + source code + +
+ +
+   + + + + + + +
test_switch_to_behavior2(self) + source code + +
+ +
+   + + + + + + +
test_default_behavior(self) + source code + +
+ +
+

Inherited from unittest.TestCase: + __call__, + __eq__, + __hash__, + __init__, + __ne__, + __repr__, + __str__, + assertAlmostEqual, + assertAlmostEquals, + assertEqual, + assertEquals, + assertFalse, + assertNotAlmostEqual, + assertNotAlmostEquals, + assertNotEqual, + assertNotEquals, + assertRaises, + assertTrue, + assert_, + countTestCases, + debug, + defaultTestResult, + fail, + failIf, + failIfAlmostEqual, + failIfEqual, + failUnless, + failUnlessAlmostEqual, + failUnlessEqual, + failUnlessRaises, + id, + run, + shortDescription +

+

Inherited from unittest.TestCase (private): + _exc_info +

+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __new__, + __reduce__, + __reduce_ex__, + __setattr__, + __sizeof__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

setUp(self) +

+
source code  +
+ +

Hook method for setting up the test fixture before exercising it.

+
+
Overrides: + unittest.TestCase.setUp +
(inherited documentation)
+ +
+
+
+ +
+ +
+ + +
+

tearDown(self) +

+
source code  +
+ +

Hook method for deconstructing the test fixture after testing it.

+
+
Overrides: + unittest.TestCase.tearDown +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests.testosc-module.html b/html/SmootLight.tests.testosc-module.html new file mode 100644 index 0000000..085e361 --- /dev/null +++ b/html/SmootLight.tests.testosc-module.html @@ -0,0 +1,204 @@ + + + + + SmootLight.tests.testosc + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests :: + Module testosc + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module testosc

source code

+ + + + + + + + + + + + + + + +
+ + + + + +
Functions[hide private]
+
+   + + + + + + +
foo_bar_callback(path, + args) + source code + +
+ +
+   + + + + + + +
foo_baz_callback(path, + args, + types, + src, + data) + source code + +
+ +
+   + + + + + + +
fallback(path, + args, + types, + src) + source code + +
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + server = liblo.Server(1234) +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.tests.testosc-pysrc.html b/html/SmootLight.tests.testosc-pysrc.html new file mode 100644 index 0000000..f5583d4 --- /dev/null +++ b/html/SmootLight.tests.testosc-pysrc.html @@ -0,0 +1,149 @@ + + + + + SmootLight.tests.testosc + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package tests :: + Module testosc + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.tests.testosc

+
+ 1  #!/usr/bin/env python 
+ 2   
+ 3  import liblo, sys 
+ 4   
+ 5  # create server, listening on port 1234 
+ 6  try: 
+ 7      server = liblo.Server(1234) 
+ 8  except liblo.ServerError, err: 
+ 9      print str(err) 
+10      sys.exit() 
+11   
+
12 -def foo_bar_callback(path, args): +
13 i, f = args +14 print "received message '%s' with arguments '%d' and '%f'" % (path, i, f) +
15 +
16 -def foo_baz_callback(path, args, types, src, data): +
17 print "received message '%s'" % path +18 print "blob contains %d bytes, user data was '%s'" % (len(args[0]), data) +
19 +
20 -def fallback(path, args, types, src): +
21 print "got unknown message '%s' from '%s'" % (path, src.get_url()) +22 for a, t in zip(args, types): +23 print "argument of type '%s': %s" % (t, a) +
24 +25 # register method taking an int and a float +26 server.add_method("/foo/bar", 'if', foo_bar_callback) +27 +28 # register method taking a blob, and passing user data to the callback +29 server.add_method("/foo/baz", 'b', foo_baz_callback, "blah") +30 +31 # register a fallback for unhandled messages +32 server.add_method(None, None, fallback) +33 +34 # loop and dispatch messages every 100ms +35 while True: +36 server.recv(100) +37 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util-module.html b/html/SmootLight.util-module.html new file mode 100644 index 0000000..e675f9b --- /dev/null +++ b/html/SmootLight.util-module.html @@ -0,0 +1,162 @@ + + + + + SmootLight.util + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Package util

source code

+ + + + + + + +
+ + + + + +
Submodules[hide private]
+
+
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = None +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util-pysrc.html b/html/SmootLight.util-pysrc.html new file mode 100644 index 0000000..d340739 --- /dev/null +++ b/html/SmootLight.util-pysrc.html @@ -0,0 +1,112 @@ + + + + + SmootLight.util + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Package SmootLight.util

+
+1   
+2   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.BehaviorQuerySystem-module.html b/html/SmootLight.util.BehaviorQuerySystem-module.html new file mode 100644 index 0000000..8f89a68 --- /dev/null +++ b/html/SmootLight.util.BehaviorQuerySystem-module.html @@ -0,0 +1,345 @@ + + + + + SmootLight.util.BehaviorQuerySystem + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module BehaviorQuerySystem + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module BehaviorQuerySystem

source code

+ + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Functions[hide private]
+
+   + + + + + + +
initBQS() + source code + +
+ +
+   + + + + + + +
addBehavior(behavior)
+ Add a behavior to the behavior registry.
+ source code + +
+ +
+   + + + + + + +
query(predicateList)
+ BehaviorQuerySystem.query takes a list of predicates (functions with signature: + (behavior,output)), and +optionally a behavior to be compared to.
+ source code + +
+ +
+   + + + + + + +
getDistLambda(loc, + maxDist)
+ Returns a lambda function that checks if for behaviors within maxDist + of loc.
+ source code + +
+ +
+   + + + + + + +
getBehaviorsNear(loc, + maxdist)
+ A premade method to do the common task of finding behavior near a + location.
+ source code + +
+ +
+ + + + + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.util' +
+   + + behaviorList = [<SmootLight.behaviors.EchoBehavior.EchoBehavio... +
+   + + initialized = True +
+ + + + + + +
+ + + + + +
Function Details[hide private]
+
+ +
+ +
+ + +
+

getDistLambda(loc, + maxDist) +

+
source code  +
+ +

Returns a lambda function that checks if for behaviors within maxDist + of loc. Can be passed in as an arg to query.

+
+
+
+
+
+ + + + + + +
+ + + + + +
Variables Details[hide private]
+
+ +
+ +
+

behaviorList

+ +
+
+
+
Value:
+
+[<SmootLight.behaviors.EchoBehavior.EchoBehavior object at 0x9979a6c>,
+ <SmootLight.behaviors.BehaviorChain.BehaviorChain object at 0x9979d6c\
+>,
+ <SmootLight.behaviors.MoveBehavior.MoveBehavior object at 0x998222c>,
+ <SmootLight.behaviors.TouchOSC.TouchOSC object at 0x998284c>,
+ <SmootLight.behaviors.RestrictLocation.RestrictLocation object at 0x9\
+982d8c>,
+ <SmootLight.behaviors.ColorChangerBehavior.ColorChangerBehavior objec\
+...
+
+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.BehaviorQuerySystem-pysrc.html b/html/SmootLight.util.BehaviorQuerySystem-pysrc.html new file mode 100644 index 0000000..103bec1 --- /dev/null +++ b/html/SmootLight.util.BehaviorQuerySystem-pysrc.html @@ -0,0 +1,159 @@ + + + + + SmootLight.util.BehaviorQuerySystem + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module BehaviorQuerySystem + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.util.BehaviorQuerySystem

+
+ 1  import types  
+ 2  """The behavior query system is a module that allows querying behaviors based on lambda-function 
+ 3  predicates.""" 
+
4 -def initBQS(): +
5 global behaviorList, initialized + 6 behaviorList = [] + 7 initialized = True +
8 +
9 -def addBehavior(behavior): +
10 """Add a behavior to the behavior registry.""" +11 behaviorList.append(behavior) +
12 +
13 -def query(predicateList): +
14 """BehaviorQuerySystem.query takes a list of predicates (functions with signature: +15 (behavior,output)), and +16 optionally a behavior to be compared to.""" +17 #want to do queries wrt: behavior itself, the behavior packet, the querying behavior +18 if isinstance(predicateList, types.FunctionType): +19 predicateList = [predicateList] +20 elif not isinstance(predicateList, list): +21 raise Exception('Predicate list must be a function or list of functions') +22 global behaviorList, initialized +23 ret = [] +24 if not initialized: +25 initBQS() +26 +27 for behavior in behaviorList: #Consider every behavior +28 lastOutput = behavior.getLastOutput() +29 for output in lastOutput: #Look at every element it has output +30 validOutput = True +31 for pred in predicateList: #Evaluate every predicate. A predicate is a lambda function that +32 #takes a dict and returns a bool. +33 if not pred(output): +34 validOutput = False +35 break +36 if validOutput: +37 ret.append(output) +38 return ret +
39 +
40 -def getDistLambda(loc, maxDist): +
41 """Returns a lambda function that checks if for behaviors within maxDist of loc. Can be passed +42 in as an arg to query.""" +43 return lambda args:geo.dist(args['Location'], loc) <= maxDist +
44 +
45 -def getBehaviorsNear(loc, maxdist): +
46 """A premade method to do the common task of finding behavior near a location.""" +47 return query(getDistLambda(loc, maxDist)) +
48 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.ColorOps-module.html b/html/SmootLight.util.ColorOps-module.html new file mode 100644 index 0000000..476787b --- /dev/null +++ b/html/SmootLight.util.ColorOps-module.html @@ -0,0 +1,288 @@ + + + + + SmootLight.util.ColorOps + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module ColorOps + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module ColorOps

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Color +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Functions[hide private]
+
+   + + + + + + +
randomColor() + source code + +
+ +
+   + + + + + + +
chooseRandomColor(colorList)
+ Given a list of colors, pick one at random
+ source code + +
+ +
+   + + + + + + +
safeColor(c)
+ Ensures that a color is valid
+ source code + +
+ +
+   + + + + + + +
combineColors(colors) + source code + +
+ +
+   + + + + + + +
multiplyColor(color, + percent) + source code + +
+ +
+   + + + + + + +
floatToIntColor(rgb) + source code + +
+ +
+   + + + + + + +
randomBrightColor() + source code + +
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.util' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.ColorOps-pysrc.html b/html/SmootLight.util.ColorOps-pysrc.html new file mode 100644 index 0000000..0fed210 --- /dev/null +++ b/html/SmootLight.util.ColorOps-pysrc.html @@ -0,0 +1,158 @@ + + + + + SmootLight.util.ColorOps + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module ColorOps + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.util.ColorOps

+
+ 1  import random 
+ 2  import colorsys 
+ 3  from util.TimeOps import Stopwatch 
+
4 -def randomColor(): +
5 return [random.randint(0,255) for i in range(3)] +
6 +
7 -def chooseRandomColor(colorList): +
8 """Given a list of colors, pick one at random""" + 9 return random.choice(colorList) +
10 -def safeColor(c): +
11 """Ensures that a color is valid""" +12 c[0] = c[0] if c[0] < 255 else 255 +13 c[1] = c[1] if c[1] < 255 else 255 +14 c[2] = c[2] if c[2] < 255 else 255 +15 +16 +17 return c +
18 +
19 -def combineColors(colors): +
20 result = [0,0,0] +21 for c in colors: +22 result[0] += c[0] +23 result[1] += c[1] +24 result[2] += c[2] +25 return safeColor(result) +
26 +
27 -def multiplyColor(color, percent): +
28 return safeColor([channel*(percent) for channel in color]) +
29 +
30 -def floatToIntColor(rgb): +
31 rgb[0] = int(rgb[0]*256 + .5) +32 rgb[1] = int(rgb[1]*256 + .5) +33 rgb[2] = int(rgb[2]*256 + .5) +34 return safeColor(rgb) +
35 +
36 -def randomBrightColor(): +
37 hue = random.random() +38 sat = random.random()/2.0 + .5 +39 val = 1.0 +40 hue, sat, val = colorsys.hsv_to_rgb(hue, sat, val) +41 ret = [hue, sat, val] +42 return floatToIntColor(ret) +
43 +
44 -class Color(object): +
45 - def __init__(self, r,g,b): +
46 self.rep = [r,g,b] +
47 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.ColorOps.Color-class.html b/html/SmootLight.util.ColorOps.Color-class.html new file mode 100644 index 0000000..8c70940 --- /dev/null +++ b/html/SmootLight.util.ColorOps.Color-class.html @@ -0,0 +1,241 @@ + + + + + SmootLight.util.ColorOps.Color + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module ColorOps :: + Class Color + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Color

source code

+
+object --+
+         |
+        Color
+
+ +
+ + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
__init__(self, + r, + g, + b)
+ x.__init__(...) initializes x; see x.__class__.__doc__ for signature
+ source code + +
+ +
+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

__init__(self, + r, + g, + b) +
(Constructor) +

+
source code  +
+ +

x.__init__(...) initializes x; see x.__class__.__doc__ for + signature

+
+
Overrides: + object.__init__ +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.ComponentRegistry-module.html b/html/SmootLight.util.ComponentRegistry-module.html new file mode 100644 index 0000000..6cee4c1 --- /dev/null +++ b/html/SmootLight.util.ComponentRegistry-module.html @@ -0,0 +1,360 @@ + + + + + SmootLight.util.ComponentRegistry + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module ComponentRegistry + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module ComponentRegistry

source code

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Functions[hide private]
+
+   + + + + + + +
initRegistry() + source code + +
+ +
+   + + + + + + +
makelock() + source code + +
+ +
+   + + + + + + +
clearRegistry() + source code + +
+ +
+   + + + + + + +
getLock() + source code + +
+ +
+   + + + + + + +
getComponent(cid) + source code + +
+ +
+   + + + + + + +
registerComponent(component, + cid=None) + source code + +
+ +
+   + + + + + + +
verifyUniqueId(cid) + source code + +
+ +
+   + + + + + + +
removeComponent(cid) + source code + +
+ +
+   + + + + + + +
getNewId() + source code + +
+ +
+ + + + + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + Registry = {'DefaultPixelMapper': <SmootLight.pixelmappers.Sim... +
+   + + __package__ = 'SmootLight.util' +
+   + + utilLock = <thread.lock object at 0xb7524420> +
+ + + + + + +
+ + + + + +
Variables Details[hide private]
+
+ +
+ +
+

Registry

+ +
+
+
+
Value:
+
+{'DefaultPixelMapper': <SmootLight.pixelmappers.SimpleMapper.SimpleMap\
+per object at 0x99c61ac>,
+ 'OSCTouchChase': <SmootLight.behaviors.BehaviorChain.BehaviorChain ob\
+ject at 0x99c09cc>,
+ 'Screen': <SmootLight.pixelcore.Screen.Screen instance at 0x9303d6c>,
+ 'SixaxisChase': <SmootLight.behaviors.BehaviorChain.BehaviorChain obj\
+ect at 0x99c05ec>,
+ 'allpixels': <SmootLight.behaviors.AllPixels.AllPixels object at 0x99\
+...
+
+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.ComponentRegistry-pysrc.html b/html/SmootLight.util.ComponentRegistry-pysrc.html new file mode 100644 index 0000000..bce3a68 --- /dev/null +++ b/html/SmootLight.util.ComponentRegistry-pysrc.html @@ -0,0 +1,303 @@ + + + + + SmootLight.util.ComponentRegistry + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module ComponentRegistry + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.util.ComponentRegistry

+
+ 1  import hashlib  
+ 2  from logger import main_log 
+ 3  import thread 
+ 4  #TODO: make component registry a singleton 
+
5 -def initRegistry(): +
6 #TODO: don't overwrite existing registry + 7 if not 'Registry' in globals(): + 8 globals()['Registry'] = {} + 9 makelock() +
10 +11 +
12 -def makelock(): +
13 global utilLock +14 utilLock = thread.allocate_lock() +
15 -def clearRegistry(): +
17 +
18 -def removeComponent(cid): +
19 global Registry +20 Registry.pop(cid) +
21 +
22 -def getLock(): +
23 global utilLock +24 return utilLock +
25 -def getComponent(cid): +
26 global Registry +27 return Registry[cid] +
28 +29 #Registry of all components of the light system +30 #TODO: pick a graceful failure behavior and implement it +
31 -def registerComponent(component, cid=None): +
32 global Registry +33 if cid != None: +34 Registry[cid] = component +35 else: +36 try: +37 cid = component['Id'] +38 except KeyError: +39 cid = getNewId() +40 component['Id'] = cid +41 main_log.debug(cid + 'automatically assigned') +42 if cid in Registry: +43 main_log.warn(cid + 'overwritten.') +44 Registry[cid] = component +45 return cid +
46 +
47 -def verifyUniqueId(cid): +
48 global Registry +49 return not cid in Registry +
50 +
51 -def removeComponent(cid): +
52 global Registry +53 Registry.pop(cid) +
54 +
55 -def getNewId(): +
56 global Registry +57 trialKey = len(Registry) +58 trialId = hashlib.md5(str(trialKey)).hexdigest() +59 while trialId in Registry: +60 trialKey += 1 +61 trialId = hashlib.md5(str(trialKey)).hexdigest() +62 return trialId +
63 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.Config-module.html b/html/SmootLight.util.Config-module.html new file mode 100644 index 0000000..1297bbc --- /dev/null +++ b/html/SmootLight.util.Config-module.html @@ -0,0 +1,496 @@ + + + + + SmootLight.util.Config + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module Config + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Config

source code

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Functions[hide private]
+
+   + + + + + + +
loadParamRequirementDict(className) + source code + +
+ +
+   + + + + + + +
loadConfigFile(fileName)
+ Loads a config file.
+ source code + +
+ +
+   + + + + + + +
getElement(el)
+ Takes an Element or an ElementTree.
+ source code + +
+ +
+   + + + + + + +
compositeXMLTrees(parentTree, + overridingTree)
+ XML tree composition.
+ source code + +
+ +
+   + + + + + + +
findElementsByTag(tag, + eList) + source code + +
+ +
+   + + + + + + +
fileToDict(fileName) + source code + +
+ +
+   + + + + + + +
pullArgsFromItem(parentNode)
+ Parses arguments into python objects if possible, otherwise leaves as + strings
+ source code + +
+ +
+   + + + + + + +
attemptEval(val)
+ Runs an eval if possible, or converts into a lambda expression if + indicated.
+ source code + +
+ +
+   + + + + + + +
generateArgDict(parentNode, + recurse=False) + source code + +
+ +
+   + + + + + + +
resolveDocumentInheritances(el)
+ In place resolution of document inheritances.
+ source code + +
+ +
+   + + + + + + +
resolveInheritance(el)
+ In place resolution of inheritence.
+ source code + +
+ +
+ + + + + + + + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + classArgsMem = {} +
+   + + CONFIG_PATH = 'config/' +
+   + + DEFAULT_OVERRIDE_MODE = 'Merge' +
+   + + __package__ = 'SmootLight.util' +
+ + + + + + +
+ + + + + +
Function Details[hide private]
+
+ +
+ +
+ + +
+

loadConfigFile(fileName) +

+
source code  +
+ +

Loads a config file. If its an xml file, inheritances are + automatically resolved.

+
+
+
+
+ +
+ +
+ + +
+

getElement(el) +

+
source code  +
+ +

Takes an Element or an ElementTree. If it is a tree, it returns its + root. Otherwise, just returns it

+
+
+
+
+ +
+ +
+ + +
+

compositeXMLTrees(parentTree, + overridingTree) +

+
source code  +
+ +

XML tree composition. Returns the resulting tree, but happens + in-place in the overriding tree.

+
+
+
+
+ +
+ +
+ + +
+

attemptEval(val) +

+
source code  +
+ +

Runs an eval if possible, or converts into a lambda expression if + indicated. Otherwise, leaves as a string.

+
+
+
+
+ +
+ +
+ + +
+

resolveDocumentInheritances(el) +

+
source code  +
+ +

In place resolution of document inheritances. Doesn't return + anything.

+
+
+
+
+ +
+ +
+ + +
+

resolveInheritance(el) +

+
source code  +
+ +

In place resolution of inheritence. Doesn't return anything.

+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.Config-pysrc.html b/html/SmootLight.util.Config-pysrc.html new file mode 100644 index 0000000..f878a13 --- /dev/null +++ b/html/SmootLight.util.Config-pysrc.html @@ -0,0 +1,718 @@ + + + + + SmootLight.util.Config + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module Config + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.util.Config

+
+  1  from xml.etree.ElementTree import * 
+  2  import re 
+  3  import sys 
+  4  import xml 
+  5  import pdb 
+  6  import util.Strings as Strings 
+  7  import util.Search as Search 
+  8  from logger import main_log, exception_log 
+  9  classArgsMem = {} 
+ 10  CONFIG_PATH = 'config/' 
+ 11  DEFAULT_OVERRIDE_MODE = 'Merge' 
+ 12   
+
13 -def loadParamRequirementDict(className): +
14 if not className in classArgsMem: #WOO CACHING + 15 classArgsMem[className] = fileToDict(CONFIG_PATH + className) + 16 return classArgsMem[className] +
17 +
18 -def loadConfigFile(fileName): #TODO: error handling etc. +
19 """Loads a config file. If its an xml file, inheritances are automatically resolved.""" + 20 try: + 21 if '.params' in fileName: + 22 return fileToDict(fileName) + 23 if '.xml' in fileName: + 24 config = ElementTree() + 25 config.parse(fileName) + 26 resolveDocumentInheritances(config.getroot()) + 27 return config + 28 except Exception as inst: + 29 main_log.info('Error loading config file ' + fileName)#, inst) TODO: log exception too + 30 main_log.info(str(inst)) + 31 return None +
32 -def getElement(el): +
33 """Takes an Element or an ElementTree. If it is a tree, it returns its root. Otherwise, just returns + 34 it""" + 35 if xml.etree.ElementTree.iselement(el): + 36 return el + 37 elif el.__class__ == ElementTree: + 38 return el.getroot() +
39 -def compositeXMLTrees(parentTree, overridingTree): +
40 """XML tree composition. Returns the resulting tree, but happens in-place in the overriding + 41 tree.""" + 42 #TODO: break up into sub-methods, change it to use .find() + 43 if parentTree == None: + 44 return overridingTree + 45 if overridingTree == None: + 46 return parentTree #TODO: this will probably cause a bug since it isn't in-place on + 47 #overridingTree + 48 parentTree = getElement(parentTree) + 49 overridingTree = getElement(overridingTree) + 50 parentItems = parentTree.getchildren() + 51 overrideItems = overridingTree.getchildren() + 52 #first, lets figure out what tags we have in the override tree: + 53 tagCollection = [el.tag for el in overrideItems] #we can speed this up with a dict if necessary + 54 for item in parentItems: + 55 if not item.tag in tagCollection: #no override + 56 overridingTree.insert(-1, item) #insert the new item at the end + 57 else: + 58 #do we merge or replace? + 59 intersectingElements = findElementsByTag(item.tag, overrideItems) + 60 if len(intersectingElements) > 1: + 61 main_log.warn('ABUSE! Override of multiple items isn\'t well defined. Don\'t do\ + 62 it!') + 63 interEl = intersectingElements[0] + 64 mode = DEFAULT_OVERRIDE_MODE + 65 if Strings.OVERRIDE_BEHAVIOR in interEl.attrib: + 66 mode = interEl.attrib[Strings.OVERRIDE_BEHAVIOR] + 67 if mode != 'Replace' and mode != 'Merge': + 68 main_log.warn('Bad Override Mode. Choosing to replace.') + 69 mode = 'Replace' + 70 if mode == 'Replace': + 71 pass #we don't need to do anything + 72 if mode == 'Merge': + 73 interEl = compositeXMLTrees(item, interEl) + 74 for item in overrideItems: #resolve appendages + 75 if item.tag == 'APPEND': + 76 children = item.getchildren() + 77 for child in children: + 78 overrideItems.insert(-1, child) + 79 overrideItems.remove(item) + 80 return overridingTree + 81 +
82 -def findElementsByTag(tag, eList): +
83 return [el for el in eList if el.tag == tag] +
84 +
85 -def fileToDict(fileName): +
86 fileText = '' + 87 try: + 88 with open(fileName) as f: + 89 for line in f: + 90 fileText += line.rstrip('\n').lstrip('\t') + ' ' + 91 except IOError: + 92 main_log.info('Failure reading ' + fileName) + 93 return {} + 94 if fileText == '': + 95 return {} + 96 try: + 97 resultDict = eval(fileText) + 98 main_log.info(fileName + ' read and parsed') + 99 return resultDict +100 except: +101 main_log.exception(fileName + ' is not a well formed python dict. Parsing failed') +102 return eval(fileText) +
103 +
104 -def pullArgsFromItem(parentNode): +
105 """Parses arguments into python objects if possible, otherwise leaves as strings""" +106 attribArgs = {} +107 for arg in parentNode.attrib: #automatically pull attributes into the argdict +108 attribArgs[arg] = attemptEval(parentNode.attrib[arg]) +109 argNode = parentNode.find('Args') +110 args = generateArgDict(argNode) +111 for key in attribArgs: +112 args[key] = attribArgs[key] +113 return args +
114 +
115 -def attemptEval(val): +
116 """Runs an eval if possible, or converts into a lambda expression if indicated. Otherwise, +117 leaves as a string.""" +118 try: +119 if '${' in val and '}$' in val: #TODO: this could be a little cleaner +120 dictVal = re.sub("'\$\{(.+?)\}\$'", "b['\\1']", val) #replace expressions '${blah}$' with b['blah'] +121 dictVal = re.sub("\$\{(.+?)\}\$", "a['\\1']", dictVal) #replace all expressions like {blah} with a['blah'] +122 if "'${" and "}$'" in val: #nested lambda madness +123 lambdaVal = eval('lambda a: lambda b: ' + dictVal) +124 else: +125 lambdaVal = eval('lambda a:'+dictVal) #TODO: nested lambdas +126 return lambdaVal #convert referential objects to lambda expressions which can be +127 #resolved dynamically. +128 else: +129 val = eval(val) +130 except (NameError, SyntaxError): +131 val = str(val) +132 return val +
133 +
134 -def generateArgDict(parentNode, recurse=False): +
135 args = {} +136 for arg in parentNode.getchildren(): +137 key = arg.tag +138 if arg.getchildren() != []: +139 value = generateArgDict(arg, True) +140 else: +141 #convert into python if possible, otherwise don't +142 value = attemptEval(arg.text) +143 if key in args: #build of lists of like-elements +144 if type(args[key]) != type([]): +145 args[key] = [args[key]] +146 args[key].append(value) +147 else: +148 args[key]=value +149 #if we should be a list but we aren't: +150 if len(args.keys()) == 1 and recurse: +151 return args[args.keys()[0]] +152 return args +
154 """In place resolution of document inheritances. Doesn't return anything.""" +155 abstractMembers = Search.parental_tree_search(el, '.getchildren()', '.tag==\'InheritsFrom\'') +156 for subel in abstractMembers: +157 subel = resolveInheritance(subel) +
158 -def resolveInheritance(el): +
159 """In place resolution of inheritence. Doesn't return anything.""" +160 parentClass = el.find('InheritsFrom') +161 if parentClass != None: +162 parentTree = loadConfigFile(parentClass.text) +163 if parentTree == None: +164 main_log.warn('Inheritance Failed. ' + parentClass.text + 'does not exist') +165 main_log.error('Inheritance Failed. ' + parentClass.text + 'does not exist') +166 return el +167 el = compositeXMLTrees(parentTree, el) +168 el.remove(parentClass) #get rid of the inheritance flag +
169 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.Geo-module.html b/html/SmootLight.util.Geo-module.html new file mode 100644 index 0000000..f4dcd71 --- /dev/null +++ b/html/SmootLight.util.Geo-module.html @@ -0,0 +1,298 @@ + + + + + SmootLight.util.Geo + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module Geo + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Geo

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Location +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Functions[hide private]
+
+   + + + + + + +
pointWithinBoundingBox(point, + bb)
+ Returns whether or not a point (x,y) is within a bounding box (xmin, + ymin, xmax, ymax)
+ source code + +
+ +
+   + + + + + + +
addLocations(l1, + l2) + source code + +
+ +
+   + + + + + + +
gaussian(x, + height, + center, + width) + source code + +
+ +
+   + + + + + + +
dist(l1, + l2) + source code + +
+ +
+   + + + + + + +
randomLoc(boundingBox) + source code + +
+ +
+   + + + + + + +
approxexp(x)
+ Approximates exp with a 3 term Taylor Series.
+ source code + +
+ +
+   + + + + + + +
windtrail(x, + y, + height, + center, + width) + source code + +
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.util' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.Geo-pysrc.html b/html/SmootLight.util.Geo-pysrc.html new file mode 100644 index 0000000..f04b974 --- /dev/null +++ b/html/SmootLight.util.Geo-pysrc.html @@ -0,0 +1,154 @@ + + + + + SmootLight.util.Geo + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module Geo + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.util.Geo

+
+ 1  #Geometry code 
+ 2  import math 
+ 3  from bisect import * 
+ 4  import random 
+
5 -def pointWithinBoundingBox(point, bb): +
6 """Returns whether or not a point (x,y) is within a bounding box (xmin, ymin, xmax, ymax)""" + 7 return all([(point[i % 2] <= bb[i]) == (i>1) for i in range(4)]) + 8 +
9 -def addLocations(l1,l2): +
10 return tuple([l1[i]+l2[i] for i in range(len(l1))]) +
11 +
12 -def gaussian(x,height,center,width): +
13 a=height +14 b=center +15 c=width +16 return a*math.exp(-((x-b)**2)/(2*c**2)) +
17 +
18 -def dist(l1, l2): +
19 return math.sqrt((l1[0]-l2[0])**2+(l1[1]-l2[1])**2) #For speed +
20 +
21 -def randomLoc(boundingBox): #TODO: make less shitty +
22 loc = [] +23 loc.append(random.randint(0, boundingBox[0])) +24 loc.append(random.randint(0, boundingBox[1])) +25 return tuple(loc) +26 +
27 -def approxexp(x): +
28 """Approximates exp with a 3 term Taylor Series.""" +29 return 1+x+x**2/2+x**3/6 +
30 +
31 -def windtrail(x,y,height,center,width): +
32 a=height +33 b=center +34 c=width +35 return a*((math.exp(-((x-b))/(c)))**2)*(math.exp(-((y))/(0.2*c)))**2 +
36 +
37 -class Location(object): +
38 - def __init__(self,x=0,y=0): +
39 self.x = x +40 self.y = y +
41 - def __add__(self, b): +
42 return Location(self.x+b.x, self.y+b.y) +
43 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.Geo.Location-class.html b/html/SmootLight.util.Geo.Location-class.html new file mode 100644 index 0000000..b0af3d5 --- /dev/null +++ b/html/SmootLight.util.Geo.Location-class.html @@ -0,0 +1,256 @@ + + + + + SmootLight.util.Geo.Location + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module Geo :: + Class Location + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Location

source code

+
+object --+
+         |
+        Location
+
+ +
+ + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
__init__(self, + x=0, + y=0)
+ x.__init__(...) initializes x; see x.__class__.__doc__ for signature
+ source code + +
+ +
+   + + + + + + +
__add__(self, + b) + source code + +
+ +
+

Inherited from object: + __delattr__, + __format__, + __getattribute__, + __hash__, + __new__, + __reduce__, + __reduce_ex__, + __repr__, + __setattr__, + __sizeof__, + __str__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

__init__(self, + x=0, + y=0) +
(Constructor) +

+
source code  +
+ +

x.__init__(...) initializes x; see x.__class__.__doc__ for + signature

+
+
Overrides: + object.__init__ +
(inherited documentation)
+ +
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.NetworkOps-module.html b/html/SmootLight.util.NetworkOps-module.html new file mode 100644 index 0000000..5b5ad4d --- /dev/null +++ b/html/SmootLight.util.NetworkOps-module.html @@ -0,0 +1,181 @@ + + + + + SmootLight.util.NetworkOps + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module NetworkOps + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module NetworkOps

source code

+ + + + + + + + + + + + +
+ + + + + +
Functions[hide private]
+
+   + + + + + + +
getConnectedSocket(ip, + port) + source code + +
+ +
+   + + + + + + +
getBroadcastSocket(port) + source code + +
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.util' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.NetworkOps-pysrc.html b/html/SmootLight.util.NetworkOps-pysrc.html new file mode 100644 index 0000000..b073a57 --- /dev/null +++ b/html/SmootLight.util.NetworkOps-pysrc.html @@ -0,0 +1,222 @@ + + + + + SmootLight.util.NetworkOps + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module NetworkOps + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.util.NetworkOps

+
+ 1  import socket 
+ 2  from logger import main_log, exception_log 
+
3 -def getConnectedSocket(ip,port): +
4 sock = socket.socket(socket.AF_INET, socket.SOCK_DGRAM) + 5 try: + 6 sock.connect((ip, port)) + 7 return sock + 8 except Exception as inst: + 9 main_log.error('Network down. All network based renderers and sensors will not function.', +10 inst) +
11 +
12 -def getBroadcastSocket(port): +
13 s = socket.socket(socket.AF_INET, socket.SOCK_DGRAM) +14 s.setsockopt(socket.SOL_SOCKET, socket.SO_REUSEADDR, 1) +15 s.setsockopt(socket.SOL_SOCKET, socket.SO_BROADCAST, 1) +16 return s +
17 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.PacketComposition-module.html b/html/SmootLight.util.PacketComposition-module.html new file mode 100644 index 0000000..a4feb8c --- /dev/null +++ b/html/SmootLight.util.PacketComposition-module.html @@ -0,0 +1,379 @@ + + + + + SmootLight.util.PacketComposition + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module PacketComposition + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module PacketComposition

source code

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Functions[hide private]
+
+   + + + + + + +
composePixelStripData(pixelStrip, + currentTime=1.29806612156e+12) + source code + +
+ +
+   + + + + + + +
memoize(f) + source code + +
+ +
+   + + + + + + +
cachePacketHeader(x) + source code + +
+ +
+   + + + + + + +
composePixelStripPacket(pixelStrip, + port, + currentTime) + source code + +
+ +
+   + + + + + + +
packheader() + source code + +
+ +
+   + + + + + + +
portOut() + source code + +
+ +
+   + + + + + + +
portOutPayload(argDict) + source code + +
+ +
+   + + + + + + +
composeSynchPacket() + source code + +
+ +
+   + + + + + + +
portOutPacket(payloadArgs) + source code + +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + VERSION = 1 +
+   + + MAGIC = 1255932164 +
+   + + PORTOUT = 264 +
+   + + UNI = 0 +
+   + + argDict = {'flags': 0, 'pad': 0, 'startcode': 4095} +
+   + + cache = {} +
+   + + __package__ = 'SmootLight.util' +
+ + + + + + +
+ + + + + +
Function Details[hide private]
+
+ +
+ +
+ + +
+

cachePacketHeader(x) +

+
source code  +
+ + +
+
Decorators:
+
    +
  • @memoize
  • +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.PacketComposition-pysrc.html b/html/SmootLight.util.PacketComposition-pysrc.html new file mode 100644 index 0000000..31aec2c --- /dev/null +++ b/html/SmootLight.util.PacketComposition-pysrc.html @@ -0,0 +1,202 @@ + + + + + SmootLight.util.PacketComposition + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module PacketComposition + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.util.PacketComposition

+
+ 1  import struct 
+ 2  VERSION = 0x0001 
+ 3  MAGIC = 0x4adc0104 
+ 4  PORTOUT = 0x0108 
+ 5  UNI = 0 
+ 6  import pdb 
+ 7  import util.TimeOps as timeops 
+ 8  argDict = {'flags': 0, 'startcode': 0x0fff, 'pad':0} 
+
9 +10 -def composePixelStripData(pixelStrip,currentTime=timeops.time()): +
11 packet = bytearray() +12 for light in pixelStrip: +13 color = light.state(currentTime) +14 for channel in color: #skip the last value, its an +15 #alpha value +16 packet.append(struct.pack('B', channel)) +17 return packet +
18 # packet = [0]*len(pixelStrip.pixels)*3 #preallocate for speed +19 # for i in range(len(pixelStrip.pixels)): +20 #color = pixelStrip.pixels[i].state() +21 #packet[i:i+2] = color +22 # return bytearray(packet) +23 +24 cache = {} +
25 -def memoize(f): +
26 def helper(x): +27 if x not in cache: +28 cache[x] = f(x) +29 return cache[x] +
30 return helper +31 +
32 @memoize +33 -def cachePacketHeader(port): +
34 packet = bytearray() +35 subDict = dict(argDict) +36 subDict['len'] = 150 #I have no idea why this works. +37 subDict['port'] = port +38 packet.extend(portOutPacket(subDict)) +39 # packet.append(0x0) +40 return packet +
41 +
42 -def composePixelStripPacket(pixelStrip,port, currentTime): +
43 packet = bytearray(cachePacketHeader(port)) +44 data = composePixelStripData(pixelStrip, currentTime) +45 packet.extend(data) +46 return packet +
47 +
48 -def packheader(): +
49 header = bytearray() +50 header.extend(struct.pack('L', MAGIC)) +51 header.extend(struct.pack('H', VERSION)) +52 header.extend(struct.pack('H', PORTOUT)) +53 header.extend(struct.pack('L', 0)) +54 return header +
55 +
56 -def portOut(): +
57 header = packheader() +58 header.extend(struct.pack('L', UNI)) +59 return header +
60 +
61 -def portOutPayload(argDict): +
62 payload = bytearray() +63 payload.extend(struct.pack('B', argDict['port'])) +64 payload.extend(struct.pack('B',0)) +65 payload.extend(struct.pack('H', argDict['flags'])) +66 payload.extend(struct.pack('H', argDict['len'])) +67 payload.extend(struct.pack('H', argDict['startcode'])) +68 return payload +
70 header = bytearray() +71 header.extend(struct.pack('L', MAGIC)) +72 header.extend(struct.pack('H', VERSION)) +73 header.extend(struct.pack('H', 0x0109)) +74 header.extend(struct.pack('L', 0)) +75 header.extend(struct.pack('L', 0)) +76 return header +
77 +
78 -def portOutPacket(payloadArgs): +
79 packet = bytearray() +80 packet.extend(portOut()) +81 packet.extend(portOutPayload(payloadArgs)) +82 return packet +
83 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.Search-module.html b/html/SmootLight.util.Search-module.html new file mode 100644 index 0000000..6859ec9 --- /dev/null +++ b/html/SmootLight.util.Search-module.html @@ -0,0 +1,203 @@ + + + + + SmootLight.util.Search + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module Search + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Search

source code

+ + + + + + + + + + + + + + + +
+ + + + + +
Functions[hide private]
+
+   + + + + + + +
find_le(a, + x)
+ Find rightmost value less than or equal to x
+ source code + +
+ +
+   + + + + + + +
find_ge(a, + x)
+ Find leftmost value greater than x
+ source code + +
+ +
+   + + + + + + +
parental_tree_search(root, + childrenstr, + conditionstr)
+ Returns parents of nodes that meed a given condition
+ source code + +
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.util' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.Search-pysrc.html b/html/SmootLight.util.Search-pysrc.html new file mode 100644 index 0000000..485ec62 --- /dev/null +++ b/html/SmootLight.util.Search-pysrc.html @@ -0,0 +1,134 @@ + + + + + SmootLight.util.Search + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module Search + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.util.Search

+
+ 1  from bisect import * 
+
2 -def find_le(a, x): +
3 """Find rightmost value less than or equal to x""" + 4 return bisect_right(a, x)-1 +
5 +
6 -def find_ge(a, x): +
7 """Find leftmost value greater than x""" + 8 return bisect_left(a, x) +
9 -def parental_tree_search(root, childrenstr, conditionstr): +
10 """Returns parents of nodes that meed a given condition""" +11 ret = [] +12 queue = [root] +13 while queue: +14 current = queue.pop() +15 children = eval('current'+childrenstr) +16 for child in children: +17 if eval('child'+conditionstr): +18 ret.append(current) +19 #we know have a tree, so there are no back-edges etc, so no checking of that kind is +20 #necessary +21 queue += children +22 return ret +
23 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.Strings-module.html b/html/SmootLight.util.Strings-module.html new file mode 100644 index 0000000..2de2972 --- /dev/null +++ b/html/SmootLight.util.Strings-module.html @@ -0,0 +1,151 @@ + + + + + SmootLight.util.Strings + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module Strings + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module Strings

source code

+ + + + + + + + + + + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + LOCATION = 'Location' +
+   + + DEFAULT_MAPPER = 'DefaultPixelMapper' +
+   + + OVERRIDE_BEHAVIOR = 'OverrideBehavior' +
+   + + __package__ = None +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.Strings-pysrc.html b/html/SmootLight.util.Strings-pysrc.html new file mode 100644 index 0000000..220212c --- /dev/null +++ b/html/SmootLight.util.Strings-pysrc.html @@ -0,0 +1,119 @@ + + + + + SmootLight.util.Strings + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module Strings + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.util.Strings

+
+1  LOCATION = 'Location' 
+2  DEFAULT_MAPPER = 'DefaultPixelMapper' 
+3   
+4   
+5   
+6  #XMLStuff 
+7  OVERRIDE_BEHAVIOR = 'OverrideBehavior' 
+8   
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.TimeOps-module.html b/html/SmootLight.util.TimeOps-module.html new file mode 100644 index 0000000..00737db --- /dev/null +++ b/html/SmootLight.util.TimeOps-module.html @@ -0,0 +1,189 @@ + + + + + SmootLight.util.TimeOps + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module TimeOps + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Module TimeOps

source code

+ + + + + + + + + +
+ + + + + +
Classes[hide private]
+
+   + + Stopwatch +
+ + + + + + + + + +
+ + + + + +
Functions[hide private]
+
+   + + + + + + +
time() + source code + +
+ +
+ + + + + + + + + +
+ + + + + +
Variables[hide private]
+
+   + + __package__ = 'SmootLight.util' +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.TimeOps-pysrc.html b/html/SmootLight.util.TimeOps-pysrc.html new file mode 100644 index 0000000..a3be363 --- /dev/null +++ b/html/SmootLight.util.TimeOps-pysrc.html @@ -0,0 +1,132 @@ + + + + + SmootLight.util.TimeOps + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module TimeOps + + + + + + +
[hide private]
[frames] | no frames]
+
+

Source Code for Module SmootLight.util.TimeOps

+
+ 1  import time as clock 
+
2 -def time(): +
3 return clock.time()*1000 #all times in MS +
4 +
5 -class Stopwatch: +
6 - def __init__(self): +
7 self.running = False + 8 self.startTime = -1 + 9 self.stopTime = -1 +
10 - def start(self): +
11 self.startTime = time() +12 self.running = True +
13 - def elapsed(self): +
14 if self.running: +15 return time()-self.startTime +16 else: +17 return self.stopTime - self.startTime +
18 - def stop(self): +
19 self.stopTime = time() +20 self.running = False +
21 +
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/SmootLight.util.TimeOps.Stopwatch-class.html b/html/SmootLight.util.TimeOps.Stopwatch-class.html new file mode 100644 index 0000000..1b9681f --- /dev/null +++ b/html/SmootLight.util.TimeOps.Stopwatch-class.html @@ -0,0 +1,188 @@ + + + + + SmootLight.util.TimeOps.Stopwatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + Package SmootLight :: + Package util :: + Module TimeOps :: + Class Stopwatch + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class Stopwatch

source code

+ + + + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
__init__(self) + source code + +
+ +
+   + + + + + + +
start(self) + source code + +
+ +
+   + + + + + + +
elapsed(self) + source code + +
+ +
+   + + + + + + +
stop(self) + source code + +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/api-objects.txt b/html/api-objects.txt new file mode 100644 index 0000000..a3c0a85 --- /dev/null +++ b/html/api-objects.txt @@ -0,0 +1,1178 @@ +SmootLight SmootLight-module.html +SmootLight.__package__ SmootLight-module.html#__package__ +SmootLight.LightInstallation SmootLight.LightInstallation-module.html +SmootLight.LightInstallation.__package__ SmootLight.LightInstallation-module.html#__package__ +SmootLight.LightInstallation.main SmootLight.LightInstallation-module.html#main +SmootLight.Profile SmootLight.Profile-module.html +SmootLight.Profile.command SmootLight.Profile-module.html#command +SmootLight.TestAll SmootLight.TestAll-module.html +SmootLight.TestAll.testSuite SmootLight.TestAll-module.html#testSuite +SmootLight.TestAll.__package__ SmootLight.TestAll-module.html#__package__ +SmootLight.TestProfile SmootLight.TestProfile-module.html +SmootLight.TestProfile.weave_inloop SmootLight.TestProfile-module.html#weave_inloop +SmootLight.TestProfile.exptest SmootLight.TestProfile-module.html#exptest +SmootLight.TestProfile.dist1 SmootLight.TestProfile-module.html#dist1 +SmootLight.TestProfile.dist2 SmootLight.TestProfile-module.html#dist2 +SmootLight.TestProfile.numiter SmootLight.TestProfile-module.html#numiter +SmootLight.TestProfile.normal_python SmootLight.TestProfile-module.html#normal_python +SmootLight.TestProfile.weave_outloop SmootLight.TestProfile-module.html#weave_outloop +SmootLight.TestProfile.main1 SmootLight.TestProfile-module.html#main1 +SmootLight.TestProfile.main2 SmootLight.TestProfile-module.html#main2 +SmootLight.TestProfile.abc1 SmootLight.TestProfile-module.html#abc1 +SmootLight.TestProfile.abc2 SmootLight.TestProfile-module.html#abc2 +SmootLight.TestProfile.a SmootLight.TestProfile-module.html#a +SmootLight.TestProfile.expapprox SmootLight.TestProfile-module.html#expapprox +SmootLight.TestProfile.dictlookup SmootLight.TestProfile-module.html#dictlookup +SmootLight.TestProfile.command SmootLight.TestProfile-module.html#command +SmootLight.TestProfile.x SmootLight.TestProfile-module.html#x +SmootLight.TestProfile.strucpack SmootLight.TestProfile-module.html#strucpack +SmootLight.behaviors SmootLight.behaviors-module.html +SmootLight.behaviors.__package__ SmootLight.behaviors-module.html#__package__ +SmootLight.behaviors.AddPixelEvent SmootLight.behaviors.AddPixelEvent-module.html +SmootLight.behaviors.AddPixelEvent.__package__ SmootLight.behaviors.AddPixelEvent-module.html#__package__ +SmootLight.behaviors.AllPixels SmootLight.behaviors.AllPixels-module.html +SmootLight.behaviors.AllPixels.__package__ SmootLight.behaviors.AllPixels-module.html#__package__ +SmootLight.behaviors.AllPixels.main_log SmootLight.behaviors.AllPixels-module.html#main_log +SmootLight.behaviors.AllPixelsLeft SmootLight.behaviors.AllPixelsLeft-module.html +SmootLight.behaviors.AllPixelsLeft.main_log SmootLight.behaviors.AllPixelsLeft-module.html#main_log +SmootLight.behaviors.AllPixelsLeft.__package__ SmootLight.behaviors.AllPixelsLeft-module.html#__package__ +SmootLight.behaviors.BehaviorChain SmootLight.behaviors.BehaviorChain-module.html +SmootLight.behaviors.BehaviorChain.__package__ SmootLight.behaviors.BehaviorChain-module.html#__package__ +SmootLight.behaviors.Circle SmootLight.behaviors.Circle-module.html +SmootLight.behaviors.Circle.__package__ SmootLight.behaviors.Circle-module.html#__package__ +SmootLight.behaviors.Circle.main_log SmootLight.behaviors.Circle-module.html#main_log +SmootLight.behaviors.ColorChangerBehavior SmootLight.behaviors.ColorChangerBehavior-module.html +SmootLight.behaviors.ColorChangerBehavior.__package__ SmootLight.behaviors.ColorChangerBehavior-module.html#__package__ +SmootLight.behaviors.ColorChangerBehavior.main_log SmootLight.behaviors.ColorChangerBehavior-module.html#main_log +SmootLight.behaviors.ColorShift SmootLight.behaviors.ColorShift-module.html +SmootLight.behaviors.ColorShift.__package__ SmootLight.behaviors.ColorShift-module.html#__package__ +SmootLight.behaviors.ColorShift.main_log SmootLight.behaviors.ColorShift-module.html#main_log +SmootLight.behaviors.ControllerOSC SmootLight.behaviors.ControllerOSC-module.html +SmootLight.behaviors.ControllerOSC.vel_decay SmootLight.behaviors.ControllerOSC-module.html#vel_decay +SmootLight.behaviors.ControllerOSC.speedfactor SmootLight.behaviors.ControllerOSC-module.html#speedfactor +SmootLight.behaviors.ControllerOSC.__package__ SmootLight.behaviors.ControllerOSC-module.html#__package__ +SmootLight.behaviors.ControllerOSC.constrainLocation SmootLight.behaviors.ControllerOSC-module.html#constrainLocation +SmootLight.behaviors.DebugBehavior SmootLight.behaviors.DebugBehavior-module.html +SmootLight.behaviors.DebugBehavior.__package__ SmootLight.behaviors.DebugBehavior-module.html#__package__ +SmootLight.behaviors.DecayBehavior SmootLight.behaviors.DecayBehavior-module.html +SmootLight.behaviors.DecayBehavior.__package__ SmootLight.behaviors.DecayBehavior-module.html#__package__ +SmootLight.behaviors.DecayBehavior.main_log SmootLight.behaviors.DecayBehavior-module.html#main_log +SmootLight.behaviors.EchoBehavior SmootLight.behaviors.EchoBehavior-module.html +SmootLight.behaviors.EchoBehavior.__package__ SmootLight.behaviors.EchoBehavior-module.html#__package__ +SmootLight.behaviors.EchoBehavior.main_log SmootLight.behaviors.EchoBehavior-module.html#main_log +SmootLight.behaviors.Expand SmootLight.behaviors.Expand-module.html +SmootLight.behaviors.Expand.__package__ SmootLight.behaviors.Expand-module.html#__package__ +SmootLight.behaviors.Expand.main_log SmootLight.behaviors.Expand-module.html#main_log +SmootLight.behaviors.ExpandingColorZones SmootLight.behaviors.ExpandingColorZones-module.html +SmootLight.behaviors.ExpandingColorZones.__package__ SmootLight.behaviors.ExpandingColorZones-module.html#__package__ +SmootLight.behaviors.Flasher SmootLight.behaviors.Flasher-module.html +SmootLight.behaviors.Flasher.__package__ SmootLight.behaviors.Flasher-module.html#__package__ +SmootLight.behaviors.Flasher.main_log SmootLight.behaviors.Flasher-module.html#main_log +SmootLight.behaviors.MITDoors SmootLight.behaviors.MITDoors-module.html +SmootLight.behaviors.MITDoors.__package__ SmootLight.behaviors.MITDoors-module.html#__package__ +SmootLight.behaviors.MITDoors.main_log SmootLight.behaviors.MITDoors-module.html#main_log +SmootLight.behaviors.MobileShakeBehavior SmootLight.behaviors.MobileShakeBehavior-module.html +SmootLight.behaviors.MobileShakeBehavior.__package__ SmootLight.behaviors.MobileShakeBehavior-module.html#__package__ +SmootLight.behaviors.MobileShakeBehavior.main_log SmootLight.behaviors.MobileShakeBehavior-module.html#main_log +SmootLight.behaviors.ModifyParam SmootLight.behaviors.ModifyParam-module.html +SmootLight.behaviors.ModifyParam.__package__ SmootLight.behaviors.ModifyParam-module.html#__package__ +SmootLight.behaviors.ModifyParam.main_log SmootLight.behaviors.ModifyParam-module.html#main_log +SmootLight.behaviors.ModulateColor SmootLight.behaviors.ModulateColor-module.html +SmootLight.behaviors.ModulateColor.__package__ SmootLight.behaviors.ModulateColor-module.html#__package__ +SmootLight.behaviors.ModulateColor.main_log SmootLight.behaviors.ModulateColor-module.html#main_log +SmootLight.behaviors.MoveBehavior SmootLight.behaviors.MoveBehavior-module.html +SmootLight.behaviors.MoveBehavior.__package__ SmootLight.behaviors.MoveBehavior-module.html#__package__ +SmootLight.behaviors.MoveBehavior.main_log SmootLight.behaviors.MoveBehavior-module.html#main_log +SmootLight.behaviors.MrmrSetColor SmootLight.behaviors.MrmrSetColor-module.html +SmootLight.behaviors.MrmrSetColor.__package__ SmootLight.behaviors.MrmrSetColor-module.html#__package__ +SmootLight.behaviors.Oval SmootLight.behaviors.Oval-module.html +SmootLight.behaviors.Oval.__package__ SmootLight.behaviors.Oval-module.html#__package__ +SmootLight.behaviors.Oval.main_log SmootLight.behaviors.Oval-module.html#main_log +SmootLight.behaviors.RandomSetBrightColorBehavior SmootLight.behaviors.RandomSetBrightColorBehavior-module.html +SmootLight.behaviors.RandomSetBrightColorBehavior.__package__ SmootLight.behaviors.RandomSetBrightColorBehavior-module.html#__package__ +SmootLight.behaviors.RandomSetBrightColorBehavior.main_log SmootLight.behaviors.RandomSetBrightColorBehavior-module.html#main_log +SmootLight.behaviors.RandomWalk SmootLight.behaviors.RandomWalk-module.html +SmootLight.behaviors.RandomWalk.main_log SmootLight.behaviors.RandomWalk-module.html#main_log +SmootLight.behaviors.RandomWalk.__package__ SmootLight.behaviors.RandomWalk-module.html#__package__ +SmootLight.behaviors.RecursiveDecay SmootLight.behaviors.RecursiveDecay-module.html +SmootLight.behaviors.RecursiveDecay.__package__ SmootLight.behaviors.RecursiveDecay-module.html#__package__ +SmootLight.behaviors.RecursiveDecay.main_log SmootLight.behaviors.RecursiveDecay-module.html#main_log +SmootLight.behaviors.ResponseMover SmootLight.behaviors.ResponseMover-module.html +SmootLight.behaviors.ResponseMover.__package__ SmootLight.behaviors.ResponseMover-module.html#__package__ +SmootLight.behaviors.ResponseMover.main_log SmootLight.behaviors.ResponseMover-module.html#main_log +SmootLight.behaviors.RestrictLocation SmootLight.behaviors.RestrictLocation-module.html +SmootLight.behaviors.RestrictLocation.main_log SmootLight.behaviors.RestrictLocation-module.html#main_log +SmootLight.behaviors.RestrictLocation.__package__ SmootLight.behaviors.RestrictLocation-module.html#__package__ +SmootLight.behaviors.RiseFall SmootLight.behaviors.RiseFall-module.html +SmootLight.behaviors.RiseFall.__package__ SmootLight.behaviors.RiseFall-module.html#__package__ +SmootLight.behaviors.RiseFall.main_log SmootLight.behaviors.RiseFall-module.html#main_log +SmootLight.behaviors.RunningBehavior SmootLight.behaviors.RunningBehavior-module.html +SmootLight.behaviors.RunningBehavior.main_log SmootLight.behaviors.RunningBehavior-module.html#main_log +SmootLight.behaviors.RunningBehavior.__package__ SmootLight.behaviors.RunningBehavior-module.html#__package__ +SmootLight.behaviors.Sink SmootLight.behaviors.Sink-module.html +SmootLight.behaviors.Sink.__package__ SmootLight.behaviors.Sink-module.html#__package__ +SmootLight.behaviors.Sink.main_log SmootLight.behaviors.Sink-module.html#main_log +SmootLight.behaviors.SmootWind SmootLight.behaviors.SmootWind-module.html +SmootLight.behaviors.SmootWind.__package__ SmootLight.behaviors.SmootWind-module.html#__package__ +SmootLight.behaviors.SmootWind.main_log SmootLight.behaviors.SmootWind-module.html#main_log +SmootLight.behaviors.Square SmootLight.behaviors.Square-module.html +SmootLight.behaviors.Square.__package__ SmootLight.behaviors.Square-module.html#__package__ +SmootLight.behaviors.Square.main_log SmootLight.behaviors.Square-module.html#main_log +SmootLight.behaviors.SwitchBehavior SmootLight.behaviors.SwitchBehavior-module.html +SmootLight.behaviors.SwitchBehavior.__package__ SmootLight.behaviors.SwitchBehavior-module.html#__package__ +SmootLight.behaviors.SwitchBehavior.main_log SmootLight.behaviors.SwitchBehavior-module.html#main_log +SmootLight.behaviors.SynchTest SmootLight.behaviors.SynchTest-module.html +SmootLight.behaviors.SynchTest.__package__ SmootLight.behaviors.SynchTest-module.html#__package__ +SmootLight.behaviors.SynchTest.main_log SmootLight.behaviors.SynchTest-module.html#main_log +SmootLight.behaviors.TimeSwitch SmootLight.behaviors.TimeSwitch-module.html +SmootLight.behaviors.TimeSwitch.__package__ SmootLight.behaviors.TimeSwitch-module.html#__package__ +SmootLight.behaviors.TimedDie SmootLight.behaviors.TimedDie-module.html +SmootLight.behaviors.TimedDie.__package__ SmootLight.behaviors.TimedDie-module.html#__package__ +SmootLight.behaviors.TimedDie.main_log SmootLight.behaviors.TimedDie-module.html#main_log +SmootLight.behaviors.Timeout SmootLight.behaviors.Timeout-module.html +SmootLight.behaviors.Timeout.__package__ SmootLight.behaviors.Timeout-module.html#__package__ +SmootLight.behaviors.Timeout.main_log SmootLight.behaviors.Timeout-module.html#main_log +SmootLight.behaviors.TouchOSC SmootLight.behaviors.TouchOSC-module.html +SmootLight.behaviors.TouchOSC.__package__ SmootLight.behaviors.TouchOSC-module.html#__package__ +SmootLight.behaviors.VerticalBar SmootLight.behaviors.VerticalBar-module.html +SmootLight.behaviors.VerticalBar.__package__ SmootLight.behaviors.VerticalBar-module.html#__package__ +SmootLight.behaviors.VerticalBar.main_log SmootLight.behaviors.VerticalBar-module.html#main_log +SmootLight.behaviors.XYMove SmootLight.behaviors.XYMove-module.html +SmootLight.behaviors.XYMove.main_log SmootLight.behaviors.XYMove-module.html#main_log +SmootLight.behaviors.XYMove.__package__ SmootLight.behaviors.XYMove-module.html#__package__ +SmootLight.inputs SmootLight.inputs-module.html +SmootLight.inputs.__package__ SmootLight.inputs-module.html#__package__ +SmootLight.inputs.ContinuousCenterInput SmootLight.inputs.ContinuousCenterInput-module.html +SmootLight.inputs.ContinuousCenterInput.main_log SmootLight.inputs.ContinuousCenterInput-module.html#main_log +SmootLight.inputs.ContinuousCenterInput.exception_log SmootLight.inputs.ContinuousCenterInput-module.html#exception_log +SmootLight.inputs.ContinuousCenterInput.__package__ SmootLight.inputs.ContinuousCenterInput-module.html#__package__ +SmootLight.inputs.ContinuousLocationInput SmootLight.inputs.ContinuousLocationInput-module.html +SmootLight.inputs.ContinuousLocationInput.main_log SmootLight.inputs.ContinuousLocationInput-module.html#main_log +SmootLight.inputs.ContinuousLocationInput.exception_log SmootLight.inputs.ContinuousLocationInput-module.html#exception_log +SmootLight.inputs.ContinuousLocationInput.__package__ SmootLight.inputs.ContinuousLocationInput-module.html#__package__ +SmootLight.inputs.HTMLInput SmootLight.inputs.HTMLInput-module.html +SmootLight.inputs.HTMLInput.exception_log SmootLight.inputs.HTMLInput-module.html#exception_log +SmootLight.inputs.HTMLInput.__package__ SmootLight.inputs.HTMLInput-module.html#__package__ +SmootLight.inputs.HTMLInput.main_log SmootLight.inputs.HTMLInput-module.html#main_log +SmootLight.inputs.OSCInput SmootLight.inputs.OSCInput-module.html +SmootLight.inputs.OSCInput.exception_log SmootLight.inputs.OSCInput-module.html#exception_log +SmootLight.inputs.OSCInput.__package__ SmootLight.inputs.OSCInput-module.html#__package__ +SmootLight.inputs.PygameInput SmootLight.inputs.PygameInput-module.html +SmootLight.inputs.PygameInput.K_KP_MINUS SmootLight.inputs.PygameInput-module.html#K_KP_MINUS +SmootLight.inputs.PygameInput.GL_STEREO SmootLight.inputs.PygameInput-module.html#GL_STEREO +SmootLight.inputs.PygameInput.K_F2 SmootLight.inputs.PygameInput-module.html#K_F2 +SmootLight.inputs.PygameInput.K_F3 SmootLight.inputs.PygameInput-module.html#K_F3 +SmootLight.inputs.PygameInput.BLEND_MULT SmootLight.inputs.PygameInput-module.html#BLEND_MULT +SmootLight.inputs.PygameInput.K_F5 SmootLight.inputs.PygameInput-module.html#K_F5 +SmootLight.inputs.PygameInput.K_F6 SmootLight.inputs.PygameInput-module.html#K_F6 +SmootLight.inputs.PygameInput.K_F1 SmootLight.inputs.PygameInput-module.html#K_F1 +SmootLight.inputs.PygameInput.K_F8 SmootLight.inputs.PygameInput-module.html#K_F8 +SmootLight.inputs.PygameInput.K_F9 SmootLight.inputs.PygameInput-module.html#K_F9 +SmootLight.inputs.PygameInput.K_2 SmootLight.inputs.PygameInput-module.html#K_2 +SmootLight.inputs.PygameInput.K_COMMA SmootLight.inputs.PygameInput-module.html#K_COMMA +SmootLight.inputs.PygameInput.SCRAP_PPM SmootLight.inputs.PygameInput-module.html#SCRAP_PPM +SmootLight.inputs.PygameInput.BLEND_RGBA_MAX SmootLight.inputs.PygameInput-module.html#BLEND_RGBA_MAX +SmootLight.inputs.PygameInput.RLEACCEL SmootLight.inputs.PygameInput-module.html#RLEACCEL +SmootLight.inputs.PygameInput.KMOD_RALT SmootLight.inputs.PygameInput-module.html#KMOD_RALT +SmootLight.inputs.PygameInput.KMOD_LALT SmootLight.inputs.PygameInput-module.html#KMOD_LALT +SmootLight.inputs.PygameInput.__package__ SmootLight.inputs.PygameInput-module.html#__package__ +SmootLight.inputs.PygameInput.BLEND_RGBA_MIN SmootLight.inputs.PygameInput-module.html#BLEND_RGBA_MIN +SmootLight.inputs.PygameInput.GL_GREEN_SIZE SmootLight.inputs.PygameInput-module.html#GL_GREEN_SIZE +SmootLight.inputs.PygameInput.KMOD_NONE SmootLight.inputs.PygameInput-module.html#KMOD_NONE +SmootLight.inputs.PygameInput.K_AMPERSAND SmootLight.inputs.PygameInput-module.html#K_AMPERSAND +SmootLight.inputs.PygameInput.K_n SmootLight.inputs.PygameInput-module.html#K_n +SmootLight.inputs.PygameInput.KMOD_LCTRL SmootLight.inputs.PygameInput-module.html#KMOD_LCTRL +SmootLight.inputs.PygameInput.K_CLEAR SmootLight.inputs.PygameInput-module.html#K_CLEAR +SmootLight.inputs.PygameInput.HAT_LEFTUP SmootLight.inputs.PygameInput-module.html#HAT_LEFTUP +SmootLight.inputs.PygameInput.K_F7 SmootLight.inputs.PygameInput-module.html#K_F7 +SmootLight.inputs.PygameInput.KMOD_META SmootLight.inputs.PygameInput-module.html#KMOD_META +SmootLight.inputs.PygameInput.TIMER_RESOLUTION SmootLight.inputs.PygameInput-module.html#TIMER_RESOLUTION +SmootLight.inputs.PygameInput.HWPALETTE SmootLight.inputs.PygameInput-module.html#HWPALETTE +SmootLight.inputs.PygameInput.KMOD_CAPS SmootLight.inputs.PygameInput-module.html#KMOD_CAPS +SmootLight.inputs.PygameInput.SCRAP_PBM SmootLight.inputs.PygameInput-module.html#SCRAP_PBM +SmootLight.inputs.PygameInput.AUDIO_U8 SmootLight.inputs.PygameInput-module.html#AUDIO_U8 +SmootLight.inputs.PygameInput.SCRAP_CLIPBOARD SmootLight.inputs.PygameInput-module.html#SCRAP_CLIPBOARD +SmootLight.inputs.PygameInput.GL_BUFFER_SIZE SmootLight.inputs.PygameInput-module.html#GL_BUFFER_SIZE +SmootLight.inputs.PygameInput.AUDIO_U16 SmootLight.inputs.PygameInput-module.html#AUDIO_U16 +SmootLight.inputs.PygameInput.K_SPACE SmootLight.inputs.PygameInput-module.html#K_SPACE +SmootLight.inputs.PygameInput.BLEND_RGB_MULT SmootLight.inputs.PygameInput-module.html#BLEND_RGB_MULT +SmootLight.inputs.PygameInput.MOUSEMOTION SmootLight.inputs.PygameInput-module.html#MOUSEMOTION +SmootLight.inputs.PygameInput.K_INSERT SmootLight.inputs.PygameInput-module.html#K_INSERT +SmootLight.inputs.PygameInput.GL_ACCUM_GREEN_SIZE SmootLight.inputs.PygameInput-module.html#GL_ACCUM_GREEN_SIZE +SmootLight.inputs.PygameInput.exception_log SmootLight.inputs.PygameInput-module.html#exception_log +SmootLight.inputs.PygameInput.K_HOME SmootLight.inputs.PygameInput-module.html#K_HOME +SmootLight.inputs.PygameInput.GL_ACCUM_RED_SIZE SmootLight.inputs.PygameInput-module.html#GL_ACCUM_RED_SIZE +SmootLight.inputs.PygameInput.K_LSUPER SmootLight.inputs.PygameInput-module.html#K_LSUPER +SmootLight.inputs.PygameInput.K_KP_DIVIDE SmootLight.inputs.PygameInput-module.html#K_KP_DIVIDE +SmootLight.inputs.PygameInput.BLEND_RGB_MAX SmootLight.inputs.PygameInput-module.html#BLEND_RGB_MAX +SmootLight.inputs.PygameInput.BLEND_RGB_MIN SmootLight.inputs.PygameInput-module.html#BLEND_RGB_MIN +SmootLight.inputs.PygameInput.SCRAP_SELECTION SmootLight.inputs.PygameInput-module.html#SCRAP_SELECTION +SmootLight.inputs.PygameInput.GL_RED_SIZE SmootLight.inputs.PygameInput-module.html#GL_RED_SIZE +SmootLight.inputs.PygameInput.HAT_RIGHT SmootLight.inputs.PygameInput-module.html#HAT_RIGHT +SmootLight.inputs.PygameInput.HWACCEL SmootLight.inputs.PygameInput-module.html#HWACCEL +SmootLight.inputs.PygameInput.K_GREATER SmootLight.inputs.PygameInput-module.html#K_GREATER +SmootLight.inputs.PygameInput.HAT_DOWN SmootLight.inputs.PygameInput-module.html#HAT_DOWN +SmootLight.inputs.PygameInput.K_FIRST SmootLight.inputs.PygameInput-module.html#K_FIRST +SmootLight.inputs.PygameInput.K_KP_PERIOD SmootLight.inputs.PygameInput-module.html#K_KP_PERIOD +SmootLight.inputs.PygameInput.K_RALT SmootLight.inputs.PygameInput-module.html#K_RALT +SmootLight.inputs.PygameInput.YV12_OVERLAY SmootLight.inputs.PygameInput-module.html#YV12_OVERLAY +SmootLight.inputs.PygameInput.K_RIGHTBRACKET SmootLight.inputs.PygameInput-module.html#K_RIGHTBRACKET +SmootLight.inputs.PygameInput.K_RSHIFT SmootLight.inputs.PygameInput-module.html#K_RSHIFT +SmootLight.inputs.PygameInput.K_LSHIFT SmootLight.inputs.PygameInput-module.html#K_LSHIFT +SmootLight.inputs.PygameInput.K_LEFTPAREN SmootLight.inputs.PygameInput-module.html#K_LEFTPAREN +SmootLight.inputs.PygameInput.JOYBALLMOTION SmootLight.inputs.PygameInput-module.html#JOYBALLMOTION +SmootLight.inputs.PygameInput.K_LAST SmootLight.inputs.PygameInput-module.html#K_LAST +SmootLight.inputs.PygameInput.BLEND_RGBA_SUB SmootLight.inputs.PygameInput-module.html#BLEND_RGBA_SUB +SmootLight.inputs.PygameInput.K_DOLLAR SmootLight.inputs.PygameInput-module.html#K_DOLLAR +SmootLight.inputs.PygameInput.K_KP_ENTER SmootLight.inputs.PygameInput-module.html#K_KP_ENTER +SmootLight.inputs.PygameInput.K_PAGEDOWN SmootLight.inputs.PygameInput-module.html#K_PAGEDOWN +SmootLight.inputs.PygameInput.KMOD_LMETA SmootLight.inputs.PygameInput-module.html#KMOD_LMETA +SmootLight.inputs.PygameInput.K_HASH SmootLight.inputs.PygameInput-module.html#K_HASH +SmootLight.inputs.PygameInput.VIDEORESIZE SmootLight.inputs.PygameInput-module.html#VIDEORESIZE +SmootLight.inputs.PygameInput.K_DOWN SmootLight.inputs.PygameInput-module.html#K_DOWN +SmootLight.inputs.PygameInput.JOYAXISMOTION SmootLight.inputs.PygameInput-module.html#JOYAXISMOTION +SmootLight.inputs.PygameInput.K_END SmootLight.inputs.PygameInput-module.html#K_END +SmootLight.inputs.PygameInput.HAT_LEFT SmootLight.inputs.PygameInput-module.html#HAT_LEFT +SmootLight.inputs.PygameInput.GL_DEPTH_SIZE SmootLight.inputs.PygameInput-module.html#GL_DEPTH_SIZE +SmootLight.inputs.PygameInput.UYVY_OVERLAY SmootLight.inputs.PygameInput-module.html#UYVY_OVERLAY +SmootLight.inputs.PygameInput.K_ASTERISK SmootLight.inputs.PygameInput-module.html#K_ASTERISK +SmootLight.inputs.PygameInput.AUDIO_S8 SmootLight.inputs.PygameInput-module.html#AUDIO_S8 +SmootLight.inputs.PygameInput.RESIZABLE SmootLight.inputs.PygameInput-module.html#RESIZABLE +SmootLight.inputs.PygameInput.BLEND_MAX SmootLight.inputs.PygameInput-module.html#BLEND_MAX +SmootLight.inputs.PygameInput.K_LCTRL SmootLight.inputs.PygameInput-module.html#K_LCTRL +SmootLight.inputs.PygameInput.K_PAUSE SmootLight.inputs.PygameInput-module.html#K_PAUSE +SmootLight.inputs.PygameInput.K_BACKSLASH SmootLight.inputs.PygameInput-module.html#K_BACKSLASH +SmootLight.inputs.PygameInput.AUDIO_U16LSB SmootLight.inputs.PygameInput-module.html#AUDIO_U16LSB +SmootLight.inputs.PygameInput.K_MINUS SmootLight.inputs.PygameInput-module.html#K_MINUS +SmootLight.inputs.PygameInput.K_HELP SmootLight.inputs.PygameInput-module.html#K_HELP +SmootLight.inputs.PygameInput.SWSURFACE SmootLight.inputs.PygameInput-module.html#SWSURFACE +SmootLight.inputs.PygameInput.SCRAP_TEXT SmootLight.inputs.PygameInput-module.html#SCRAP_TEXT +SmootLight.inputs.PygameInput.K_r SmootLight.inputs.PygameInput-module.html#K_r +SmootLight.inputs.PygameInput.K_q SmootLight.inputs.PygameInput-module.html#K_q +SmootLight.inputs.PygameInput.SYSWMEVENT SmootLight.inputs.PygameInput-module.html#SYSWMEVENT +SmootLight.inputs.PygameInput.K_EXCLAIM SmootLight.inputs.PygameInput-module.html#K_EXCLAIM +SmootLight.inputs.PygameInput.KMOD_LSHIFT SmootLight.inputs.PygameInput-module.html#KMOD_LSHIFT +SmootLight.inputs.PygameInput.KMOD_ALT SmootLight.inputs.PygameInput-module.html#KMOD_ALT +SmootLight.inputs.PygameInput.K_BREAK SmootLight.inputs.PygameInput-module.html#K_BREAK +SmootLight.inputs.PygameInput.NOEVENT SmootLight.inputs.PygameInput-module.html#NOEVENT +SmootLight.inputs.PygameInput.BLEND_ADD SmootLight.inputs.PygameInput-module.html#BLEND_ADD +SmootLight.inputs.PygameInput.K_POWER SmootLight.inputs.PygameInput-module.html#K_POWER +SmootLight.inputs.PygameInput.K_ESCAPE SmootLight.inputs.PygameInput-module.html#K_ESCAPE +SmootLight.inputs.PygameInput.K_BACKSPACE SmootLight.inputs.PygameInput-module.html#K_BACKSPACE +SmootLight.inputs.PygameInput.K_MENU SmootLight.inputs.PygameInput-module.html#K_MENU +SmootLight.inputs.PygameInput.K_UNDERSCORE SmootLight.inputs.PygameInput-module.html#K_UNDERSCORE +SmootLight.inputs.PygameInput.FULLSCREEN SmootLight.inputs.PygameInput-module.html#FULLSCREEN +SmootLight.inputs.PygameInput.RLEACCELOK SmootLight.inputs.PygameInput-module.html#RLEACCELOK +SmootLight.inputs.PygameInput.JOYHATMOTION SmootLight.inputs.PygameInput-module.html#JOYHATMOTION +SmootLight.inputs.PygameInput.SRCALPHA SmootLight.inputs.PygameInput-module.html#SRCALPHA +SmootLight.inputs.PygameInput.SRCCOLORKEY SmootLight.inputs.PygameInput-module.html#SRCCOLORKEY +SmootLight.inputs.PygameInput.K_QUOTEDBL SmootLight.inputs.PygameInput-module.html#K_QUOTEDBL +SmootLight.inputs.PygameInput.K_KP_MULTIPLY SmootLight.inputs.PygameInput-module.html#K_KP_MULTIPLY +SmootLight.inputs.PygameInput.K_COLON SmootLight.inputs.PygameInput-module.html#K_COLON +SmootLight.inputs.PygameInput.GL_SWAP_CONTROL SmootLight.inputs.PygameInput-module.html#GL_SWAP_CONTROL +SmootLight.inputs.PygameInput.KMOD_MODE SmootLight.inputs.PygameInput-module.html#KMOD_MODE +SmootLight.inputs.PygameInput.GL_DOUBLEBUFFER SmootLight.inputs.PygameInput-module.html#GL_DOUBLEBUFFER +SmootLight.inputs.PygameInput.ASYNCBLIT SmootLight.inputs.PygameInput-module.html#ASYNCBLIT +SmootLight.inputs.PygameInput.K_t SmootLight.inputs.PygameInput-module.html#K_t +SmootLight.inputs.PygameInput.HAT_LEFTDOWN SmootLight.inputs.PygameInput-module.html#HAT_LEFTDOWN +SmootLight.inputs.PygameInput.VIDEOEXPOSE SmootLight.inputs.PygameInput-module.html#VIDEOEXPOSE +SmootLight.inputs.PygameInput.K_LALT SmootLight.inputs.PygameInput-module.html#K_LALT +SmootLight.inputs.PygameInput.K_F4 SmootLight.inputs.PygameInput-module.html#K_F4 +SmootLight.inputs.PygameInput.K_KP_PLUS SmootLight.inputs.PygameInput-module.html#K_KP_PLUS +SmootLight.inputs.PygameInput.K_NUMLOCK SmootLight.inputs.PygameInput-module.html#K_NUMLOCK +SmootLight.inputs.PygameInput.K_x SmootLight.inputs.PygameInput-module.html#K_x +SmootLight.inputs.PygameInput.K_RMETA SmootLight.inputs.PygameInput-module.html#K_RMETA +SmootLight.inputs.PygameInput.K_QUESTION SmootLight.inputs.PygameInput-module.html#K_QUESTION +SmootLight.inputs.PygameInput.K_LEFT SmootLight.inputs.PygameInput-module.html#K_LEFT +SmootLight.inputs.PygameInput.K_RIGHT SmootLight.inputs.PygameInput-module.html#K_RIGHT +SmootLight.inputs.PygameInput.AUDIO_S16 SmootLight.inputs.PygameInput-module.html#AUDIO_S16 +SmootLight.inputs.PygameInput.GL_ALPHA_SIZE SmootLight.inputs.PygameInput-module.html#GL_ALPHA_SIZE +SmootLight.inputs.PygameInput.K_z SmootLight.inputs.PygameInput-module.html#K_z +SmootLight.inputs.PygameInput.HWSURFACE SmootLight.inputs.PygameInput-module.html#HWSURFACE +SmootLight.inputs.PygameInput.K_SYSREQ SmootLight.inputs.PygameInput-module.html#K_SYSREQ +SmootLight.inputs.PygameInput.NOFRAME SmootLight.inputs.PygameInput-module.html#NOFRAME +SmootLight.inputs.PygameInput.AUDIO_S16LSB SmootLight.inputs.PygameInput-module.html#AUDIO_S16LSB +SmootLight.inputs.PygameInput.K_SEMICOLON SmootLight.inputs.PygameInput-module.html#K_SEMICOLON +SmootLight.inputs.PygameInput.BLEND_RGBA_ADD SmootLight.inputs.PygameInput-module.html#BLEND_RGBA_ADD +SmootLight.inputs.PygameInput.KMOD_RMETA SmootLight.inputs.PygameInput-module.html#KMOD_RMETA +SmootLight.inputs.PygameInput.HAT_RIGHTDOWN SmootLight.inputs.PygameInput-module.html#HAT_RIGHTDOWN +SmootLight.inputs.PygameInput.K_UNKNOWN SmootLight.inputs.PygameInput-module.html#K_UNKNOWN +SmootLight.inputs.PygameInput.KMOD_NUM SmootLight.inputs.PygameInput-module.html#KMOD_NUM +SmootLight.inputs.PygameInput.BLEND_RGB_ADD SmootLight.inputs.PygameInput-module.html#BLEND_RGB_ADD +SmootLight.inputs.PygameInput.HAT_CENTERED SmootLight.inputs.PygameInput-module.html#HAT_CENTERED +SmootLight.inputs.PygameInput.GL_MULTISAMPLESAMPLES SmootLight.inputs.PygameInput-module.html#GL_MULTISAMPLESAMPLES +SmootLight.inputs.PygameInput.GL_BLUE_SIZE SmootLight.inputs.PygameInput-module.html#GL_BLUE_SIZE +SmootLight.inputs.PygameInput.GL_ACCELERATED_VISUAL SmootLight.inputs.PygameInput-module.html#GL_ACCELERATED_VISUAL +SmootLight.inputs.PygameInput.K_EURO SmootLight.inputs.PygameInput-module.html#K_EURO +SmootLight.inputs.PygameInput.KMOD_CTRL SmootLight.inputs.PygameInput-module.html#KMOD_CTRL +SmootLight.inputs.PygameInput.MOUSEBUTTONUP SmootLight.inputs.PygameInput-module.html#MOUSEBUTTONUP +SmootLight.inputs.PygameInput.K_PERIOD SmootLight.inputs.PygameInput-module.html#K_PERIOD +SmootLight.inputs.PygameInput.BLEND_SUB SmootLight.inputs.PygameInput-module.html#BLEND_SUB +SmootLight.inputs.PygameInput.BLEND_MIN SmootLight.inputs.PygameInput-module.html#BLEND_MIN +SmootLight.inputs.PygameInput.JOYBUTTONUP SmootLight.inputs.PygameInput-module.html#JOYBUTTONUP +SmootLight.inputs.PygameInput.main_log SmootLight.inputs.PygameInput-module.html#main_log +SmootLight.inputs.PygameInput.K_DELETE SmootLight.inputs.PygameInput-module.html#K_DELETE +SmootLight.inputs.PygameInput.K_CARET SmootLight.inputs.PygameInput-module.html#K_CARET +SmootLight.inputs.PygameInput.USEREVENT SmootLight.inputs.PygameInput-module.html#USEREVENT +SmootLight.inputs.PygameInput.BLEND_RGBA_MULT SmootLight.inputs.PygameInput-module.html#BLEND_RGBA_MULT +SmootLight.inputs.PygameInput.LIL_ENDIAN SmootLight.inputs.PygameInput-module.html#LIL_ENDIAN +SmootLight.inputs.PygameInput.KMOD_SHIFT SmootLight.inputs.PygameInput-module.html#KMOD_SHIFT +SmootLight.inputs.PygameInput.KMOD_RSHIFT SmootLight.inputs.PygameInput-module.html#KMOD_RSHIFT +SmootLight.inputs.PygameInput.BIG_ENDIAN SmootLight.inputs.PygameInput-module.html#BIG_ENDIAN +SmootLight.inputs.PygameInput.K_v SmootLight.inputs.PygameInput-module.html#K_v +SmootLight.inputs.PygameInput.GL_MULTISAMPLEBUFFERS SmootLight.inputs.PygameInput-module.html#GL_MULTISAMPLEBUFFERS +SmootLight.inputs.PygameInput.HAT_RIGHTUP SmootLight.inputs.PygameInput-module.html#HAT_RIGHTUP +SmootLight.inputs.PygameInput.QUIT SmootLight.inputs.PygameInput-module.html#QUIT +SmootLight.inputs.PygameInput.K_LMETA SmootLight.inputs.PygameInput-module.html#K_LMETA +SmootLight.inputs.PygameInput.K_TAB SmootLight.inputs.PygameInput-module.html#K_TAB +SmootLight.inputs.PygameInput.K_EQUALS SmootLight.inputs.PygameInput-module.html#K_EQUALS +SmootLight.inputs.PygameInput.GL_ACCUM_BLUE_SIZE SmootLight.inputs.PygameInput-module.html#GL_ACCUM_BLUE_SIZE +SmootLight.inputs.PygameInput.K_MODE SmootLight.inputs.PygameInput-module.html#K_MODE +SmootLight.inputs.PygameInput.OPENGL SmootLight.inputs.PygameInput-module.html#OPENGL +SmootLight.inputs.PygameInput.K_RIGHTPAREN SmootLight.inputs.PygameInput-module.html#K_RIGHTPAREN +SmootLight.inputs.PygameInput.K_SLASH SmootLight.inputs.PygameInput-module.html#K_SLASH +SmootLight.inputs.PygameInput.GL_STENCIL_SIZE SmootLight.inputs.PygameInput-module.html#GL_STENCIL_SIZE +SmootLight.inputs.PygameInput.PREALLOC SmootLight.inputs.PygameInput-module.html#PREALLOC +SmootLight.inputs.PygameInput.K_F12 SmootLight.inputs.PygameInput-module.html#K_F12 +SmootLight.inputs.PygameInput.K_F13 SmootLight.inputs.PygameInput-module.html#K_F13 +SmootLight.inputs.PygameInput.K_F10 SmootLight.inputs.PygameInput-module.html#K_F10 +SmootLight.inputs.PygameInput.K_F11 SmootLight.inputs.PygameInput-module.html#K_F11 +SmootLight.inputs.PygameInput.K_F14 SmootLight.inputs.PygameInput-module.html#K_F14 +SmootLight.inputs.PygameInput.K_F15 SmootLight.inputs.PygameInput-module.html#K_F15 +SmootLight.inputs.PygameInput.K_y SmootLight.inputs.PygameInput-module.html#K_y +SmootLight.inputs.PygameInput.K_KP_EQUALS SmootLight.inputs.PygameInput-module.html#K_KP_EQUALS +SmootLight.inputs.PygameInput.K_l SmootLight.inputs.PygameInput-module.html#K_l +SmootLight.inputs.PygameInput.K_o SmootLight.inputs.PygameInput-module.html#K_o +SmootLight.inputs.PygameInput.YVYU_OVERLAY SmootLight.inputs.PygameInput-module.html#YVYU_OVERLAY +SmootLight.inputs.PygameInput.K_UP SmootLight.inputs.PygameInput-module.html#K_UP +SmootLight.inputs.PygameInput.K_p SmootLight.inputs.PygameInput-module.html#K_p +SmootLight.inputs.PygameInput.K_s SmootLight.inputs.PygameInput-module.html#K_s +SmootLight.inputs.PygameInput.KEYUP SmootLight.inputs.PygameInput-module.html#KEYUP +SmootLight.inputs.PygameInput.K_u SmootLight.inputs.PygameInput-module.html#K_u +SmootLight.inputs.PygameInput.AUDIO_S16MSB SmootLight.inputs.PygameInput-module.html#AUDIO_S16MSB +SmootLight.inputs.PygameInput.K_w SmootLight.inputs.PygameInput-module.html#K_w +SmootLight.inputs.PygameInput.KMOD_RCTRL SmootLight.inputs.PygameInput-module.html#KMOD_RCTRL +SmootLight.inputs.PygameInput.K_i SmootLight.inputs.PygameInput-module.html#K_i +SmootLight.inputs.PygameInput.K_h SmootLight.inputs.PygameInput-module.html#K_h +SmootLight.inputs.PygameInput.K_k SmootLight.inputs.PygameInput-module.html#K_k +SmootLight.inputs.PygameInput.GL_ACCUM_ALPHA_SIZE SmootLight.inputs.PygameInput-module.html#GL_ACCUM_ALPHA_SIZE +SmootLight.inputs.PygameInput.K_m SmootLight.inputs.PygameInput-module.html#K_m +SmootLight.inputs.PygameInput.K_LEFTBRACKET SmootLight.inputs.PygameInput-module.html#K_LEFTBRACKET +SmootLight.inputs.PygameInput.IYUV_OVERLAY SmootLight.inputs.PygameInput-module.html#IYUV_OVERLAY +SmootLight.inputs.PygameInput.K_RSUPER SmootLight.inputs.PygameInput-module.html#K_RSUPER +SmootLight.inputs.PygameInput.K_a SmootLight.inputs.PygameInput-module.html#K_a +SmootLight.inputs.PygameInput.ANYFORMAT SmootLight.inputs.PygameInput-module.html#ANYFORMAT +SmootLight.inputs.PygameInput.BLEND_RGB_SUB SmootLight.inputs.PygameInput-module.html#BLEND_RGB_SUB +SmootLight.inputs.PygameInput.K_e SmootLight.inputs.PygameInput-module.html#K_e +SmootLight.inputs.PygameInput.K_c SmootLight.inputs.PygameInput-module.html#K_c +SmootLight.inputs.PygameInput.K_g SmootLight.inputs.PygameInput-module.html#K_g +SmootLight.inputs.PygameInput.K_f SmootLight.inputs.PygameInput-module.html#K_f +SmootLight.inputs.PygameInput.BUTTON_X2 SmootLight.inputs.PygameInput-module.html#BUTTON_X2 +SmootLight.inputs.PygameInput.K_AT SmootLight.inputs.PygameInput-module.html#K_AT +SmootLight.inputs.PygameInput.BUTTON_X1 SmootLight.inputs.PygameInput-module.html#BUTTON_X1 +SmootLight.inputs.PygameInput.K_PAGEUP SmootLight.inputs.PygameInput-module.html#K_PAGEUP +SmootLight.inputs.PygameInput.K_CAPSLOCK SmootLight.inputs.PygameInput-module.html#K_CAPSLOCK +SmootLight.inputs.PygameInput.DOUBLEBUF SmootLight.inputs.PygameInput-module.html#DOUBLEBUF +SmootLight.inputs.PygameInput.K_PRINT SmootLight.inputs.PygameInput-module.html#K_PRINT +SmootLight.inputs.PygameInput.K_j SmootLight.inputs.PygameInput-module.html#K_j +SmootLight.inputs.PygameInput.KEYDOWN SmootLight.inputs.PygameInput-module.html#KEYDOWN +SmootLight.inputs.PygameInput.K_d SmootLight.inputs.PygameInput-module.html#K_d +SmootLight.inputs.PygameInput.AUDIO_U16SYS SmootLight.inputs.PygameInput-module.html#AUDIO_U16SYS +SmootLight.inputs.PygameInput.K_RETURN SmootLight.inputs.PygameInput-module.html#K_RETURN +SmootLight.inputs.PygameInput.K_SCROLLOCK SmootLight.inputs.PygameInput-module.html#K_SCROLLOCK +SmootLight.inputs.PygameInput.ACTIVEEVENT SmootLight.inputs.PygameInput-module.html#ACTIVEEVENT +SmootLight.inputs.PygameInput.SCRAP_BMP SmootLight.inputs.PygameInput-module.html#SCRAP_BMP +SmootLight.inputs.PygameInput.K_9 SmootLight.inputs.PygameInput-module.html#K_9 +SmootLight.inputs.PygameInput.K_8 SmootLight.inputs.PygameInput-module.html#K_8 +SmootLight.inputs.PygameInput.NUMEVENTS SmootLight.inputs.PygameInput-module.html#NUMEVENTS +SmootLight.inputs.PygameInput.HAT_UP SmootLight.inputs.PygameInput-module.html#HAT_UP +SmootLight.inputs.PygameInput.K_1 SmootLight.inputs.PygameInput-module.html#K_1 +SmootLight.inputs.PygameInput.K_0 SmootLight.inputs.PygameInput-module.html#K_0 +SmootLight.inputs.PygameInput.K_3 SmootLight.inputs.PygameInput-module.html#K_3 +SmootLight.inputs.PygameInput.AUDIO_U16MSB SmootLight.inputs.PygameInput-module.html#AUDIO_U16MSB +SmootLight.inputs.PygameInput.K_5 SmootLight.inputs.PygameInput-module.html#K_5 +SmootLight.inputs.PygameInput.K_4 SmootLight.inputs.PygameInput-module.html#K_4 +SmootLight.inputs.PygameInput.K_7 SmootLight.inputs.PygameInput-module.html#K_7 +SmootLight.inputs.PygameInput.K_6 SmootLight.inputs.PygameInput-module.html#K_6 +SmootLight.inputs.PygameInput.YUY2_OVERLAY SmootLight.inputs.PygameInput-module.html#YUY2_OVERLAY +SmootLight.inputs.PygameInput.K_PLUS SmootLight.inputs.PygameInput-module.html#K_PLUS +SmootLight.inputs.PygameInput.K_KP6 SmootLight.inputs.PygameInput-module.html#K_KP6 +SmootLight.inputs.PygameInput.K_b SmootLight.inputs.PygameInput-module.html#K_b +SmootLight.inputs.PygameInput.K_QUOTE SmootLight.inputs.PygameInput-module.html#K_QUOTE +SmootLight.inputs.PygameInput.K_RCTRL SmootLight.inputs.PygameInput-module.html#K_RCTRL +SmootLight.inputs.PygameInput.MOUSEBUTTONDOWN SmootLight.inputs.PygameInput-module.html#MOUSEBUTTONDOWN +SmootLight.inputs.PygameInput.K_LESS SmootLight.inputs.PygameInput-module.html#K_LESS +SmootLight.inputs.PygameInput.AUDIO_S16SYS SmootLight.inputs.PygameInput-module.html#AUDIO_S16SYS +SmootLight.inputs.PygameInput.OPENGLBLIT SmootLight.inputs.PygameInput-module.html#OPENGLBLIT +SmootLight.inputs.PygameInput.JOYBUTTONDOWN SmootLight.inputs.PygameInput-module.html#JOYBUTTONDOWN +SmootLight.inputs.PygameInput.K_KP8 SmootLight.inputs.PygameInput-module.html#K_KP8 +SmootLight.inputs.PygameInput.K_KP9 SmootLight.inputs.PygameInput-module.html#K_KP9 +SmootLight.inputs.PygameInput.K_KP4 SmootLight.inputs.PygameInput-module.html#K_KP4 +SmootLight.inputs.PygameInput.K_KP5 SmootLight.inputs.PygameInput-module.html#K_KP5 +SmootLight.inputs.PygameInput.K_BACKQUOTE SmootLight.inputs.PygameInput-module.html#K_BACKQUOTE +SmootLight.inputs.PygameInput.K_KP7 SmootLight.inputs.PygameInput-module.html#K_KP7 +SmootLight.inputs.PygameInput.K_KP0 SmootLight.inputs.PygameInput-module.html#K_KP0 +SmootLight.inputs.PygameInput.K_KP1 SmootLight.inputs.PygameInput-module.html#K_KP1 +SmootLight.inputs.PygameInput.K_KP2 SmootLight.inputs.PygameInput-module.html#K_KP2 +SmootLight.inputs.PygameInput.K_KP3 SmootLight.inputs.PygameInput-module.html#K_KP3 +SmootLight.inputs.RandomLocs SmootLight.inputs.RandomLocs-module.html +SmootLight.inputs.RandomLocs.exception_log SmootLight.inputs.RandomLocs-module.html#exception_log +SmootLight.inputs.RandomLocs.__package__ SmootLight.inputs.RandomLocs-module.html#__package__ +SmootLight.inputs.RandomLocs.main_log SmootLight.inputs.RandomLocs-module.html#main_log +SmootLight.inputs.TCPInput SmootLight.inputs.TCPInput-module.html +SmootLight.inputs.TCPInput.exception_log SmootLight.inputs.TCPInput-module.html#exception_log +SmootLight.inputs.TCPInput.__package__ SmootLight.inputs.TCPInput-module.html#__package__ +SmootLight.inputs.TCPInput_backup SmootLight.inputs.TCPInput_backup-module.html +SmootLight.inputs.UDPInput SmootLight.inputs.UDPInput-module.html +SmootLight.inputs.UDPInput.exception_log SmootLight.inputs.UDPInput-module.html#exception_log +SmootLight.inputs.UDPInput.__package__ SmootLight.inputs.UDPInput-module.html#__package__ +SmootLight.inputs.UDPInput.main_log SmootLight.inputs.UDPInput-module.html#main_log +SmootLight.layouts SmootLight.layouts-module.html +SmootLight.layouts.__package__ SmootLight.layouts-module.html#__package__ +SmootLight.layouts.LineLayout SmootLight.layouts.LineLayout-module.html +SmootLight.layouts.LineLayout.__package__ SmootLight.layouts.LineLayout-module.html#__package__ +SmootLight.layouts.SpecifiedLayout SmootLight.layouts.SpecifiedLayout-module.html +SmootLight.layouts.SpecifiedLayout.__package__ SmootLight.layouts.SpecifiedLayout-module.html#__package__ +SmootLight.layouts.ZigzagLayout SmootLight.layouts.ZigzagLayout-module.html +SmootLight.layouts.ZigzagLayout.__package__ SmootLight.layouts.ZigzagLayout-module.html#__package__ +SmootLight.logger SmootLight.logger-module.html +SmootLight.logger.__package__ SmootLight.logger-module.html#__package__ +SmootLight.logger.Logger SmootLight.logger.Logger-module.html +SmootLight.logger.Logger.screen_log SmootLight.logger.Logger-module.html#screen_log +SmootLight.logger.Logger.main_log SmootLight.logger.Logger-module.html#main_log +SmootLight.logger.Logger.exception_log SmootLight.logger.Logger-module.html#exception_log +SmootLight.logger.Logger.__package__ SmootLight.logger.Logger-module.html#__package__ +SmootLight.logger.UTF8LogFormatter SmootLight.logger.UTF8LogFormatter-module.html +SmootLight.logger.UTF8LogFormatter.__package__ SmootLight.logger.UTF8LogFormatter-module.html#__package__ +SmootLight.operationscore SmootLight.operationscore-module.html +SmootLight.operationscore.__package__ SmootLight.operationscore-module.html#__package__ +SmootLight.operationscore.Behavior SmootLight.operationscore.Behavior-module.html +SmootLight.operationscore.Behavior.__package__ SmootLight.operationscore.Behavior-module.html#__package__ +SmootLight.operationscore.Input SmootLight.operationscore.Input-module.html +SmootLight.operationscore.Input.__package__ SmootLight.operationscore.Input-module.html#__package__ +SmootLight.operationscore.PixelAssembler SmootLight.operationscore.PixelAssembler-module.html +SmootLight.operationscore.PixelAssembler.__package__ SmootLight.operationscore.PixelAssembler-module.html#__package__ +SmootLight.operationscore.PixelEvent SmootLight.operationscore.PixelEvent-module.html +SmootLight.operationscore.PixelEvent.__package__ SmootLight.operationscore.PixelEvent-module.html#__package__ +SmootLight.operationscore.PixelMapper SmootLight.operationscore.PixelMapper-module.html +SmootLight.operationscore.PixelMapper.__package__ SmootLight.operationscore.PixelMapper-module.html#__package__ +SmootLight.operationscore.Renderer SmootLight.operationscore.Renderer-module.html +SmootLight.operationscore.Renderer.__package__ SmootLight.operationscore.Renderer-module.html#__package__ +SmootLight.operationscore.SmootCoreObject SmootLight.operationscore.SmootCoreObject-module.html +SmootLight.operationscore.SmootCoreObject.__package__ SmootLight.operationscore.SmootCoreObject-module.html#__package__ +SmootLight.operationscore.ThreadedSmootCoreObject SmootLight.operationscore.ThreadedSmootCoreObject-module.html +SmootLight.operationscore.ThreadedSmootCoreObject.__package__ SmootLight.operationscore.ThreadedSmootCoreObject-module.html#__package__ +SmootLight.pixelcore SmootLight.pixelcore-module.html +SmootLight.pixelcore.__package__ SmootLight.pixelcore-module.html#__package__ +SmootLight.pixelcore.Pixel SmootLight.pixelcore.Pixel-module.html +SmootLight.pixelcore.Pixel.__package__ SmootLight.pixelcore.Pixel-module.html#__package__ +SmootLight.pixelcore.PixelStrip SmootLight.pixelcore.PixelStrip-module.html +SmootLight.pixelcore.PixelStrip.main_log SmootLight.pixelcore.PixelStrip-module.html#main_log +SmootLight.pixelcore.PixelStrip.__package__ SmootLight.pixelcore.PixelStrip-module.html#__package__ +SmootLight.pixelcore.Screen SmootLight.pixelcore.Screen-module.html +SmootLight.pixelcore.Screen.__package__ SmootLight.pixelcore.Screen-module.html#__package__ +SmootLight.pixelevents SmootLight.pixelevents-module.html +SmootLight.pixelevents.__package__ SmootLight.pixelevents-module.html#__package__ +SmootLight.pixelevents.DecayEvent SmootLight.pixelevents.DecayEvent-module.html +SmootLight.pixelevents.DecayEvent.__package__ SmootLight.pixelevents.DecayEvent-module.html#__package__ +SmootLight.pixelevents.SingleFrameEvent SmootLight.pixelevents.SingleFrameEvent-module.html +SmootLight.pixelevents.SingleFrameEvent.__package__ SmootLight.pixelevents.SingleFrameEvent-module.html#__package__ +SmootLight.pixelevents.StepEvent SmootLight.pixelevents.StepEvent-module.html +SmootLight.pixelevents.StepEvent.__package__ SmootLight.pixelevents.StepEvent-module.html#__package__ +SmootLight.pixelevents.SynchTestEvent SmootLight.pixelevents.SynchTestEvent-module.html +SmootLight.pixelevents.SynchTestEvent.__package__ SmootLight.pixelevents.SynchTestEvent-module.html#__package__ +SmootLight.pixelmappers SmootLight.pixelmappers-module.html +SmootLight.pixelmappers.__package__ SmootLight.pixelmappers-module.html#__package__ +SmootLight.pixelmappers.C5SignMapper SmootLight.pixelmappers.C5SignMapper-module.html +SmootLight.pixelmappers.C5SignMapper.main_log SmootLight.pixelmappers.C5SignMapper-module.html#main_log +SmootLight.pixelmappers.C5SignMapper.__package__ SmootLight.pixelmappers.C5SignMapper-module.html#__package__ +SmootLight.pixelmappers.GaussianMapper SmootLight.pixelmappers.GaussianMapper-module.html +SmootLight.pixelmappers.GaussianMapper.main_log SmootLight.pixelmappers.GaussianMapper-module.html#main_log +SmootLight.pixelmappers.GaussianMapper.__package__ SmootLight.pixelmappers.GaussianMapper-module.html#__package__ +SmootLight.pixelmappers.SimpleMapper SmootLight.pixelmappers.SimpleMapper-module.html +SmootLight.pixelmappers.SimpleMapper.main_log SmootLight.pixelmappers.SimpleMapper-module.html#main_log +SmootLight.pixelmappers.SimpleMapper.__package__ SmootLight.pixelmappers.SimpleMapper-module.html#__package__ +SmootLight.pixelmappers.WindGaussianMapper SmootLight.pixelmappers.WindGaussianMapper-module.html +SmootLight.pixelmappers.WindGaussianMapper.main_log SmootLight.pixelmappers.WindGaussianMapper-module.html#main_log +SmootLight.pixelmappers.WindGaussianMapper.__package__ SmootLight.pixelmappers.WindGaussianMapper-module.html#__package__ +SmootLight.renderers SmootLight.renderers-module.html +SmootLight.renderers.__package__ SmootLight.renderers-module.html#__package__ +SmootLight.renderers.IndoorRenderer SmootLight.renderers.IndoorRenderer-module.html +SmootLight.renderers.IndoorRenderer.sock_port SmootLight.renderers.IndoorRenderer-module.html#sock_port +SmootLight.renderers.IndoorRenderer.__package__ SmootLight.renderers.IndoorRenderer-module.html#__package__ +SmootLight.renderers.PygameRenderer SmootLight.renderers.PygameRenderer-module.html +SmootLight.renderers.PygameRenderer.K_KP_MINUS SmootLight.renderers.PygameRenderer-module.html#K_KP_MINUS +SmootLight.renderers.PygameRenderer.GL_STEREO SmootLight.renderers.PygameRenderer-module.html#GL_STEREO +SmootLight.renderers.PygameRenderer.K_F2 SmootLight.renderers.PygameRenderer-module.html#K_F2 +SmootLight.renderers.PygameRenderer.K_F3 SmootLight.renderers.PygameRenderer-module.html#K_F3 +SmootLight.renderers.PygameRenderer.BLEND_MULT SmootLight.renderers.PygameRenderer-module.html#BLEND_MULT +SmootLight.renderers.PygameRenderer.K_F5 SmootLight.renderers.PygameRenderer-module.html#K_F5 +SmootLight.renderers.PygameRenderer.K_F6 SmootLight.renderers.PygameRenderer-module.html#K_F6 +SmootLight.renderers.PygameRenderer.K_F1 SmootLight.renderers.PygameRenderer-module.html#K_F1 +SmootLight.renderers.PygameRenderer.K_F8 SmootLight.renderers.PygameRenderer-module.html#K_F8 +SmootLight.renderers.PygameRenderer.K_F9 SmootLight.renderers.PygameRenderer-module.html#K_F9 +SmootLight.renderers.PygameRenderer.K_2 SmootLight.renderers.PygameRenderer-module.html#K_2 +SmootLight.renderers.PygameRenderer.K_COMMA SmootLight.renderers.PygameRenderer-module.html#K_COMMA +SmootLight.renderers.PygameRenderer.SCRAP_PPM SmootLight.renderers.PygameRenderer-module.html#SCRAP_PPM +SmootLight.renderers.PygameRenderer.BLEND_RGBA_MAX SmootLight.renderers.PygameRenderer-module.html#BLEND_RGBA_MAX +SmootLight.renderers.PygameRenderer.RLEACCEL SmootLight.renderers.PygameRenderer-module.html#RLEACCEL +SmootLight.renderers.PygameRenderer.KMOD_RALT SmootLight.renderers.PygameRenderer-module.html#KMOD_RALT +SmootLight.renderers.PygameRenderer.KMOD_LALT SmootLight.renderers.PygameRenderer-module.html#KMOD_LALT +SmootLight.renderers.PygameRenderer.__package__ SmootLight.renderers.PygameRenderer-module.html#__package__ +SmootLight.renderers.PygameRenderer.BLEND_RGBA_MIN SmootLight.renderers.PygameRenderer-module.html#BLEND_RGBA_MIN +SmootLight.renderers.PygameRenderer.GL_GREEN_SIZE SmootLight.renderers.PygameRenderer-module.html#GL_GREEN_SIZE +SmootLight.renderers.PygameRenderer.KMOD_NONE SmootLight.renderers.PygameRenderer-module.html#KMOD_NONE +SmootLight.renderers.PygameRenderer.K_AMPERSAND SmootLight.renderers.PygameRenderer-module.html#K_AMPERSAND +SmootLight.renderers.PygameRenderer.K_n SmootLight.renderers.PygameRenderer-module.html#K_n +SmootLight.renderers.PygameRenderer.KMOD_LCTRL SmootLight.renderers.PygameRenderer-module.html#KMOD_LCTRL +SmootLight.renderers.PygameRenderer.K_CLEAR SmootLight.renderers.PygameRenderer-module.html#K_CLEAR +SmootLight.renderers.PygameRenderer.HAT_LEFTUP SmootLight.renderers.PygameRenderer-module.html#HAT_LEFTUP +SmootLight.renderers.PygameRenderer.K_F7 SmootLight.renderers.PygameRenderer-module.html#K_F7 +SmootLight.renderers.PygameRenderer.KMOD_META SmootLight.renderers.PygameRenderer-module.html#KMOD_META +SmootLight.renderers.PygameRenderer.TIMER_RESOLUTION SmootLight.renderers.PygameRenderer-module.html#TIMER_RESOLUTION +SmootLight.renderers.PygameRenderer.HWPALETTE SmootLight.renderers.PygameRenderer-module.html#HWPALETTE +SmootLight.renderers.PygameRenderer.KMOD_CAPS SmootLight.renderers.PygameRenderer-module.html#KMOD_CAPS +SmootLight.renderers.PygameRenderer.SCRAP_PBM SmootLight.renderers.PygameRenderer-module.html#SCRAP_PBM +SmootLight.renderers.PygameRenderer.AUDIO_U8 SmootLight.renderers.PygameRenderer-module.html#AUDIO_U8 +SmootLight.renderers.PygameRenderer.SCRAP_CLIPBOARD SmootLight.renderers.PygameRenderer-module.html#SCRAP_CLIPBOARD +SmootLight.renderers.PygameRenderer.GL_BUFFER_SIZE SmootLight.renderers.PygameRenderer-module.html#GL_BUFFER_SIZE +SmootLight.renderers.PygameRenderer.AUDIO_U16 SmootLight.renderers.PygameRenderer-module.html#AUDIO_U16 +SmootLight.renderers.PygameRenderer.K_SPACE SmootLight.renderers.PygameRenderer-module.html#K_SPACE +SmootLight.renderers.PygameRenderer.BLEND_RGB_MULT SmootLight.renderers.PygameRenderer-module.html#BLEND_RGB_MULT +SmootLight.renderers.PygameRenderer.MOUSEMOTION SmootLight.renderers.PygameRenderer-module.html#MOUSEMOTION +SmootLight.renderers.PygameRenderer.K_INSERT SmootLight.renderers.PygameRenderer-module.html#K_INSERT +SmootLight.renderers.PygameRenderer.GL_ACCUM_GREEN_SIZE SmootLight.renderers.PygameRenderer-module.html#GL_ACCUM_GREEN_SIZE +SmootLight.renderers.PygameRenderer.K_HOME SmootLight.renderers.PygameRenderer-module.html#K_HOME +SmootLight.renderers.PygameRenderer.GL_ACCUM_RED_SIZE SmootLight.renderers.PygameRenderer-module.html#GL_ACCUM_RED_SIZE +SmootLight.renderers.PygameRenderer.K_LSUPER SmootLight.renderers.PygameRenderer-module.html#K_LSUPER +SmootLight.renderers.PygameRenderer.K_KP_DIVIDE SmootLight.renderers.PygameRenderer-module.html#K_KP_DIVIDE +SmootLight.renderers.PygameRenderer.BLEND_RGB_MAX SmootLight.renderers.PygameRenderer-module.html#BLEND_RGB_MAX +SmootLight.renderers.PygameRenderer.BLEND_RGB_MIN SmootLight.renderers.PygameRenderer-module.html#BLEND_RGB_MIN +SmootLight.renderers.PygameRenderer.SCRAP_SELECTION SmootLight.renderers.PygameRenderer-module.html#SCRAP_SELECTION +SmootLight.renderers.PygameRenderer.GL_RED_SIZE SmootLight.renderers.PygameRenderer-module.html#GL_RED_SIZE +SmootLight.renderers.PygameRenderer.HAT_RIGHT SmootLight.renderers.PygameRenderer-module.html#HAT_RIGHT +SmootLight.renderers.PygameRenderer.HWACCEL SmootLight.renderers.PygameRenderer-module.html#HWACCEL +SmootLight.renderers.PygameRenderer.K_GREATER SmootLight.renderers.PygameRenderer-module.html#K_GREATER +SmootLight.renderers.PygameRenderer.HAT_DOWN SmootLight.renderers.PygameRenderer-module.html#HAT_DOWN +SmootLight.renderers.PygameRenderer.K_FIRST SmootLight.renderers.PygameRenderer-module.html#K_FIRST +SmootLight.renderers.PygameRenderer.K_KP_PERIOD SmootLight.renderers.PygameRenderer-module.html#K_KP_PERIOD +SmootLight.renderers.PygameRenderer.K_RALT SmootLight.renderers.PygameRenderer-module.html#K_RALT +SmootLight.renderers.PygameRenderer.YV12_OVERLAY SmootLight.renderers.PygameRenderer-module.html#YV12_OVERLAY +SmootLight.renderers.PygameRenderer.K_RIGHTBRACKET SmootLight.renderers.PygameRenderer-module.html#K_RIGHTBRACKET +SmootLight.renderers.PygameRenderer.K_RSHIFT SmootLight.renderers.PygameRenderer-module.html#K_RSHIFT +SmootLight.renderers.PygameRenderer.K_LSHIFT SmootLight.renderers.PygameRenderer-module.html#K_LSHIFT +SmootLight.renderers.PygameRenderer.K_LEFTPAREN SmootLight.renderers.PygameRenderer-module.html#K_LEFTPAREN +SmootLight.renderers.PygameRenderer.JOYBALLMOTION SmootLight.renderers.PygameRenderer-module.html#JOYBALLMOTION +SmootLight.renderers.PygameRenderer.SYSWMEVENT SmootLight.renderers.PygameRenderer-module.html#SYSWMEVENT +SmootLight.renderers.PygameRenderer.K_LAST SmootLight.renderers.PygameRenderer-module.html#K_LAST +SmootLight.renderers.PygameRenderer.BLEND_RGBA_SUB SmootLight.renderers.PygameRenderer-module.html#BLEND_RGBA_SUB +SmootLight.renderers.PygameRenderer.K_DOLLAR SmootLight.renderers.PygameRenderer-module.html#K_DOLLAR +SmootLight.renderers.PygameRenderer.K_KP_ENTER SmootLight.renderers.PygameRenderer-module.html#K_KP_ENTER +SmootLight.renderers.PygameRenderer.K_PAGEDOWN SmootLight.renderers.PygameRenderer-module.html#K_PAGEDOWN +SmootLight.renderers.PygameRenderer.KMOD_LMETA SmootLight.renderers.PygameRenderer-module.html#KMOD_LMETA +SmootLight.renderers.PygameRenderer.K_HASH SmootLight.renderers.PygameRenderer-module.html#K_HASH +SmootLight.renderers.PygameRenderer.VIDEORESIZE SmootLight.renderers.PygameRenderer-module.html#VIDEORESIZE +SmootLight.renderers.PygameRenderer.K_DOWN SmootLight.renderers.PygameRenderer-module.html#K_DOWN +SmootLight.renderers.PygameRenderer.JOYAXISMOTION SmootLight.renderers.PygameRenderer-module.html#JOYAXISMOTION +SmootLight.renderers.PygameRenderer.K_END SmootLight.renderers.PygameRenderer-module.html#K_END +SmootLight.renderers.PygameRenderer.HAT_LEFT SmootLight.renderers.PygameRenderer-module.html#HAT_LEFT +SmootLight.renderers.PygameRenderer.GL_DEPTH_SIZE SmootLight.renderers.PygameRenderer-module.html#GL_DEPTH_SIZE +SmootLight.renderers.PygameRenderer.UYVY_OVERLAY SmootLight.renderers.PygameRenderer-module.html#UYVY_OVERLAY +SmootLight.renderers.PygameRenderer.K_ASTERISK SmootLight.renderers.PygameRenderer-module.html#K_ASTERISK +SmootLight.renderers.PygameRenderer.AUDIO_S8 SmootLight.renderers.PygameRenderer-module.html#AUDIO_S8 +SmootLight.renderers.PygameRenderer.RESIZABLE SmootLight.renderers.PygameRenderer-module.html#RESIZABLE +SmootLight.renderers.PygameRenderer.BLEND_MAX SmootLight.renderers.PygameRenderer-module.html#BLEND_MAX +SmootLight.renderers.PygameRenderer.K_LCTRL SmootLight.renderers.PygameRenderer-module.html#K_LCTRL +SmootLight.renderers.PygameRenderer.K_PAUSE SmootLight.renderers.PygameRenderer-module.html#K_PAUSE +SmootLight.renderers.PygameRenderer.K_BACKSLASH SmootLight.renderers.PygameRenderer-module.html#K_BACKSLASH +SmootLight.renderers.PygameRenderer.AUDIO_U16LSB SmootLight.renderers.PygameRenderer-module.html#AUDIO_U16LSB +SmootLight.renderers.PygameRenderer.K_MINUS SmootLight.renderers.PygameRenderer-module.html#K_MINUS +SmootLight.renderers.PygameRenderer.K_HELP SmootLight.renderers.PygameRenderer-module.html#K_HELP +SmootLight.renderers.PygameRenderer.SWSURFACE SmootLight.renderers.PygameRenderer-module.html#SWSURFACE +SmootLight.renderers.PygameRenderer.SCRAP_TEXT SmootLight.renderers.PygameRenderer-module.html#SCRAP_TEXT +SmootLight.renderers.PygameRenderer.K_r SmootLight.renderers.PygameRenderer-module.html#K_r +SmootLight.renderers.PygameRenderer.K_q SmootLight.renderers.PygameRenderer-module.html#K_q +SmootLight.renderers.PygameRenderer.K_EXCLAIM SmootLight.renderers.PygameRenderer-module.html#K_EXCLAIM +SmootLight.renderers.PygameRenderer.KMOD_LSHIFT SmootLight.renderers.PygameRenderer-module.html#KMOD_LSHIFT +SmootLight.renderers.PygameRenderer.KMOD_ALT SmootLight.renderers.PygameRenderer-module.html#KMOD_ALT +SmootLight.renderers.PygameRenderer.K_BREAK SmootLight.renderers.PygameRenderer-module.html#K_BREAK +SmootLight.renderers.PygameRenderer.NOEVENT SmootLight.renderers.PygameRenderer-module.html#NOEVENT +SmootLight.renderers.PygameRenderer.BLEND_ADD SmootLight.renderers.PygameRenderer-module.html#BLEND_ADD +SmootLight.renderers.PygameRenderer.K_POWER SmootLight.renderers.PygameRenderer-module.html#K_POWER +SmootLight.renderers.PygameRenderer.K_ESCAPE SmootLight.renderers.PygameRenderer-module.html#K_ESCAPE +SmootLight.renderers.PygameRenderer.K_BACKSPACE SmootLight.renderers.PygameRenderer-module.html#K_BACKSPACE +SmootLight.renderers.PygameRenderer.K_MENU SmootLight.renderers.PygameRenderer-module.html#K_MENU +SmootLight.renderers.PygameRenderer.K_UNDERSCORE SmootLight.renderers.PygameRenderer-module.html#K_UNDERSCORE +SmootLight.renderers.PygameRenderer.FULLSCREEN SmootLight.renderers.PygameRenderer-module.html#FULLSCREEN +SmootLight.renderers.PygameRenderer.RLEACCELOK SmootLight.renderers.PygameRenderer-module.html#RLEACCELOK +SmootLight.renderers.PygameRenderer.JOYHATMOTION SmootLight.renderers.PygameRenderer-module.html#JOYHATMOTION +SmootLight.renderers.PygameRenderer.SRCALPHA SmootLight.renderers.PygameRenderer-module.html#SRCALPHA +SmootLight.renderers.PygameRenderer.SRCCOLORKEY SmootLight.renderers.PygameRenderer-module.html#SRCCOLORKEY +SmootLight.renderers.PygameRenderer.K_QUOTEDBL SmootLight.renderers.PygameRenderer-module.html#K_QUOTEDBL +SmootLight.renderers.PygameRenderer.K_KP_MULTIPLY SmootLight.renderers.PygameRenderer-module.html#K_KP_MULTIPLY +SmootLight.renderers.PygameRenderer.K_COLON SmootLight.renderers.PygameRenderer-module.html#K_COLON +SmootLight.renderers.PygameRenderer.GL_SWAP_CONTROL SmootLight.renderers.PygameRenderer-module.html#GL_SWAP_CONTROL +SmootLight.renderers.PygameRenderer.KMOD_MODE SmootLight.renderers.PygameRenderer-module.html#KMOD_MODE +SmootLight.renderers.PygameRenderer.GL_DOUBLEBUFFER SmootLight.renderers.PygameRenderer-module.html#GL_DOUBLEBUFFER +SmootLight.renderers.PygameRenderer.ASYNCBLIT SmootLight.renderers.PygameRenderer-module.html#ASYNCBLIT +SmootLight.renderers.PygameRenderer.K_t SmootLight.renderers.PygameRenderer-module.html#K_t +SmootLight.renderers.PygameRenderer.HAT_LEFTDOWN SmootLight.renderers.PygameRenderer-module.html#HAT_LEFTDOWN +SmootLight.renderers.PygameRenderer.VIDEOEXPOSE SmootLight.renderers.PygameRenderer-module.html#VIDEOEXPOSE +SmootLight.renderers.PygameRenderer.K_LALT SmootLight.renderers.PygameRenderer-module.html#K_LALT +SmootLight.renderers.PygameRenderer.K_F4 SmootLight.renderers.PygameRenderer-module.html#K_F4 +SmootLight.renderers.PygameRenderer.K_KP_PLUS SmootLight.renderers.PygameRenderer-module.html#K_KP_PLUS +SmootLight.renderers.PygameRenderer.K_NUMLOCK SmootLight.renderers.PygameRenderer-module.html#K_NUMLOCK +SmootLight.renderers.PygameRenderer.K_x SmootLight.renderers.PygameRenderer-module.html#K_x +SmootLight.renderers.PygameRenderer.K_RMETA SmootLight.renderers.PygameRenderer-module.html#K_RMETA +SmootLight.renderers.PygameRenderer.K_QUESTION SmootLight.renderers.PygameRenderer-module.html#K_QUESTION +SmootLight.renderers.PygameRenderer.K_LEFT SmootLight.renderers.PygameRenderer-module.html#K_LEFT +SmootLight.renderers.PygameRenderer.K_RIGHT SmootLight.renderers.PygameRenderer-module.html#K_RIGHT +SmootLight.renderers.PygameRenderer.AUDIO_S16 SmootLight.renderers.PygameRenderer-module.html#AUDIO_S16 +SmootLight.renderers.PygameRenderer.GL_ALPHA_SIZE SmootLight.renderers.PygameRenderer-module.html#GL_ALPHA_SIZE +SmootLight.renderers.PygameRenderer.K_z SmootLight.renderers.PygameRenderer-module.html#K_z +SmootLight.renderers.PygameRenderer.HWSURFACE SmootLight.renderers.PygameRenderer-module.html#HWSURFACE +SmootLight.renderers.PygameRenderer.K_SYSREQ SmootLight.renderers.PygameRenderer-module.html#K_SYSREQ +SmootLight.renderers.PygameRenderer.NOFRAME SmootLight.renderers.PygameRenderer-module.html#NOFRAME +SmootLight.renderers.PygameRenderer.AUDIO_S16LSB SmootLight.renderers.PygameRenderer-module.html#AUDIO_S16LSB +SmootLight.renderers.PygameRenderer.K_SEMICOLON SmootLight.renderers.PygameRenderer-module.html#K_SEMICOLON +SmootLight.renderers.PygameRenderer.BLEND_RGBA_ADD SmootLight.renderers.PygameRenderer-module.html#BLEND_RGBA_ADD +SmootLight.renderers.PygameRenderer.KMOD_RMETA SmootLight.renderers.PygameRenderer-module.html#KMOD_RMETA +SmootLight.renderers.PygameRenderer.HAT_RIGHTDOWN SmootLight.renderers.PygameRenderer-module.html#HAT_RIGHTDOWN +SmootLight.renderers.PygameRenderer.K_UNKNOWN SmootLight.renderers.PygameRenderer-module.html#K_UNKNOWN +SmootLight.renderers.PygameRenderer.KMOD_NUM SmootLight.renderers.PygameRenderer-module.html#KMOD_NUM +SmootLight.renderers.PygameRenderer.BLEND_RGB_ADD SmootLight.renderers.PygameRenderer-module.html#BLEND_RGB_ADD +SmootLight.renderers.PygameRenderer.HAT_CENTERED SmootLight.renderers.PygameRenderer-module.html#HAT_CENTERED +SmootLight.renderers.PygameRenderer.GL_MULTISAMPLESAMPLES SmootLight.renderers.PygameRenderer-module.html#GL_MULTISAMPLESAMPLES +SmootLight.renderers.PygameRenderer.GL_BLUE_SIZE SmootLight.renderers.PygameRenderer-module.html#GL_BLUE_SIZE +SmootLight.renderers.PygameRenderer.GL_ACCELERATED_VISUAL SmootLight.renderers.PygameRenderer-module.html#GL_ACCELERATED_VISUAL +SmootLight.renderers.PygameRenderer.K_EURO SmootLight.renderers.PygameRenderer-module.html#K_EURO +SmootLight.renderers.PygameRenderer.KMOD_CTRL SmootLight.renderers.PygameRenderer-module.html#KMOD_CTRL +SmootLight.renderers.PygameRenderer.MOUSEBUTTONUP SmootLight.renderers.PygameRenderer-module.html#MOUSEBUTTONUP +SmootLight.renderers.PygameRenderer.K_PERIOD SmootLight.renderers.PygameRenderer-module.html#K_PERIOD +SmootLight.renderers.PygameRenderer.BLEND_SUB SmootLight.renderers.PygameRenderer-module.html#BLEND_SUB +SmootLight.renderers.PygameRenderer.BLEND_MIN SmootLight.renderers.PygameRenderer-module.html#BLEND_MIN +SmootLight.renderers.PygameRenderer.JOYBUTTONUP SmootLight.renderers.PygameRenderer-module.html#JOYBUTTONUP +SmootLight.renderers.PygameRenderer.K_DELETE SmootLight.renderers.PygameRenderer-module.html#K_DELETE +SmootLight.renderers.PygameRenderer.K_CARET SmootLight.renderers.PygameRenderer-module.html#K_CARET +SmootLight.renderers.PygameRenderer.USEREVENT SmootLight.renderers.PygameRenderer-module.html#USEREVENT +SmootLight.renderers.PygameRenderer.BLEND_RGBA_MULT SmootLight.renderers.PygameRenderer-module.html#BLEND_RGBA_MULT +SmootLight.renderers.PygameRenderer.LIL_ENDIAN SmootLight.renderers.PygameRenderer-module.html#LIL_ENDIAN +SmootLight.renderers.PygameRenderer.KMOD_SHIFT SmootLight.renderers.PygameRenderer-module.html#KMOD_SHIFT +SmootLight.renderers.PygameRenderer.KMOD_RSHIFT SmootLight.renderers.PygameRenderer-module.html#KMOD_RSHIFT +SmootLight.renderers.PygameRenderer.BIG_ENDIAN SmootLight.renderers.PygameRenderer-module.html#BIG_ENDIAN +SmootLight.renderers.PygameRenderer.K_v SmootLight.renderers.PygameRenderer-module.html#K_v +SmootLight.renderers.PygameRenderer.GL_MULTISAMPLEBUFFERS SmootLight.renderers.PygameRenderer-module.html#GL_MULTISAMPLEBUFFERS +SmootLight.renderers.PygameRenderer.HAT_RIGHTUP SmootLight.renderers.PygameRenderer-module.html#HAT_RIGHTUP +SmootLight.renderers.PygameRenderer.QUIT SmootLight.renderers.PygameRenderer-module.html#QUIT +SmootLight.renderers.PygameRenderer.K_LMETA SmootLight.renderers.PygameRenderer-module.html#K_LMETA +SmootLight.renderers.PygameRenderer.K_TAB SmootLight.renderers.PygameRenderer-module.html#K_TAB +SmootLight.renderers.PygameRenderer.K_EQUALS SmootLight.renderers.PygameRenderer-module.html#K_EQUALS +SmootLight.renderers.PygameRenderer.GL_ACCUM_BLUE_SIZE SmootLight.renderers.PygameRenderer-module.html#GL_ACCUM_BLUE_SIZE +SmootLight.renderers.PygameRenderer.K_MODE SmootLight.renderers.PygameRenderer-module.html#K_MODE +SmootLight.renderers.PygameRenderer.OPENGL SmootLight.renderers.PygameRenderer-module.html#OPENGL +SmootLight.renderers.PygameRenderer.K_RIGHTPAREN SmootLight.renderers.PygameRenderer-module.html#K_RIGHTPAREN +SmootLight.renderers.PygameRenderer.K_SLASH SmootLight.renderers.PygameRenderer-module.html#K_SLASH +SmootLight.renderers.PygameRenderer.GL_STENCIL_SIZE SmootLight.renderers.PygameRenderer-module.html#GL_STENCIL_SIZE +SmootLight.renderers.PygameRenderer.PREALLOC SmootLight.renderers.PygameRenderer-module.html#PREALLOC +SmootLight.renderers.PygameRenderer.K_F12 SmootLight.renderers.PygameRenderer-module.html#K_F12 +SmootLight.renderers.PygameRenderer.K_F13 SmootLight.renderers.PygameRenderer-module.html#K_F13 +SmootLight.renderers.PygameRenderer.K_F10 SmootLight.renderers.PygameRenderer-module.html#K_F10 +SmootLight.renderers.PygameRenderer.K_F11 SmootLight.renderers.PygameRenderer-module.html#K_F11 +SmootLight.renderers.PygameRenderer.K_F14 SmootLight.renderers.PygameRenderer-module.html#K_F14 +SmootLight.renderers.PygameRenderer.K_F15 SmootLight.renderers.PygameRenderer-module.html#K_F15 +SmootLight.renderers.PygameRenderer.K_y SmootLight.renderers.PygameRenderer-module.html#K_y +SmootLight.renderers.PygameRenderer.K_KP_EQUALS SmootLight.renderers.PygameRenderer-module.html#K_KP_EQUALS +SmootLight.renderers.PygameRenderer.K_l SmootLight.renderers.PygameRenderer-module.html#K_l +SmootLight.renderers.PygameRenderer.K_o SmootLight.renderers.PygameRenderer-module.html#K_o +SmootLight.renderers.PygameRenderer.YVYU_OVERLAY SmootLight.renderers.PygameRenderer-module.html#YVYU_OVERLAY +SmootLight.renderers.PygameRenderer.K_UP SmootLight.renderers.PygameRenderer-module.html#K_UP +SmootLight.renderers.PygameRenderer.K_p SmootLight.renderers.PygameRenderer-module.html#K_p +SmootLight.renderers.PygameRenderer.K_s SmootLight.renderers.PygameRenderer-module.html#K_s +SmootLight.renderers.PygameRenderer.KEYUP SmootLight.renderers.PygameRenderer-module.html#KEYUP +SmootLight.renderers.PygameRenderer.K_u SmootLight.renderers.PygameRenderer-module.html#K_u +SmootLight.renderers.PygameRenderer.AUDIO_S16MSB SmootLight.renderers.PygameRenderer-module.html#AUDIO_S16MSB +SmootLight.renderers.PygameRenderer.K_w SmootLight.renderers.PygameRenderer-module.html#K_w +SmootLight.renderers.PygameRenderer.KMOD_RCTRL SmootLight.renderers.PygameRenderer-module.html#KMOD_RCTRL +SmootLight.renderers.PygameRenderer.K_i SmootLight.renderers.PygameRenderer-module.html#K_i +SmootLight.renderers.PygameRenderer.K_h SmootLight.renderers.PygameRenderer-module.html#K_h +SmootLight.renderers.PygameRenderer.K_k SmootLight.renderers.PygameRenderer-module.html#K_k +SmootLight.renderers.PygameRenderer.GL_ACCUM_ALPHA_SIZE SmootLight.renderers.PygameRenderer-module.html#GL_ACCUM_ALPHA_SIZE +SmootLight.renderers.PygameRenderer.K_m SmootLight.renderers.PygameRenderer-module.html#K_m +SmootLight.renderers.PygameRenderer.K_LEFTBRACKET SmootLight.renderers.PygameRenderer-module.html#K_LEFTBRACKET +SmootLight.renderers.PygameRenderer.IYUV_OVERLAY SmootLight.renderers.PygameRenderer-module.html#IYUV_OVERLAY +SmootLight.renderers.PygameRenderer.K_RSUPER SmootLight.renderers.PygameRenderer-module.html#K_RSUPER +SmootLight.renderers.PygameRenderer.K_a SmootLight.renderers.PygameRenderer-module.html#K_a +SmootLight.renderers.PygameRenderer.ANYFORMAT SmootLight.renderers.PygameRenderer-module.html#ANYFORMAT +SmootLight.renderers.PygameRenderer.BLEND_RGB_SUB SmootLight.renderers.PygameRenderer-module.html#BLEND_RGB_SUB +SmootLight.renderers.PygameRenderer.K_e SmootLight.renderers.PygameRenderer-module.html#K_e +SmootLight.renderers.PygameRenderer.K_c SmootLight.renderers.PygameRenderer-module.html#K_c +SmootLight.renderers.PygameRenderer.K_g SmootLight.renderers.PygameRenderer-module.html#K_g +SmootLight.renderers.PygameRenderer.K_f SmootLight.renderers.PygameRenderer-module.html#K_f +SmootLight.renderers.PygameRenderer.BUTTON_X2 SmootLight.renderers.PygameRenderer-module.html#BUTTON_X2 +SmootLight.renderers.PygameRenderer.K_AT SmootLight.renderers.PygameRenderer-module.html#K_AT +SmootLight.renderers.PygameRenderer.BUTTON_X1 SmootLight.renderers.PygameRenderer-module.html#BUTTON_X1 +SmootLight.renderers.PygameRenderer.K_PAGEUP SmootLight.renderers.PygameRenderer-module.html#K_PAGEUP +SmootLight.renderers.PygameRenderer.K_CAPSLOCK SmootLight.renderers.PygameRenderer-module.html#K_CAPSLOCK +SmootLight.renderers.PygameRenderer.DOUBLEBUF SmootLight.renderers.PygameRenderer-module.html#DOUBLEBUF +SmootLight.renderers.PygameRenderer.K_PRINT SmootLight.renderers.PygameRenderer-module.html#K_PRINT +SmootLight.renderers.PygameRenderer.K_j SmootLight.renderers.PygameRenderer-module.html#K_j +SmootLight.renderers.PygameRenderer.KEYDOWN SmootLight.renderers.PygameRenderer-module.html#KEYDOWN +SmootLight.renderers.PygameRenderer.K_d SmootLight.renderers.PygameRenderer-module.html#K_d +SmootLight.renderers.PygameRenderer.AUDIO_U16SYS SmootLight.renderers.PygameRenderer-module.html#AUDIO_U16SYS +SmootLight.renderers.PygameRenderer.K_RETURN SmootLight.renderers.PygameRenderer-module.html#K_RETURN +SmootLight.renderers.PygameRenderer.K_SCROLLOCK SmootLight.renderers.PygameRenderer-module.html#K_SCROLLOCK +SmootLight.renderers.PygameRenderer.ACTIVEEVENT SmootLight.renderers.PygameRenderer-module.html#ACTIVEEVENT +SmootLight.renderers.PygameRenderer.SCRAP_BMP SmootLight.renderers.PygameRenderer-module.html#SCRAP_BMP +SmootLight.renderers.PygameRenderer.K_9 SmootLight.renderers.PygameRenderer-module.html#K_9 +SmootLight.renderers.PygameRenderer.K_8 SmootLight.renderers.PygameRenderer-module.html#K_8 +SmootLight.renderers.PygameRenderer.NUMEVENTS SmootLight.renderers.PygameRenderer-module.html#NUMEVENTS +SmootLight.renderers.PygameRenderer.HAT_UP SmootLight.renderers.PygameRenderer-module.html#HAT_UP +SmootLight.renderers.PygameRenderer.K_1 SmootLight.renderers.PygameRenderer-module.html#K_1 +SmootLight.renderers.PygameRenderer.K_0 SmootLight.renderers.PygameRenderer-module.html#K_0 +SmootLight.renderers.PygameRenderer.K_3 SmootLight.renderers.PygameRenderer-module.html#K_3 +SmootLight.renderers.PygameRenderer.AUDIO_U16MSB SmootLight.renderers.PygameRenderer-module.html#AUDIO_U16MSB +SmootLight.renderers.PygameRenderer.K_5 SmootLight.renderers.PygameRenderer-module.html#K_5 +SmootLight.renderers.PygameRenderer.K_4 SmootLight.renderers.PygameRenderer-module.html#K_4 +SmootLight.renderers.PygameRenderer.K_7 SmootLight.renderers.PygameRenderer-module.html#K_7 +SmootLight.renderers.PygameRenderer.K_6 SmootLight.renderers.PygameRenderer-module.html#K_6 +SmootLight.renderers.PygameRenderer.YUY2_OVERLAY SmootLight.renderers.PygameRenderer-module.html#YUY2_OVERLAY +SmootLight.renderers.PygameRenderer.K_PLUS SmootLight.renderers.PygameRenderer-module.html#K_PLUS +SmootLight.renderers.PygameRenderer.K_KP6 SmootLight.renderers.PygameRenderer-module.html#K_KP6 +SmootLight.renderers.PygameRenderer.K_b SmootLight.renderers.PygameRenderer-module.html#K_b +SmootLight.renderers.PygameRenderer.K_QUOTE SmootLight.renderers.PygameRenderer-module.html#K_QUOTE +SmootLight.renderers.PygameRenderer.K_RCTRL SmootLight.renderers.PygameRenderer-module.html#K_RCTRL +SmootLight.renderers.PygameRenderer.MOUSEBUTTONDOWN SmootLight.renderers.PygameRenderer-module.html#MOUSEBUTTONDOWN +SmootLight.renderers.PygameRenderer.K_LESS SmootLight.renderers.PygameRenderer-module.html#K_LESS +SmootLight.renderers.PygameRenderer.AUDIO_S16SYS SmootLight.renderers.PygameRenderer-module.html#AUDIO_S16SYS +SmootLight.renderers.PygameRenderer.OPENGLBLIT SmootLight.renderers.PygameRenderer-module.html#OPENGLBLIT +SmootLight.renderers.PygameRenderer.JOYBUTTONDOWN SmootLight.renderers.PygameRenderer-module.html#JOYBUTTONDOWN +SmootLight.renderers.PygameRenderer.K_KP8 SmootLight.renderers.PygameRenderer-module.html#K_KP8 +SmootLight.renderers.PygameRenderer.K_KP9 SmootLight.renderers.PygameRenderer-module.html#K_KP9 +SmootLight.renderers.PygameRenderer.K_KP4 SmootLight.renderers.PygameRenderer-module.html#K_KP4 +SmootLight.renderers.PygameRenderer.K_KP5 SmootLight.renderers.PygameRenderer-module.html#K_KP5 +SmootLight.renderers.PygameRenderer.K_BACKQUOTE SmootLight.renderers.PygameRenderer-module.html#K_BACKQUOTE +SmootLight.renderers.PygameRenderer.K_KP7 SmootLight.renderers.PygameRenderer-module.html#K_KP7 +SmootLight.renderers.PygameRenderer.K_KP0 SmootLight.renderers.PygameRenderer-module.html#K_KP0 +SmootLight.renderers.PygameRenderer.K_KP1 SmootLight.renderers.PygameRenderer-module.html#K_KP1 +SmootLight.renderers.PygameRenderer.K_KP2 SmootLight.renderers.PygameRenderer-module.html#K_KP2 +SmootLight.renderers.PygameRenderer.K_KP3 SmootLight.renderers.PygameRenderer-module.html#K_KP3 +SmootLight.tests SmootLight.tests-module.html +SmootLight.tests.__package__ SmootLight.tests-module.html#__package__ +SmootLight.tests.TestBQS' SmootLight.tests.TestBQS%27-module.html +SmootLight.tests.TestBQS'.main_log SmootLight.tests.TestBQS%27-module.html#main_log +SmootLight.tests.TestBQS'.__package__ SmootLight.tests.TestBQS%27-module.html#__package__ +SmootLight.tests.TestComponentRegistry' SmootLight.tests.TestComponentRegistry%27-module.html +SmootLight.tests.TestComponentRegistry'.__package__ SmootLight.tests.TestComponentRegistry%27-module.html#__package__ +SmootLight.tests.TestConfigLoaders' SmootLight.tests.TestConfigLoaders%27-module.html +SmootLight.tests.TestConfigLoaders'.__package__ SmootLight.tests.TestConfigLoaders%27-module.html#__package__ +SmootLight.tests.TestConfigLoaders'.VERSION SmootLight.tests.TestConfigLoaders%27-module.html#VERSION +SmootLight.tests.TestSwitchBehavior SmootLight.tests.TestSwitchBehavior-module.html +SmootLight.tests.TestSwitchBehavior.SwitchBehavior SmootLight.behaviors.SwitchBehavior.SwitchBehavior-class.html +SmootLight.tests.TestSwitchBehavior.EchoBehavior SmootLight.behaviors.EchoBehavior.EchoBehavior-class.html +SmootLight.tests.TestSwitchBehavior.__package__ SmootLight.tests.TestSwitchBehavior-module.html#__package__ +SmootLight.tests.TestSwitchBehavior.DebugBehavior SmootLight.behaviors.DebugBehavior.DebugBehavior-class.html +SmootLight.tests.testosc SmootLight.tests.testosc-module.html +SmootLight.tests.testosc.foo_baz_callback SmootLight.tests.testosc-module.html#foo_baz_callback +SmootLight.tests.testosc.server SmootLight.tests.testosc-module.html#server +SmootLight.tests.testosc.foo_bar_callback SmootLight.tests.testosc-module.html#foo_bar_callback +SmootLight.tests.testosc.fallback SmootLight.tests.testosc-module.html#fallback +SmootLight.util SmootLight.util-module.html +SmootLight.util.__package__ SmootLight.util-module.html#__package__ +SmootLight.util.BehaviorQuerySystem SmootLight.util.BehaviorQuerySystem-module.html +SmootLight.util.BehaviorQuerySystem.getBehaviorsNear SmootLight.util.BehaviorQuerySystem-module.html#getBehaviorsNear +SmootLight.util.BehaviorQuerySystem.initBQS SmootLight.util.BehaviorQuerySystem-module.html#initBQS +SmootLight.util.BehaviorQuerySystem.getDistLambda SmootLight.util.BehaviorQuerySystem-module.html#getDistLambda +SmootLight.util.BehaviorQuerySystem.behaviorList SmootLight.util.BehaviorQuerySystem-module.html#behaviorList +SmootLight.util.BehaviorQuerySystem.__package__ SmootLight.util.BehaviorQuerySystem-module.html#__package__ +SmootLight.util.BehaviorQuerySystem.query SmootLight.util.BehaviorQuerySystem-module.html#query +SmootLight.util.BehaviorQuerySystem.initialized SmootLight.util.BehaviorQuerySystem-module.html#initialized +SmootLight.util.BehaviorQuerySystem.addBehavior SmootLight.util.BehaviorQuerySystem-module.html#addBehavior +SmootLight.util.ColorOps SmootLight.util.ColorOps-module.html +SmootLight.util.ColorOps.chooseRandomColor SmootLight.util.ColorOps-module.html#chooseRandomColor +SmootLight.util.ColorOps.safeColor SmootLight.util.ColorOps-module.html#safeColor +SmootLight.util.ColorOps.combineColors SmootLight.util.ColorOps-module.html#combineColors +SmootLight.util.ColorOps.__package__ SmootLight.util.ColorOps-module.html#__package__ +SmootLight.util.ColorOps.multiplyColor SmootLight.util.ColorOps-module.html#multiplyColor +SmootLight.util.ColorOps.floatToIntColor SmootLight.util.ColorOps-module.html#floatToIntColor +SmootLight.util.ColorOps.Stopwatch SmootLight.util.TimeOps.Stopwatch-class.html +SmootLight.util.ColorOps.randomColor SmootLight.util.ColorOps-module.html#randomColor +SmootLight.util.ColorOps.randomBrightColor SmootLight.util.ColorOps-module.html#randomBrightColor +SmootLight.util.ComponentRegistry SmootLight.util.ComponentRegistry-module.html +SmootLight.util.ComponentRegistry.getLock SmootLight.util.ComponentRegistry-module.html#getLock +SmootLight.util.ComponentRegistry.makelock SmootLight.util.ComponentRegistry-module.html#makelock +SmootLight.util.ComponentRegistry.initRegistry SmootLight.util.ComponentRegistry-module.html#initRegistry +SmootLight.util.ComponentRegistry.clearRegistry SmootLight.util.ComponentRegistry-module.html#clearRegistry +SmootLight.util.ComponentRegistry.removeComponent SmootLight.util.ComponentRegistry-module.html#removeComponent +SmootLight.util.ComponentRegistry.verifyUniqueId SmootLight.util.ComponentRegistry-module.html#verifyUniqueId +SmootLight.util.ComponentRegistry.getNewId SmootLight.util.ComponentRegistry-module.html#getNewId +SmootLight.util.ComponentRegistry.registerComponent SmootLight.util.ComponentRegistry-module.html#registerComponent +SmootLight.util.ComponentRegistry.utilLock SmootLight.util.ComponentRegistry-module.html#utilLock +SmootLight.util.ComponentRegistry.__package__ SmootLight.util.ComponentRegistry-module.html#__package__ +SmootLight.util.ComponentRegistry.Registry SmootLight.util.ComponentRegistry-module.html#Registry +SmootLight.util.ComponentRegistry.getComponent SmootLight.util.ComponentRegistry-module.html#getComponent +SmootLight.util.Config SmootLight.util.Config-module.html +SmootLight.util.Config.attemptEval SmootLight.util.Config-module.html#attemptEval +SmootLight.util.Config.classArgsMem SmootLight.util.Config-module.html#classArgsMem +SmootLight.util.Config.compositeXMLTrees SmootLight.util.Config-module.html#compositeXMLTrees +SmootLight.util.Config.resolveInheritance SmootLight.util.Config-module.html#resolveInheritance +SmootLight.util.Config.pullArgsFromItem SmootLight.util.Config-module.html#pullArgsFromItem +SmootLight.util.Config.loadConfigFile SmootLight.util.Config-module.html#loadConfigFile +SmootLight.util.Config.getElement SmootLight.util.Config-module.html#getElement +SmootLight.util.Config.CONFIG_PATH SmootLight.util.Config-module.html#CONFIG_PATH +SmootLight.util.Config.resolveDocumentInheritances SmootLight.util.Config-module.html#resolveDocumentInheritances +SmootLight.util.Config.__package__ SmootLight.util.Config-module.html#__package__ +SmootLight.util.Config.fileToDict SmootLight.util.Config-module.html#fileToDict +SmootLight.util.Config.generateArgDict SmootLight.util.Config-module.html#generateArgDict +SmootLight.util.Config.DEFAULT_OVERRIDE_MODE SmootLight.util.Config-module.html#DEFAULT_OVERRIDE_MODE +SmootLight.util.Config.findElementsByTag SmootLight.util.Config-module.html#findElementsByTag +SmootLight.util.Config.loadParamRequirementDict SmootLight.util.Config-module.html#loadParamRequirementDict +SmootLight.util.Geo SmootLight.util.Geo-module.html +SmootLight.util.Geo.randomLoc SmootLight.util.Geo-module.html#randomLoc +SmootLight.util.Geo.pointWithinBoundingBox SmootLight.util.Geo-module.html#pointWithinBoundingBox +SmootLight.util.Geo.dist SmootLight.util.Geo-module.html#dist +SmootLight.util.Geo.windtrail SmootLight.util.Geo-module.html#windtrail +SmootLight.util.Geo.addLocations SmootLight.util.Geo-module.html#addLocations +SmootLight.util.Geo.gaussian SmootLight.util.Geo-module.html#gaussian +SmootLight.util.Geo.__package__ SmootLight.util.Geo-module.html#__package__ +SmootLight.util.Geo.approxexp SmootLight.util.Geo-module.html#approxexp +SmootLight.util.NetworkOps SmootLight.util.NetworkOps-module.html +SmootLight.util.NetworkOps.__package__ SmootLight.util.NetworkOps-module.html#__package__ +SmootLight.util.NetworkOps.getConnectedSocket SmootLight.util.NetworkOps-module.html#getConnectedSocket +SmootLight.util.NetworkOps.getBroadcastSocket SmootLight.util.NetworkOps-module.html#getBroadcastSocket +SmootLight.util.PacketComposition SmootLight.util.PacketComposition-module.html +SmootLight.util.PacketComposition.portOutPayload SmootLight.util.PacketComposition-module.html#portOutPayload +SmootLight.util.PacketComposition.composePixelStripData SmootLight.util.PacketComposition-module.html#composePixelStripData +SmootLight.util.PacketComposition.MAGIC SmootLight.util.PacketComposition-module.html#MAGIC +SmootLight.util.PacketComposition.packheader SmootLight.util.PacketComposition-module.html#packheader +SmootLight.util.PacketComposition.cachePacketHeader SmootLight.util.PacketComposition-module.html#cachePacketHeader +SmootLight.util.PacketComposition.composePixelStripPacket SmootLight.util.PacketComposition-module.html#composePixelStripPacket +SmootLight.util.PacketComposition.cache SmootLight.util.PacketComposition-module.html#cache +SmootLight.util.PacketComposition.portOut SmootLight.util.PacketComposition-module.html#portOut +SmootLight.util.PacketComposition.__package__ SmootLight.util.PacketComposition-module.html#__package__ +SmootLight.util.PacketComposition.argDict SmootLight.util.PacketComposition-module.html#argDict +SmootLight.util.PacketComposition.VERSION SmootLight.util.PacketComposition-module.html#VERSION +SmootLight.util.PacketComposition.composeSynchPacket SmootLight.util.PacketComposition-module.html#composeSynchPacket +SmootLight.util.PacketComposition.PORTOUT SmootLight.util.PacketComposition-module.html#PORTOUT +SmootLight.util.PacketComposition.UNI SmootLight.util.PacketComposition-module.html#UNI +SmootLight.util.PacketComposition.memoize SmootLight.util.PacketComposition-module.html#memoize +SmootLight.util.PacketComposition.portOutPacket SmootLight.util.PacketComposition-module.html#portOutPacket +SmootLight.util.Search SmootLight.util.Search-module.html +SmootLight.util.Search.parental_tree_search SmootLight.util.Search-module.html#parental_tree_search +SmootLight.util.Search.__package__ SmootLight.util.Search-module.html#__package__ +SmootLight.util.Search.find_le SmootLight.util.Search-module.html#find_le +SmootLight.util.Search.find_ge SmootLight.util.Search-module.html#find_ge +SmootLight.util.Strings SmootLight.util.Strings-module.html +SmootLight.util.Strings.DEFAULT_MAPPER SmootLight.util.Strings-module.html#DEFAULT_MAPPER +SmootLight.util.Strings.OVERRIDE_BEHAVIOR SmootLight.util.Strings-module.html#OVERRIDE_BEHAVIOR +SmootLight.util.Strings.LOCATION SmootLight.util.Strings-module.html#LOCATION +SmootLight.util.Strings.__package__ SmootLight.util.Strings-module.html#__package__ +SmootLight.util.TimeOps SmootLight.util.TimeOps-module.html +SmootLight.util.TimeOps.time SmootLight.util.TimeOps-module.html#time +SmootLight.util.TimeOps.__package__ SmootLight.util.TimeOps-module.html#__package__ +SmootLight.LightInstallation.LightInstallation SmootLight.LightInstallation.LightInstallation-class.html +SmootLight.LightInstallation.LightInstallation.initializeScreen SmootLight.LightInstallation.LightInstallation-class.html#initializeScreen +SmootLight.LightInstallation.LightInstallation.initializeInputs SmootLight.LightInstallation.LightInstallation-class.html#initializeInputs +SmootLight.LightInstallation.LightInstallation.registerAllComponents SmootLight.LightInstallation.LightInstallation-class.html#registerAllComponents +SmootLight.LightInstallation.LightInstallation.__init__ SmootLight.LightInstallation.LightInstallation-class.html#__init__ +SmootLight.LightInstallation.LightInstallation.initializeComponent SmootLight.LightInstallation.LightInstallation-class.html#initializeComponent +SmootLight.LightInstallation.LightInstallation.mainLoop SmootLight.LightInstallation.LightInstallation-class.html#mainLoop +SmootLight.LightInstallation.LightInstallation.evaluateBehaviors SmootLight.LightInstallation.LightInstallation-class.html#evaluateBehaviors +SmootLight.LightInstallation.LightInstallation.addBehavior SmootLight.LightInstallation.LightInstallation-class.html#addBehavior +SmootLight.LightInstallation.LightInstallation.processResponse SmootLight.LightInstallation.LightInstallation-class.html#processResponse +SmootLight.LightInstallation.LightInstallation.alive SmootLight.LightInstallation.LightInstallation-class.html#alive +SmootLight.LightInstallation.LightInstallation.configureInstallation SmootLight.LightInstallation.LightInstallation-class.html#configureInstallation +SmootLight.LightInstallation.LightInstallation.initializeBehaviors SmootLight.LightInstallation.LightInstallation-class.html#initializeBehaviors +SmootLight.LightInstallation.LightInstallation.handleDie SmootLight.LightInstallation.LightInstallation-class.html#handleDie +SmootLight.LightInstallation.LightInstallation.addPixelStrip SmootLight.LightInstallation.LightInstallation-class.html#addPixelStrip +SmootLight.LightInstallation.LightInstallation.initializeMapper SmootLight.LightInstallation.LightInstallation-class.html#initializeMapper +SmootLight.LightInstallation.LightInstallation.registerComponents SmootLight.LightInstallation.LightInstallation-class.html#registerComponents +SmootLight.LightInstallation.LightInstallation.initializeRenderers SmootLight.LightInstallation.LightInstallation-class.html#initializeRenderers +SmootLight.behaviors.AddPixelEvent.AddPixelEvent SmootLight.behaviors.AddPixelEvent.AddPixelEvent-class.html +SmootLight.behaviors.AddPixelEvent.AddPixelEvent.processResponse SmootLight.behaviors.AddPixelEvent.AddPixelEvent-class.html#processResponse +SmootLight.behaviors.AddPixelEvent.AddPixelEvent.behaviorInit SmootLight.behaviors.AddPixelEvent.AddPixelEvent-class.html#behaviorInit +SmootLight.behaviors.AllPixels.AllPixels SmootLight.behaviors.AllPixels.AllPixels-class.html +SmootLight.behaviors.AllPixels.AllPixels.processResponse SmootLight.behaviors.AllPixels.AllPixels-class.html#processResponse +SmootLight.behaviors.AllPixelsLeft.AllPixelsLeft SmootLight.behaviors.AllPixelsLeft.AllPixelsLeft-class.html +SmootLight.behaviors.AllPixelsLeft.AllPixelsLeft.processResponse SmootLight.behaviors.AllPixelsLeft.AllPixelsLeft-class.html#processResponse +SmootLight.behaviors.BehaviorChain.BehaviorChain SmootLight.behaviors.BehaviorChain.BehaviorChain-class.html +SmootLight.behaviors.BehaviorChain.BehaviorChain.appendBehavior SmootLight.behaviors.BehaviorChain.BehaviorChain-class.html#appendBehavior +SmootLight.behaviors.BehaviorChain.BehaviorChain.processResponse SmootLight.behaviors.BehaviorChain.BehaviorChain-class.html#processResponse +SmootLight.behaviors.BehaviorChain.BehaviorChain.behaviorInit SmootLight.behaviors.BehaviorChain.BehaviorChain-class.html#behaviorInit +SmootLight.behaviors.Circle.Circle SmootLight.behaviors.Circle.Circle-class.html +SmootLight.behaviors.Circle.Circle.setLastOutput SmootLight.behaviors.Circle.Circle-class.html#setLastOutput +SmootLight.behaviors.Circle.Circle.processResponse SmootLight.behaviors.Circle.Circle-class.html#processResponse +SmootLight.behaviors.ColorChangerBehavior.ColorChangerBehavior SmootLight.behaviors.ColorChangerBehavior.ColorChangerBehavior-class.html +SmootLight.behaviors.ColorChangerBehavior.ColorChangerBehavior.processResponse SmootLight.behaviors.ColorChangerBehavior.ColorChangerBehavior-class.html#processResponse +SmootLight.behaviors.ColorShift.ColorShift SmootLight.behaviors.ColorShift.ColorShift-class.html +SmootLight.behaviors.ColorShift.ColorShift.processResponse SmootLight.behaviors.ColorShift.ColorShift-class.html#processResponse +SmootLight.behaviors.ControllerOSC.ControllerOSC SmootLight.behaviors.ControllerOSC.ControllerOSC-class.html +SmootLight.behaviors.ControllerOSC.ControllerOSC.processResponse SmootLight.behaviors.ControllerOSC.ControllerOSC-class.html#processResponse +SmootLight.behaviors.ControllerOSC.ControllerOSC.behaviorInit SmootLight.behaviors.ControllerOSC.ControllerOSC-class.html#behaviorInit +SmootLight.behaviors.DebugBehavior.DebugBehavior SmootLight.behaviors.DebugBehavior.DebugBehavior-class.html +SmootLight.behaviors.DebugBehavior.DebugBehavior.processResponse SmootLight.behaviors.DebugBehavior.DebugBehavior-class.html#processResponse +SmootLight.behaviors.DecayBehavior.DecayBehavior SmootLight.behaviors.DecayBehavior.DecayBehavior-class.html +SmootLight.behaviors.DecayBehavior.DecayBehavior.processResponse SmootLight.behaviors.DecayBehavior.DecayBehavior-class.html#processResponse +SmootLight.behaviors.EchoBehavior.EchoBehavior SmootLight.behaviors.EchoBehavior.EchoBehavior-class.html +SmootLight.behaviors.EchoBehavior.EchoBehavior.processResponse SmootLight.behaviors.EchoBehavior.EchoBehavior-class.html#processResponse +SmootLight.behaviors.Expand.Expand SmootLight.behaviors.Expand.Expand-class.html +SmootLight.behaviors.Expand.Expand.processResponse SmootLight.behaviors.Expand.Expand-class.html#processResponse +SmootLight.behaviors.ExpandingColorZones.ExpandingColorZones SmootLight.behaviors.ExpandingColorZones.ExpandingColorZones-class.html +SmootLight.behaviors.ExpandingColorZones.ExpandingColorZones.processResponse SmootLight.behaviors.ExpandingColorZones.ExpandingColorZones-class.html#processResponse +SmootLight.behaviors.ExpandingColorZones.ExpandingColorZones.behaviorInit SmootLight.behaviors.ExpandingColorZones.ExpandingColorZones-class.html#behaviorInit +SmootLight.behaviors.Flasher.Flasher SmootLight.behaviors.Flasher.Flasher-class.html +SmootLight.behaviors.Flasher.Flasher.processResponse SmootLight.behaviors.Flasher.Flasher-class.html#processResponse +SmootLight.behaviors.MITDoors.MITDoors SmootLight.behaviors.MITDoors.MITDoors-class.html +SmootLight.behaviors.MITDoors.MITDoors.processResponse SmootLight.behaviors.MITDoors.MITDoors-class.html#processResponse +SmootLight.behaviors.MITDoors.MITDoors.behaviorInit SmootLight.behaviors.MITDoors.MITDoors-class.html#behaviorInit +SmootLight.behaviors.MobileShakeBehavior.MobileShakeBehavior SmootLight.behaviors.MobileShakeBehavior.MobileShakeBehavior-class.html +SmootLight.behaviors.MobileShakeBehavior.MobileShakeBehavior.processResponse SmootLight.behaviors.MobileShakeBehavior.MobileShakeBehavior-class.html#processResponse +SmootLight.behaviors.MobileShakeBehavior.MobileShakeBehavior.behaviorInit SmootLight.behaviors.MobileShakeBehavior.MobileShakeBehavior-class.html#behaviorInit +SmootLight.behaviors.ModifyParam.ModifyParam SmootLight.behaviors.ModifyParam.ModifyParam-class.html +SmootLight.behaviors.ModifyParam.ModifyParam.processResponse SmootLight.behaviors.ModifyParam.ModifyParam-class.html#processResponse +SmootLight.behaviors.ModulateColor.ColorShift SmootLight.behaviors.ModulateColor.ColorShift-class.html +SmootLight.behaviors.ModulateColor.ColorShift.processResponse SmootLight.behaviors.ModulateColor.ColorShift-class.html#processResponse +SmootLight.behaviors.MoveBehavior.MoveBehavior SmootLight.behaviors.MoveBehavior.MoveBehavior-class.html +SmootLight.behaviors.MoveBehavior.MoveBehavior.processResponse SmootLight.behaviors.MoveBehavior.MoveBehavior-class.html#processResponse +SmootLight.behaviors.MrmrSetColor.MrmrSetColor SmootLight.behaviors.MrmrSetColor.MrmrSetColor-class.html +SmootLight.behaviors.MrmrSetColor.MrmrSetColor.processResponse SmootLight.behaviors.MrmrSetColor.MrmrSetColor-class.html#processResponse +SmootLight.behaviors.MrmrSetColor.MrmrSetColor.behaviorInit SmootLight.behaviors.MrmrSetColor.MrmrSetColor-class.html#behaviorInit +SmootLight.behaviors.Oval.Oval SmootLight.behaviors.Oval.Oval-class.html +SmootLight.behaviors.Oval.Oval.setLastOutput SmootLight.behaviors.Oval.Oval-class.html#setLastOutput +SmootLight.behaviors.Oval.Oval.processResponse SmootLight.behaviors.Oval.Oval-class.html#processResponse +SmootLight.behaviors.RandomSetBrightColorBehavior.RandomSetBrightColorBehavior SmootLight.behaviors.RandomSetBrightColorBehavior.RandomSetBrightColorBehavior-class.html +SmootLight.behaviors.RandomSetBrightColorBehavior.RandomSetBrightColorBehavior.processResponse SmootLight.behaviors.RandomSetBrightColorBehavior.RandomSetBrightColorBehavior-class.html#processResponse +SmootLight.behaviors.RandomWalk.RandomWalk SmootLight.behaviors.RandomWalk.RandomWalk-class.html +SmootLight.behaviors.RandomWalk.RandomWalk.processResponse SmootLight.behaviors.RandomWalk.RandomWalk-class.html#processResponse +SmootLight.behaviors.RecursiveDecay.RecursiveDecay SmootLight.behaviors.RecursiveDecay.RecursiveDecay-class.html +SmootLight.behaviors.RecursiveDecay.RecursiveDecay.processResponse SmootLight.behaviors.RecursiveDecay.RecursiveDecay-class.html#processResponse +SmootLight.behaviors.ResponseMover.ResponseMover SmootLight.behaviors.ResponseMover.ResponseMover-class.html +SmootLight.behaviors.ResponseMover.ResponseMover.processResponse SmootLight.behaviors.ResponseMover.ResponseMover-class.html#processResponse +SmootLight.behaviors.RestrictLocation.RestrictLocation SmootLight.behaviors.RestrictLocation.RestrictLocation-class.html +SmootLight.behaviors.RestrictLocation.RestrictLocation.processResponse SmootLight.behaviors.RestrictLocation.RestrictLocation-class.html#processResponse +SmootLight.behaviors.RestrictLocation.RestrictLocation.behaviorInit SmootLight.behaviors.RestrictLocation.RestrictLocation-class.html#behaviorInit +SmootLight.behaviors.RiseFall.RiseFall SmootLight.behaviors.RiseFall.RiseFall-class.html +SmootLight.behaviors.RiseFall.RiseFall.processResponse SmootLight.behaviors.RiseFall.RiseFall-class.html#processResponse +SmootLight.behaviors.RunningBehavior.RunningBehavior SmootLight.behaviors.RunningBehavior.RunningBehavior-class.html +SmootLight.behaviors.RunningBehavior.RunningBehavior.processResponse SmootLight.behaviors.RunningBehavior.RunningBehavior-class.html#processResponse +SmootLight.behaviors.Sink.Sink SmootLight.behaviors.Sink.Sink-class.html +SmootLight.behaviors.Sink.Sink.processResponse SmootLight.behaviors.Sink.Sink-class.html#processResponse +SmootLight.behaviors.SmootWind.SmootWind SmootLight.behaviors.SmootWind.SmootWind-class.html +SmootLight.behaviors.SmootWind.SmootWind.processResponse SmootLight.behaviors.SmootWind.SmootWind-class.html#processResponse +SmootLight.behaviors.SmootWind.SmootWind.behaviorInit SmootLight.behaviors.SmootWind.SmootWind-class.html#behaviorInit +SmootLight.behaviors.Square.Square SmootLight.behaviors.Square.Square-class.html +SmootLight.behaviors.Square.Square.setLastOutput SmootLight.behaviors.Square.Square-class.html#setLastOutput +SmootLight.behaviors.Square.Square.processResponse SmootLight.behaviors.Square.Square-class.html#processResponse +SmootLight.behaviors.SwitchBehavior.SwitchBehavior SmootLight.behaviors.SwitchBehavior.SwitchBehavior-class.html +SmootLight.behaviors.SwitchBehavior.SwitchBehavior.processResponse SmootLight.behaviors.SwitchBehavior.SwitchBehavior-class.html#processResponse +SmootLight.behaviors.SwitchBehavior.SwitchBehavior.setBehavior SmootLight.behaviors.SwitchBehavior.SwitchBehavior-class.html#setBehavior +SmootLight.behaviors.SwitchBehavior.SwitchBehavior.behaviorInit SmootLight.behaviors.SwitchBehavior.SwitchBehavior-class.html#behaviorInit +SmootLight.behaviors.SynchTest.SynchTest SmootLight.behaviors.SynchTest.SynchTest-class.html +SmootLight.behaviors.SynchTest.SynchTest.processResponse SmootLight.behaviors.SynchTest.SynchTest-class.html#processResponse +SmootLight.behaviors.SynchTest.SynchTest.behaviorInit SmootLight.behaviors.SynchTest.SynchTest-class.html#behaviorInit +SmootLight.behaviors.TimeSwitch.TimeSwitch SmootLight.behaviors.TimeSwitch.TimeSwitch-class.html +SmootLight.behaviors.TimeSwitch.TimeSwitch.processResponse SmootLight.behaviors.TimeSwitch.TimeSwitch-class.html#processResponse +SmootLight.behaviors.TimeSwitch.TimeSwitch.behaviorInit SmootLight.behaviors.TimeSwitch.TimeSwitch-class.html#behaviorInit +SmootLight.behaviors.TimedDie.Timeout SmootLight.behaviors.TimedDie.Timeout-class.html +SmootLight.behaviors.TimedDie.Timeout.processResponse SmootLight.behaviors.TimedDie.Timeout-class.html#processResponse +SmootLight.behaviors.Timeout.Timeout SmootLight.behaviors.Timeout.Timeout-class.html +SmootLight.behaviors.Timeout.Timeout.processResponse SmootLight.behaviors.Timeout.Timeout-class.html#processResponse +SmootLight.behaviors.TouchOSC.TouchOSC SmootLight.behaviors.TouchOSC.TouchOSC-class.html +SmootLight.behaviors.TouchOSC.TouchOSC.processResponse SmootLight.behaviors.TouchOSC.TouchOSC-class.html#processResponse +SmootLight.behaviors.TouchOSC.TouchOSC.behaviorInit SmootLight.behaviors.TouchOSC.TouchOSC-class.html#behaviorInit +SmootLight.behaviors.VerticalBar.VerticalBar SmootLight.behaviors.VerticalBar.VerticalBar-class.html +SmootLight.behaviors.VerticalBar.VerticalBar.processResponse SmootLight.behaviors.VerticalBar.VerticalBar-class.html#processResponse +SmootLight.behaviors.XYMove.XYMove SmootLight.behaviors.XYMove.XYMove-class.html +SmootLight.behaviors.XYMove.XYMove.insertStepIfMissing SmootLight.behaviors.XYMove.XYMove-class.html#insertStepIfMissing +SmootLight.behaviors.XYMove.XYMove.processResponse SmootLight.behaviors.XYMove.XYMove-class.html#processResponse +SmootLight.inputs.ContinuousCenterInput.ContinuousCenterInput SmootLight.inputs.ContinuousCenterInput.ContinuousCenterInput-class.html +SmootLight.inputs.ContinuousCenterInput.ContinuousCenterInput.sensingLoop SmootLight.inputs.ContinuousCenterInput.ContinuousCenterInput-class.html#sensingLoop +SmootLight.inputs.ContinuousCenterInput.ContinuousCenterInput.inputInit SmootLight.inputs.ContinuousCenterInput.ContinuousCenterInput-class.html#inputInit +SmootLight.inputs.ContinuousLocationInput.ContinuousLocationInput SmootLight.inputs.ContinuousLocationInput.ContinuousLocationInput-class.html +SmootLight.inputs.ContinuousLocationInput.ContinuousLocationInput.sensingLoop SmootLight.inputs.ContinuousLocationInput.ContinuousLocationInput-class.html#sensingLoop +SmootLight.inputs.ContinuousLocationInput.ContinuousLocationInput.inputInit SmootLight.inputs.ContinuousLocationInput.ContinuousLocationInput-class.html#inputInit +SmootLight.inputs.HTMLInput.HTMLInput SmootLight.inputs.HTMLInput.HTMLInput-class.html +SmootLight.inputs.HTMLInput.HTMLInput.sensingLoop SmootLight.inputs.HTMLInput.HTMLInput-class.html#sensingLoop +SmootLight.inputs.HTMLInput.HTMLInput.getHTML SmootLight.inputs.HTMLInput.HTMLInput-class.html#getHTML +SmootLight.inputs.HTMLInput.HTMLInput.inputInit SmootLight.inputs.HTMLInput.HTMLInput-class.html#inputInit +SmootLight.inputs.OSCInput.OSCInput SmootLight.inputs.OSCInput.OSCInput-class.html +SmootLight.inputs.OSCInput.OSCInput.sensingLoop SmootLight.inputs.OSCInput.OSCInput-class.html#sensingLoop +SmootLight.inputs.OSCInput.OSCInput.inputInit SmootLight.inputs.OSCInput.OSCInput-class.html#inputInit +SmootLight.inputs.OSCInput.OSCInput.fallback SmootLight.inputs.OSCInput.OSCInput-class.html#fallback +SmootLight.inputs.PygameInput.PygameInput SmootLight.inputs.PygameInput.PygameInput-class.html +SmootLight.inputs.PygameInput.PygameInput.sensingLoop SmootLight.inputs.PygameInput.PygameInput-class.html#sensingLoop +SmootLight.inputs.RandomLocs.RandomLocs SmootLight.inputs.RandomLocs.RandomLocs-class.html +SmootLight.inputs.RandomLocs.RandomLocs.sensingLoop SmootLight.inputs.RandomLocs.RandomLocs-class.html#sensingLoop +SmootLight.inputs.RandomLocs.RandomLocs.inputInit SmootLight.inputs.RandomLocs.RandomLocs-class.html#inputInit +SmootLight.inputs.TCPInput.TCPInput SmootLight.inputs.TCPInput.TCPInput-class.html +SmootLight.inputs.TCPInput.TCPInput.sensingLoop SmootLight.inputs.TCPInput.TCPInput-class.html#sensingLoop +SmootLight.inputs.TCPInput.TCPInput.inputInit SmootLight.inputs.TCPInput.TCPInput-class.html#inputInit +SmootLight.inputs.TCPInput_backup.TCPInput SmootLight.inputs.TCPInput_backup.TCPInput-class.html +SmootLight.inputs.TCPInput_backup.TCPInput.InputTCPHandler SmootLight.inputs.TCPInput_backup.TCPInput.InputTCPHandler-class.html +SmootLight.inputs.TCPInput_backup.TCPInput.inputInit SmootLight.inputs.TCPInput_backup.TCPInput-class.html#inputInit +SmootLight.inputs.TCPInput_backup.TCPInput.sensingLoop SmootLight.inputs.TCPInput_backup.TCPInput-class.html#sensingLoop +SmootLight.inputs.TCPInput_backup.TCPInput.doShutDown SmootLight.inputs.TCPInput_backup.TCPInput-class.html#doShutDown +SmootLight.inputs.TCPInput_backup.TCPInput.InputTCPHandler SmootLight.inputs.TCPInput_backup.TCPInput.InputTCPHandler-class.html +SmootLight.inputs.TCPInput_backup.TCPInput.InputTCPHandler.handle SmootLight.inputs.TCPInput_backup.TCPInput.InputTCPHandler-class.html#handle +SmootLight.inputs.UDPInput.UDPInput SmootLight.inputs.UDPInput.UDPInput-class.html +SmootLight.inputs.UDPInput.UDPInput.sensingLoop SmootLight.inputs.UDPInput.UDPInput-class.html#sensingLoop +SmootLight.inputs.UDPInput.UDPInput.inputInit SmootLight.inputs.UDPInput.UDPInput-class.html#inputInit +SmootLight.layouts.LineLayout.LineLayout SmootLight.layouts.LineLayout.LineLayout-class.html +SmootLight.layouts.LineLayout.LineLayout.layoutFunc SmootLight.layouts.LineLayout.LineLayout-class.html#layoutFunc +SmootLight.layouts.SpecifiedLayout.SpecifiedLayout SmootLight.layouts.SpecifiedLayout.SpecifiedLayout-class.html +SmootLight.layouts.SpecifiedLayout.SpecifiedLayout.layoutFunc SmootLight.layouts.SpecifiedLayout.SpecifiedLayout-class.html#layoutFunc +SmootLight.layouts.SpecifiedLayout.SpecifiedLayout.initLayout SmootLight.layouts.SpecifiedLayout.SpecifiedLayout-class.html#initLayout +SmootLight.layouts.ZigzagLayout.ZigzagLayout SmootLight.layouts.ZigzagLayout.ZigzagLayout-class.html +SmootLight.layouts.ZigzagLayout.ZigzagLayout.layoutFunc SmootLight.layouts.ZigzagLayout.ZigzagLayout-class.html#layoutFunc +SmootLight.layouts.ZigzagLayout.ZigzagLayout.initLayout SmootLight.layouts.ZigzagLayout.ZigzagLayout-class.html#initLayout +SmootLight.logger.UTF8LogFormatter.UTF8LogFormatter SmootLight.logger.UTF8LogFormatter.UTF8LogFormatter-class.html +SmootLight.logger.UTF8LogFormatter.UTF8LogFormatter.format SmootLight.logger.UTF8LogFormatter.UTF8LogFormatter-class.html#format +SmootLight.operationscore.Behavior.Behavior SmootLight.operationscore.Behavior.Behavior-class.html +SmootLight.operationscore.Behavior.Behavior.immediateProcessInput SmootLight.operationscore.Behavior.Behavior-class.html#immediateProcessInput +SmootLight.operationscore.Behavior.Behavior.setLastOutput SmootLight.operationscore.Behavior.Behavior-class.html#setLastOutput +SmootLight.operationscore.Behavior.Behavior.getLastOutput SmootLight.operationscore.Behavior.Behavior-class.html#getLastOutput +SmootLight.operationscore.Behavior.Behavior.addMapperToResponse SmootLight.operationscore.Behavior.Behavior-class.html#addMapperToResponse +SmootLight.operationscore.Behavior.Behavior.init SmootLight.operationscore.Behavior.Behavior-class.html#init +SmootLight.operationscore.Behavior.Behavior.addInputs SmootLight.operationscore.Behavior.Behavior-class.html#addInputs +SmootLight.operationscore.Behavior.Behavior.processResponse SmootLight.operationscore.Behavior.Behavior-class.html#processResponse +SmootLight.operationscore.Behavior.Behavior.deepCopyPacket SmootLight.operationscore.Behavior.Behavior-class.html#deepCopyPacket +SmootLight.operationscore.Behavior.Behavior.behaviorInit SmootLight.operationscore.Behavior.Behavior-class.html#behaviorInit +SmootLight.operationscore.Behavior.Behavior.timeStep SmootLight.operationscore.Behavior.Behavior-class.html#timeStep +SmootLight.operationscore.Behavior.Behavior.addInput SmootLight.operationscore.Behavior.Behavior-class.html#addInput +SmootLight.operationscore.Behavior.Behavior.addMapper SmootLight.operationscore.Behavior.Behavior-class.html#addMapper +SmootLight.operationscore.Input.Input SmootLight.operationscore.Input.Input-class.html +SmootLight.operationscore.Input.Input.respond SmootLight.operationscore.Input.Input-class.html#respond +SmootLight.operationscore.Input.Input.sensingLoop SmootLight.operationscore.Input.Input-class.html#sensingLoop +SmootLight.operationscore.Input.Input.inputInit SmootLight.operationscore.Input.Input-class.html#inputInit +SmootLight.operationscore.Input.Input.parentAlive SmootLight.operationscore.Input.Input-class.html#parentAlive +SmootLight.operationscore.Input.Input.init SmootLight.operationscore.Input.Input-class.html#init +SmootLight.operationscore.Input.Input.run SmootLight.operationscore.Input.Input-class.html#run +SmootLight.operationscore.PixelAssembler.PixelAssembler SmootLight.operationscore.PixelAssembler.PixelAssembler-class.html +SmootLight.operationscore.PixelAssembler.PixelAssembler.layoutFunc SmootLight.operationscore.PixelAssembler.PixelAssembler-class.html#layoutFunc +SmootLight.operationscore.PixelAssembler.PixelAssembler.init SmootLight.operationscore.PixelAssembler.PixelAssembler-class.html#init +SmootLight.operationscore.PixelAssembler.PixelAssembler.getStripArgs SmootLight.operationscore.PixelAssembler.PixelAssembler-class.html#getStripArgs +SmootLight.operationscore.PixelAssembler.PixelAssembler.initLayout SmootLight.operationscore.PixelAssembler.PixelAssembler-class.html#initLayout +SmootLight.operationscore.PixelAssembler.PixelAssembler.getPixelLocations SmootLight.operationscore.PixelAssembler.PixelAssembler-class.html#getPixelLocations +SmootLight.operationscore.PixelEvent.PixelEvent SmootLight.operationscore.PixelEvent.PixelEvent-class.html +SmootLight.operationscore.PixelEvent.PixelEvent.addPixelEventIfMissing SmootLight.operationscore.PixelEvent.PixelEvent-class.html#addPixelEventIfMissing +SmootLight.operationscore.PixelEvent.PixelEvent.scale SmootLight.operationscore.PixelEvent.PixelEvent-class.html#scale +SmootLight.operationscore.PixelEvent.PixelEvent.state SmootLight.operationscore.PixelEvent.PixelEvent-class.html#state +SmootLight.operationscore.PixelEvent.PixelEvent.init SmootLight.operationscore.PixelEvent.PixelEvent-class.html#init +SmootLight.operationscore.PixelEvent.PixelEvent.initEvent SmootLight.operationscore.PixelEvent.PixelEvent-class.html#initEvent +SmootLight.operationscore.PixelMapper.PixelMapper SmootLight.operationscore.PixelMapper.PixelMapper-class.html +SmootLight.operationscore.PixelMapper.PixelMapper.mapEvent SmootLight.operationscore.PixelMapper.PixelMapper-class.html#mapEvent +SmootLight.operationscore.PixelMapper.PixelMapper.init SmootLight.operationscore.PixelMapper.PixelMapper-class.html#init +SmootLight.operationscore.PixelMapper.PixelMapper.mappingFunction SmootLight.operationscore.PixelMapper.PixelMapper-class.html#mappingFunction +SmootLight.operationscore.Renderer.Renderer SmootLight.operationscore.Renderer.Renderer-class.html +SmootLight.operationscore.Renderer.Renderer.render SmootLight.operationscore.Renderer.Renderer-class.html#render +SmootLight.operationscore.Renderer.Renderer.init SmootLight.operationscore.Renderer.Renderer-class.html#init +SmootLight.operationscore.Renderer.Renderer.initRenderer SmootLight.operationscore.Renderer.Renderer-class.html#initRenderer +SmootLight.operationscore.SmootCoreObject.SmootCoreObject SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html +SmootLight.operationscore.SmootCoreObject.SmootCoreObject.__getiter__ SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html#__getiter__ +SmootLight.operationscore.SmootCoreObject.SmootCoreObject.validateArgDict SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html#validateArgDict +SmootLight.operationscore.SmootCoreObject.SmootCoreObject.addDieListener SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html#addDieListener +SmootLight.operationscore.SmootCoreObject.SmootCoreObject.__init__ SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html#__init__ +SmootLight.operationscore.SmootCoreObject.SmootCoreObject.__contains__ SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html#__contains__ +SmootLight.operationscore.SmootCoreObject.SmootCoreObject.init SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html#init +SmootLight.operationscore.SmootCoreObject.SmootCoreObject.__getitem__ SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html#__getitem__ +SmootLight.operationscore.SmootCoreObject.SmootCoreObject.removeDieListener SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html#removeDieListener +SmootLight.operationscore.SmootCoreObject.SmootCoreObject.__setitem__ SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html#__setitem__ +SmootLight.operationscore.SmootCoreObject.SmootCoreObject.validateArgs SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html#validateArgs +SmootLight.operationscore.SmootCoreObject.SmootCoreObject.releaseLock SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html#releaseLock +SmootLight.operationscore.SmootCoreObject.SmootCoreObject.die SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html#die +SmootLight.operationscore.SmootCoreObject.SmootCoreObject.acquireLock SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html#acquireLock +SmootLight.operationscore.SmootCoreObject.SmootCoreObject.className SmootLight.operationscore.SmootCoreObject.SmootCoreObject-class.html#className +SmootLight.operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject SmootLight.operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject-class.html +SmootLight.operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject.__init__ SmootLight.operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject-class.html#__init__ +SmootLight.pixelcore.Pixel.Pixel SmootLight.pixelcore.Pixel.Pixel-class.html +SmootLight.pixelcore.Pixel.Pixel.clearAllEvents SmootLight.pixelcore.Pixel.Pixel-class.html#clearAllEvents +SmootLight.pixelcore.Pixel.Pixel.turnOnFor SmootLight.pixelcore.Pixel.Pixel-class.html#turnOnFor +SmootLight.pixelcore.Pixel.Pixel.timeOff SmootLight.pixelcore.Pixel.Pixel-class.html#timeOff +SmootLight.pixelcore.Pixel.Pixel.state SmootLight.pixelcore.Pixel.Pixel-class.html#state +SmootLight.pixelcore.Pixel.Pixel.radius SmootLight.pixelcore.Pixel.Pixel-class.html#radius +SmootLight.pixelcore.Pixel.Pixel.turnOn SmootLight.pixelcore.Pixel.Pixel-class.html#turnOn +SmootLight.pixelcore.Pixel.Pixel.__str__ SmootLight.pixelcore.Pixel.Pixel-class.html#__str__ +SmootLight.pixelcore.Pixel.Pixel.processInput SmootLight.pixelcore.Pixel.Pixel-class.html#processInput +SmootLight.pixelcore.Pixel.Pixel.__init__ SmootLight.pixelcore.Pixel.Pixel-class.html#__init__ +SmootLight.pixelcore.PixelStrip.PixelStrip SmootLight.pixelcore.PixelStrip.PixelStrip-class.html +SmootLight.pixelcore.PixelStrip.PixelStrip.__iter__ SmootLight.pixelcore.PixelStrip.PixelStrip-class.html#__iter__ +SmootLight.pixelcore.PixelStrip.PixelStrip.initStrip SmootLight.pixelcore.PixelStrip.PixelStrip-class.html#initStrip +SmootLight.pixelcore.PixelStrip.PixelStrip.__init__ SmootLight.pixelcore.PixelStrip.PixelStrip-class.html#__init__ +SmootLight.pixelcore.Screen.Screen SmootLight.pixelcore.Screen.Screen-class.html +SmootLight.pixelcore.Screen.Screen.respond SmootLight.pixelcore.Screen.Screen-class.html#respond +SmootLight.pixelcore.Screen.Screen.pixelsInRange SmootLight.pixelcore.Screen.Screen-class.html#pixelsInRange +SmootLight.pixelcore.Screen.Screen.computeXSortedPixels SmootLight.pixelcore.Screen.Screen-class.html#computeXSortedPixels +SmootLight.pixelcore.Screen.Screen.processResponse SmootLight.pixelcore.Screen.Screen-class.html#processResponse +SmootLight.pixelcore.Screen.Screen.getSize SmootLight.pixelcore.Screen.Screen-class.html#getSize +SmootLight.pixelcore.Screen.Screen.addStrip SmootLight.pixelcore.Screen.Screen-class.html#addStrip +SmootLight.pixelcore.Screen.Screen.__iter__ SmootLight.pixelcore.Screen.Screen-class.html#__iter__ +SmootLight.pixelcore.Screen.Screen.timeStep SmootLight.pixelcore.Screen.Screen-class.html#timeStep +SmootLight.pixelcore.Screen.Screen.__init__ SmootLight.pixelcore.Screen.Screen-class.html#__init__ +SmootLight.pixelevents.DecayEvent.DecayEvent SmootLight.pixelevents.DecayEvent.DecayEvent-class.html +SmootLight.pixelevents.DecayEvent.DecayEvent.state SmootLight.pixelevents.DecayEvent.DecayEvent-class.html#state +SmootLight.pixelevents.DecayEvent.DecayEvent.initEvent SmootLight.pixelevents.DecayEvent.DecayEvent-class.html#initEvent +SmootLight.pixelevents.DecayEvent.DecayEvent.generate SmootLight.pixelevents.DecayEvent.DecayEvent-class.html#generate +SmootLight.pixelevents.SingleFrameEvent.SingleFrameEvent SmootLight.pixelevents.SingleFrameEvent.SingleFrameEvent-class.html +SmootLight.pixelevents.SingleFrameEvent.SingleFrameEvent.state SmootLight.pixelevents.SingleFrameEvent.SingleFrameEvent-class.html#state +SmootLight.pixelevents.SingleFrameEvent.SingleFrameEvent.initEvent SmootLight.pixelevents.SingleFrameEvent.SingleFrameEvent-class.html#initEvent +SmootLight.pixelevents.StepEvent.StepEvent SmootLight.pixelevents.StepEvent.StepEvent-class.html +SmootLight.pixelevents.StepEvent.StepEvent.state SmootLight.pixelevents.StepEvent.StepEvent-class.html#state +SmootLight.pixelevents.StepEvent.StepEvent.initEvent SmootLight.pixelevents.StepEvent.StepEvent-class.html#initEvent +SmootLight.pixelevents.StepEvent.StepEvent.generate SmootLight.pixelevents.StepEvent.StepEvent-class.html#generate +SmootLight.pixelevents.SynchTestEvent.SynchTestEvent SmootLight.pixelevents.SynchTestEvent.SynchTestEvent-class.html +SmootLight.pixelevents.SynchTestEvent.SynchTestEvent.state SmootLight.pixelevents.SynchTestEvent.SynchTestEvent-class.html#state +SmootLight.pixelevents.SynchTestEvent.SynchTestEvent.initEvent SmootLight.pixelevents.SynchTestEvent.SynchTestEvent-class.html#initEvent +SmootLight.pixelmappers.C5SignMapper.C5SignMapper SmootLight.pixelmappers.C5SignMapper.C5SignMapper-class.html +SmootLight.pixelmappers.C5SignMapper.C5SignMapper.signPosition SmootLight.pixelmappers.C5SignMapper.C5SignMapper-class.html#signPosition +SmootLight.pixelmappers.C5SignMapper.C5SignMapper.mappingFunction SmootLight.pixelmappers.C5SignMapper.C5SignMapper-class.html#mappingFunction +SmootLight.pixelmappers.GaussianMapper.GaussianMapper SmootLight.pixelmappers.GaussianMapper.GaussianMapper-class.html +SmootLight.pixelmappers.GaussianMapper.GaussianMapper.mappingFunction SmootLight.pixelmappers.GaussianMapper.GaussianMapper-class.html#mappingFunction +SmootLight.pixelmappers.SimpleMapper.SimpleMapper SmootLight.pixelmappers.SimpleMapper.SimpleMapper-class.html +SmootLight.pixelmappers.SimpleMapper.SimpleMapper.mappingFunction SmootLight.pixelmappers.SimpleMapper.SimpleMapper-class.html#mappingFunction +SmootLight.pixelmappers.WindGaussianMapper.WindGaussianMapper SmootLight.pixelmappers.WindGaussianMapper.WindGaussianMapper-class.html +SmootLight.pixelmappers.WindGaussianMapper.WindGaussianMapper.mappingFunction SmootLight.pixelmappers.WindGaussianMapper.WindGaussianMapper-class.html#mappingFunction +SmootLight.renderers.IndoorRenderer.IndoorRenderer SmootLight.renderers.IndoorRenderer.IndoorRenderer-class.html +SmootLight.renderers.IndoorRenderer.IndoorRenderer.render SmootLight.renderers.IndoorRenderer.IndoorRenderer-class.html#render +SmootLight.renderers.IndoorRenderer.IndoorRenderer.initRenderer SmootLight.renderers.IndoorRenderer.IndoorRenderer-class.html#initRenderer +SmootLight.renderers.PygameRenderer.PygameRenderer SmootLight.renderers.PygameRenderer.PygameRenderer-class.html +SmootLight.renderers.PygameRenderer.PygameRenderer.render SmootLight.renderers.PygameRenderer.PygameRenderer-class.html#render +SmootLight.renderers.PygameRenderer.PygameRenderer.initRenderer SmootLight.renderers.PygameRenderer.PygameRenderer-class.html#initRenderer +SmootLight.tests.TestBQS'.TestBQS SmootLight.tests.TestBQS%27.TestBQS-class.html +SmootLight.tests.TestBQS'.TestBQS.tearDown SmootLight.tests.TestBQS%27.TestBQS-class.html#tearDown +SmootLight.tests.TestBQS'.TestBQS.test_simple_query SmootLight.tests.TestBQS%27.TestBQS-class.html#test_simple_query +unittest.TestCase.failureException exceptions.AssertionError-class.html +SmootLight.tests.TestBQS'.TestBQS.test_complex_queries SmootLight.tests.TestBQS%27.TestBQS-class.html#test_complex_queries +SmootLight.tests.TestBQS'.TestBQS.test_dist_query SmootLight.tests.TestBQS%27.TestBQS-class.html#test_dist_query +SmootLight.tests.TestBQS'.TestBQS.setUp SmootLight.tests.TestBQS%27.TestBQS-class.html#setUp +SmootLight.tests.TestComponentRegistry'.TestComponentRegistry SmootLight.tests.TestComponentRegistry%27.TestComponentRegistry-class.html +SmootLight.tests.TestComponentRegistry'.TestComponentRegistry.test_register_new_id SmootLight.tests.TestComponentRegistry%27.TestComponentRegistry-class.html#test_register_new_id +SmootLight.tests.TestComponentRegistry'.TestComponentRegistry.tearDown SmootLight.tests.TestComponentRegistry%27.TestComponentRegistry-class.html#tearDown +SmootLight.tests.TestComponentRegistry'.TestComponentRegistry.test_register_component_id_specified SmootLight.tests.TestComponentRegistry%27.TestComponentRegistry-class.html#test_register_component_id_specified +unittest.TestCase.failureException exceptions.AssertionError-class.html +SmootLight.tests.TestComponentRegistry'.TestComponentRegistry.setUp SmootLight.tests.TestComponentRegistry%27.TestComponentRegistry-class.html#setUp +SmootLight.tests.TestConfigLoaders'.TestConfigLoaders SmootLight.tests.TestConfigLoaders%27.TestConfigLoaders-class.html +SmootLight.tests.TestConfigLoaders'.TestConfigLoaders.tearDown SmootLight.tests.TestConfigLoaders%27.TestConfigLoaders-class.html#tearDown +SmootLight.tests.TestConfigLoaders'.TestConfigLoaders.test_inheritance SmootLight.tests.TestConfigLoaders%27.TestConfigLoaders-class.html#test_inheritance +unittest.TestCase.failureException exceptions.AssertionError-class.html +SmootLight.tests.TestConfigLoaders'.TestConfigLoaders.setUp SmootLight.tests.TestConfigLoaders%27.TestConfigLoaders-class.html#setUp +SmootLight.tests.TestConfigLoaders'.TestConfigLoaders.test_composite SmootLight.tests.TestConfigLoaders%27.TestConfigLoaders-class.html#test_composite +SmootLight.tests.TestConfigLoaders'.TestConfigLoaders.test_eval SmootLight.tests.TestConfigLoaders%27.TestConfigLoaders-class.html#test_eval +SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior-class.html +SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior.tearDown SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior-class.html#tearDown +unittest.TestCase.failureException exceptions.AssertionError-class.html +SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior.setUp SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior-class.html#setUp +SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior.test_switch_to_behavior2 SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior-class.html#test_switch_to_behavior2 +SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior.test_switch_to_behavior1 SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior-class.html#test_switch_to_behavior1 +SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior.test_default_behavior SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior-class.html#test_default_behavior +SmootLight.util.ColorOps.Color SmootLight.util.ColorOps.Color-class.html +SmootLight.util.ColorOps.Color.__init__ SmootLight.util.ColorOps.Color-class.html#__init__ +SmootLight.util.Geo.Location SmootLight.util.Geo.Location-class.html +SmootLight.util.Geo.Location.__add__ SmootLight.util.Geo.Location-class.html#__add__ +SmootLight.util.Geo.Location.__init__ SmootLight.util.Geo.Location-class.html#__init__ +SmootLight.util.TimeOps.Stopwatch SmootLight.util.TimeOps.Stopwatch-class.html +SmootLight.util.TimeOps.Stopwatch.start SmootLight.util.TimeOps.Stopwatch-class.html#start +SmootLight.util.TimeOps.Stopwatch.stop SmootLight.util.TimeOps.Stopwatch-class.html#stop +SmootLight.util.TimeOps.Stopwatch.__init__ SmootLight.util.TimeOps.Stopwatch-class.html#__init__ +SmootLight.util.TimeOps.Stopwatch.elapsed SmootLight.util.TimeOps.Stopwatch-class.html#elapsed +exceptions.AssertionError exceptions.AssertionError-class.html +exceptions.AssertionError.__init__ exceptions.AssertionError-class.html#__init__ +exceptions.AssertionError.__new__ exceptions.AssertionError-class.html#__new__ diff --git a/html/class-tree.html b/html/class-tree.html new file mode 100644 index 0000000..e4e8fb6 --- /dev/null +++ b/html/class-tree.html @@ -0,0 +1,480 @@ + + + + + Class Hierarchy + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
  + + + + +
[hide private]
[frames] | no frames]
+
+
+ [ Module Hierarchy + | Class Hierarchy ] +

+

Class Hierarchy

+ + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/crarr.png b/html/crarr.png new file mode 100644 index 0000000..26b43c5 Binary files /dev/null and b/html/crarr.png differ diff --git a/html/epydoc.css b/html/epydoc.css new file mode 100644 index 0000000..86d4170 --- /dev/null +++ b/html/epydoc.css @@ -0,0 +1,322 @@ + + +/* Epydoc CSS Stylesheet + * + * This stylesheet can be used to customize the appearance of epydoc's + * HTML output. + * + */ + +/* Default Colors & Styles + * - Set the default foreground & background color with 'body'; and + * link colors with 'a:link' and 'a:visited'. + * - Use bold for decision list terms. + * - The heading styles defined here are used for headings *within* + * docstring descriptions. All headings used by epydoc itself use + * either class='epydoc' or class='toc' (CSS styles for both + * defined below). + */ +body { background: #ffffff; color: #000000; } +p { margin-top: 0.5em; margin-bottom: 0.5em; } +a:link { color: #0000ff; } +a:visited { color: #204080; } +dt { font-weight: bold; } +h1 { font-size: +140%; font-style: italic; + font-weight: bold; } +h2 { font-size: +125%; font-style: italic; + font-weight: bold; } +h3 { font-size: +110%; font-style: italic; + font-weight: normal; } +code { font-size: 100%; } +/* N.B.: class, not pseudoclass */ +a.link { font-family: monospace; } + +/* Page Header & Footer + * - The standard page header consists of a navigation bar (with + * pointers to standard pages such as 'home' and 'trees'); a + * breadcrumbs list, which can be used to navigate to containing + * classes or modules; options links, to show/hide private + * variables and to show/hide frames; and a page title (using + *

). The page title may be followed by a link to the + * corresponding source code (using 'span.codelink'). + * - The footer consists of a navigation bar, a timestamp, and a + * pointer to epydoc's homepage. + */ +h1.epydoc { margin: 0; font-size: +140%; font-weight: bold; } +h2.epydoc { font-size: +130%; font-weight: bold; } +h3.epydoc { font-size: +115%; font-weight: bold; + margin-top: 0.2em; } +td h3.epydoc { font-size: +115%; font-weight: bold; + margin-bottom: 0; } +table.navbar { background: #a0c0ff; color: #000000; + border: 2px groove #c0d0d0; } +table.navbar table { color: #000000; } +th.navbar-select { background: #70b0ff; + color: #000000; } +table.navbar a { text-decoration: none; } +table.navbar a:link { color: #0000ff; } +table.navbar a:visited { color: #204080; } +span.breadcrumbs { font-size: 85%; font-weight: bold; } +span.options { font-size: 70%; } +span.codelink { font-size: 85%; } +td.footer { font-size: 85%; } + +/* Table Headers + * - Each summary table and details section begins with a 'header' + * row. This row contains a section title (marked by + * 'span.table-header') as well as a show/hide private link + * (marked by 'span.options', defined above). + * - Summary tables that contain user-defined groups mark those + * groups using 'group header' rows. + */ +td.table-header { background: #70b0ff; color: #000000; + border: 1px solid #608090; } +td.table-header table { color: #000000; } +td.table-header table a:link { color: #0000ff; } +td.table-header table a:visited { color: #204080; } +span.table-header { font-size: 120%; font-weight: bold; } +th.group-header { background: #c0e0f8; color: #000000; + text-align: left; font-style: italic; + font-size: 115%; + border: 1px solid #608090; } + +/* Summary Tables (functions, variables, etc) + * - Each object is described by a single row of the table with + * two cells. The left cell gives the object's type, and is + * marked with 'code.summary-type'. The right cell gives the + * object's name and a summary description. + * - CSS styles for the table's header and group headers are + * defined above, under 'Table Headers' + */ +table.summary { border-collapse: collapse; + background: #e8f0f8; color: #000000; + border: 1px solid #608090; + margin-bottom: 0.5em; } +td.summary { border: 1px solid #608090; } +code.summary-type { font-size: 85%; } +table.summary a:link { color: #0000ff; } +table.summary a:visited { color: #204080; } + + +/* Details Tables (functions, variables, etc) + * - Each object is described in its own div. + * - A single-row summary table w/ table-header is used as + * a header for each details section (CSS style for table-header + * is defined above, under 'Table Headers'). + */ +table.details { border-collapse: collapse; + background: #e8f0f8; color: #000000; + border: 1px solid #608090; + margin: .2em 0 0 0; } +table.details table { color: #000000; } +table.details a:link { color: #0000ff; } +table.details a:visited { color: #204080; } + +/* Fields */ +dl.fields { margin-left: 2em; margin-top: 1em; + margin-bottom: 1em; } +dl.fields dd ul { margin-left: 0em; padding-left: 0em; } +dl.fields dd ul li ul { margin-left: 2em; padding-left: 0em; } +div.fields { margin-left: 2em; } +div.fields p { margin-bottom: 0.5em; } + +/* Index tables (identifier index, term index, etc) + * - link-index is used for indices containing lists of links + * (namely, the identifier index & term index). + * - index-where is used in link indices for the text indicating + * the container/source for each link. + * - metadata-index is used for indices containing metadata + * extracted from fields (namely, the bug index & todo index). + */ +table.link-index { border-collapse: collapse; + background: #e8f0f8; color: #000000; + border: 1px solid #608090; } +td.link-index { border-width: 0px; } +table.link-index a:link { color: #0000ff; } +table.link-index a:visited { color: #204080; } +span.index-where { font-size: 70%; } +table.metadata-index { border-collapse: collapse; + background: #e8f0f8; color: #000000; + border: 1px solid #608090; + margin: .2em 0 0 0; } +td.metadata-index { border-width: 1px; border-style: solid; } +table.metadata-index a:link { color: #0000ff; } +table.metadata-index a:visited { color: #204080; } + +/* Function signatures + * - sig* is used for the signature in the details section. + * - .summary-sig* is used for the signature in the summary + * table, and when listing property accessor functions. + * */ +.sig-name { color: #006080; } +.sig-arg { color: #008060; } +.sig-default { color: #602000; } +.summary-sig { font-family: monospace; } +.summary-sig-name { color: #006080; font-weight: bold; } +table.summary a.summary-sig-name:link + { color: #006080; font-weight: bold; } +table.summary a.summary-sig-name:visited + { color: #006080; font-weight: bold; } +.summary-sig-arg { color: #006040; } +.summary-sig-default { color: #501800; } + +/* Subclass list + */ +ul.subclass-list { display: inline; } +ul.subclass-list li { display: inline; } + +/* To render variables, classes etc. like functions */ +table.summary .summary-name { color: #006080; font-weight: bold; + font-family: monospace; } +table.summary + a.summary-name:link { color: #006080; font-weight: bold; + font-family: monospace; } +table.summary + a.summary-name:visited { color: #006080; font-weight: bold; + font-family: monospace; } + +/* Variable values + * - In the 'variable details' sections, each varaible's value is + * listed in a 'pre.variable' box. The width of this box is + * restricted to 80 chars; if the value's repr is longer than + * this it will be wrapped, using a backslash marked with + * class 'variable-linewrap'. If the value's repr is longer + * than 3 lines, the rest will be ellided; and an ellipsis + * marker ('...' marked with 'variable-ellipsis') will be used. + * - If the value is a string, its quote marks will be marked + * with 'variable-quote'. + * - If the variable is a regexp, it is syntax-highlighted using + * the re* CSS classes. + */ +pre.variable { padding: .5em; margin: 0; + background: #dce4ec; color: #000000; + border: 1px solid #708890; } +.variable-linewrap { color: #604000; font-weight: bold; } +.variable-ellipsis { color: #604000; font-weight: bold; } +.variable-quote { color: #604000; font-weight: bold; } +.variable-group { color: #008000; font-weight: bold; } +.variable-op { color: #604000; font-weight: bold; } +.variable-string { color: #006030; } +.variable-unknown { color: #a00000; font-weight: bold; } +.re { color: #000000; } +.re-char { color: #006030; } +.re-op { color: #600000; } +.re-group { color: #003060; } +.re-ref { color: #404040; } + +/* Base tree + * - Used by class pages to display the base class hierarchy. + */ +pre.base-tree { font-size: 80%; margin: 0; } + +/* Frames-based table of contents headers + * - Consists of two frames: one for selecting modules; and + * the other listing the contents of the selected module. + * - h1.toc is used for each frame's heading + * - h2.toc is used for subheadings within each frame. + */ +h1.toc { text-align: center; font-size: 105%; + margin: 0; font-weight: bold; + padding: 0; } +h2.toc { font-size: 100%; font-weight: bold; + margin: 0.5em 0 0 -0.3em; } + +/* Syntax Highlighting for Source Code + * - doctest examples are displayed in a 'pre.py-doctest' block. + * If the example is in a details table entry, then it will use + * the colors specified by the 'table pre.py-doctest' line. + * - Source code listings are displayed in a 'pre.py-src' block. + * Each line is marked with 'span.py-line' (used to draw a line + * down the left margin, separating the code from the line + * numbers). Line numbers are displayed with 'span.py-lineno'. + * The expand/collapse block toggle button is displayed with + * 'a.py-toggle' (Note: the CSS style for 'a.py-toggle' should not + * modify the font size of the text.) + * - If a source code page is opened with an anchor, then the + * corresponding code block will be highlighted. The code + * block's header is highlighted with 'py-highlight-hdr'; and + * the code block's body is highlighted with 'py-highlight'. + * - The remaining py-* classes are used to perform syntax + * highlighting (py-string for string literals, py-name for names, + * etc.) + */ +pre.py-doctest { padding: .5em; margin: 1em; + background: #e8f0f8; color: #000000; + border: 1px solid #708890; } +table pre.py-doctest { background: #dce4ec; + color: #000000; } +pre.py-src { border: 2px solid #000000; + background: #f0f0f0; color: #000000; } +.py-line { border-left: 2px solid #000000; + margin-left: .2em; padding-left: .4em; } +.py-lineno { font-style: italic; font-size: 90%; + padding-left: .5em; } +a.py-toggle { text-decoration: none; } +div.py-highlight-hdr { border-top: 2px solid #000000; + border-bottom: 2px solid #000000; + background: #d8e8e8; } +div.py-highlight { border-bottom: 2px solid #000000; + background: #d0e0e0; } +.py-prompt { color: #005050; font-weight: bold;} +.py-more { color: #005050; font-weight: bold;} +.py-string { color: #006030; } +.py-comment { color: #003060; } +.py-keyword { color: #600000; } +.py-output { color: #404040; } +.py-name { color: #000050; } +.py-name:link { color: #000050 !important; } +.py-name:visited { color: #000050 !important; } +.py-number { color: #005000; } +.py-defname { color: #000060; font-weight: bold; } +.py-def-name { color: #000060; font-weight: bold; } +.py-base-class { color: #000060; } +.py-param { color: #000060; } +.py-docstring { color: #006030; } +.py-decorator { color: #804020; } +/* Use this if you don't want links to names underlined: */ +/*a.py-name { text-decoration: none; }*/ + +/* Graphs & Diagrams + * - These CSS styles are used for graphs & diagrams generated using + * Graphviz dot. 'img.graph-without-title' is used for bare + * diagrams (to remove the border created by making the image + * clickable). + */ +img.graph-without-title { border: none; } +img.graph-with-title { border: 1px solid #000000; } +span.graph-title { font-weight: bold; } +span.graph-caption { } + +/* General-purpose classes + * - 'p.indent-wrapped-lines' defines a paragraph whose first line + * is not indented, but whose subsequent lines are. + * - The 'nomargin-top' class is used to remove the top margin (e.g. + * from lists). The 'nomargin' class is used to remove both the + * top and bottom margin (but not the left or right margin -- + * for lists, that would cause the bullets to disappear.) + */ +p.indent-wrapped-lines { padding: 0 0 0 7em; text-indent: -7em; + margin: 0; } +.nomargin-top { margin-top: 0; } +.nomargin { margin-top: 0; margin-bottom: 0; } + +/* HTML Log */ +div.log-block { padding: 0; margin: .5em 0 .5em 0; + background: #e8f0f8; color: #000000; + border: 1px solid #000000; } +div.log-error { padding: .1em .3em .1em .3em; margin: 4px; + background: #ffb0b0; color: #000000; + border: 1px solid #000000; } +div.log-warning { padding: .1em .3em .1em .3em; margin: 4px; + background: #ffffb0; color: #000000; + border: 1px solid #000000; } +div.log-info { padding: .1em .3em .1em .3em; margin: 4px; + background: #b0ffb0; color: #000000; + border: 1px solid #000000; } +h2.log-hdr { background: #70b0ff; color: #000000; + margin: 0; padding: 0em 0.5em 0em 0.5em; + border-bottom: 1px solid #000000; font-size: 110%; } +p.log { font-weight: bold; margin: .5em 0 .5em 0; } +tr.opt-changed { color: #000000; font-weight: bold; } +tr.opt-default { color: #606060; } +pre.log { margin: 0; padding: 0; padding-left: 1em; } diff --git a/html/epydoc.js b/html/epydoc.js new file mode 100644 index 0000000..e787dbc --- /dev/null +++ b/html/epydoc.js @@ -0,0 +1,293 @@ +function toggle_private() { + // Search for any private/public links on this page. Store + // their old text in "cmd," so we will know what action to + // take; and change their text to the opposite action. + var cmd = "?"; + var elts = document.getElementsByTagName("a"); + for(var i=0; i...
"; + elt.innerHTML = s; + } +} + +function toggle(id) { + elt = document.getElementById(id+"-toggle"); + if (elt.innerHTML == "-") + collapse(id); + else + expand(id); + return false; +} + +function highlight(id) { + var elt = document.getElementById(id+"-def"); + if (elt) elt.className = "py-highlight-hdr"; + var elt = document.getElementById(id+"-expanded"); + if (elt) elt.className = "py-highlight"; + var elt = document.getElementById(id+"-collapsed"); + if (elt) elt.className = "py-highlight"; +} + +function num_lines(s) { + var n = 1; + var pos = s.indexOf("\n"); + while ( pos > 0) { + n += 1; + pos = s.indexOf("\n", pos+1); + } + return n; +} + +// Collapse all blocks that mave more than `min_lines` lines. +function collapse_all(min_lines) { + var elts = document.getElementsByTagName("div"); + for (var i=0; i 0) + if (elt.id.substring(split, elt.id.length) == "-expanded") + if (num_lines(elt.innerHTML) > min_lines) + collapse(elt.id.substring(0, split)); + } +} + +function expandto(href) { + var start = href.indexOf("#")+1; + if (start != 0 && start != href.length) { + if (href.substring(start, href.length) != "-") { + collapse_all(4); + pos = href.indexOf(".", start); + while (pos != -1) { + var id = href.substring(start, pos); + expand(id); + pos = href.indexOf(".", pos+1); + } + var id = href.substring(start, href.length); + expand(id); + highlight(id); + } + } +} + +function kill_doclink(id) { + var parent = document.getElementById(id); + parent.removeChild(parent.childNodes.item(0)); +} +function auto_kill_doclink(ev) { + if (!ev) var ev = window.event; + if (!this.contains(ev.toElement)) { + var parent = document.getElementById(this.parentID); + parent.removeChild(parent.childNodes.item(0)); + } +} + +function doclink(id, name, targets_id) { + var elt = document.getElementById(id); + + // If we already opened the box, then destroy it. + // (This case should never occur, but leave it in just in case.) + if (elt.childNodes.length > 1) { + elt.removeChild(elt.childNodes.item(0)); + } + else { + // The outer box: relative + inline positioning. + var box1 = document.createElement("div"); + box1.style.position = "relative"; + box1.style.display = "inline"; + box1.style.top = 0; + box1.style.left = 0; + + // A shadow for fun + var shadow = document.createElement("div"); + shadow.style.position = "absolute"; + shadow.style.left = "-1.3em"; + shadow.style.top = "-1.3em"; + shadow.style.background = "#404040"; + + // The inner box: absolute positioning. + var box2 = document.createElement("div"); + box2.style.position = "relative"; + box2.style.border = "1px solid #a0a0a0"; + box2.style.left = "-.2em"; + box2.style.top = "-.2em"; + box2.style.background = "white"; + box2.style.padding = ".3em .4em .3em .4em"; + box2.style.fontStyle = "normal"; + box2.onmouseout=auto_kill_doclink; + box2.parentID = id; + + // Get the targets + var targets_elt = document.getElementById(targets_id); + var targets = targets_elt.getAttribute("targets"); + var links = ""; + target_list = targets.split(","); + for (var i=0; i" + + target[0] + ""; + } + + // Put it all together. + elt.insertBefore(box1, elt.childNodes.item(0)); + //box1.appendChild(box2); + box1.appendChild(shadow); + shadow.appendChild(box2); + box2.innerHTML = + "Which "+name+" do you want to see documentation for?" + + ""; + } + return false; +} + +function get_anchor() { + var href = location.href; + var start = href.indexOf("#")+1; + if ((start != 0) && (start != href.length)) + return href.substring(start, href.length); + } +function redirect_url(dottedName) { + // Scan through each element of the "pages" list, and check + // if "name" matches with any of them. + for (var i=0; i-m" or "-c"; + // extract the portion & compare it to dottedName. + var pagename = pages[i].substring(0, pages[i].length-2); + if (pagename == dottedName.substring(0,pagename.length)) { + + // We've found a page that matches `dottedName`; + // construct its URL, using leftover `dottedName` + // content to form an anchor. + var pagetype = pages[i].charAt(pages[i].length-1); + var url = pagename + ((pagetype=="m")?"-module.html": + "-class.html"); + if (dottedName.length > pagename.length) + url += "#" + dottedName.substring(pagename.length+1, + dottedName.length); + return url; + } + } + } diff --git a/html/exceptions.AssertionError-class.html b/html/exceptions.AssertionError-class.html new file mode 100644 index 0000000..3f0cff4 --- /dev/null +++ b/html/exceptions.AssertionError-class.html @@ -0,0 +1,293 @@ + + + + + exceptions.AssertionError + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + exceptions :: + AssertionError :: + Class AssertionError + + + + + + +
[hide private]
[frames] | no frames]
+
+ +

Class AssertionError

+
+   object --+            
+            |            
+BaseException --+        
+                |        
+        Exception --+    
+                    |    
+        StandardError --+
+                        |
+                       AssertionError
+
+ +
+

Assertion failed.

+ + + + + + + + + + + + + + + + +
+ + + + + +
Instance Methods[hide private]
+
+   + + + + + + +
__init__(...)
+ x.__init__(...) initializes x; see x.__class__.__doc__ for signature
+ + +
+ +
+ a new object with type S, a subtype of T + + + + + + +
__new__(T, + S, + ...) + + +
+ +
+

Inherited from BaseException: + __delattr__, + __getattribute__, + __getitem__, + __getslice__, + __reduce__, + __repr__, + __setattr__, + __setstate__, + __str__, + __unicode__ +

+

Inherited from object: + __format__, + __hash__, + __reduce_ex__, + __sizeof__, + __subclasshook__ +

+
+ + + + + + + + + +
+ + + + + +
Properties[hide private]
+
+

Inherited from BaseException: + args, + message +

+

Inherited from object: + __class__ +

+
+ + + + + + +
+ + + + + +
Method Details[hide private]
+
+ +
+ +
+ + +
+

__init__(...) +
(Constructor) +

+
  +
+ +

x.__init__(...) initializes x; see x.__class__.__doc__ for + signature

+
+
Overrides: + object.__init__ +
+
+
+
+ +
+ +
+ + +
+

__new__(T, + S, + ...) +

+
  +
+ + +
+
Returns: a new object with type S, a subtype of T
+
Overrides: + object.__new__ +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/frames.html b/html/frames.html new file mode 100644 index 0000000..71aada7 --- /dev/null +++ b/html/frames.html @@ -0,0 +1,17 @@ + + + + + API Documentation + + + + + + + + + diff --git a/html/help.html b/html/help.html new file mode 100644 index 0000000..d503d98 --- /dev/null +++ b/html/help.html @@ -0,0 +1,268 @@ + + + + + Help + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
  + + + + +
[hide private]
[frames] | no frames]
+
+ +

API Documentation

+ +

This document contains the API (Application Programming Interface) +documentation for this project. Documentation for the Python +objects defined by the project is divided into separate pages for each +package, module, and class. The API documentation also includes two +pages containing information about the project as a whole: a trees +page, and an index page.

+ +

Object Documentation

+ +

Each Package Documentation page contains:

+
    +
  • A description of the package.
  • +
  • A list of the modules and sub-packages contained by the + package.
  • +
  • A summary of the classes defined by the package.
  • +
  • A summary of the functions defined by the package.
  • +
  • A summary of the variables defined by the package.
  • +
  • A detailed description of each function defined by the + package.
  • +
  • A detailed description of each variable defined by the + package.
  • +
+ +

Each Module Documentation page contains:

+
    +
  • A description of the module.
  • +
  • A summary of the classes defined by the module.
  • +
  • A summary of the functions defined by the module.
  • +
  • A summary of the variables defined by the module.
  • +
  • A detailed description of each function defined by the + module.
  • +
  • A detailed description of each variable defined by the + module.
  • +
+ +

Each Class Documentation page contains:

+
    +
  • A class inheritance diagram.
  • +
  • A list of known subclasses.
  • +
  • A description of the class.
  • +
  • A summary of the methods defined by the class.
  • +
  • A summary of the instance variables defined by the class.
  • +
  • A summary of the class (static) variables defined by the + class.
  • +
  • A detailed description of each method defined by the + class.
  • +
  • A detailed description of each instance variable defined by the + class.
  • +
  • A detailed description of each class (static) variable defined + by the class.
  • +
+ +

Project Documentation

+ +

The Trees page contains the module and class hierarchies:

+
    +
  • The module hierarchy lists every package and module, with + modules grouped into packages. At the top level, and within each + package, modules and sub-packages are listed alphabetically.
  • +
  • The class hierarchy lists every class, grouped by base + class. If a class has more than one base class, then it will be + listed under each base class. At the top level, and under each base + class, classes are listed alphabetically.
  • +
+ +

The Index page contains indices of terms and + identifiers:

+
    +
  • The term index lists every term indexed by any object's + documentation. For each term, the index provides links to each + place where the term is indexed.
  • +
  • The identifier index lists the (short) name of every package, + module, class, method, function, variable, and parameter. For each + identifier, the index provides a short description, and a link to + its documentation.
  • +
+ +

The Table of Contents

+ +

The table of contents occupies the two frames on the left side of +the window. The upper-left frame displays the project +contents, and the lower-left frame displays the module +contents:

+ + + + + + + + + +
+ Project
Contents
...
+ API
Documentation
Frame


+
+ Module
Contents
 
...
  +

+ +

The project contents frame contains a list of all packages +and modules that are defined by the project. Clicking on an entry +will display its contents in the module contents frame. Clicking on a +special entry, labeled "Everything," will display the contents of +the entire project.

+ +

The module contents frame contains a list of every +submodule, class, type, exception, function, and variable defined by a +module or package. Clicking on an entry will display its +documentation in the API documentation frame. Clicking on the name of +the module, at the top of the frame, will display the documentation +for the module itself.

+ +

The "frames" and "no frames" buttons below the top +navigation bar can be used to control whether the table of contents is +displayed or not.

+ +

The Navigation Bar

+ +

A navigation bar is located at the top and bottom of every page. +It indicates what type of page you are currently viewing, and allows +you to go to related pages. The following table describes the labels +on the navigation bar. Note that not some labels (such as +[Parent]) are not displayed on all pages.

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + +
LabelHighlighted when...Links to...
[Parent](never highlighted) the parent of the current package
[Package]viewing a packagethe package containing the current object +
[Module]viewing a modulethe module containing the current object +
[Class]viewing a class the class containing the current object
[Trees]viewing the trees page the trees page
[Index]viewing the index page the index page
[Help]viewing the help page the help page
+ +

The "show private" and "hide private" buttons below +the top navigation bar can be used to control whether documentation +for private objects is displayed. Private objects are usually defined +as objects whose (short) names begin with a single underscore, but do +not end with an underscore. For example, "_x", +"__pprint", and "epydoc.epytext._tokenize" +are private objects; but "re.sub", +"__init__", and "type_" are not. However, +if a module defines the "__all__" variable, then its +contents are used to decide which objects are private.

+ +

A timestamp below the bottom navigation bar indicates when each +page was last updated.

+ + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/identifier-index.html b/html/identifier-index.html new file mode 100644 index 0000000..9b5981b --- /dev/null +++ b/html/identifier-index.html @@ -0,0 +1,3421 @@ + + + + + Identifier Index + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
  + + + + +
[hide private]
[frames] | no frames]
+
+ +
+

Identifier Index

+
+[ + A + B + C + D + E + F + G + H + I + J + K + L + M + N + O + P + Q + R + S + T + U + V + W + X + Y + Z + _ +] +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

A

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

B

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

C

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

D

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

E

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

F

+ + + + + + + + + + + + + + + + + + + + + + + + + + + +

G

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

H

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

I

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

J

+ + + + + + + + + + + + + + + + + + + + + + +

K

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

L

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

M

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

N

+ + + + + + + + + + + + + + + + + +

O

+ + + + + + + + + + + + + + + + + + + + + + +

P

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Q

+ + + + + + + + +

R

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

S

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

T

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

U

+ + + + + + + + + + + + + + + + + + + + + + +

V

+ + + + + + + + + + + + + + + + + + + + + + +

W

+ + + + + + + + + + + + +

X

+ + + + + + + + +

Y

+ + + + + + + + + + + + +

Z

+ + + + + + + + +

_

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+

+ + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/index.html b/html/index.html new file mode 100644 index 0000000..71aada7 --- /dev/null +++ b/html/index.html @@ -0,0 +1,17 @@ + + + + + API Documentation + + + + + + + + + diff --git a/html/module-tree.html b/html/module-tree.html new file mode 100644 index 0000000..12d412c --- /dev/null +++ b/html/module-tree.html @@ -0,0 +1,248 @@ + + + + + Module Hierarchy + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
  + + + + +
[hide private]
[frames] | no frames]
+
+
+ [ Module Hierarchy + | Class Hierarchy ] +

+

Module Hierarchy

+ + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + diff --git a/html/redirect.html b/html/redirect.html new file mode 100644 index 0000000..b3bc3a2 --- /dev/null +++ b/html/redirect.html @@ -0,0 +1,38 @@ +Epydoc Redirect Page + + + + + + + + +

Epydoc Auto-redirect page

+ +

When javascript is enabled, this page will redirect URLs of +the form redirect.html#dotted.name to the +documentation for the object with the given fully-qualified +dotted name.

+

 

+ + + + + diff --git a/html/toc-SmootLight-module.html b/html/toc-SmootLight-module.html new file mode 100644 index 0000000..de41668 --- /dev/null +++ b/html/toc-SmootLight-module.html @@ -0,0 +1,31 @@ + + + + + SmootLight + + + + + +

Module SmootLight

+
+

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.LightInstallation-module.html b/html/toc-SmootLight.LightInstallation-module.html new file mode 100644 index 0000000..d930a31 --- /dev/null +++ b/html/toc-SmootLight.LightInstallation-module.html @@ -0,0 +1,35 @@ + + + + + LightInstallation + + + + + +

Module LightInstallation

+
+

Classes

+ LightInstallation

Functions

+ main

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.Profile-module.html b/html/toc-SmootLight.Profile-module.html new file mode 100644 index 0000000..229e743 --- /dev/null +++ b/html/toc-SmootLight.Profile-module.html @@ -0,0 +1,31 @@ + + + + + Profile + + + + + +

Module Profile

+
+

Variables

+ command

+[hide private] + + + + diff --git a/html/toc-SmootLight.TestAll-module.html b/html/toc-SmootLight.TestAll-module.html new file mode 100644 index 0000000..d8987a9 --- /dev/null +++ b/html/toc-SmootLight.TestAll-module.html @@ -0,0 +1,32 @@ + + + + + TestAll + + + + + +

Module TestAll

+
+

Variables

+ __package__
testSuite

+[hide private] + + + + diff --git a/html/toc-SmootLight.TestProfile-module.html b/html/toc-SmootLight.TestProfile-module.html new file mode 100644 index 0000000..3f546a9 --- /dev/null +++ b/html/toc-SmootLight.TestProfile-module.html @@ -0,0 +1,48 @@ + + + + + TestProfile + + + + + +

Module TestProfile

+
+

Functions

+ abc1
abc2
dictlookup
dist1
dist2
expapprox
exptest
main1
main2
normal_python
strucpack
weave_inloop
weave_outloop

Variables

+ a
command
numiter
x

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors-module.html b/html/toc-SmootLight.behaviors-module.html new file mode 100644 index 0000000..2e8db9b --- /dev/null +++ b/html/toc-SmootLight.behaviors-module.html @@ -0,0 +1,31 @@ + + + + + behaviors + + + + + +

Module behaviors

+
+

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.AddPixelEvent-module.html b/html/toc-SmootLight.behaviors.AddPixelEvent-module.html new file mode 100644 index 0000000..a8907dd --- /dev/null +++ b/html/toc-SmootLight.behaviors.AddPixelEvent-module.html @@ -0,0 +1,33 @@ + + + + + AddPixelEvent + + + + + +

Module AddPixelEvent

+
+

Classes

+ AddPixelEvent

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.AllPixels-module.html b/html/toc-SmootLight.behaviors.AllPixels-module.html new file mode 100644 index 0000000..83351d0 --- /dev/null +++ b/html/toc-SmootLight.behaviors.AllPixels-module.html @@ -0,0 +1,34 @@ + + + + + AllPixels + + + + + +

Module AllPixels

+
+

Classes

+ AllPixels

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.AllPixelsLeft-module.html b/html/toc-SmootLight.behaviors.AllPixelsLeft-module.html new file mode 100644 index 0000000..9634015 --- /dev/null +++ b/html/toc-SmootLight.behaviors.AllPixelsLeft-module.html @@ -0,0 +1,34 @@ + + + + + AllPixelsLeft + + + + + +

Module AllPixelsLeft

+
+

Classes

+ AllPixelsLeft

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.BehaviorChain-module.html b/html/toc-SmootLight.behaviors.BehaviorChain-module.html new file mode 100644 index 0000000..be470ba --- /dev/null +++ b/html/toc-SmootLight.behaviors.BehaviorChain-module.html @@ -0,0 +1,33 @@ + + + + + BehaviorChain + + + + + +

Module BehaviorChain

+
+

Classes

+ BehaviorChain

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.Circle-module.html b/html/toc-SmootLight.behaviors.Circle-module.html new file mode 100644 index 0000000..bcfe3f4 --- /dev/null +++ b/html/toc-SmootLight.behaviors.Circle-module.html @@ -0,0 +1,34 @@ + + + + + Circle + + + + + +

Module Circle

+
+

Classes

+ Circle

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.ColorChangerBehavior-module.html b/html/toc-SmootLight.behaviors.ColorChangerBehavior-module.html new file mode 100644 index 0000000..c55b7ae --- /dev/null +++ b/html/toc-SmootLight.behaviors.ColorChangerBehavior-module.html @@ -0,0 +1,34 @@ + + + + + ColorChangerBehavior + + + + + +

Module ColorChangerBehavior

+
+

Classes

+ ColorChangerBehavior

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.ColorShift-module.html b/html/toc-SmootLight.behaviors.ColorShift-module.html new file mode 100644 index 0000000..0ed7bb8 --- /dev/null +++ b/html/toc-SmootLight.behaviors.ColorShift-module.html @@ -0,0 +1,34 @@ + + + + + ColorShift + + + + + +

Module ColorShift

+
+

Classes

+ ColorShift

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.ControllerOSC-module.html b/html/toc-SmootLight.behaviors.ControllerOSC-module.html new file mode 100644 index 0000000..3b63d09 --- /dev/null +++ b/html/toc-SmootLight.behaviors.ControllerOSC-module.html @@ -0,0 +1,37 @@ + + + + + ControllerOSC + + + + + +

Module ControllerOSC

+
+

Classes

+ ControllerOSC

Functions

+ constrainLocation

Variables

+ __package__
speedfactor
vel_decay

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.DebugBehavior-module.html b/html/toc-SmootLight.behaviors.DebugBehavior-module.html new file mode 100644 index 0000000..1aa2029 --- /dev/null +++ b/html/toc-SmootLight.behaviors.DebugBehavior-module.html @@ -0,0 +1,33 @@ + + + + + DebugBehavior + + + + + +

Module DebugBehavior

+
+

Classes

+ DebugBehavior

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.DecayBehavior-module.html b/html/toc-SmootLight.behaviors.DecayBehavior-module.html new file mode 100644 index 0000000..461243a --- /dev/null +++ b/html/toc-SmootLight.behaviors.DecayBehavior-module.html @@ -0,0 +1,34 @@ + + + + + DecayBehavior + + + + + +

Module DecayBehavior

+
+

Classes

+ DecayBehavior

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.EchoBehavior-module.html b/html/toc-SmootLight.behaviors.EchoBehavior-module.html new file mode 100644 index 0000000..6d3c05f --- /dev/null +++ b/html/toc-SmootLight.behaviors.EchoBehavior-module.html @@ -0,0 +1,34 @@ + + + + + EchoBehavior + + + + + +

Module EchoBehavior

+
+

Classes

+ EchoBehavior

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.Expand-module.html b/html/toc-SmootLight.behaviors.Expand-module.html new file mode 100644 index 0000000..7425c4e --- /dev/null +++ b/html/toc-SmootLight.behaviors.Expand-module.html @@ -0,0 +1,34 @@ + + + + + Expand + + + + + +

Module Expand

+
+

Classes

+ Expand

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.ExpandingColorZones-module.html b/html/toc-SmootLight.behaviors.ExpandingColorZones-module.html new file mode 100644 index 0000000..dcd2408 --- /dev/null +++ b/html/toc-SmootLight.behaviors.ExpandingColorZones-module.html @@ -0,0 +1,33 @@ + + + + + ExpandingColorZones + + + + + +

Module ExpandingColorZones

+
+

Classes

+ ExpandingColorZones

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.Flasher-module.html b/html/toc-SmootLight.behaviors.Flasher-module.html new file mode 100644 index 0000000..2e86133 --- /dev/null +++ b/html/toc-SmootLight.behaviors.Flasher-module.html @@ -0,0 +1,34 @@ + + + + + Flasher + + + + + +

Module Flasher

+
+

Classes

+ Flasher

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.MITDoors-module.html b/html/toc-SmootLight.behaviors.MITDoors-module.html new file mode 100644 index 0000000..8a65dd8 --- /dev/null +++ b/html/toc-SmootLight.behaviors.MITDoors-module.html @@ -0,0 +1,34 @@ + + + + + MITDoors + + + + + +

Module MITDoors

+
+

Classes

+ MITDoors

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.MobileShakeBehavior-module.html b/html/toc-SmootLight.behaviors.MobileShakeBehavior-module.html new file mode 100644 index 0000000..7f5c493 --- /dev/null +++ b/html/toc-SmootLight.behaviors.MobileShakeBehavior-module.html @@ -0,0 +1,34 @@ + + + + + MobileShakeBehavior + + + + + +

Module MobileShakeBehavior

+
+

Classes

+ MobileShakeBehavior

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.ModifyParam-module.html b/html/toc-SmootLight.behaviors.ModifyParam-module.html new file mode 100644 index 0000000..b36fb23 --- /dev/null +++ b/html/toc-SmootLight.behaviors.ModifyParam-module.html @@ -0,0 +1,34 @@ + + + + + ModifyParam + + + + + +

Module ModifyParam

+
+

Classes

+ ModifyParam

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.ModulateColor-module.html b/html/toc-SmootLight.behaviors.ModulateColor-module.html new file mode 100644 index 0000000..c5e307a --- /dev/null +++ b/html/toc-SmootLight.behaviors.ModulateColor-module.html @@ -0,0 +1,34 @@ + + + + + ModulateColor + + + + + +

Module ModulateColor

+
+

Classes

+ ColorShift

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.MoveBehavior-module.html b/html/toc-SmootLight.behaviors.MoveBehavior-module.html new file mode 100644 index 0000000..595198a --- /dev/null +++ b/html/toc-SmootLight.behaviors.MoveBehavior-module.html @@ -0,0 +1,34 @@ + + + + + MoveBehavior + + + + + +

Module MoveBehavior

+
+

Classes

+ MoveBehavior

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.MrmrSetColor-module.html b/html/toc-SmootLight.behaviors.MrmrSetColor-module.html new file mode 100644 index 0000000..34cf817 --- /dev/null +++ b/html/toc-SmootLight.behaviors.MrmrSetColor-module.html @@ -0,0 +1,33 @@ + + + + + MrmrSetColor + + + + + +

Module MrmrSetColor

+
+

Classes

+ MrmrSetColor

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.Oval-module.html b/html/toc-SmootLight.behaviors.Oval-module.html new file mode 100644 index 0000000..ec8e7d9 --- /dev/null +++ b/html/toc-SmootLight.behaviors.Oval-module.html @@ -0,0 +1,34 @@ + + + + + Oval + + + + + +

Module Oval

+
+

Classes

+ Oval

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.RandomSetBrightColorBehavior-module.html b/html/toc-SmootLight.behaviors.RandomSetBrightColorBehavior-module.html new file mode 100644 index 0000000..9ed6e7a --- /dev/null +++ b/html/toc-SmootLight.behaviors.RandomSetBrightColorBehavior-module.html @@ -0,0 +1,34 @@ + + + + + RandomSetBrightColorBehavior + + + + + +

Module RandomSetBrightColorBehavior

+
+

Classes

+ RandomSetBrightColorBehavior

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.RandomWalk-module.html b/html/toc-SmootLight.behaviors.RandomWalk-module.html new file mode 100644 index 0000000..5bf167d --- /dev/null +++ b/html/toc-SmootLight.behaviors.RandomWalk-module.html @@ -0,0 +1,34 @@ + + + + + RandomWalk + + + + + +

Module RandomWalk

+
+

Classes

+ RandomWalk

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.RecursiveDecay-module.html b/html/toc-SmootLight.behaviors.RecursiveDecay-module.html new file mode 100644 index 0000000..531e354 --- /dev/null +++ b/html/toc-SmootLight.behaviors.RecursiveDecay-module.html @@ -0,0 +1,34 @@ + + + + + RecursiveDecay + + + + + +

Module RecursiveDecay

+
+

Classes

+ RecursiveDecay

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.ResponseMover-module.html b/html/toc-SmootLight.behaviors.ResponseMover-module.html new file mode 100644 index 0000000..e25d118 --- /dev/null +++ b/html/toc-SmootLight.behaviors.ResponseMover-module.html @@ -0,0 +1,34 @@ + + + + + ResponseMover + + + + + +

Module ResponseMover

+
+

Classes

+ ResponseMover

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.RestrictLocation-module.html b/html/toc-SmootLight.behaviors.RestrictLocation-module.html new file mode 100644 index 0000000..76a09cc --- /dev/null +++ b/html/toc-SmootLight.behaviors.RestrictLocation-module.html @@ -0,0 +1,34 @@ + + + + + RestrictLocation + + + + + +

Module RestrictLocation

+
+

Classes

+ RestrictLocation

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.RiseFall-module.html b/html/toc-SmootLight.behaviors.RiseFall-module.html new file mode 100644 index 0000000..f827adf --- /dev/null +++ b/html/toc-SmootLight.behaviors.RiseFall-module.html @@ -0,0 +1,34 @@ + + + + + RiseFall + + + + + +

Module RiseFall

+
+

Classes

+ RiseFall

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.RunningBehavior-module.html b/html/toc-SmootLight.behaviors.RunningBehavior-module.html new file mode 100644 index 0000000..c9751c8 --- /dev/null +++ b/html/toc-SmootLight.behaviors.RunningBehavior-module.html @@ -0,0 +1,34 @@ + + + + + RunningBehavior + + + + + +

Module RunningBehavior

+
+

Classes

+ RunningBehavior

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.Sink-module.html b/html/toc-SmootLight.behaviors.Sink-module.html new file mode 100644 index 0000000..6004edd --- /dev/null +++ b/html/toc-SmootLight.behaviors.Sink-module.html @@ -0,0 +1,34 @@ + + + + + Sink + + + + + +

Module Sink

+
+

Classes

+ Sink

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.SmootWind-module.html b/html/toc-SmootLight.behaviors.SmootWind-module.html new file mode 100644 index 0000000..1c8adc9 --- /dev/null +++ b/html/toc-SmootLight.behaviors.SmootWind-module.html @@ -0,0 +1,34 @@ + + + + + SmootWind + + + + + +

Module SmootWind

+
+

Classes

+ SmootWind

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.Square-module.html b/html/toc-SmootLight.behaviors.Square-module.html new file mode 100644 index 0000000..0e89e11 --- /dev/null +++ b/html/toc-SmootLight.behaviors.Square-module.html @@ -0,0 +1,34 @@ + + + + + Square + + + + + +

Module Square

+
+

Classes

+ Square

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.SwitchBehavior-module.html b/html/toc-SmootLight.behaviors.SwitchBehavior-module.html new file mode 100644 index 0000000..43c3a8f --- /dev/null +++ b/html/toc-SmootLight.behaviors.SwitchBehavior-module.html @@ -0,0 +1,34 @@ + + + + + SwitchBehavior + + + + + +

Module SwitchBehavior

+
+

Classes

+ SwitchBehavior

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.SynchTest-module.html b/html/toc-SmootLight.behaviors.SynchTest-module.html new file mode 100644 index 0000000..a670749 --- /dev/null +++ b/html/toc-SmootLight.behaviors.SynchTest-module.html @@ -0,0 +1,34 @@ + + + + + SynchTest + + + + + +

Module SynchTest

+
+

Classes

+ SynchTest

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.TimeSwitch-module.html b/html/toc-SmootLight.behaviors.TimeSwitch-module.html new file mode 100644 index 0000000..d366e9a --- /dev/null +++ b/html/toc-SmootLight.behaviors.TimeSwitch-module.html @@ -0,0 +1,33 @@ + + + + + TimeSwitch + + + + + +

Module TimeSwitch

+
+

Classes

+ TimeSwitch

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.TimedDie-module.html b/html/toc-SmootLight.behaviors.TimedDie-module.html new file mode 100644 index 0000000..335793e --- /dev/null +++ b/html/toc-SmootLight.behaviors.TimedDie-module.html @@ -0,0 +1,34 @@ + + + + + TimedDie + + + + + +

Module TimedDie

+
+

Classes

+ Timeout

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.Timeout-module.html b/html/toc-SmootLight.behaviors.Timeout-module.html new file mode 100644 index 0000000..4d6c158 --- /dev/null +++ b/html/toc-SmootLight.behaviors.Timeout-module.html @@ -0,0 +1,34 @@ + + + + + Timeout + + + + + +

Module Timeout

+
+

Classes

+ Timeout

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.TouchOSC-module.html b/html/toc-SmootLight.behaviors.TouchOSC-module.html new file mode 100644 index 0000000..05b02aa --- /dev/null +++ b/html/toc-SmootLight.behaviors.TouchOSC-module.html @@ -0,0 +1,33 @@ + + + + + TouchOSC + + + + + +

Module TouchOSC

+
+

Classes

+ TouchOSC

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.VerticalBar-module.html b/html/toc-SmootLight.behaviors.VerticalBar-module.html new file mode 100644 index 0000000..1f43992 --- /dev/null +++ b/html/toc-SmootLight.behaviors.VerticalBar-module.html @@ -0,0 +1,34 @@ + + + + + VerticalBar + + + + + +

Module VerticalBar

+
+

Classes

+ VerticalBar

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.behaviors.XYMove-module.html b/html/toc-SmootLight.behaviors.XYMove-module.html new file mode 100644 index 0000000..5104abc --- /dev/null +++ b/html/toc-SmootLight.behaviors.XYMove-module.html @@ -0,0 +1,34 @@ + + + + + XYMove + + + + + +

Module XYMove

+
+

Classes

+ XYMove

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.inputs-module.html b/html/toc-SmootLight.inputs-module.html new file mode 100644 index 0000000..7137587 --- /dev/null +++ b/html/toc-SmootLight.inputs-module.html @@ -0,0 +1,31 @@ + + + + + inputs + + + + + +

Module inputs

+
+

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.inputs.ContinuousCenterInput-module.html b/html/toc-SmootLight.inputs.ContinuousCenterInput-module.html new file mode 100644 index 0000000..2b4033d --- /dev/null +++ b/html/toc-SmootLight.inputs.ContinuousCenterInput-module.html @@ -0,0 +1,35 @@ + + + + + ContinuousCenterInput + + + + + +

Module ContinuousCenterInput

+
+

Classes

+ ContinuousCenterInput

Variables

+ __package__
exception_log
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.inputs.ContinuousLocationInput-module.html b/html/toc-SmootLight.inputs.ContinuousLocationInput-module.html new file mode 100644 index 0000000..8355d78 --- /dev/null +++ b/html/toc-SmootLight.inputs.ContinuousLocationInput-module.html @@ -0,0 +1,35 @@ + + + + + ContinuousLocationInput + + + + + +

Module ContinuousLocationInput

+
+

Classes

+ ContinuousLocationInput

Variables

+ __package__
exception_log
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.inputs.HTMLInput-module.html b/html/toc-SmootLight.inputs.HTMLInput-module.html new file mode 100644 index 0000000..9be5656 --- /dev/null +++ b/html/toc-SmootLight.inputs.HTMLInput-module.html @@ -0,0 +1,35 @@ + + + + + HTMLInput + + + + + +

Module HTMLInput

+
+

Classes

+ HTMLInput

Variables

+ __package__
exception_log
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.inputs.OSCInput-module.html b/html/toc-SmootLight.inputs.OSCInput-module.html new file mode 100644 index 0000000..b07fefe --- /dev/null +++ b/html/toc-SmootLight.inputs.OSCInput-module.html @@ -0,0 +1,34 @@ + + + + + OSCInput + + + + + +

Module OSCInput

+
+

Classes

+ OSCInput

Variables

+ __package__
exception_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.inputs.PygameInput-module.html b/html/toc-SmootLight.inputs.PygameInput-module.html new file mode 100644 index 0000000..62456bc --- /dev/null +++ b/html/toc-SmootLight.inputs.PygameInput-module.html @@ -0,0 +1,289 @@ + + + + + PygameInput + + + + + +

Module PygameInput

+
+

Classes

+ PygameInput

Variables

+ ACTIVEEVENT
ANYFORMAT
ASYNCBLIT
AUDIO_S16
AUDIO_S16LSB
AUDIO_S16MSB
AUDIO_S16SYS
AUDIO_S8
AUDIO_U16
AUDIO_U16LSB
AUDIO_U16MSB
AUDIO_U16SYS
AUDIO_U8
BIG_ENDIAN
BLEND_ADD
BLEND_MAX
BLEND_MIN
BLEND_MULT
BLEND_RGBA_ADD
BLEND_RGBA_MAX
BLEND_RGBA_MIN
BLEND_RGBA_MULT
BLEND_RGBA_SUB
BLEND_RGB_ADD
BLEND_RGB_MAX
BLEND_RGB_MIN
BLEND_RGB_MULT
BLEND_RGB_SUB
BLEND_SUB
BUTTON_X1
BUTTON_X2
DOUBLEBUF
FULLSCREEN
GL_ACCELERATED_VISUAL
GL_ACCUM_ALPHA_SIZE
GL_ACCUM_BLUE_SIZE
GL_ACCUM_GREEN_SIZE
GL_ACCUM_RED_SIZE
GL_ALPHA_SIZE
GL_BLUE_SIZE
GL_BUFFER_SIZE
GL_DEPTH_SIZE
GL_DOUBLEBUFFER
GL_GREEN_SIZE
GL_MULTISAMPLEBUFFERS
GL_MULTISAMPLESAMPLES
GL_RED_SIZE
GL_STENCIL_SIZE
GL_STEREO
GL_SWAP_CONTROL
HAT_CENTERED
HAT_DOWN
HAT_LEFT
HAT_LEFTDOWN
HAT_LEFTUP
HAT_RIGHT
HAT_RIGHTDOWN
HAT_RIGHTUP
HAT_UP
HWACCEL
HWPALETTE
HWSURFACE
IYUV_OVERLAY
JOYAXISMOTION
JOYBALLMOTION
JOYBUTTONDOWN
JOYBUTTONUP
JOYHATMOTION
KEYDOWN
KEYUP
KMOD_ALT
KMOD_CAPS
KMOD_CTRL
KMOD_LALT
KMOD_LCTRL
KMOD_LMETA
KMOD_LSHIFT
KMOD_META
KMOD_MODE
KMOD_NONE
KMOD_NUM
KMOD_RALT
KMOD_RCTRL
KMOD_RMETA
KMOD_RSHIFT
KMOD_SHIFT
K_0
K_1
K_2
K_3
K_4
K_5
K_6
K_7
K_8
K_9
K_AMPERSAND
K_ASTERISK
K_AT
K_BACKQUOTE
K_BACKSLASH
K_BACKSPACE
K_BREAK
K_CAPSLOCK
K_CARET
K_CLEAR
K_COLON
K_COMMA
K_DELETE
K_DOLLAR
K_DOWN
K_END
K_EQUALS
K_ESCAPE
K_EURO
K_EXCLAIM
K_F1
K_F10
K_F11
K_F12
K_F13
K_F14
K_F15
K_F2
K_F3
K_F4
K_F5
K_F6
K_F7
K_F8
K_F9
K_FIRST
K_GREATER
K_HASH
K_HELP
K_HOME
K_INSERT
K_KP0
K_KP1
K_KP2
K_KP3
K_KP4
K_KP5
K_KP6
K_KP7
K_KP8
K_KP9
K_KP_DIVIDE
K_KP_ENTER
K_KP_EQUALS
K_KP_MINUS
K_KP_MULTIPLY
K_KP_PERIOD
K_KP_PLUS
K_LALT
K_LAST
K_LCTRL
K_LEFT
K_LEFTBRACKET
K_LEFTPAREN
K_LESS
K_LMETA
K_LSHIFT
K_LSUPER
K_MENU
K_MINUS
K_MODE
K_NUMLOCK
K_PAGEDOWN
K_PAGEUP
K_PAUSE
K_PERIOD
K_PLUS
K_POWER
K_PRINT
K_QUESTION
K_QUOTE
K_QUOTEDBL
K_RALT
K_RCTRL
K_RETURN
K_RIGHT
K_RIGHTBRACKET
K_RIGHTPAREN
K_RMETA
K_RSHIFT
K_RSUPER
K_SCROLLOCK
K_SEMICOLON
K_SLASH
K_SPACE
K_SYSREQ
K_TAB
K_UNDERSCORE
K_UNKNOWN
K_UP
K_a
K_b
K_c
K_d
K_e
K_f
K_g
K_h
K_i
K_j
K_k
K_l
K_m
K_n
K_o
K_p
K_q
K_r
K_s
K_t
K_u
K_v
K_w
K_x
K_y
K_z
LIL_ENDIAN
MOUSEBUTTONDOWN
MOUSEBUTTONUP
MOUSEMOTION
NOEVENT
NOFRAME
NUMEVENTS
OPENGL
OPENGLBLIT
PREALLOC
QUIT
RESIZABLE
RLEACCEL
RLEACCELOK
SCRAP_BMP
SCRAP_CLIPBOARD
SCRAP_PBM
SCRAP_PPM
SCRAP_SELECTION
SCRAP_TEXT
SRCALPHA
SRCCOLORKEY
SWSURFACE
SYSWMEVENT
TIMER_RESOLUTION
USEREVENT
UYVY_OVERLAY
VIDEOEXPOSE
VIDEORESIZE
YUY2_OVERLAY
YV12_OVERLAY
YVYU_OVERLAY
__package__
exception_log
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.inputs.RandomLocs-module.html b/html/toc-SmootLight.inputs.RandomLocs-module.html new file mode 100644 index 0000000..1638657 --- /dev/null +++ b/html/toc-SmootLight.inputs.RandomLocs-module.html @@ -0,0 +1,35 @@ + + + + + RandomLocs + + + + + +

Module RandomLocs

+
+

Classes

+ RandomLocs

Variables

+ __package__
exception_log
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.inputs.TCPInput-module.html b/html/toc-SmootLight.inputs.TCPInput-module.html new file mode 100644 index 0000000..332c416 --- /dev/null +++ b/html/toc-SmootLight.inputs.TCPInput-module.html @@ -0,0 +1,34 @@ + + + + + TCPInput + + + + + +

Module TCPInput

+
+

Classes

+ TCPInput

Variables

+ __package__
exception_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.inputs.TCPInput_backup-module.html b/html/toc-SmootLight.inputs.TCPInput_backup-module.html new file mode 100644 index 0000000..a1f276b --- /dev/null +++ b/html/toc-SmootLight.inputs.TCPInput_backup-module.html @@ -0,0 +1,31 @@ + + + + + TCPInput_backup + + + + + +

Module TCPInput_backup

+
+

Classes

+ TCPInput

+[hide private] + + + + diff --git a/html/toc-SmootLight.inputs.UDPInput-module.html b/html/toc-SmootLight.inputs.UDPInput-module.html new file mode 100644 index 0000000..3cdba38 --- /dev/null +++ b/html/toc-SmootLight.inputs.UDPInput-module.html @@ -0,0 +1,35 @@ + + + + + UDPInput + + + + + +

Module UDPInput

+
+

Classes

+ UDPInput

Variables

+ __package__
exception_log
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.layouts-module.html b/html/toc-SmootLight.layouts-module.html new file mode 100644 index 0000000..ca6e8bd --- /dev/null +++ b/html/toc-SmootLight.layouts-module.html @@ -0,0 +1,31 @@ + + + + + layouts + + + + + +

Module layouts

+
+

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.layouts.LineLayout-module.html b/html/toc-SmootLight.layouts.LineLayout-module.html new file mode 100644 index 0000000..7f199f3 --- /dev/null +++ b/html/toc-SmootLight.layouts.LineLayout-module.html @@ -0,0 +1,33 @@ + + + + + LineLayout + + + + + +

Module LineLayout

+
+

Classes

+ LineLayout

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.layouts.SpecifiedLayout-module.html b/html/toc-SmootLight.layouts.SpecifiedLayout-module.html new file mode 100644 index 0000000..5a70682 --- /dev/null +++ b/html/toc-SmootLight.layouts.SpecifiedLayout-module.html @@ -0,0 +1,33 @@ + + + + + SpecifiedLayout + + + + + +

Module SpecifiedLayout

+
+

Classes

+ SpecifiedLayout

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.layouts.ZigzagLayout-module.html b/html/toc-SmootLight.layouts.ZigzagLayout-module.html new file mode 100644 index 0000000..058007d --- /dev/null +++ b/html/toc-SmootLight.layouts.ZigzagLayout-module.html @@ -0,0 +1,33 @@ + + + + + ZigzagLayout + + + + + +

Module ZigzagLayout

+
+

Classes

+ ZigzagLayout

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.logger-module.html b/html/toc-SmootLight.logger-module.html new file mode 100644 index 0000000..f2c4203 --- /dev/null +++ b/html/toc-SmootLight.logger-module.html @@ -0,0 +1,31 @@ + + + + + logger + + + + + +

Module logger

+
+

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.logger.Logger-module.html b/html/toc-SmootLight.logger.Logger-module.html new file mode 100644 index 0000000..1cd8f6c --- /dev/null +++ b/html/toc-SmootLight.logger.Logger-module.html @@ -0,0 +1,34 @@ + + + + + Logger + + + + + +

Module Logger

+
+

Variables

+ __package__
exception_log
main_log
screen_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.logger.UTF8LogFormatter-module.html b/html/toc-SmootLight.logger.UTF8LogFormatter-module.html new file mode 100644 index 0000000..83e33be --- /dev/null +++ b/html/toc-SmootLight.logger.UTF8LogFormatter-module.html @@ -0,0 +1,33 @@ + + + + + UTF8LogFormatter + + + + + +

Module UTF8LogFormatter

+
+

Classes

+ UTF8LogFormatter

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.operationscore-module.html b/html/toc-SmootLight.operationscore-module.html new file mode 100644 index 0000000..20ea34a --- /dev/null +++ b/html/toc-SmootLight.operationscore-module.html @@ -0,0 +1,31 @@ + + + + + operationscore + + + + + +

Module operationscore

+
+

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.operationscore.Behavior-module.html b/html/toc-SmootLight.operationscore.Behavior-module.html new file mode 100644 index 0000000..733809f --- /dev/null +++ b/html/toc-SmootLight.operationscore.Behavior-module.html @@ -0,0 +1,33 @@ + + + + + Behavior + + + + + +

Module Behavior

+
+

Classes

+ Behavior

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.operationscore.Input-module.html b/html/toc-SmootLight.operationscore.Input-module.html new file mode 100644 index 0000000..95841f1 --- /dev/null +++ b/html/toc-SmootLight.operationscore.Input-module.html @@ -0,0 +1,33 @@ + + + + + Input + + + + + +

Module Input

+
+

Classes

+ Input

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.operationscore.PixelAssembler-module.html b/html/toc-SmootLight.operationscore.PixelAssembler-module.html new file mode 100644 index 0000000..a53a20f --- /dev/null +++ b/html/toc-SmootLight.operationscore.PixelAssembler-module.html @@ -0,0 +1,33 @@ + + + + + PixelAssembler + + + + + +

Module PixelAssembler

+
+

Classes

+ PixelAssembler

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.operationscore.PixelEvent-module.html b/html/toc-SmootLight.operationscore.PixelEvent-module.html new file mode 100644 index 0000000..5614fe9 --- /dev/null +++ b/html/toc-SmootLight.operationscore.PixelEvent-module.html @@ -0,0 +1,33 @@ + + + + + PixelEvent + + + + + +

Module PixelEvent

+
+

Classes

+ PixelEvent

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.operationscore.PixelMapper-module.html b/html/toc-SmootLight.operationscore.PixelMapper-module.html new file mode 100644 index 0000000..c889c02 --- /dev/null +++ b/html/toc-SmootLight.operationscore.PixelMapper-module.html @@ -0,0 +1,33 @@ + + + + + PixelMapper + + + + + +

Module PixelMapper

+
+

Classes

+ PixelMapper

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.operationscore.Renderer-module.html b/html/toc-SmootLight.operationscore.Renderer-module.html new file mode 100644 index 0000000..2e0df1f --- /dev/null +++ b/html/toc-SmootLight.operationscore.Renderer-module.html @@ -0,0 +1,33 @@ + + + + + Renderer + + + + + +

Module Renderer

+
+

Classes

+ Renderer

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.operationscore.SmootCoreObject-module.html b/html/toc-SmootLight.operationscore.SmootCoreObject-module.html new file mode 100644 index 0000000..af9df6f --- /dev/null +++ b/html/toc-SmootLight.operationscore.SmootCoreObject-module.html @@ -0,0 +1,33 @@ + + + + + SmootCoreObject + + + + + +

Module SmootCoreObject

+
+

Classes

+ SmootCoreObject

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.operationscore.ThreadedSmootCoreObject-module.html b/html/toc-SmootLight.operationscore.ThreadedSmootCoreObject-module.html new file mode 100644 index 0000000..a2d53e4 --- /dev/null +++ b/html/toc-SmootLight.operationscore.ThreadedSmootCoreObject-module.html @@ -0,0 +1,33 @@ + + + + + ThreadedSmootCoreObject + + + + + +

Module ThreadedSmootCoreObject

+
+

Classes

+ ThreadedSmootCoreObject

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.pixelcore-module.html b/html/toc-SmootLight.pixelcore-module.html new file mode 100644 index 0000000..3f71d91 --- /dev/null +++ b/html/toc-SmootLight.pixelcore-module.html @@ -0,0 +1,31 @@ + + + + + pixelcore + + + + + +

Module pixelcore

+
+

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.pixelcore.Pixel-module.html b/html/toc-SmootLight.pixelcore.Pixel-module.html new file mode 100644 index 0000000..70d8c04 --- /dev/null +++ b/html/toc-SmootLight.pixelcore.Pixel-module.html @@ -0,0 +1,33 @@ + + + + + Pixel + + + + + +

Module Pixel

+
+

Classes

+ Pixel

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.pixelcore.PixelStrip-module.html b/html/toc-SmootLight.pixelcore.PixelStrip-module.html new file mode 100644 index 0000000..d871906 --- /dev/null +++ b/html/toc-SmootLight.pixelcore.PixelStrip-module.html @@ -0,0 +1,34 @@ + + + + + PixelStrip + + + + + +

Module PixelStrip

+
+

Classes

+ PixelStrip

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.pixelcore.Screen-module.html b/html/toc-SmootLight.pixelcore.Screen-module.html new file mode 100644 index 0000000..13d20e3 --- /dev/null +++ b/html/toc-SmootLight.pixelcore.Screen-module.html @@ -0,0 +1,33 @@ + + + + + Screen + + + + + +

Module Screen

+
+

Classes

+ Screen

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.pixelevents-module.html b/html/toc-SmootLight.pixelevents-module.html new file mode 100644 index 0000000..599afdb --- /dev/null +++ b/html/toc-SmootLight.pixelevents-module.html @@ -0,0 +1,31 @@ + + + + + pixelevents + + + + + +

Module pixelevents

+
+

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.pixelevents.DecayEvent-module.html b/html/toc-SmootLight.pixelevents.DecayEvent-module.html new file mode 100644 index 0000000..f193b2f --- /dev/null +++ b/html/toc-SmootLight.pixelevents.DecayEvent-module.html @@ -0,0 +1,33 @@ + + + + + DecayEvent + + + + + +

Module DecayEvent

+
+

Classes

+ DecayEvent

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.pixelevents.SingleFrameEvent-module.html b/html/toc-SmootLight.pixelevents.SingleFrameEvent-module.html new file mode 100644 index 0000000..40be3b8 --- /dev/null +++ b/html/toc-SmootLight.pixelevents.SingleFrameEvent-module.html @@ -0,0 +1,33 @@ + + + + + SingleFrameEvent + + + + + +

Module SingleFrameEvent

+
+

Classes

+ SingleFrameEvent

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.pixelevents.StepEvent-module.html b/html/toc-SmootLight.pixelevents.StepEvent-module.html new file mode 100644 index 0000000..d8a3c75 --- /dev/null +++ b/html/toc-SmootLight.pixelevents.StepEvent-module.html @@ -0,0 +1,33 @@ + + + + + StepEvent + + + + + +

Module StepEvent

+
+

Classes

+ StepEvent

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.pixelevents.SynchTestEvent-module.html b/html/toc-SmootLight.pixelevents.SynchTestEvent-module.html new file mode 100644 index 0000000..02bff92 --- /dev/null +++ b/html/toc-SmootLight.pixelevents.SynchTestEvent-module.html @@ -0,0 +1,33 @@ + + + + + SynchTestEvent + + + + + +

Module SynchTestEvent

+
+

Classes

+ SynchTestEvent

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.pixelmappers-module.html b/html/toc-SmootLight.pixelmappers-module.html new file mode 100644 index 0000000..128d428 --- /dev/null +++ b/html/toc-SmootLight.pixelmappers-module.html @@ -0,0 +1,31 @@ + + + + + pixelmappers + + + + + +

Module pixelmappers

+
+

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.pixelmappers.C5SignMapper-module.html b/html/toc-SmootLight.pixelmappers.C5SignMapper-module.html new file mode 100644 index 0000000..d0c172e --- /dev/null +++ b/html/toc-SmootLight.pixelmappers.C5SignMapper-module.html @@ -0,0 +1,34 @@ + + + + + C5SignMapper + + + + + +

Module C5SignMapper

+
+

Classes

+ C5SignMapper

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.pixelmappers.GaussianMapper-module.html b/html/toc-SmootLight.pixelmappers.GaussianMapper-module.html new file mode 100644 index 0000000..4ebbe09 --- /dev/null +++ b/html/toc-SmootLight.pixelmappers.GaussianMapper-module.html @@ -0,0 +1,34 @@ + + + + + GaussianMapper + + + + + +

Module GaussianMapper

+
+

Classes

+ GaussianMapper

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.pixelmappers.SimpleMapper-module.html b/html/toc-SmootLight.pixelmappers.SimpleMapper-module.html new file mode 100644 index 0000000..6972377 --- /dev/null +++ b/html/toc-SmootLight.pixelmappers.SimpleMapper-module.html @@ -0,0 +1,34 @@ + + + + + SimpleMapper + + + + + +

Module SimpleMapper

+
+

Classes

+ SimpleMapper

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.pixelmappers.WindGaussianMapper-module.html b/html/toc-SmootLight.pixelmappers.WindGaussianMapper-module.html new file mode 100644 index 0000000..2d7f875 --- /dev/null +++ b/html/toc-SmootLight.pixelmappers.WindGaussianMapper-module.html @@ -0,0 +1,34 @@ + + + + + WindGaussianMapper + + + + + +

Module WindGaussianMapper

+
+

Classes

+ WindGaussianMapper

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.renderers-module.html b/html/toc-SmootLight.renderers-module.html new file mode 100644 index 0000000..aefb91f --- /dev/null +++ b/html/toc-SmootLight.renderers-module.html @@ -0,0 +1,31 @@ + + + + + renderers + + + + + +

Module renderers

+
+

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.renderers.IndoorRenderer-module.html b/html/toc-SmootLight.renderers.IndoorRenderer-module.html new file mode 100644 index 0000000..4095dc2 --- /dev/null +++ b/html/toc-SmootLight.renderers.IndoorRenderer-module.html @@ -0,0 +1,34 @@ + + + + + IndoorRenderer + + + + + +

Module IndoorRenderer

+
+

Classes

+ IndoorRenderer

Variables

+ __package__
sock_port

+[hide private] + + + + diff --git a/html/toc-SmootLight.renderers.PygameRenderer-module.html b/html/toc-SmootLight.renderers.PygameRenderer-module.html new file mode 100644 index 0000000..6fe85a7 --- /dev/null +++ b/html/toc-SmootLight.renderers.PygameRenderer-module.html @@ -0,0 +1,287 @@ + + + + + PygameRenderer + + + + + +

Module PygameRenderer

+
+

Classes

+ PygameRenderer

Variables

+ ACTIVEEVENT
ANYFORMAT
ASYNCBLIT
AUDIO_S16
AUDIO_S16LSB
AUDIO_S16MSB
AUDIO_S16SYS
AUDIO_S8
AUDIO_U16
AUDIO_U16LSB
AUDIO_U16MSB
AUDIO_U16SYS
AUDIO_U8
BIG_ENDIAN
BLEND_ADD
BLEND_MAX
BLEND_MIN
BLEND_MULT
BLEND_RGBA_ADD
BLEND_RGBA_MAX
BLEND_RGBA_MIN
BLEND_RGBA_MULT
BLEND_RGBA_SUB
BLEND_RGB_ADD
BLEND_RGB_MAX
BLEND_RGB_MIN
BLEND_RGB_MULT
BLEND_RGB_SUB
BLEND_SUB
BUTTON_X1
BUTTON_X2
DOUBLEBUF
FULLSCREEN
GL_ACCELERATED_VISUAL
GL_ACCUM_ALPHA_SIZE
GL_ACCUM_BLUE_SIZE
GL_ACCUM_GREEN_SIZE
GL_ACCUM_RED_SIZE
GL_ALPHA_SIZE
GL_BLUE_SIZE
GL_BUFFER_SIZE
GL_DEPTH_SIZE
GL_DOUBLEBUFFER
GL_GREEN_SIZE
GL_MULTISAMPLEBUFFERS
GL_MULTISAMPLESAMPLES
GL_RED_SIZE
GL_STENCIL_SIZE
GL_STEREO
GL_SWAP_CONTROL
HAT_CENTERED
HAT_DOWN
HAT_LEFT
HAT_LEFTDOWN
HAT_LEFTUP
HAT_RIGHT
HAT_RIGHTDOWN
HAT_RIGHTUP
HAT_UP
HWACCEL
HWPALETTE
HWSURFACE
IYUV_OVERLAY
JOYAXISMOTION
JOYBALLMOTION
JOYBUTTONDOWN
JOYBUTTONUP
JOYHATMOTION
KEYDOWN
KEYUP
KMOD_ALT
KMOD_CAPS
KMOD_CTRL
KMOD_LALT
KMOD_LCTRL
KMOD_LMETA
KMOD_LSHIFT
KMOD_META
KMOD_MODE
KMOD_NONE
KMOD_NUM
KMOD_RALT
KMOD_RCTRL
KMOD_RMETA
KMOD_RSHIFT
KMOD_SHIFT
K_0
K_1
K_2
K_3
K_4
K_5
K_6
K_7
K_8
K_9
K_AMPERSAND
K_ASTERISK
K_AT
K_BACKQUOTE
K_BACKSLASH
K_BACKSPACE
K_BREAK
K_CAPSLOCK
K_CARET
K_CLEAR
K_COLON
K_COMMA
K_DELETE
K_DOLLAR
K_DOWN
K_END
K_EQUALS
K_ESCAPE
K_EURO
K_EXCLAIM
K_F1
K_F10
K_F11
K_F12
K_F13
K_F14
K_F15
K_F2
K_F3
K_F4
K_F5
K_F6
K_F7
K_F8
K_F9
K_FIRST
K_GREATER
K_HASH
K_HELP
K_HOME
K_INSERT
K_KP0
K_KP1
K_KP2
K_KP3
K_KP4
K_KP5
K_KP6
K_KP7
K_KP8
K_KP9
K_KP_DIVIDE
K_KP_ENTER
K_KP_EQUALS
K_KP_MINUS
K_KP_MULTIPLY
K_KP_PERIOD
K_KP_PLUS
K_LALT
K_LAST
K_LCTRL
K_LEFT
K_LEFTBRACKET
K_LEFTPAREN
K_LESS
K_LMETA
K_LSHIFT
K_LSUPER
K_MENU
K_MINUS
K_MODE
K_NUMLOCK
K_PAGEDOWN
K_PAGEUP
K_PAUSE
K_PERIOD
K_PLUS
K_POWER
K_PRINT
K_QUESTION
K_QUOTE
K_QUOTEDBL
K_RALT
K_RCTRL
K_RETURN
K_RIGHT
K_RIGHTBRACKET
K_RIGHTPAREN
K_RMETA
K_RSHIFT
K_RSUPER
K_SCROLLOCK
K_SEMICOLON
K_SLASH
K_SPACE
K_SYSREQ
K_TAB
K_UNDERSCORE
K_UNKNOWN
K_UP
K_a
K_b
K_c
K_d
K_e
K_f
K_g
K_h
K_i
K_j
K_k
K_l
K_m
K_n
K_o
K_p
K_q
K_r
K_s
K_t
K_u
K_v
K_w
K_x
K_y
K_z
LIL_ENDIAN
MOUSEBUTTONDOWN
MOUSEBUTTONUP
MOUSEMOTION
NOEVENT
NOFRAME
NUMEVENTS
OPENGL
OPENGLBLIT
PREALLOC
QUIT
RESIZABLE
RLEACCEL
RLEACCELOK
SCRAP_BMP
SCRAP_CLIPBOARD
SCRAP_PBM
SCRAP_PPM
SCRAP_SELECTION
SCRAP_TEXT
SRCALPHA
SRCCOLORKEY
SWSURFACE
SYSWMEVENT
TIMER_RESOLUTION
USEREVENT
UYVY_OVERLAY
VIDEOEXPOSE
VIDEORESIZE
YUY2_OVERLAY
YV12_OVERLAY
YVYU_OVERLAY
__package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.tests-module.html b/html/toc-SmootLight.tests-module.html new file mode 100644 index 0000000..043557a --- /dev/null +++ b/html/toc-SmootLight.tests-module.html @@ -0,0 +1,31 @@ + + + + + tests + + + + + +

Module tests

+
+

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.tests.TestBQS'-module.html b/html/toc-SmootLight.tests.TestBQS'-module.html new file mode 100644 index 0000000..f18f4dd --- /dev/null +++ b/html/toc-SmootLight.tests.TestBQS'-module.html @@ -0,0 +1,34 @@ + + + + + TestBQS' + + + + + +

Module TestBQS'

+
+

Classes

+ TestBQS

Variables

+ __package__
main_log

+[hide private] + + + + diff --git a/html/toc-SmootLight.tests.TestComponentRegistry'-module.html b/html/toc-SmootLight.tests.TestComponentRegistry'-module.html new file mode 100644 index 0000000..ba44372 --- /dev/null +++ b/html/toc-SmootLight.tests.TestComponentRegistry'-module.html @@ -0,0 +1,33 @@ + + + + + TestComponentRegistry' + + + + + +

Module TestComponentRegistry'

+
+

Classes

+ TestComponentRegistry

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.tests.TestConfigLoaders'-module.html b/html/toc-SmootLight.tests.TestConfigLoaders'-module.html new file mode 100644 index 0000000..927feeb --- /dev/null +++ b/html/toc-SmootLight.tests.TestConfigLoaders'-module.html @@ -0,0 +1,34 @@ + + + + + TestConfigLoaders' + + + + + +

Module TestConfigLoaders'

+
+

Classes

+ TestConfigLoaders

Variables

+ VERSION
__package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.tests.TestSwitchBehavior-module.html b/html/toc-SmootLight.tests.TestSwitchBehavior-module.html new file mode 100644 index 0000000..f83b337 --- /dev/null +++ b/html/toc-SmootLight.tests.TestSwitchBehavior-module.html @@ -0,0 +1,33 @@ + + + + + TestSwitchBehavior + + + + + +

Module TestSwitchBehavior

+
+

Classes

+ TestSwitchBehavior

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.tests.testosc-module.html b/html/toc-SmootLight.tests.testosc-module.html new file mode 100644 index 0000000..8f46ac1 --- /dev/null +++ b/html/toc-SmootLight.tests.testosc-module.html @@ -0,0 +1,35 @@ + + + + + testosc + + + + + +

Module testosc

+
+

Functions

+ fallback
foo_bar_callback
foo_baz_callback

Variables

+ server

+[hide private] + + + + diff --git a/html/toc-SmootLight.util-module.html b/html/toc-SmootLight.util-module.html new file mode 100644 index 0000000..3751730 --- /dev/null +++ b/html/toc-SmootLight.util-module.html @@ -0,0 +1,31 @@ + + + + + util + + + + + +

Module util

+
+

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.util.BehaviorQuerySystem-module.html b/html/toc-SmootLight.util.BehaviorQuerySystem-module.html new file mode 100644 index 0000000..b35088b --- /dev/null +++ b/html/toc-SmootLight.util.BehaviorQuerySystem-module.html @@ -0,0 +1,39 @@ + + + + + BehaviorQuerySystem + + + + + +

Module BehaviorQuerySystem

+
+

Functions

+ addBehavior
getBehaviorsNear
getDistLambda
initBQS
query

Variables

+ __package__
behaviorList
initialized

+[hide private] + + + + diff --git a/html/toc-SmootLight.util.ColorOps-module.html b/html/toc-SmootLight.util.ColorOps-module.html new file mode 100644 index 0000000..286fb74 --- /dev/null +++ b/html/toc-SmootLight.util.ColorOps-module.html @@ -0,0 +1,41 @@ + + + + + ColorOps + + + + + +

Module ColorOps

+
+

Classes

+ Color

Functions

+ chooseRandomColor
combineColors
floatToIntColor
multiplyColor
randomBrightColor
randomColor
safeColor

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.util.ComponentRegistry-module.html b/html/toc-SmootLight.util.ComponentRegistry-module.html new file mode 100644 index 0000000..33faee5 --- /dev/null +++ b/html/toc-SmootLight.util.ComponentRegistry-module.html @@ -0,0 +1,43 @@ + + + + + ComponentRegistry + + + + + +

Module ComponentRegistry

+
+

Functions

+ clearRegistry
getComponent
getLock
getNewId
initRegistry
makelock
registerComponent
removeComponent
verifyUniqueId

Variables

+ Registry
__package__
utilLock

+[hide private] + + + + diff --git a/html/toc-SmootLight.util.Config-module.html b/html/toc-SmootLight.util.Config-module.html new file mode 100644 index 0000000..808dc3b --- /dev/null +++ b/html/toc-SmootLight.util.Config-module.html @@ -0,0 +1,46 @@ + + + + + Config + + + + + +

Module Config

+
+

Functions

+ attemptEval
compositeXMLTrees
fileToDict
findElementsByTag
generateArgDict
getElement
loadConfigFile
loadParamRequirementDict
pullArgsFromItem
resolveDocumentInheritances
resolveInheritance

Variables

+ CONFIG_PATH
DEFAULT_OVERRIDE_MODE
__package__
classArgsMem

+[hide private] + + + + diff --git a/html/toc-SmootLight.util.Geo-module.html b/html/toc-SmootLight.util.Geo-module.html new file mode 100644 index 0000000..c023b72 --- /dev/null +++ b/html/toc-SmootLight.util.Geo-module.html @@ -0,0 +1,41 @@ + + + + + Geo + + + + + +

Module Geo

+
+

Classes

+ Location

Functions

+ addLocations
approxexp
dist
gaussian
pointWithinBoundingBox
randomLoc
windtrail

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.util.NetworkOps-module.html b/html/toc-SmootLight.util.NetworkOps-module.html new file mode 100644 index 0000000..8cfda9f --- /dev/null +++ b/html/toc-SmootLight.util.NetworkOps-module.html @@ -0,0 +1,34 @@ + + + + + NetworkOps + + + + + +

Module NetworkOps

+
+

Functions

+ getBroadcastSocket
getConnectedSocket

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.util.PacketComposition-module.html b/html/toc-SmootLight.util.PacketComposition-module.html new file mode 100644 index 0000000..6e2202c --- /dev/null +++ b/html/toc-SmootLight.util.PacketComposition-module.html @@ -0,0 +1,47 @@ + + + + + PacketComposition + + + + + +

Module PacketComposition

+
+

Functions

+ cachePacketHeader
composePixelStripData
composePixelStripPacket
composeSynchPacket
memoize
packheader
portOut
portOutPacket
portOutPayload

Variables

+ MAGIC
PORTOUT
UNI
VERSION
__package__
argDict
cache

+[hide private] + + + + diff --git a/html/toc-SmootLight.util.Search-module.html b/html/toc-SmootLight.util.Search-module.html new file mode 100644 index 0000000..f913e04 --- /dev/null +++ b/html/toc-SmootLight.util.Search-module.html @@ -0,0 +1,35 @@ + + + + + Search + + + + + +

Module Search

+
+

Functions

+ find_ge
find_le
parental_tree_search

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.util.Strings-module.html b/html/toc-SmootLight.util.Strings-module.html new file mode 100644 index 0000000..acbb31d --- /dev/null +++ b/html/toc-SmootLight.util.Strings-module.html @@ -0,0 +1,34 @@ + + + + + Strings + + + + + +

Module Strings

+
+

Variables

+ DEFAULT_MAPPER
LOCATION
OVERRIDE_BEHAVIOR
__package__

+[hide private] + + + + diff --git a/html/toc-SmootLight.util.TimeOps-module.html b/html/toc-SmootLight.util.TimeOps-module.html new file mode 100644 index 0000000..dea9262 --- /dev/null +++ b/html/toc-SmootLight.util.TimeOps-module.html @@ -0,0 +1,35 @@ + + + + + TimeOps + + + + + +

Module TimeOps

+
+

Classes

+ Stopwatch

Functions

+ time

Variables

+ __package__

+[hide private] + + + + diff --git a/html/toc-everything.html b/html/toc-everything.html new file mode 100644 index 0000000..e891cbe --- /dev/null +++ b/html/toc-everything.html @@ -0,0 +1,877 @@ + + + + + Everything + + + + + +

Everything

+
+

All Classes

+ SmootLight.LightInstallation.LightInstallation
SmootLight.behaviors.AddPixelEvent.AddPixelEvent
SmootLight.behaviors.AllPixels.AllPixels
SmootLight.behaviors.AllPixelsLeft.AllPixelsLeft
SmootLight.behaviors.BehaviorChain.BehaviorChain
SmootLight.behaviors.Circle.Circle
SmootLight.behaviors.ColorChangerBehavior.ColorChangerBehavior
SmootLight.behaviors.ColorShift.ColorShift
SmootLight.behaviors.ControllerOSC.ControllerOSC
SmootLight.behaviors.DebugBehavior.DebugBehavior
SmootLight.behaviors.DecayBehavior.DecayBehavior
SmootLight.behaviors.EchoBehavior.EchoBehavior
SmootLight.behaviors.Expand.Expand
SmootLight.behaviors.ExpandingColorZones.ExpandingColorZones
SmootLight.behaviors.Flasher.Flasher
SmootLight.behaviors.MITDoors.MITDoors
SmootLight.behaviors.MobileShakeBehavior.MobileShakeBehavior
SmootLight.behaviors.ModifyParam.ModifyParam
SmootLight.behaviors.ModulateColor.ColorShift
SmootLight.behaviors.MoveBehavior.MoveBehavior
SmootLight.behaviors.MrmrSetColor.MrmrSetColor
SmootLight.behaviors.Oval.Oval
SmootLight.behaviors.RandomSetBrightColorBehavior.RandomSetBrightColorBehavior
SmootLight.behaviors.RandomWalk.RandomWalk
SmootLight.behaviors.RecursiveDecay.RecursiveDecay
SmootLight.behaviors.ResponseMover.ResponseMover
SmootLight.behaviors.RestrictLocation.RestrictLocation
SmootLight.behaviors.RiseFall.RiseFall
SmootLight.behaviors.RunningBehavior.RunningBehavior
SmootLight.behaviors.Sink.Sink
SmootLight.behaviors.SmootWind.SmootWind
SmootLight.behaviors.Square.Square
SmootLight.behaviors.SwitchBehavior.SwitchBehavior
SmootLight.behaviors.SynchTest.SynchTest
SmootLight.behaviors.TimeSwitch.TimeSwitch
SmootLight.behaviors.TimedDie.Timeout
SmootLight.behaviors.Timeout.Timeout
SmootLight.behaviors.TouchOSC.TouchOSC
SmootLight.behaviors.VerticalBar.VerticalBar
SmootLight.behaviors.XYMove.XYMove
SmootLight.inputs.ContinuousCenterInput.ContinuousCenterInput
SmootLight.inputs.ContinuousLocationInput.ContinuousLocationInput
SmootLight.inputs.HTMLInput.HTMLInput
SmootLight.inputs.OSCInput.OSCInput
SmootLight.inputs.PygameInput.PygameInput
SmootLight.inputs.RandomLocs.RandomLocs
SmootLight.inputs.TCPInput.TCPInput
SmootLight.inputs.TCPInput_backup.TCPInput
SmootLight.inputs.TCPInput_backup.TCPInput.InputTCPHandler
SmootLight.inputs.UDPInput.UDPInput
SmootLight.layouts.LineLayout.LineLayout
SmootLight.layouts.SpecifiedLayout.SpecifiedLayout
SmootLight.layouts.ZigzagLayout.ZigzagLayout
SmootLight.logger.UTF8LogFormatter.UTF8LogFormatter
SmootLight.operationscore.Behavior.Behavior
SmootLight.operationscore.Input.Input
SmootLight.operationscore.PixelAssembler.PixelAssembler
SmootLight.operationscore.PixelEvent.PixelEvent
SmootLight.operationscore.PixelMapper.PixelMapper
SmootLight.operationscore.Renderer.Renderer
SmootLight.operationscore.SmootCoreObject.SmootCoreObject
SmootLight.operationscore.ThreadedSmootCoreObject.ThreadedSmootCoreObject
SmootLight.pixelcore.Pixel.Pixel
SmootLight.pixelcore.PixelStrip.PixelStrip
SmootLight.pixelcore.Screen.Screen
SmootLight.pixelevents.DecayEvent.DecayEvent
SmootLight.pixelevents.SingleFrameEvent.SingleFrameEvent
SmootLight.pixelevents.StepEvent.StepEvent
SmootLight.pixelevents.SynchTestEvent.SynchTestEvent
SmootLight.pixelmappers.C5SignMapper.C5SignMapper
SmootLight.pixelmappers.GaussianMapper.GaussianMapper
SmootLight.pixelmappers.SimpleMapper.SimpleMapper
SmootLight.pixelmappers.WindGaussianMapper.WindGaussianMapper
SmootLight.renderers.IndoorRenderer.IndoorRenderer
SmootLight.renderers.PygameRenderer.PygameRenderer
SmootLight.tests.TestBQS'.TestBQS
SmootLight.tests.TestComponentRegistry'.TestComponentRegistry
SmootLight.tests.TestConfigLoaders'.TestConfigLoaders
SmootLight.tests.TestSwitchBehavior.TestSwitchBehavior
SmootLight.util.ColorOps.Color
SmootLight.util.Geo.Location
SmootLight.util.TimeOps.Stopwatch
exceptions.AssertionError

All Functions

+ SmootLight.LightInstallation.main
SmootLight.TestProfile.abc1
SmootLight.TestProfile.abc2
SmootLight.TestProfile.dictlookup
SmootLight.TestProfile.dist1
SmootLight.TestProfile.dist2
SmootLight.TestProfile.expapprox
SmootLight.TestProfile.exptest
SmootLight.TestProfile.main1
SmootLight.TestProfile.main2
SmootLight.TestProfile.normal_python
SmootLight.TestProfile.strucpack
SmootLight.TestProfile.weave_inloop
SmootLight.TestProfile.weave_outloop
SmootLight.behaviors.ControllerOSC.constrainLocation
SmootLight.tests.testosc.fallback
SmootLight.tests.testosc.foo_bar_callback
SmootLight.tests.testosc.foo_baz_callback
SmootLight.util.BehaviorQuerySystem.addBehavior
SmootLight.util.BehaviorQuerySystem.getBehaviorsNear
SmootLight.util.BehaviorQuerySystem.getDistLambda
SmootLight.util.BehaviorQuerySystem.initBQS
SmootLight.util.BehaviorQuerySystem.query
SmootLight.util.ColorOps.chooseRandomColor
SmootLight.util.ColorOps.combineColors
SmootLight.util.ColorOps.floatToIntColor
SmootLight.util.ColorOps.multiplyColor
SmootLight.util.ColorOps.randomBrightColor
SmootLight.util.ColorOps.randomColor
SmootLight.util.ColorOps.safeColor
SmootLight.util.ComponentRegistry.clearRegistry
SmootLight.util.ComponentRegistry.getComponent
SmootLight.util.ComponentRegistry.getLock
SmootLight.util.ComponentRegistry.getNewId
SmootLight.util.ComponentRegistry.initRegistry
SmootLight.util.ComponentRegistry.makelock
SmootLight.util.ComponentRegistry.registerComponent
SmootLight.util.ComponentRegistry.removeComponent
SmootLight.util.ComponentRegistry.verifyUniqueId
SmootLight.util.Config.attemptEval
SmootLight.util.Config.compositeXMLTrees
SmootLight.util.Config.fileToDict
SmootLight.util.Config.findElementsByTag
SmootLight.util.Config.generateArgDict
SmootLight.util.Config.getElement
SmootLight.util.Config.loadConfigFile
SmootLight.util.Config.loadParamRequirementDict
SmootLight.util.Config.pullArgsFromItem
SmootLight.util.Config.resolveDocumentInheritances
SmootLight.util.Config.resolveInheritance
SmootLight.util.Geo.addLocations
SmootLight.util.Geo.approxexp
SmootLight.util.Geo.dist
SmootLight.util.Geo.gaussian
SmootLight.util.Geo.pointWithinBoundingBox
SmootLight.util.Geo.randomLoc
SmootLight.util.Geo.windtrail
SmootLight.util.NetworkOps.getBroadcastSocket
SmootLight.util.NetworkOps.getConnectedSocket
SmootLight.util.PacketComposition.cachePacketHeader
SmootLight.util.PacketComposition.composePixelStripData
SmootLight.util.PacketComposition.composePixelStripPacket
SmootLight.util.PacketComposition.composeSynchPacket
SmootLight.util.PacketComposition.memoize
SmootLight.util.PacketComposition.packheader
SmootLight.util.PacketComposition.portOut
SmootLight.util.PacketComposition.portOutPacket
SmootLight.util.PacketComposition.portOutPayload
SmootLight.util.Search.find_ge
SmootLight.util.Search.find_le
SmootLight.util.Search.parental_tree_search
SmootLight.util.TimeOps.time

All Variables

+ SmootLight.LightInstallation.__package__
SmootLight.Profile.command
SmootLight.TestAll.__package__
SmootLight.TestAll.testSuite
SmootLight.TestProfile.a
SmootLight.TestProfile.command
SmootLight.TestProfile.numiter
SmootLight.TestProfile.x
SmootLight.__package__
SmootLight.behaviors.AddPixelEvent.__package__
SmootLight.behaviors.AllPixels.__package__
SmootLight.behaviors.AllPixels.main_log
SmootLight.behaviors.AllPixelsLeft.__package__
SmootLight.behaviors.AllPixelsLeft.main_log
SmootLight.behaviors.BehaviorChain.__package__
SmootLight.behaviors.Circle.__package__
SmootLight.behaviors.Circle.main_log
SmootLight.behaviors.ColorChangerBehavior.__package__
SmootLight.behaviors.ColorChangerBehavior.main_log
SmootLight.behaviors.ColorShift.__package__
SmootLight.behaviors.ColorShift.main_log
SmootLight.behaviors.ControllerOSC.__package__
SmootLight.behaviors.ControllerOSC.speedfactor
SmootLight.behaviors.ControllerOSC.vel_decay
SmootLight.behaviors.DebugBehavior.__package__
SmootLight.behaviors.DecayBehavior.__package__
SmootLight.behaviors.DecayBehavior.main_log
SmootLight.behaviors.EchoBehavior.__package__
SmootLight.behaviors.EchoBehavior.main_log
SmootLight.behaviors.Expand.__package__
SmootLight.behaviors.Expand.main_log
SmootLight.behaviors.ExpandingColorZones.__package__
SmootLight.behaviors.Flasher.__package__
SmootLight.behaviors.Flasher.main_log
SmootLight.behaviors.MITDoors.__package__
SmootLight.behaviors.MITDoors.main_log
SmootLight.behaviors.MobileShakeBehavior.__package__
SmootLight.behaviors.MobileShakeBehavior.main_log
SmootLight.behaviors.ModifyParam.__package__
SmootLight.behaviors.ModifyParam.main_log
SmootLight.behaviors.ModulateColor.__package__
SmootLight.behaviors.ModulateColor.main_log
SmootLight.behaviors.MoveBehavior.__package__
SmootLight.behaviors.MoveBehavior.main_log
SmootLight.behaviors.MrmrSetColor.__package__
SmootLight.behaviors.Oval.__package__
SmootLight.behaviors.Oval.main_log
SmootLight.behaviors.RandomSetBrightColorBehavior.__package__
SmootLight.behaviors.RandomSetBrightColorBehavior.main_log
SmootLight.behaviors.RandomWalk.__package__
SmootLight.behaviors.RandomWalk.main_log
SmootLight.behaviors.RecursiveDecay.__package__
SmootLight.behaviors.RecursiveDecay.main_log
SmootLight.behaviors.ResponseMover.__package__
SmootLight.behaviors.ResponseMover.main_log
SmootLight.behaviors.RestrictLocation.__package__
SmootLight.behaviors.RestrictLocation.main_log
SmootLight.behaviors.RiseFall.__package__
SmootLight.behaviors.RiseFall.main_log
SmootLight.behaviors.RunningBehavior.__package__
SmootLight.behaviors.RunningBehavior.main_log
SmootLight.behaviors.Sink.__package__
SmootLight.behaviors.Sink.main_log
SmootLight.behaviors.SmootWind.__package__
SmootLight.behaviors.SmootWind.main_log
SmootLight.behaviors.Square.__package__
SmootLight.behaviors.Square.main_log
SmootLight.behaviors.SwitchBehavior.__package__
SmootLight.behaviors.SwitchBehavior.main_log
SmootLight.behaviors.SynchTest.__package__
SmootLight.behaviors.SynchTest.main_log
SmootLight.behaviors.TimeSwitch.__package__
SmootLight.behaviors.TimedDie.__package__
SmootLight.behaviors.TimedDie.main_log
SmootLight.behaviors.Timeout.__package__
SmootLight.behaviors.Timeout.main_log
SmootLight.behaviors.TouchOSC.__package__
SmootLight.behaviors.VerticalBar.__package__
SmootLight.behaviors.VerticalBar.main_log
SmootLight.behaviors.XYMove.__package__
SmootLight.behaviors.XYMove.main_log
SmootLight.behaviors.__package__
SmootLight.inputs.ContinuousCenterInput.__package__
SmootLight.inputs.ContinuousCenterInput.exception_log
SmootLight.inputs.ContinuousCenterInput.main_log
SmootLight.inputs.ContinuousLocationInput.__package__
SmootLight.inputs.ContinuousLocationInput.exception_log
SmootLight.inputs.ContinuousLocationInput.main_log
SmootLight.inputs.HTMLInput.__package__
SmootLight.inputs.HTMLInput.exception_log
SmootLight.inputs.HTMLInput.main_log
SmootLight.inputs.OSCInput.__package__
SmootLight.inputs.OSCInput.exception_log
SmootLight.inputs.PygameInput.ACTIVEEVENT
SmootLight.inputs.PygameInput.ANYFORMAT
SmootLight.inputs.PygameInput.ASYNCBLIT
SmootLight.inputs.PygameInput.AUDIO_S16
SmootLight.inputs.PygameInput.AUDIO_S16LSB
SmootLight.inputs.PygameInput.AUDIO_S16MSB
SmootLight.inputs.PygameInput.AUDIO_S16SYS
SmootLight.inputs.PygameInput.AUDIO_S8
SmootLight.inputs.PygameInput.AUDIO_U16
SmootLight.inputs.PygameInput.AUDIO_U16LSB
SmootLight.inputs.PygameInput.AUDIO_U16MSB
SmootLight.inputs.PygameInput.AUDIO_U16SYS
SmootLight.inputs.PygameInput.AUDIO_U8
SmootLight.inputs.PygameInput.BIG_ENDIAN
SmootLight.inputs.PygameInput.BLEND_ADD
SmootLight.inputs.PygameInput.BLEND_MAX
SmootLight.inputs.PygameInput.BLEND_MIN
SmootLight.inputs.PygameInput.BLEND_MULT
SmootLight.inputs.PygameInput.BLEND_RGBA_ADD
SmootLight.inputs.PygameInput.BLEND_RGBA_MAX
SmootLight.inputs.PygameInput.BLEND_RGBA_MIN
SmootLight.inputs.PygameInput.BLEND_RGBA_MULT
SmootLight.inputs.PygameInput.BLEND_RGBA_SUB
SmootLight.inputs.PygameInput.BLEND_RGB_ADD
SmootLight.inputs.PygameInput.BLEND_RGB_MAX
SmootLight.inputs.PygameInput.BLEND_RGB_MIN
SmootLight.inputs.PygameInput.BLEND_RGB_MULT
SmootLight.inputs.PygameInput.BLEND_RGB_SUB
SmootLight.inputs.PygameInput.BLEND_SUB
SmootLight.inputs.PygameInput.BUTTON_X1
SmootLight.inputs.PygameInput.BUTTON_X2
SmootLight.inputs.PygameInput.DOUBLEBUF
SmootLight.inputs.PygameInput.FULLSCREEN
SmootLight.inputs.PygameInput.GL_ACCELERATED_VISUAL
SmootLight.inputs.PygameInput.GL_ACCUM_ALPHA_SIZE
SmootLight.inputs.PygameInput.GL_ACCUM_BLUE_SIZE
SmootLight.inputs.PygameInput.GL_ACCUM_GREEN_SIZE
SmootLight.inputs.PygameInput.GL_ACCUM_RED_SIZE
SmootLight.inputs.PygameInput.GL_ALPHA_SIZE
SmootLight.inputs.PygameInput.GL_BLUE_SIZE
SmootLight.inputs.PygameInput.GL_BUFFER_SIZE
SmootLight.inputs.PygameInput.GL_DEPTH_SIZE
SmootLight.inputs.PygameInput.GL_DOUBLEBUFFER
SmootLight.inputs.PygameInput.GL_GREEN_SIZE
SmootLight.inputs.PygameInput.GL_MULTISAMPLEBUFFERS
SmootLight.inputs.PygameInput.GL_MULTISAMPLESAMPLES
SmootLight.inputs.PygameInput.GL_RED_SIZE
SmootLight.inputs.PygameInput.GL_STENCIL_SIZE
SmootLight.inputs.PygameInput.GL_STEREO
SmootLight.inputs.PygameInput.GL_SWAP_CONTROL
SmootLight.inputs.PygameInput.HAT_CENTERED
SmootLight.inputs.PygameInput.HAT_DOWN
SmootLight.inputs.PygameInput.HAT_LEFT
SmootLight.inputs.PygameInput.HAT_LEFTDOWN
SmootLight.inputs.PygameInput.HAT_LEFTUP
SmootLight.inputs.PygameInput.HAT_RIGHT
SmootLight.inputs.PygameInput.HAT_RIGHTDOWN
SmootLight.inputs.PygameInput.HAT_RIGHTUP
SmootLight.inputs.PygameInput.HAT_UP
SmootLight.inputs.PygameInput.HWACCEL
SmootLight.inputs.PygameInput.HWPALETTE
SmootLight.inputs.PygameInput.HWSURFACE
SmootLight.inputs.PygameInput.IYUV_OVERLAY
SmootLight.inputs.PygameInput.JOYAXISMOTION
SmootLight.inputs.PygameInput.JOYBALLMOTION
SmootLight.inputs.PygameInput.JOYBUTTONDOWN
SmootLight.inputs.PygameInput.JOYBUTTONUP
SmootLight.inputs.PygameInput.JOYHATMOTION
SmootLight.inputs.PygameInput.KEYDOWN
SmootLight.inputs.PygameInput.KEYUP
SmootLight.inputs.PygameInput.KMOD_ALT
SmootLight.inputs.PygameInput.KMOD_CAPS
SmootLight.inputs.PygameInput.KMOD_CTRL
SmootLight.inputs.PygameInput.KMOD_LALT
SmootLight.inputs.PygameInput.KMOD_LCTRL
SmootLight.inputs.PygameInput.KMOD_LMETA
SmootLight.inputs.PygameInput.KMOD_LSHIFT
SmootLight.inputs.PygameInput.KMOD_META
SmootLight.inputs.PygameInput.KMOD_MODE
SmootLight.inputs.PygameInput.KMOD_NONE
SmootLight.inputs.PygameInput.KMOD_NUM
SmootLight.inputs.PygameInput.KMOD_RALT
SmootLight.inputs.PygameInput.KMOD_RCTRL
SmootLight.inputs.PygameInput.KMOD_RMETA
SmootLight.inputs.PygameInput.KMOD_RSHIFT
SmootLight.inputs.PygameInput.KMOD_SHIFT
SmootLight.inputs.PygameInput.K_0
SmootLight.inputs.PygameInput.K_1
SmootLight.inputs.PygameInput.K_2
SmootLight.inputs.PygameInput.K_3
SmootLight.inputs.PygameInput.K_4
SmootLight.inputs.PygameInput.K_5
SmootLight.inputs.PygameInput.K_6
SmootLight.inputs.PygameInput.K_7
SmootLight.inputs.PygameInput.K_8
SmootLight.inputs.PygameInput.K_9
SmootLight.inputs.PygameInput.K_AMPERSAND
SmootLight.inputs.PygameInput.K_ASTERISK
SmootLight.inputs.PygameInput.K_AT
SmootLight.inputs.PygameInput.K_BACKQUOTE
SmootLight.inputs.PygameInput.K_BACKSLASH
SmootLight.inputs.PygameInput.K_BACKSPACE
SmootLight.inputs.PygameInput.K_BREAK
SmootLight.inputs.PygameInput.K_CAPSLOCK
SmootLight.inputs.PygameInput.K_CARET
SmootLight.inputs.PygameInput.K_CLEAR
SmootLight.inputs.PygameInput.K_COLON
SmootLight.inputs.PygameInput.K_COMMA
SmootLight.inputs.PygameInput.K_DELETE
SmootLight.inputs.PygameInput.K_DOLLAR
SmootLight.inputs.PygameInput.K_DOWN
SmootLight.inputs.PygameInput.K_END
SmootLight.inputs.PygameInput.K_EQUALS
SmootLight.inputs.PygameInput.K_ESCAPE
SmootLight.inputs.PygameInput.K_EURO
SmootLight.inputs.PygameInput.K_EXCLAIM
SmootLight.inputs.PygameInput.K_F1
SmootLight.inputs.PygameInput.K_F10
SmootLight.inputs.PygameInput.K_F11
SmootLight.inputs.PygameInput.K_F12
SmootLight.inputs.PygameInput.K_F13
SmootLight.inputs.PygameInput.K_F14
SmootLight.inputs.PygameInput.K_F15
SmootLight.inputs.PygameInput.K_F2
SmootLight.inputs.PygameInput.K_F3
SmootLight.inputs.PygameInput.K_F4
SmootLight.inputs.PygameInput.K_F5
SmootLight.inputs.PygameInput.K_F6
SmootLight.inputs.PygameInput.K_F7
SmootLight.inputs.PygameInput.K_F8
SmootLight.inputs.PygameInput.K_F9
SmootLight.inputs.PygameInput.K_FIRST
SmootLight.inputs.PygameInput.K_GREATER
SmootLight.inputs.PygameInput.K_HASH
SmootLight.inputs.PygameInput.K_HELP
SmootLight.inputs.PygameInput.K_HOME
SmootLight.inputs.PygameInput.K_INSERT
SmootLight.inputs.PygameInput.K_KP0
SmootLight.inputs.PygameInput.K_KP1
SmootLight.inputs.PygameInput.K_KP2
SmootLight.inputs.PygameInput.K_KP3
SmootLight.inputs.PygameInput.K_KP4
SmootLight.inputs.PygameInput.K_KP5
SmootLight.inputs.PygameInput.K_KP6
SmootLight.inputs.PygameInput.K_KP7
SmootLight.inputs.PygameInput.K_KP8
SmootLight.inputs.PygameInput.K_KP9
SmootLight.inputs.PygameInput.K_KP_DIVIDE
SmootLight.inputs.PygameInput.K_KP_ENTER
SmootLight.inputs.PygameInput.K_KP_EQUALS
SmootLight.inputs.PygameInput.K_KP_MINUS
SmootLight.inputs.PygameInput.K_KP_MULTIPLY
SmootLight.inputs.PygameInput.K_KP_PERIOD
SmootLight.inputs.PygameInput.K_KP_PLUS
SmootLight.inputs.PygameInput.K_LALT
SmootLight.inputs.PygameInput.K_LAST
SmootLight.inputs.PygameInput.K_LCTRL
SmootLight.inputs.PygameInput.K_LEFT
SmootLight.inputs.PygameInput.K_LEFTBRACKET
SmootLight.inputs.PygameInput.K_LEFTPAREN
SmootLight.inputs.PygameInput.K_LESS
SmootLight.inputs.PygameInput.K_LMETA
SmootLight.inputs.PygameInput.K_LSHIFT
SmootLight.inputs.PygameInput.K_LSUPER
SmootLight.inputs.PygameInput.K_MENU
SmootLight.inputs.PygameInput.K_MINUS
SmootLight.inputs.PygameInput.K_MODE
SmootLight.inputs.PygameInput.K_NUMLOCK
SmootLight.inputs.PygameInput.K_PAGEDOWN
SmootLight.inputs.PygameInput.K_PAGEUP
SmootLight.inputs.PygameInput.K_PAUSE
SmootLight.inputs.PygameInput.K_PERIOD
SmootLight.inputs.PygameInput.K_PLUS
SmootLight.inputs.PygameInput.K_POWER
SmootLight.inputs.PygameInput.K_PRINT
SmootLight.inputs.PygameInput.K_QUESTION
SmootLight.inputs.PygameInput.K_QUOTE
SmootLight.inputs.PygameInput.K_QUOTEDBL
SmootLight.inputs.PygameInput.K_RALT
SmootLight.inputs.PygameInput.K_RCTRL
SmootLight.inputs.PygameInput.K_RETURN
SmootLight.inputs.PygameInput.K_RIGHT
SmootLight.inputs.PygameInput.K_RIGHTBRACKET
SmootLight.inputs.PygameInput.K_RIGHTPAREN
SmootLight.inputs.PygameInput.K_RMETA
SmootLight.inputs.PygameInput.K_RSHIFT
SmootLight.inputs.PygameInput.K_RSUPER
SmootLight.inputs.PygameInput.K_SCROLLOCK
SmootLight.inputs.PygameInput.K_SEMICOLON
SmootLight.inputs.PygameInput.K_SLASH
SmootLight.inputs.PygameInput.K_SPACE
SmootLight.inputs.PygameInput.K_SYSREQ
SmootLight.inputs.PygameInput.K_TAB
SmootLight.inputs.PygameInput.K_UNDERSCORE
SmootLight.inputs.PygameInput.K_UNKNOWN
SmootLight.inputs.PygameInput.K_UP
SmootLight.inputs.PygameInput.K_a
SmootLight.inputs.PygameInput.K_b
SmootLight.inputs.PygameInput.K_c
SmootLight.inputs.PygameInput.K_d
SmootLight.inputs.PygameInput.K_e
SmootLight.inputs.PygameInput.K_f
SmootLight.inputs.PygameInput.K_g
SmootLight.inputs.PygameInput.K_h
SmootLight.inputs.PygameInput.K_i
SmootLight.inputs.PygameInput.K_j
SmootLight.inputs.PygameInput.K_k
SmootLight.inputs.PygameInput.K_l
SmootLight.inputs.PygameInput.K_m
SmootLight.inputs.PygameInput.K_n
SmootLight.inputs.PygameInput.K_o
SmootLight.inputs.PygameInput.K_p
SmootLight.inputs.PygameInput.K_q
SmootLight.inputs.PygameInput.K_r
SmootLight.inputs.PygameInput.K_s
SmootLight.inputs.PygameInput.K_t
SmootLight.inputs.PygameInput.K_u
SmootLight.inputs.PygameInput.K_v
SmootLight.inputs.PygameInput.K_w
SmootLight.inputs.PygameInput.K_x
SmootLight.inputs.PygameInput.K_y
SmootLight.inputs.PygameInput.K_z
SmootLight.inputs.PygameInput.LIL_ENDIAN
SmootLight.inputs.PygameInput.MOUSEBUTTONDOWN
SmootLight.inputs.PygameInput.MOUSEBUTTONUP
SmootLight.inputs.PygameInput.MOUSEMOTION
SmootLight.inputs.PygameInput.NOEVENT
SmootLight.inputs.PygameInput.NOFRAME
SmootLight.inputs.PygameInput.NUMEVENTS
SmootLight.inputs.PygameInput.OPENGL
SmootLight.inputs.PygameInput.OPENGLBLIT
SmootLight.inputs.PygameInput.PREALLOC
SmootLight.inputs.PygameInput.QUIT
SmootLight.inputs.PygameInput.RESIZABLE
SmootLight.inputs.PygameInput.RLEACCEL
SmootLight.inputs.PygameInput.RLEACCELOK
SmootLight.inputs.PygameInput.SCRAP_BMP
SmootLight.inputs.PygameInput.SCRAP_CLIPBOARD
SmootLight.inputs.PygameInput.SCRAP_PBM
SmootLight.inputs.PygameInput.SCRAP_PPM
SmootLight.inputs.PygameInput.SCRAP_SELECTION
SmootLight.inputs.PygameInput.SCRAP_TEXT
SmootLight.inputs.PygameInput.SRCALPHA
SmootLight.inputs.PygameInput.SRCCOLORKEY
SmootLight.inputs.PygameInput.SWSURFACE
SmootLight.inputs.PygameInput.SYSWMEVENT
SmootLight.inputs.PygameInput.TIMER_RESOLUTION
SmootLight.inputs.PygameInput.USEREVENT
SmootLight.inputs.PygameInput.UYVY_OVERLAY
SmootLight.inputs.PygameInput.VIDEOEXPOSE
SmootLight.inputs.PygameInput.VIDEORESIZE
SmootLight.inputs.PygameInput.YUY2_OVERLAY
SmootLight.inputs.PygameInput.YV12_OVERLAY
SmootLight.inputs.PygameInput.YVYU_OVERLAY
SmootLight.inputs.PygameInput.__package__
SmootLight.inputs.PygameInput.exception_log
SmootLight.inputs.PygameInput.main_log
SmootLight.inputs.RandomLocs.__package__
SmootLight.inputs.RandomLocs.exception_log
SmootLight.inputs.RandomLocs.main_log
SmootLight.inputs.TCPInput.__package__
SmootLight.inputs.TCPInput.exception_log
SmootLight.inputs.UDPInput.__package__
SmootLight.inputs.UDPInput.exception_log
SmootLight.inputs.UDPInput.main_log
SmootLight.inputs.__package__
SmootLight.layouts.LineLayout.__package__
SmootLight.layouts.SpecifiedLayout.__package__
SmootLight.layouts.ZigzagLayout.__package__
SmootLight.layouts.__package__
SmootLight.logger.Logger.__package__
SmootLight.logger.Logger.exception_log
SmootLight.logger.Logger.main_log
SmootLight.logger.Logger.screen_log
SmootLight.logger.UTF8LogFormatter.__package__
SmootLight.logger.__package__
SmootLight.operationscore.Behavior.__package__
SmootLight.operationscore.Input.__package__
SmootLight.operationscore.PixelAssembler.__package__
SmootLight.operationscore.PixelEvent.__package__
SmootLight.operationscore.PixelMapper.__package__
SmootLight.operationscore.Renderer.__package__
SmootLight.operationscore.SmootCoreObject.__package__
SmootLight.operationscore.ThreadedSmootCoreObject.__package__
SmootLight.operationscore.__package__
SmootLight.pixelcore.Pixel.__package__
SmootLight.pixelcore.PixelStrip.__package__
SmootLight.pixelcore.PixelStrip.main_log
SmootLight.pixelcore.Screen.__package__
SmootLight.pixelcore.__package__
SmootLight.pixelevents.DecayEvent.__package__
SmootLight.pixelevents.SingleFrameEvent.__package__
SmootLight.pixelevents.StepEvent.__package__
SmootLight.pixelevents.SynchTestEvent.__package__
SmootLight.pixelevents.__package__
SmootLight.pixelmappers.C5SignMapper.__package__
SmootLight.pixelmappers.C5SignMapper.main_log
SmootLight.pixelmappers.GaussianMapper.__package__
SmootLight.pixelmappers.GaussianMapper.main_log
SmootLight.pixelmappers.SimpleMapper.__package__
SmootLight.pixelmappers.SimpleMapper.main_log
SmootLight.pixelmappers.WindGaussianMapper.__package__
SmootLight.pixelmappers.WindGaussianMapper.main_log
SmootLight.pixelmappers.__package__
SmootLight.renderers.IndoorRenderer.__package__
SmootLight.renderers.IndoorRenderer.sock_port
SmootLight.renderers.PygameRenderer.ACTIVEEVENT
SmootLight.renderers.PygameRenderer.ANYFORMAT
SmootLight.renderers.PygameRenderer.ASYNCBLIT
SmootLight.renderers.PygameRenderer.AUDIO_S16
SmootLight.renderers.PygameRenderer.AUDIO_S16LSB
SmootLight.renderers.PygameRenderer.AUDIO_S16MSB
SmootLight.renderers.PygameRenderer.AUDIO_S16SYS
SmootLight.renderers.PygameRenderer.AUDIO_S8
SmootLight.renderers.PygameRenderer.AUDIO_U16
SmootLight.renderers.PygameRenderer.AUDIO_U16LSB
SmootLight.renderers.PygameRenderer.AUDIO_U16MSB
SmootLight.renderers.PygameRenderer.AUDIO_U16SYS
SmootLight.renderers.PygameRenderer.AUDIO_U8
SmootLight.renderers.PygameRenderer.BIG_ENDIAN
SmootLight.renderers.PygameRenderer.BLEND_ADD
SmootLight.renderers.PygameRenderer.BLEND_MAX
SmootLight.renderers.PygameRenderer.BLEND_MIN
SmootLight.renderers.PygameRenderer.BLEND_MULT
SmootLight.renderers.PygameRenderer.BLEND_RGBA_ADD
SmootLight.renderers.PygameRenderer.BLEND_RGBA_MAX
SmootLight.renderers.PygameRenderer.BLEND_RGBA_MIN
SmootLight.renderers.PygameRenderer.BLEND_RGBA_MULT
SmootLight.renderers.PygameRenderer.BLEND_RGBA_SUB
SmootLight.renderers.PygameRenderer.BLEND_RGB_ADD
SmootLight.renderers.PygameRenderer.BLEND_RGB_MAX
SmootLight.renderers.PygameRenderer.BLEND_RGB_MIN
SmootLight.renderers.PygameRenderer.BLEND_RGB_MULT
SmootLight.renderers.PygameRenderer.BLEND_RGB_SUB
SmootLight.renderers.PygameRenderer.BLEND_SUB
SmootLight.renderers.PygameRenderer.BUTTON_X1
SmootLight.renderers.PygameRenderer.BUTTON_X2
SmootLight.renderers.PygameRenderer.DOUBLEBUF
SmootLight.renderers.PygameRenderer.FULLSCREEN
SmootLight.renderers.PygameRenderer.GL_ACCELERATED_VISUAL
SmootLight.renderers.PygameRenderer.GL_ACCUM_ALPHA_SIZE
SmootLight.renderers.PygameRenderer.GL_ACCUM_BLUE_SIZE
SmootLight.renderers.PygameRenderer.GL_ACCUM_GREEN_SIZE
SmootLight.renderers.PygameRenderer.GL_ACCUM_RED_SIZE
SmootLight.renderers.PygameRenderer.GL_ALPHA_SIZE
SmootLight.renderers.PygameRenderer.GL_BLUE_SIZE
SmootLight.renderers.PygameRenderer.GL_BUFFER_SIZE
SmootLight.renderers.PygameRenderer.GL_DEPTH_SIZE
SmootLight.renderers.PygameRenderer.GL_DOUBLEBUFFER
SmootLight.renderers.PygameRenderer.GL_GREEN_SIZE
SmootLight.renderers.PygameRenderer.GL_MULTISAMPLEBUFFERS
SmootLight.renderers.PygameRenderer.GL_MULTISAMPLESAMPLES
SmootLight.renderers.PygameRenderer.GL_RED_SIZE
SmootLight.renderers.PygameRenderer.GL_STENCIL_SIZE
SmootLight.renderers.PygameRenderer.GL_STEREO
SmootLight.renderers.PygameRenderer.GL_SWAP_CONTROL
SmootLight.renderers.PygameRenderer.HAT_CENTERED
SmootLight.renderers.PygameRenderer.HAT_DOWN
SmootLight.renderers.PygameRenderer.HAT_LEFT
SmootLight.renderers.PygameRenderer.HAT_LEFTDOWN
SmootLight.renderers.PygameRenderer.HAT_LEFTUP
SmootLight.renderers.PygameRenderer.HAT_RIGHT
SmootLight.renderers.PygameRenderer.HAT_RIGHTDOWN
SmootLight.renderers.PygameRenderer.HAT_RIGHTUP
SmootLight.renderers.PygameRenderer.HAT_UP
SmootLight.renderers.PygameRenderer.HWACCEL
SmootLight.renderers.PygameRenderer.HWPALETTE
SmootLight.renderers.PygameRenderer.HWSURFACE
SmootLight.renderers.PygameRenderer.IYUV_OVERLAY
SmootLight.renderers.PygameRenderer.JOYAXISMOTION
SmootLight.renderers.PygameRenderer.JOYBALLMOTION
SmootLight.renderers.PygameRenderer.JOYBUTTONDOWN
SmootLight.renderers.PygameRenderer.JOYBUTTONUP
SmootLight.renderers.PygameRenderer.JOYHATMOTION
SmootLight.renderers.PygameRenderer.KEYDOWN
SmootLight.renderers.PygameRenderer.KEYUP
SmootLight.renderers.PygameRenderer.KMOD_ALT
SmootLight.renderers.PygameRenderer.KMOD_CAPS
SmootLight.renderers.PygameRenderer.KMOD_CTRL
SmootLight.renderers.PygameRenderer.KMOD_LALT
SmootLight.renderers.PygameRenderer.KMOD_LCTRL
SmootLight.renderers.PygameRenderer.KMOD_LMETA
SmootLight.renderers.PygameRenderer.KMOD_LSHIFT
SmootLight.renderers.PygameRenderer.KMOD_META
SmootLight.renderers.PygameRenderer.KMOD_MODE
SmootLight.renderers.PygameRenderer.KMOD_NONE
SmootLight.renderers.PygameRenderer.KMOD_NUM
SmootLight.renderers.PygameRenderer.KMOD_RALT
SmootLight.renderers.PygameRenderer.KMOD_RCTRL
SmootLight.renderers.PygameRenderer.KMOD_RMETA
SmootLight.renderers.PygameRenderer.KMOD_RSHIFT
SmootLight.renderers.PygameRenderer.KMOD_SHIFT
SmootLight.renderers.PygameRenderer.K_0
SmootLight.renderers.PygameRenderer.K_1
SmootLight.renderers.PygameRenderer.K_2
SmootLight.renderers.PygameRenderer.K_3
SmootLight.renderers.PygameRenderer.K_4
SmootLight.renderers.PygameRenderer.K_5
SmootLight.renderers.PygameRenderer.K_6
SmootLight.renderers.PygameRenderer.K_7
SmootLight.renderers.PygameRenderer.K_8
SmootLight.renderers.PygameRenderer.K_9
SmootLight.renderers.PygameRenderer.K_AMPERSAND
SmootLight.renderers.PygameRenderer.K_ASTERISK
SmootLight.renderers.PygameRenderer.K_AT
SmootLight.renderers.PygameRenderer.K_BACKQUOTE
SmootLight.renderers.PygameRenderer.K_BACKSLASH
SmootLight.renderers.PygameRenderer.K_BACKSPACE
SmootLight.renderers.PygameRenderer.K_BREAK
SmootLight.renderers.PygameRenderer.K_CAPSLOCK
SmootLight.renderers.PygameRenderer.K_CARET
SmootLight.renderers.PygameRenderer.K_CLEAR
SmootLight.renderers.PygameRenderer.K_COLON
SmootLight.renderers.PygameRenderer.K_COMMA
SmootLight.renderers.PygameRenderer.K_DELETE
SmootLight.renderers.PygameRenderer.K_DOLLAR
SmootLight.renderers.PygameRenderer.K_DOWN
SmootLight.renderers.PygameRenderer.K_END
SmootLight.renderers.PygameRenderer.K_EQUALS
SmootLight.renderers.PygameRenderer.K_ESCAPE
SmootLight.renderers.PygameRenderer.K_EURO
SmootLight.renderers.PygameRenderer.K_EXCLAIM
SmootLight.renderers.PygameRenderer.K_F1
SmootLight.renderers.PygameRenderer.K_F10
SmootLight.renderers.PygameRenderer.K_F11
SmootLight.renderers.PygameRenderer.K_F12
SmootLight.renderers.PygameRenderer.K_F13
SmootLight.renderers.PygameRenderer.K_F14
SmootLight.renderers.PygameRenderer.K_F15
SmootLight.renderers.PygameRenderer.K_F2
SmootLight.renderers.PygameRenderer.K_F3
SmootLight.renderers.PygameRenderer.K_F4
SmootLight.renderers.PygameRenderer.K_F5
SmootLight.renderers.PygameRenderer.K_F6
SmootLight.renderers.PygameRenderer.K_F7
SmootLight.renderers.PygameRenderer.K_F8
SmootLight.renderers.PygameRenderer.K_F9
SmootLight.renderers.PygameRenderer.K_FIRST
SmootLight.renderers.PygameRenderer.K_GREATER
SmootLight.renderers.PygameRenderer.K_HASH
SmootLight.renderers.PygameRenderer.K_HELP
SmootLight.renderers.PygameRenderer.K_HOME
SmootLight.renderers.PygameRenderer.K_INSERT
SmootLight.renderers.PygameRenderer.K_KP0
SmootLight.renderers.PygameRenderer.K_KP1
SmootLight.renderers.PygameRenderer.K_KP2
SmootLight.renderers.PygameRenderer.K_KP3
SmootLight.renderers.PygameRenderer.K_KP4
SmootLight.renderers.PygameRenderer.K_KP5
SmootLight.renderers.PygameRenderer.K_KP6
SmootLight.renderers.PygameRenderer.K_KP7
SmootLight.renderers.PygameRenderer.K_KP8
SmootLight.renderers.PygameRenderer.K_KP9
SmootLight.renderers.PygameRenderer.K_KP_DIVIDE
SmootLight.renderers.PygameRenderer.K_KP_ENTER
SmootLight.renderers.PygameRenderer.K_KP_EQUALS
SmootLight.renderers.PygameRenderer.K_KP_MINUS
SmootLight.renderers.PygameRenderer.K_KP_MULTIPLY
SmootLight.renderers.PygameRenderer.K_KP_PERIOD
SmootLight.renderers.PygameRenderer.K_KP_PLUS
SmootLight.renderers.PygameRenderer.K_LALT
SmootLight.renderers.PygameRenderer.K_LAST
SmootLight.renderers.PygameRenderer.K_LCTRL
SmootLight.renderers.PygameRenderer.K_LEFT
SmootLight.renderers.PygameRenderer.K_LEFTBRACKET
SmootLight.renderers.PygameRenderer.K_LEFTPAREN
SmootLight.renderers.PygameRenderer.K_LESS
SmootLight.renderers.PygameRenderer.K_LMETA
SmootLight.renderers.PygameRenderer.K_LSHIFT
SmootLight.renderers.PygameRenderer.K_LSUPER
SmootLight.renderers.PygameRenderer.K_MENU
SmootLight.renderers.PygameRenderer.K_MINUS
SmootLight.renderers.PygameRenderer.K_MODE
SmootLight.renderers.PygameRenderer.K_NUMLOCK
SmootLight.renderers.PygameRenderer.K_PAGEDOWN
SmootLight.renderers.PygameRenderer.K_PAGEUP
SmootLight.renderers.PygameRenderer.K_PAUSE
SmootLight.renderers.PygameRenderer.K_PERIOD
SmootLight.renderers.PygameRenderer.K_PLUS
SmootLight.renderers.PygameRenderer.K_POWER
SmootLight.renderers.PygameRenderer.K_PRINT
SmootLight.renderers.PygameRenderer.K_QUESTION
SmootLight.renderers.PygameRenderer.K_QUOTE
SmootLight.renderers.PygameRenderer.K_QUOTEDBL
SmootLight.renderers.PygameRenderer.K_RALT
SmootLight.renderers.PygameRenderer.K_RCTRL
SmootLight.renderers.PygameRenderer.K_RETURN
SmootLight.renderers.PygameRenderer.K_RIGHT
SmootLight.renderers.PygameRenderer.K_RIGHTBRACKET
SmootLight.renderers.PygameRenderer.K_RIGHTPAREN
SmootLight.renderers.PygameRenderer.K_RMETA
SmootLight.renderers.PygameRenderer.K_RSHIFT
SmootLight.renderers.PygameRenderer.K_RSUPER
SmootLight.renderers.PygameRenderer.K_SCROLLOCK
SmootLight.renderers.PygameRenderer.K_SEMICOLON
SmootLight.renderers.PygameRenderer.K_SLASH
SmootLight.renderers.PygameRenderer.K_SPACE
SmootLight.renderers.PygameRenderer.K_SYSREQ
SmootLight.renderers.PygameRenderer.K_TAB
SmootLight.renderers.PygameRenderer.K_UNDERSCORE
SmootLight.renderers.PygameRenderer.K_UNKNOWN
SmootLight.renderers.PygameRenderer.K_UP
SmootLight.renderers.PygameRenderer.K_a
SmootLight.renderers.PygameRenderer.K_b
SmootLight.renderers.PygameRenderer.K_c
SmootLight.renderers.PygameRenderer.K_d
SmootLight.renderers.PygameRenderer.K_e
SmootLight.renderers.PygameRenderer.K_f
SmootLight.renderers.PygameRenderer.K_g
SmootLight.renderers.PygameRenderer.K_h
SmootLight.renderers.PygameRenderer.K_i
SmootLight.renderers.PygameRenderer.K_j
SmootLight.renderers.PygameRenderer.K_k
SmootLight.renderers.PygameRenderer.K_l
SmootLight.renderers.PygameRenderer.K_m
SmootLight.renderers.PygameRenderer.K_n
SmootLight.renderers.PygameRenderer.K_o
SmootLight.renderers.PygameRenderer.K_p
SmootLight.renderers.PygameRenderer.K_q
SmootLight.renderers.PygameRenderer.K_r
SmootLight.renderers.PygameRenderer.K_s
SmootLight.renderers.PygameRenderer.K_t
SmootLight.renderers.PygameRenderer.K_u
SmootLight.renderers.PygameRenderer.K_v
SmootLight.renderers.PygameRenderer.K_w
SmootLight.renderers.PygameRenderer.K_x
SmootLight.renderers.PygameRenderer.K_y
SmootLight.renderers.PygameRenderer.K_z
SmootLight.renderers.PygameRenderer.LIL_ENDIAN
SmootLight.renderers.PygameRenderer.MOUSEBUTTONDOWN
SmootLight.renderers.PygameRenderer.MOUSEBUTTONUP
SmootLight.renderers.PygameRenderer.MOUSEMOTION
SmootLight.renderers.PygameRenderer.NOEVENT
SmootLight.renderers.PygameRenderer.NOFRAME
SmootLight.renderers.PygameRenderer.NUMEVENTS
SmootLight.renderers.PygameRenderer.OPENGL
SmootLight.renderers.PygameRenderer.OPENGLBLIT
SmootLight.renderers.PygameRenderer.PREALLOC
SmootLight.renderers.PygameRenderer.QUIT
SmootLight.renderers.PygameRenderer.RESIZABLE
SmootLight.renderers.PygameRenderer.RLEACCEL
SmootLight.renderers.PygameRenderer.RLEACCELOK
SmootLight.renderers.PygameRenderer.SCRAP_BMP
SmootLight.renderers.PygameRenderer.SCRAP_CLIPBOARD
SmootLight.renderers.PygameRenderer.SCRAP_PBM
SmootLight.renderers.PygameRenderer.SCRAP_PPM
SmootLight.renderers.PygameRenderer.SCRAP_SELECTION
SmootLight.renderers.PygameRenderer.SCRAP_TEXT
SmootLight.renderers.PygameRenderer.SRCALPHA
SmootLight.renderers.PygameRenderer.SRCCOLORKEY
SmootLight.renderers.PygameRenderer.SWSURFACE
SmootLight.renderers.PygameRenderer.SYSWMEVENT
SmootLight.renderers.PygameRenderer.TIMER_RESOLUTION
SmootLight.renderers.PygameRenderer.USEREVENT
SmootLight.renderers.PygameRenderer.UYVY_OVERLAY
SmootLight.renderers.PygameRenderer.VIDEOEXPOSE
SmootLight.renderers.PygameRenderer.VIDEORESIZE
SmootLight.renderers.PygameRenderer.YUY2_OVERLAY
SmootLight.renderers.PygameRenderer.YV12_OVERLAY
SmootLight.renderers.PygameRenderer.YVYU_OVERLAY
SmootLight.renderers.PygameRenderer.__package__
SmootLight.renderers.__package__
SmootLight.tests.TestBQS'.__package__
SmootLight.tests.TestBQS'.main_log
SmootLight.tests.TestComponentRegistry'.__package__
SmootLight.tests.TestConfigLoaders'.VERSION
SmootLight.tests.TestConfigLoaders'.__package__
SmootLight.tests.TestSwitchBehavior.__package__
SmootLight.tests.__package__
SmootLight.tests.testosc.server
SmootLight.util.BehaviorQuerySystem.__package__
SmootLight.util.BehaviorQuerySystem.behaviorList
SmootLight.util.BehaviorQuerySystem.initialized
SmootLight.util.ColorOps.__package__
SmootLight.util.ComponentRegistry.Registry
SmootLight.util.ComponentRegistry.__package__
SmootLight.util.ComponentRegistry.utilLock
SmootLight.util.Config.CONFIG_PATH
SmootLight.util.Config.DEFAULT_OVERRIDE_MODE
SmootLight.util.Config.__package__
SmootLight.util.Config.classArgsMem
SmootLight.util.Geo.__package__
SmootLight.util.NetworkOps.__package__
SmootLight.util.PacketComposition.MAGIC
SmootLight.util.PacketComposition.PORTOUT
SmootLight.util.PacketComposition.UNI
SmootLight.util.PacketComposition.VERSION
SmootLight.util.PacketComposition.__package__
SmootLight.util.PacketComposition.argDict
SmootLight.util.PacketComposition.cache
SmootLight.util.Search.__package__
SmootLight.util.Strings.DEFAULT_MAPPER
SmootLight.util.Strings.LOCATION
SmootLight.util.Strings.OVERRIDE_BEHAVIOR
SmootLight.util.Strings.__package__
SmootLight.util.TimeOps.__package__
SmootLight.util.__package__

+[hide private] + + + + diff --git a/html/toc.html b/html/toc.html new file mode 100644 index 0000000..16eb83d --- /dev/null +++ b/html/toc.html @@ -0,0 +1,137 @@ + + + + + Table of Contents + + + + + +

Table of Contents

+
+ Everything +
+

Modules

+ SmootLight
SmootLight.LightInstallation
SmootLight.Profile
SmootLight.TestAll
SmootLight.TestProfile
SmootLight.behaviors
SmootLight.behaviors.AddPixelEvent
SmootLight.behaviors.AllPixels
SmootLight.behaviors.AllPixelsLeft
SmootLight.behaviors.BehaviorChain
SmootLight.behaviors.Circle
SmootLight.behaviors.ColorChangerBehavior
SmootLight.behaviors.ColorShift
SmootLight.behaviors.ControllerOSC
SmootLight.behaviors.DebugBehavior
SmootLight.behaviors.DecayBehavior
SmootLight.behaviors.EchoBehavior
SmootLight.behaviors.Expand
SmootLight.behaviors.ExpandingColorZones
SmootLight.behaviors.Flasher
SmootLight.behaviors.MITDoors
SmootLight.behaviors.MobileShakeBehavior
SmootLight.behaviors.ModifyParam
SmootLight.behaviors.ModulateColor
SmootLight.behaviors.MoveBehavior
SmootLight.behaviors.MrmrSetColor
SmootLight.behaviors.Oval
SmootLight.behaviors.RandomSetBrightColorBehavior
SmootLight.behaviors.RandomWalk
SmootLight.behaviors.RecursiveDecay
SmootLight.behaviors.ResponseMover
SmootLight.behaviors.RestrictLocation
SmootLight.behaviors.RiseFall
SmootLight.behaviors.RunningBehavior
SmootLight.behaviors.Sink
SmootLight.behaviors.SmootWind
SmootLight.behaviors.Square
SmootLight.behaviors.SwitchBehavior
SmootLight.behaviors.SynchTest
SmootLight.behaviors.TimeSwitch
SmootLight.behaviors.TimedDie
SmootLight.behaviors.Timeout
SmootLight.behaviors.TouchOSC
SmootLight.behaviors.VerticalBar
SmootLight.behaviors.XYMove
SmootLight.inputs
SmootLight.inputs.ContinuousCenterInput
SmootLight.inputs.ContinuousLocationInput
SmootLight.inputs.HTMLInput
SmootLight.inputs.OSCInput
SmootLight.inputs.PygameInput
SmootLight.inputs.RandomLocs
SmootLight.inputs.TCPInput
SmootLight.inputs.TCPInput_backup
SmootLight.inputs.UDPInput
SmootLight.layouts
SmootLight.layouts.LineLayout
SmootLight.layouts.SpecifiedLayout
SmootLight.layouts.ZigzagLayout
SmootLight.logger
SmootLight.logger.Logger
SmootLight.logger.UTF8LogFormatter
SmootLight.operationscore
SmootLight.operationscore.Behavior
SmootLight.operationscore.Input
SmootLight.operationscore.PixelAssembler
SmootLight.operationscore.PixelEvent
SmootLight.operationscore.PixelMapper
SmootLight.operationscore.Renderer
SmootLight.operationscore.SmootCoreObject
SmootLight.operationscore.ThreadedSmootCoreObject
SmootLight.pixelcore
SmootLight.pixelcore.Pixel
SmootLight.pixelcore.PixelStrip
SmootLight.pixelcore.Screen
SmootLight.pixelevents
SmootLight.pixelevents.DecayEvent
SmootLight.pixelevents.SingleFrameEvent
SmootLight.pixelevents.StepEvent
SmootLight.pixelevents.SynchTestEvent
SmootLight.pixelmappers
SmootLight.pixelmappers.C5SignMapper
SmootLight.pixelmappers.GaussianMapper
SmootLight.pixelmappers.SimpleMapper
SmootLight.pixelmappers.WindGaussianMapper
SmootLight.renderers
SmootLight.renderers.IndoorRenderer
SmootLight.renderers.PygameRenderer
SmootLight.tests
SmootLight.tests.TestBQS'
SmootLight.tests.TestComponentRegistry'
SmootLight.tests.TestConfigLoaders'
SmootLight.tests.TestSwitchBehavior
SmootLight.tests.testosc
SmootLight.util
SmootLight.util.BehaviorQuerySystem
SmootLight.util.ColorOps
SmootLight.util.ComponentRegistry
SmootLight.util.Config
SmootLight.util.Geo
SmootLight.util.NetworkOps
SmootLight.util.PacketComposition
SmootLight.util.Search
SmootLight.util.Strings
SmootLight.util.TimeOps

+ [hide private] + + + + -- cgit v1.2.3 From 58ec94a477f5edef0bf75a60252af96adec34d8d Mon Sep 17 00:00:00 2001 From: rcoh Date: Sat, 19 Feb 2011 00:38:03 -0500 Subject: Added XML introspection script (XmlInfo.py). Should make reading XML files a lot easier for us humans! --- XmlInfo.py | 47 ++++++++++++++++++++++++++++++++++++++++++ tests/testdata/XmlInfoTest.xml | 30 +++++++++++++++++++++++++++ 2 files changed, 77 insertions(+) create mode 100644 XmlInfo.py create mode 100644 tests/testdata/XmlInfoTest.xml diff --git a/XmlInfo.py b/XmlInfo.py new file mode 100644 index 0000000..59ece57 --- /dev/null +++ b/XmlInfo.py @@ -0,0 +1,47 @@ +#!/usr/bin/python +import util.Config as config +import util.Search as search +import sys +"""XmlInfo.py is a module for quick introspection of XML Documents. It will print all the Ids of +the components defined in an XML document and (if possible) their Doc strings. Usage: + python XmlInfo.py [fileName] [-b] [-i] + Example: + python XmlInfo.py config/C5Sign.xml + +With no flags all components are printed. With -b, behaviors are printed. With -i, inputs are +printed. (And both if both are specified) +""" +def loadFile(args): + fileName = args[1] + parentTags = [] + if '-b' in args: + parentTags.append('BehaviorConfiguration') + if '-i' in args: + parentTags.append('InputConfiguration') + if not parentTags: + parentTags = ['InputConfiguration', 'BehaviorConfiguration','PixelConfiguration', + 'RendererConfiguration'] + confRoot = config.loadConfigFile(fileName).getroot() + for tag in parentTags: + subTree = confRoot.find(tag) + print tag + ':' + nodesWithArgs = search.parental_tree_search(subTree,'.getchildren()', ".tag=='Args'") + nodesWithDocs = search.parental_tree_search(subTree,'.getchildren()', ".tag=='Doc'") + for obj in nodesWithArgs: + args = obj.find('Args') + cidEl = args.find('Id') + docEl = args.find('Doc') or obj.find('Doc') + classEl = obj.find('Class') + cid = None + doc = None + className = None + if cidEl != None: + cid = cidEl.text + if docEl != None: + doc = docEl.text + if classEl != None: + className = classEl.text + print '\tComponent %(id)s - Doc: %(doc)s - Class: %(class)s' % {'id':cid, 'doc':doc, + 'class':className} +if __name__ == "__main__": + loadFile(sys.argv) diff --git a/tests/testdata/XmlInfoTest.xml b/tests/testdata/XmlInfoTest.xml new file mode 100644 index 0000000..c79896a --- /dev/null +++ b/tests/testdata/XmlInfoTest.xml @@ -0,0 +1,30 @@ + + + + simplemap + + + + layouts/C5SignLayout.xml + + + + pixelmappers.C5SignMapper + + simplemap + 20 + SimpleMapper is a mapper which returns the closest pixel. + + + + pixelmappers.GaussianMapper + + gaussmap + 30 + 0.1 + 7 + 1 + + + + -- cgit v1.2.3